diff options
author | Fathi Boudra <fathi.boudra@linaro.org> | 2013-03-30 17:38:14 +0200 |
---|---|---|
committer | Fathi Boudra <fathi.boudra@linaro.org> | 2013-03-30 17:38:14 +0200 |
commit | 341f04dca0008c290cf065c4b36348fd80fe9700 (patch) | |
tree | ab372775bee83fd6c6500c75fd066315f725981d /waflib |
Imported Upstream version 2012.12HEADupstream/2012.12upstreammaster
Diffstat (limited to 'waflib')
75 files changed, 11649 insertions, 0 deletions
diff --git a/waflib/Build.py b/waflib/Build.py new file mode 100644 index 0000000..58d781b --- /dev/null +++ b/waflib/Build.py @@ -0,0 +1,731 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os,sys,errno,re,shutil +try:import cPickle +except:import pickle as cPickle +from waflib import Runner,TaskGen,Utils,ConfigSet,Task,Logs,Options,Context,Errors +import waflib.Node +CACHE_DIR='c4che' +CACHE_SUFFIX='_cache.py' +INSTALL=1337 +UNINSTALL=-1337 +SAVED_ATTRS='root node_deps raw_deps task_sigs'.split() +CFG_FILES='cfg_files' +POST_AT_ONCE=0 +POST_LAZY=1 +POST_BOTH=2 +class BuildContext(Context.Context): + '''executes the build''' + cmd='build' + variant='' + def __init__(self,**kw): + super(BuildContext,self).__init__(**kw) + self.is_install=0 + self.top_dir=kw.get('top_dir',Context.top_dir) + self.run_dir=kw.get('run_dir',Context.run_dir) + self.post_mode=POST_AT_ONCE + self.out_dir=kw.get('out_dir',Context.out_dir) + self.cache_dir=kw.get('cache_dir',None) + if not self.cache_dir: + self.cache_dir=self.out_dir+os.sep+CACHE_DIR + self.all_envs={} + self.task_sigs={} + self.node_deps={} + self.raw_deps={} + self.cache_dir_contents={} + self.task_gen_cache_names={} + self.launch_dir=Context.launch_dir + self.jobs=Options.options.jobs + self.targets=Options.options.targets + self.keep=Options.options.keep + self.cache_global=Options.cache_global + self.nocache=Options.options.nocache + self.progress_bar=Options.options.progress_bar + self.deps_man=Utils.defaultdict(list) + self.current_group=0 + self.groups=[] + self.group_names={} + def get_variant_dir(self): + if not self.variant: + return self.out_dir + return os.path.join(self.out_dir,self.variant) + variant_dir=property(get_variant_dir,None) + def __call__(self,*k,**kw): + kw['bld']=self + ret=TaskGen.task_gen(*k,**kw) + self.task_gen_cache_names={} + self.add_to_group(ret,group=kw.get('group',None)) + return ret + def __copy__(self): + raise Errors.WafError('build contexts are not supposed to be copied') + def install_files(self,*k,**kw): + pass + def install_as(self,*k,**kw): + pass + def symlink_as(self,*k,**kw): + pass + def load_envs(self): + node=self.root.find_node(self.cache_dir) + if not node: + raise Errors.WafError('The project was not configured: run "waf configure" first!') + lst=node.ant_glob('**/*%s'%CACHE_SUFFIX,quiet=True) + if not lst: + raise Errors.WafError('The cache directory is empty: reconfigure the project') + for x in lst: + name=x.path_from(node).replace(CACHE_SUFFIX,'').replace('\\','/') + env=ConfigSet.ConfigSet(x.abspath()) + self.all_envs[name]=env + for f in env[CFG_FILES]: + newnode=self.root.find_resource(f) + try: + h=Utils.h_file(newnode.abspath()) + except(IOError,AttributeError): + Logs.error('cannot find %r'%f) + h=Utils.SIG_NIL + newnode.sig=h + def init_dirs(self): + if not(os.path.isabs(self.top_dir)and os.path.isabs(self.out_dir)): + raise Errors.WafError('The project was not configured: run "waf configure" first!') + self.path=self.srcnode=self.root.find_dir(self.top_dir) + self.bldnode=self.root.make_node(self.variant_dir) + self.bldnode.mkdir() + def execute(self): + self.restore() + if not self.all_envs: + self.load_envs() + self.execute_build() + def execute_build(self): + Logs.info("Waf: Entering directory `%s'"%self.variant_dir) + self.recurse([self.run_dir]) + self.pre_build() + self.timer=Utils.Timer() + if self.progress_bar: + sys.stderr.write(Logs.colors.cursor_off) + try: + self.compile() + finally: + if self.progress_bar==1: + c=len(self.returned_tasks)or 1 + self.to_log(self.progress_line(c,c,Logs.colors.BLUE,Logs.colors.NORMAL)) + print('') + sys.stdout.flush() + sys.stderr.write(Logs.colors.cursor_on) + Logs.info("Waf: Leaving directory `%s'"%self.variant_dir) + self.post_build() + def restore(self): + try: + env=ConfigSet.ConfigSet(os.path.join(self.cache_dir,'build.config.py')) + except(IOError,OSError): + pass + else: + if env['version']<Context.HEXVERSION: + raise Errors.WafError('Version mismatch! reconfigure the project') + for t in env['tools']: + self.setup(**t) + f=None + try: + dbfn=os.path.join(self.variant_dir,Context.DBFILE) + try: + f=open(dbfn,'rb') + except(IOError,EOFError): + Logs.debug('build: could not load the build cache %s (missing)'%dbfn) + else: + try: + waflib.Node.pickle_lock.acquire() + waflib.Node.Nod3=self.node_class + try: + data=cPickle.load(f) + except Exception ,e: + Logs.debug('build: could not pickle the build cache %s: %r'%(dbfn,e)) + else: + for x in SAVED_ATTRS: + setattr(self,x,data[x]) + finally: + waflib.Node.pickle_lock.release() + finally: + if f: + f.close() + self.init_dirs() + def store(self): + data={} + for x in SAVED_ATTRS: + data[x]=getattr(self,x) + db=os.path.join(self.variant_dir,Context.DBFILE) + try: + waflib.Node.pickle_lock.acquire() + waflib.Node.Nod3=self.node_class + f=None + try: + f=open(db+'.tmp','wb') + cPickle.dump(data,f) + finally: + if f: + f.close() + finally: + waflib.Node.pickle_lock.release() + try: + st=os.stat(db) + os.unlink(db) + if not Utils.is_win32: + os.chown(db+'.tmp',st.st_uid,st.st_gid) + except(AttributeError,OSError): + pass + os.rename(db+'.tmp',db) + def compile(self): + Logs.debug('build: compile()') + self.producer=Runner.Parallel(self,self.jobs) + self.producer.biter=self.get_build_iterator() + self.returned_tasks=[] + try: + self.producer.start() + except KeyboardInterrupt: + self.store() + raise + else: + if self.producer.dirty: + self.store() + if self.producer.error: + raise Errors.BuildError(self.producer.error) + def setup(self,tool,tooldir=None,funs=None): + if isinstance(tool,list): + for i in tool:self.setup(i,tooldir) + return + module=Context.load_tool(tool,tooldir) + if hasattr(module,"setup"):module.setup(self) + def get_env(self): + try: + return self.all_envs[self.variant] + except KeyError: + return self.all_envs[''] + def set_env(self,val): + self.all_envs[self.variant]=val + env=property(get_env,set_env) + def add_manual_dependency(self,path,value): + if isinstance(path,waflib.Node.Node): + node=path + elif os.path.isabs(path): + node=self.root.find_resource(path) + else: + node=self.path.find_resource(path) + self.deps_man[id(node)].append(value) + def launch_node(self): + try: + return self.p_ln + except AttributeError: + self.p_ln=self.root.find_dir(self.launch_dir) + return self.p_ln + def hash_env_vars(self,env,vars_lst): + if not env.table: + env=env.parent + if not env: + return Utils.SIG_NIL + idx=str(id(env))+str(vars_lst) + try: + cache=self.cache_env + except AttributeError: + cache=self.cache_env={} + else: + try: + return self.cache_env[idx] + except KeyError: + pass + lst=[env[a]for a in vars_lst] + ret=Utils.h_list(lst) + Logs.debug('envhash: %s %r',Utils.to_hex(ret),lst) + cache[idx]=ret + return ret + def get_tgen_by_name(self,name): + cache=self.task_gen_cache_names + if not cache: + for g in self.groups: + for tg in g: + try: + cache[tg.name]=tg + except AttributeError: + pass + try: + return cache[name] + except KeyError: + raise Errors.WafError('Could not find a task generator for the name %r'%name) + def progress_line(self,state,total,col1,col2): + n=len(str(total)) + Utils.rot_idx+=1 + ind=Utils.rot_chr[Utils.rot_idx%4] + pc=(100.*state)/total + eta=str(self.timer) + fs="[%%%dd/%%%dd][%%s%%2d%%%%%%s][%s]["%(n,n,ind) + left=fs%(state,total,col1,pc,col2) + right='][%s%s%s]'%(col1,eta,col2) + cols=Logs.get_term_cols()-len(left)-len(right)+2*len(col1)+2*len(col2) + if cols<7:cols=7 + ratio=((cols*state)//total)-1 + bar=('='*ratio+'>').ljust(cols) + msg=Utils.indicator%(left,bar,right) + return msg + def declare_chain(self,*k,**kw): + return TaskGen.declare_chain(*k,**kw) + def pre_build(self): + for m in getattr(self,'pre_funs',[]): + m(self) + def post_build(self): + for m in getattr(self,'post_funs',[]): + m(self) + def add_pre_fun(self,meth): + try: + self.pre_funs.append(meth) + except AttributeError: + self.pre_funs=[meth] + def add_post_fun(self,meth): + try: + self.post_funs.append(meth) + except AttributeError: + self.post_funs=[meth] + def get_group(self,x): + if not self.groups: + self.add_group() + if x is None: + return self.groups[self.current_group] + if x in self.group_names: + return self.group_names[x] + return self.groups[x] + def add_to_group(self,tgen,group=None): + assert(isinstance(tgen,TaskGen.task_gen)or isinstance(tgen,Task.TaskBase)) + tgen.bld=self + self.get_group(group).append(tgen) + def get_group_name(self,g): + if not isinstance(g,list): + g=self.groups[g] + for x in self.group_names: + if id(self.group_names[x])==id(g): + return x + return'' + def get_group_idx(self,tg): + se=id(tg) + for i in range(len(self.groups)): + for t in self.groups[i]: + if id(t)==se: + return i + return None + def add_group(self,name=None,move=True): + if name and name in self.group_names: + Logs.error('add_group: name %s already present'%name) + g=[] + self.group_names[name]=g + self.groups.append(g) + if move: + self.current_group=len(self.groups)-1 + def set_group(self,idx): + if isinstance(idx,str): + g=self.group_names[idx] + for i in range(len(self.groups)): + if id(g)==id(self.groups[i]): + self.current_group=i + else: + self.current_group=idx + def total(self): + total=0 + for group in self.groups: + for tg in group: + try: + total+=len(tg.tasks) + except AttributeError: + total+=1 + return total + def get_targets(self): + to_post=[] + min_grp=0 + for name in self.targets.split(','): + tg=self.get_tgen_by_name(name) + if not tg: + raise Errors.WafError('target %r does not exist'%name) + m=self.get_group_idx(tg) + if m>min_grp: + min_grp=m + to_post=[tg] + elif m==min_grp: + to_post.append(tg) + return(min_grp,to_post) + def post_group(self): + if self.targets=='*': + for tg in self.groups[self.cur]: + try: + f=tg.post + except AttributeError: + pass + else: + f() + elif self.targets: + if self.cur<self._min_grp: + for tg in self.groups[self.cur]: + try: + f=tg.post + except AttributeError: + pass + else: + f() + else: + for tg in self._exact_tg: + tg.post() + else: + ln=self.launch_node() + for tg in self.groups[self.cur]: + try: + f=tg.post + except AttributeError: + pass + else: + if tg.path.is_child_of(ln): + f() + def get_tasks_group(self,idx): + tasks=[] + for tg in self.groups[idx]: + if isinstance(tg,Task.TaskBase): + tasks.append(tg) + else: + tasks.extend(tg.tasks) + return tasks + def get_build_iterator(self): + self.cur=0 + if self.targets and self.targets!='*': + (self._min_grp,self._exact_tg)=self.get_targets() + global lazy_post + if self.post_mode!=POST_LAZY: + while self.cur<len(self.groups): + self.post_group() + self.cur+=1 + self.cur=0 + while self.cur<len(self.groups): + if self.post_mode!=POST_AT_ONCE: + self.post_group() + tasks=self.get_tasks_group(self.cur) + Task.set_file_constraints(tasks) + Task.set_precedence_constraints(tasks) + self.cur_tasks=tasks + self.cur+=1 + if not tasks: + continue + yield tasks + while 1: + yield[] +class inst(Task.Task): + color='CYAN' + def post(self): + buf=[] + for x in self.source: + if isinstance(x,waflib.Node.Node): + y=x + else: + y=self.path.find_resource(x) + if not y: + if Logs.verbose: + Logs.warn('Could not find %s immediately (may cause broken builds)'%x) + idx=self.generator.bld.get_group_idx(self) + for tg in self.generator.bld.groups[idx]: + if not isinstance(tg,inst)and id(tg)!=id(self): + tg.post() + y=self.path.find_resource(x) + if y: + break + else: + raise Errors.WafError('could not find %r in %r'%(x,self.path)) + buf.append(y) + self.inputs=buf + def runnable_status(self): + ret=super(inst,self).runnable_status() + if ret==Task.SKIP_ME: + return Task.RUN_ME + return ret + def __str__(self): + return'' + def run(self): + return self.generator.exec_task() + def get_install_path(self,destdir=True): + dest=Utils.subst_vars(self.dest,self.env) + dest=dest.replace('/',os.sep) + if destdir and Options.options.destdir: + dest=os.path.join(Options.options.destdir,os.path.splitdrive(dest)[1].lstrip(os.sep)) + return dest + def exec_install_files(self): + destpath=self.get_install_path() + if not destpath: + raise Errors.WafError('unknown installation path %r'%self.generator) + for x,y in zip(self.source,self.inputs): + if self.relative_trick: + destfile=os.path.join(destpath,y.path_from(self.path)) + Utils.check_dir(os.path.dirname(destfile)) + else: + destfile=os.path.join(destpath,y.name) + self.generator.bld.do_install(y.abspath(),destfile,self.chmod) + def exec_install_as(self): + destfile=self.get_install_path() + self.generator.bld.do_install(self.inputs[0].abspath(),destfile,self.chmod) + def exec_symlink_as(self): + destfile=self.get_install_path() + self.generator.bld.do_link(self.link,destfile) +class InstallContext(BuildContext): + '''installs the targets on the system''' + cmd='install' + def __init__(self,**kw): + super(InstallContext,self).__init__(**kw) + self.uninstall=[] + self.is_install=INSTALL + def do_install(self,src,tgt,chmod=Utils.O644): + d,_=os.path.split(tgt) + if not d: + raise Errors.WafError('Invalid installation given %r->%r'%(src,tgt)) + Utils.check_dir(d) + srclbl=src.replace(self.srcnode.abspath()+os.sep,'') + if not Options.options.force: + try: + st1=os.stat(tgt) + st2=os.stat(src) + except OSError: + pass + else: + if st1.st_mtime+2>=st2.st_mtime and st1.st_size==st2.st_size: + if not self.progress_bar: + Logs.info('- install %s (from %s)'%(tgt,srclbl)) + return False + if not self.progress_bar: + Logs.info('+ install %s (from %s)'%(tgt,srclbl)) + try: + os.remove(tgt) + except OSError: + pass + try: + shutil.copy2(src,tgt) + os.chmod(tgt,chmod) + except IOError: + try: + os.stat(src) + except(OSError,IOError): + Logs.error('File %r does not exist'%src) + raise Errors.WafError('Could not install the file %r'%tgt) + def do_link(self,src,tgt): + d,_=os.path.split(tgt) + Utils.check_dir(d) + link=False + if not os.path.islink(tgt): + link=True + elif os.readlink(tgt)!=src: + link=True + if link: + try:os.remove(tgt) + except OSError:pass + if not self.progress_bar: + Logs.info('+ symlink %s (to %s)'%(tgt,src)) + os.symlink(src,tgt) + else: + if not self.progress_bar: + Logs.info('- symlink %s (to %s)'%(tgt,src)) + def run_task_now(self,tsk,postpone): + tsk.post() + if not postpone: + if tsk.runnable_status()==Task.ASK_LATER: + raise self.WafError('cannot post the task %r'%tsk) + tsk.run() + def install_files(self,dest,files,env=None,chmod=Utils.O644,relative_trick=False,cwd=None,add=True,postpone=True): + tsk=inst(env=env or self.env) + tsk.bld=self + tsk.path=cwd or self.path + tsk.chmod=chmod + if isinstance(files,waflib.Node.Node): + tsk.source=[files] + else: + tsk.source=Utils.to_list(files) + tsk.dest=dest + tsk.exec_task=tsk.exec_install_files + tsk.relative_trick=relative_trick + if add:self.add_to_group(tsk) + self.run_task_now(tsk,postpone) + return tsk + def install_as(self,dest,srcfile,env=None,chmod=Utils.O644,cwd=None,add=True,postpone=True): + tsk=inst(env=env or self.env) + tsk.bld=self + tsk.path=cwd or self.path + tsk.chmod=chmod + tsk.source=[srcfile] + tsk.dest=dest + tsk.exec_task=tsk.exec_install_as + if add:self.add_to_group(tsk) + self.run_task_now(tsk,postpone) + return tsk + def symlink_as(self,dest,src,env=None,cwd=None,add=True,postpone=True): + if Utils.is_win32: + return + tsk=inst(env=env or self.env) + tsk.bld=self + tsk.dest=dest + tsk.path=cwd or self.path + tsk.source=[] + tsk.link=src + tsk.exec_task=tsk.exec_symlink_as + if add:self.add_to_group(tsk) + self.run_task_now(tsk,postpone) + return tsk +class UninstallContext(InstallContext): + '''removes the targets installed''' + cmd='uninstall' + def __init__(self,**kw): + super(UninstallContext,self).__init__(**kw) + self.is_install=UNINSTALL + def do_install(self,src,tgt,chmod=Utils.O644): + if not self.progress_bar: + Logs.info('- remove %s'%tgt) + self.uninstall.append(tgt) + try: + os.remove(tgt) + except OSError ,e: + if e.errno!=errno.ENOENT: + if not getattr(self,'uninstall_error',None): + self.uninstall_error=True + Logs.warn('build: some files could not be uninstalled (retry with -vv to list them)') + if Logs.verbose>1: + Logs.warn('could not remove %s (error code %r)'%(e.filename,e.errno)) + while tgt: + tgt=os.path.dirname(tgt) + try: + os.rmdir(tgt) + except OSError: + break + def do_link(self,src,tgt): + try: + if not self.progress_bar: + Logs.info('- unlink %s'%tgt) + os.remove(tgt) + except OSError: + pass + while tgt: + tgt=os.path.dirname(tgt) + try: + os.rmdir(tgt) + except OSError: + break + def execute(self): + try: + def runnable_status(self): + return Task.SKIP_ME + setattr(Task.Task,'runnable_status_back',Task.Task.runnable_status) + setattr(Task.Task,'runnable_status',runnable_status) + super(UninstallContext,self).execute() + finally: + setattr(Task.Task,'runnable_status',Task.Task.runnable_status_back) +class CleanContext(BuildContext): + '''cleans the project''' + cmd='clean' + def execute(self): + self.restore() + if not self.all_envs: + self.load_envs() + self.recurse([self.run_dir]) + try: + self.clean() + finally: + self.store() + def clean(self): + Logs.debug('build: clean called') + if self.bldnode!=self.srcnode: + lst=[self.root.find_or_declare(f)for f in self.env[CFG_FILES]] + for n in self.bldnode.ant_glob('**/*',excl='lock* *conf_check_*/** config.log c4che/*',quiet=True): + if n in lst: + continue + n.delete() + self.root.children={} + for v in'node_deps task_sigs raw_deps'.split(): + setattr(self,v,{}) +class ListContext(BuildContext): + '''lists the targets to execute''' + cmd='list' + def execute(self): + self.restore() + if not self.all_envs: + self.load_envs() + self.recurse([self.run_dir]) + self.pre_build() + self.timer=Utils.Timer() + for g in self.groups: + for tg in g: + try: + f=tg.post + except AttributeError: + pass + else: + f() + try: + self.get_tgen_by_name('') + except: + pass + lst=list(self.task_gen_cache_names.keys()) + lst.sort() + for k in lst: + Logs.pprint('GREEN',k) +class StepContext(BuildContext): + '''executes tasks in a step-by-step fashion, for debugging''' + cmd='step' + def __init__(self,**kw): + super(StepContext,self).__init__(**kw) + self.files=Options.options.files + def compile(self): + if not self.files: + Logs.warn('Add a pattern for the debug build, for example "waf step --files=main.c,app"') + BuildContext.compile(self) + return + for g in self.groups: + for tg in g: + try: + f=tg.post + except AttributeError: + pass + else: + f() + for pat in self.files.split(','): + matcher=self.get_matcher(pat) + for tg in g: + if isinstance(tg,Task.TaskBase): + lst=[tg] + else: + lst=tg.tasks + for tsk in lst: + do_exec=False + for node in getattr(tsk,'inputs',[]): + if matcher(node,output=False): + do_exec=True + break + for node in getattr(tsk,'outputs',[]): + if matcher(node,output=True): + do_exec=True + break + if do_exec: + ret=tsk.run() + Logs.info('%s -> exit %r'%(str(tsk),ret)) + def get_matcher(self,pat): + inn=True + out=True + if pat.startswith('in:'): + out=False + pat=pat.replace('in:','') + elif pat.startswith('out:'): + inn=False + pat=pat.replace('out:','') + anode=self.root.find_node(pat) + pattern=None + if not anode: + if not pat.startswith('^'): + pat='^.+?%s'%pat + if not pat.endswith('$'): + pat='%s$'%pat + pattern=re.compile(pat) + def match(node,output): + if output==True and not out: + return False + if output==False and not inn: + return False + if anode: + return anode==node + else: + return pattern.match(node.abspath()) + return match +BuildContext.store=Utils.nogc(BuildContext.store) +BuildContext.restore=Utils.nogc(BuildContext.restore) diff --git a/waflib/ConfigSet.py b/waflib/ConfigSet.py new file mode 100644 index 0000000..fa55135 --- /dev/null +++ b/waflib/ConfigSet.py @@ -0,0 +1,151 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import sys +if sys.hexversion < 0x020400f0: from sets import Set as set +import copy,re,os +from waflib import Logs,Utils +re_imp=re.compile('^(#)*?([^#=]*?)\ =\ (.*?)$',re.M) +class ConfigSet(object): + __slots__=('table','parent') + def __init__(self,filename=None): + self.table={} + if filename: + self.load(filename) + def __contains__(self,key): + if key in self.table:return True + try:return self.parent.__contains__(key) + except AttributeError:return False + def keys(self): + keys=set() + cur=self + while cur: + keys.update(cur.table.keys()) + cur=getattr(cur,'parent',None) + keys=list(keys) + keys.sort() + return keys + def __str__(self): + return"\n".join(["%r %r"%(x,self.__getitem__(x))for x in self.keys()]) + def __getitem__(self,key): + try: + while 1: + x=self.table.get(key,None) + if not x is None: + return x + self=self.parent + except AttributeError: + return[] + def __setitem__(self,key,value): + self.table[key]=value + def __delitem__(self,key): + self[key]=[] + def __getattr__(self,name): + if name in self.__slots__: + return object.__getattr__(self,name) + else: + return self[name] + def __setattr__(self,name,value): + if name in self.__slots__: + object.__setattr__(self,name,value) + else: + self[name]=value + def __delattr__(self,name): + if name in self.__slots__: + object.__delattr__(self,name) + else: + del self[name] + def derive(self): + newenv=ConfigSet() + newenv.parent=self + return newenv + def detach(self): + tbl=self.get_merged_dict() + try: + delattr(self,'parent') + except AttributeError: + pass + else: + keys=tbl.keys() + for x in keys: + tbl[x]=copy.deepcopy(tbl[x]) + self.table=tbl + def get_flat(self,key): + s=self[key] + if isinstance(s,str):return s + return' '.join(s) + def _get_list_value_for_modification(self,key): + try: + value=self.table[key] + except KeyError: + try:value=self.parent[key] + except AttributeError:value=[] + if isinstance(value,list): + value=value[:] + else: + value=[value] + else: + if not isinstance(value,list): + value=[value] + self.table[key]=value + return value + def append_value(self,var,val): + current_value=self._get_list_value_for_modification(var) + if isinstance(val,str): + val=[val] + current_value.extend(val) + def prepend_value(self,var,val): + if isinstance(val,str): + val=[val] + self.table[var]=val+self._get_list_value_for_modification(var) + def append_unique(self,var,val): + if isinstance(val,str): + val=[val] + current_value=self._get_list_value_for_modification(var) + for x in val: + if x not in current_value: + current_value.append(x) + def get_merged_dict(self): + table_list=[] + env=self + while 1: + table_list.insert(0,env.table) + try:env=env.parent + except AttributeError:break + merged_table={} + for table in table_list: + merged_table.update(table) + return merged_table + def store(self,filename): + try: + os.makedirs(os.path.split(filename)[0]) + except OSError: + pass + f=None + try: + f=open(filename,'w') + merged_table=self.get_merged_dict() + keys=list(merged_table.keys()) + keys.sort() + for k in keys: + if k!='undo_stack': + f.write('%s = %r\n'%(k,merged_table[k])) + finally: + if f: + f.close() + def load(self,filename): + tbl=self.table + code=Utils.readf(filename) + for m in re_imp.finditer(code): + g=m.group + tbl[g(2)]=eval(g(3)) + Logs.debug('env: %s'%str(self.table)) + def update(self,d): + for k,v in d.items(): + self[k]=v + def stash(self): + self.undo_stack=self.undo_stack+[self.table] + self.table=self.table.copy() + def revert(self): + self.table=self.undo_stack.pop(-1) diff --git a/waflib/Configure.py b/waflib/Configure.py new file mode 100644 index 0000000..bd004c6 --- /dev/null +++ b/waflib/Configure.py @@ -0,0 +1,315 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os,shlex,sys,time +from waflib import ConfigSet,Utils,Options,Logs,Context,Build,Errors +try: + from urllib import request +except: + from urllib import urlopen +else: + urlopen=request.urlopen +BREAK='break' +CONTINUE='continue' +WAF_CONFIG_LOG='config.log' +autoconfig=False +conf_template='''# project %(app)s configured on %(now)s by +# waf %(wafver)s (abi %(abi)s, python %(pyver)x on %(systype)s) +# using %(args)s +#''' +def download_check(node): + pass +def download_tool(tool,force=False,ctx=None): + for x in Utils.to_list(Context.remote_repo): + for sub in Utils.to_list(Context.remote_locs): + url='/'.join((x,sub,tool+'.py')) + try: + web=urlopen(url) + try: + if web.getcode()!=200: + continue + except AttributeError: + pass + except Exception: + continue + else: + tmp=ctx.root.make_node(os.sep.join((Context.waf_dir,'waflib','extras',tool+'.py'))) + tmp.write(web.read()) + Logs.warn('Downloaded %s from %s'%(tool,url)) + download_check(tmp) + try: + module=Context.load_tool(tool) + except: + Logs.warn('The tool %s from %s is unusable'%(tool,url)) + try: + tmp.delete() + except: + pass + continue + return module + raise Errors.WafError('Could not load the Waf tool') +class ConfigurationContext(Context.Context): + '''configures the project''' + cmd='configure' + error_handlers=[] + def __init__(self,**kw): + super(ConfigurationContext,self).__init__(**kw) + self.environ=dict(os.environ) + self.all_envs={} + self.top_dir=None + self.out_dir=None + self.tools=[] + self.hash=0 + self.files=[] + self.tool_cache=[] + self.setenv('') + def setenv(self,name,env=None): + if name not in self.all_envs or env: + if not env: + env=ConfigSet.ConfigSet() + self.prepare_env(env) + else: + env=env.derive() + self.all_envs[name]=env + self.variant=name + def get_env(self): + return self.all_envs[self.variant] + def set_env(self,val): + self.all_envs[self.variant]=val + env=property(get_env,set_env) + def init_dirs(self): + top=self.top_dir + if not top: + top=Options.options.top + if not top: + top=getattr(Context.g_module,Context.TOP,None) + if not top: + top=self.path.abspath() + top=os.path.abspath(top) + self.srcnode=(os.path.isabs(top)and self.root or self.path).find_dir(top) + assert(self.srcnode) + out=self.out_dir + if not out: + out=Options.options.out + if not out: + out=getattr(Context.g_module,Context.OUT,None) + if not out: + out=Options.lockfile.replace('.lock-waf_%s_'%sys.platform,'').replace('.lock-waf','') + self.bldnode=(os.path.isabs(out)and self.root or self.path).make_node(out) + self.bldnode.mkdir() + if not os.path.isdir(self.bldnode.abspath()): + conf.fatal('could not create the build directory %s'%self.bldnode.abspath()) + def execute(self): + self.init_dirs() + self.cachedir=self.bldnode.make_node(Build.CACHE_DIR) + self.cachedir.mkdir() + path=os.path.join(self.bldnode.abspath(),WAF_CONFIG_LOG) + self.logger=Logs.make_logger(path,'cfg') + app=getattr(Context.g_module,'APPNAME','') + if app: + ver=getattr(Context.g_module,'VERSION','') + if ver: + app="%s (%s)"%(app,ver) + now=time.ctime() + pyver=sys.hexversion + systype=sys.platform + args=" ".join(sys.argv) + wafver=Context.WAFVERSION + abi=Context.ABI + self.to_log(conf_template%vars()) + self.msg('Setting top to',self.srcnode.abspath()) + self.msg('Setting out to',self.bldnode.abspath()) + if id(self.srcnode)==id(self.bldnode): + Logs.warn('Setting top == out (remember to use "update_outputs")') + elif id(self.path)!=id(self.srcnode): + if self.srcnode.is_child_of(self.path): + Logs.warn('Are you certain that you do not want to set top="." ?') + super(ConfigurationContext,self).execute() + self.store() + Context.top_dir=self.srcnode.abspath() + Context.out_dir=self.bldnode.abspath() + env=ConfigSet.ConfigSet() + env['argv']=sys.argv + env['options']=Options.options.__dict__ + env.run_dir=Context.run_dir + env.top_dir=Context.top_dir + env.out_dir=Context.out_dir + env['hash']=self.hash + env['files']=self.files + env['environ']=dict(self.environ) + if not self.env.NO_LOCK_IN_RUN: + env.store(Context.run_dir+os.sep+Options.lockfile) + if not self.env.NO_LOCK_IN_TOP: + env.store(Context.top_dir+os.sep+Options.lockfile) + if not self.env.NO_LOCK_IN_OUT: + env.store(Context.out_dir+os.sep+Options.lockfile) + def prepare_env(self,env): + if not env.PREFIX: + env.PREFIX=os.path.abspath(os.path.expanduser(Options.options.prefix)) + if not env.BINDIR: + env.BINDIR=Utils.subst_vars('${PREFIX}/bin',env) + if not env.LIBDIR: + env.LIBDIR=Utils.subst_vars('${PREFIX}/lib',env) + def store(self): + n=self.cachedir.make_node('build.config.py') + n.write('version = 0x%x\ntools = %r\n'%(Context.HEXVERSION,self.tools)) + if not self.all_envs: + self.fatal('nothing to store in the configuration context!') + for key in self.all_envs: + tmpenv=self.all_envs[key] + tmpenv.store(os.path.join(self.cachedir.abspath(),key+Build.CACHE_SUFFIX)) + def load(self,input,tooldir=None,funs=None,download=True): + tools=Utils.to_list(input) + if tooldir:tooldir=Utils.to_list(tooldir) + for tool in tools: + mag=(tool,id(self.env),funs) + if mag in self.tool_cache: + self.to_log('(tool %s is already loaded, skipping)'%tool) + continue + self.tool_cache.append(mag) + module=None + try: + module=Context.load_tool(tool,tooldir) + except ImportError ,e: + if Options.options.download: + module=download_tool(tool,ctx=self) + if not module: + self.fatal('Could not load the Waf tool %r or download a suitable replacement from the repository (sys.path %r)\n%s'%(tool,sys.path,e)) + else: + self.fatal('Could not load the Waf tool %r from %r (try the --download option?):\n%s'%(tool,sys.path,e)) + except Exception ,e: + self.to_log('imp %r (%r & %r)'%(tool,tooldir,funs)) + self.to_log(Utils.ex_stack()) + raise + if funs is not None: + self.eval_rules(funs) + else: + func=getattr(module,'configure',None) + if func: + if type(func)is type(Utils.readf):func(self) + else:self.eval_rules(func) + self.tools.append({'tool':tool,'tooldir':tooldir,'funs':funs}) + def post_recurse(self,node): + super(ConfigurationContext,self).post_recurse(node) + self.hash=hash((self.hash,node.read('rb'))) + self.files.append(node.abspath()) + def eval_rules(self,rules): + self.rules=Utils.to_list(rules) + for x in self.rules: + f=getattr(self,x) + if not f:self.fatal("No such method '%s'."%x) + try: + f() + except Exception ,e: + ret=self.err_handler(x,e) + if ret==BREAK: + break + elif ret==CONTINUE: + continue + else: + raise + def err_handler(self,fun,error): + pass +def conf(f): + def fun(*k,**kw): + mandatory=True + if'mandatory'in kw: + mandatory=kw['mandatory'] + del kw['mandatory'] + try: + return f(*k,**kw) + except Errors.ConfigurationError ,e: + if mandatory: + raise e + setattr(ConfigurationContext,f.__name__,fun) + setattr(Build.BuildContext,f.__name__,fun) + return f +def add_os_flags(self,var,dest=None): + try:self.env.append_value(dest or var,shlex.split(self.environ[var])) + except KeyError:pass +def cmd_to_list(self,cmd): + if isinstance(cmd,str)and cmd.find(' '): + try: + os.stat(cmd) + except OSError: + return shlex.split(cmd) + else: + return[cmd] + return cmd +def check_waf_version(self,mini='1.6.0',maxi='1.7.0'): + self.start_msg('Checking for waf version in %s-%s'%(str(mini),str(maxi))) + ver=Context.HEXVERSION + if Utils.num2ver(mini)>ver: + self.fatal('waf version should be at least %r (%r found)'%(Utils.num2ver(mini),ver)) + if Utils.num2ver(maxi)<ver: + self.fatal('waf version should be at most %r (%r found)'%(Utils.num2ver(maxi),ver)) + self.end_msg('ok') +def find_file(self,filename,path_list=[]): + for n in Utils.to_list(filename): + for d in Utils.to_list(path_list): + p=os.path.join(d,n) + if os.path.exists(p): + return p + self.fatal('Could not find %r'%filename) +def find_program(self,filename,**kw): + exts=kw.get('exts',Utils.is_win32 and'.exe,.com,.bat,.cmd'or',.sh,.pl,.py') + environ=kw.get('environ',os.environ) + ret='' + filename=Utils.to_list(filename) + var=kw.get('var','') + if not var: + var=filename[0].upper() + if self.env[var]: + ret=self.env[var] + elif var in environ: + ret=environ[var] + path_list=kw.get('path_list','') + if not ret: + if path_list: + path_list=Utils.to_list(path_list) + else: + path_list=environ.get('PATH','').split(os.pathsep) + if not isinstance(filename,list): + filename=[filename] + for a in exts.split(','): + if ret: + break + for b in filename: + if ret: + break + for c in path_list: + if ret: + break + x=os.path.expanduser(os.path.join(c,b+a)) + if os.path.isfile(x): + ret=x + if not ret and Utils.winreg: + ret=Utils.get_registry_app_path(Utils.winreg.HKEY_CURRENT_USER,filename) + if not ret and Utils.winreg: + ret=Utils.get_registry_app_path(Utils.winreg.HKEY_LOCAL_MACHINE,filename) + self.msg('Checking for program '+','.join(filename),ret or False) + self.to_log('find program=%r paths=%r var=%r -> %r'%(filename,path_list,var,ret)) + if not ret: + self.fatal(kw.get('errmsg','')or'Could not find the program %s'%','.join(filename)) + if var: + self.env[var]=ret + return ret +def find_perl_program(self,filename,path_list=[],var=None,environ=None,exts=''): + try: + app=self.find_program(filename,path_list=path_list,var=var,environ=environ,exts=exts) + except: + self.find_program('perl',var='PERL') + app=self.find_file(filename,os.environ['PATH'].split(os.pathsep)) + if not app: + raise + if var: + self.env[var]=Utils.to_list(self.env['PERL'])+[app] + self.msg('Checking for %r'%filename,app) + +conf(add_os_flags) +conf(cmd_to_list) +conf(check_waf_version) +conf(find_file) +conf(find_program) +conf(find_perl_program)
\ No newline at end of file diff --git a/waflib/Context.py b/waflib/Context.py new file mode 100644 index 0000000..a16af30 --- /dev/null +++ b/waflib/Context.py @@ -0,0 +1,299 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os,imp,sys +from waflib import Utils,Errors,Logs +import waflib.Node +HEXVERSION=0x1060b00 +WAFVERSION="1.6.11" +WAFREVISION="a7e69d6b81b04729804754c4d5214da063779a65" +ABI=98 +DBFILE='.wafpickle-%d'%ABI +APPNAME='APPNAME' +VERSION='VERSION' +TOP='top' +OUT='out' +WSCRIPT_FILE='wscript' +launch_dir='' +run_dir='' +top_dir='' +out_dir='' +waf_dir='' +local_repo='' +remote_repo='http://waf.googlecode.com/git/' +remote_locs=['waflib/extras','waflib/Tools'] +g_module=None +STDOUT=1 +STDERR=-1 +BOTH=0 +classes=[] +def create_context(cmd_name,*k,**kw): + global classes + for x in classes: + if x.cmd==cmd_name: + return x(*k,**kw) + ctx=Context(*k,**kw) + ctx.fun=cmd_name + return ctx +class store_context(type): + def __init__(cls,name,bases,dict): + super(store_context,cls).__init__(name,bases,dict) + name=cls.__name__ + if name=='ctx'or name=='Context': + return + try: + cls.cmd + except AttributeError: + raise Errors.WafError('Missing command for the context class %r (cmd)'%name) + if not getattr(cls,'fun',None): + cls.fun=cls.cmd + global classes + classes.insert(0,cls) +ctx=store_context('ctx',(object,),{}) +class Context(ctx): + errors=Errors + tools={} + def __init__(self,**kw): + try: + rd=kw['run_dir'] + except KeyError: + global run_dir + rd=run_dir + class node_class(waflib.Node.Node): + pass + self.node_class=node_class + self.node_class.__module__="waflib.Node" + self.node_class.__name__="Nod3" + self.node_class.ctx=self + self.root=self.node_class('',None) + self.cur_script=None + self.path=self.root.find_dir(rd) + self.stack_path=[] + self.exec_dict={'ctx':self,'conf':self,'bld':self,'opt':self} + self.logger=None + def __hash__(self): + return id(self) + def load(self,tool_list,*k,**kw): + tools=Utils.to_list(tool_list) + path=Utils.to_list(kw.get('tooldir','')) + for t in tools: + module=load_tool(t,path) + fun=getattr(module,kw.get('name',self.fun),None) + if fun: + fun(self) + def execute(self): + global g_module + self.recurse([os.path.dirname(g_module.root_path)]) + def pre_recurse(self,node): + self.stack_path.append(self.cur_script) + self.cur_script=node + self.path=node.parent + def post_recurse(self,node): + self.cur_script=self.stack_path.pop() + if self.cur_script: + self.path=self.cur_script.parent + def recurse(self,dirs,name=None,mandatory=True,once=True): + try: + cache=self.recurse_cache + except: + cache=self.recurse_cache={} + for d in Utils.to_list(dirs): + if not os.path.isabs(d): + d=os.path.join(self.path.abspath(),d) + WSCRIPT=os.path.join(d,WSCRIPT_FILE) + WSCRIPT_FUN=WSCRIPT+'_'+(name or self.fun) + node=self.root.find_node(WSCRIPT_FUN) + if node and(not once or node not in cache): + cache[node]=True + self.pre_recurse(node) + try: + function_code=node.read('rU') + exec(compile(function_code,node.abspath(),'exec'),self.exec_dict) + finally: + self.post_recurse(node) + elif not node: + node=self.root.find_node(WSCRIPT) + tup=(node,name or self.fun) + if node and(not once or tup not in cache): + cache[tup]=True + self.pre_recurse(node) + try: + wscript_module=load_module(node.abspath()) + user_function=getattr(wscript_module,(name or self.fun),None) + if not user_function: + if not mandatory: + continue + raise Errors.WafError('No function %s defined in %s'%(name or self.fun,node.abspath())) + user_function(self) + finally: + self.post_recurse(node) + elif not node: + if not mandatory: + continue + raise Errors.WafError('No wscript file in directory %s'%d) + def exec_command(self,cmd,**kw): + subprocess=Utils.subprocess + kw['shell']=isinstance(cmd,str) + Logs.debug('runner: %r'%cmd) + Logs.debug('runner_env: kw=%s'%kw) + try: + if self.logger: + self.logger.info(cmd) + kw['stdout']=kw['stderr']=subprocess.PIPE + p=subprocess.Popen(cmd,**kw) + (out,err)=p.communicate() + if out: + self.logger.debug('out: %s'%out.decode(sys.stdout.encoding or'iso8859-1')) + if err: + self.logger.error('err: %s'%err.decode(sys.stdout.encoding or'iso8859-1')) + return p.returncode + else: + p=subprocess.Popen(cmd,**kw) + return p.wait() + except OSError: + return-1 + def cmd_and_log(self,cmd,**kw): + subprocess=Utils.subprocess + kw['shell']=isinstance(cmd,str) + Logs.debug('runner: %r'%cmd) + if'quiet'in kw: + quiet=kw['quiet'] + del kw['quiet'] + else: + quiet=None + if'output'in kw: + to_ret=kw['output'] + del kw['output'] + else: + to_ret=STDOUT + kw['stdout']=kw['stderr']=subprocess.PIPE + if quiet is None: + self.to_log(cmd) + try: + p=subprocess.Popen(cmd,**kw) + (out,err)=p.communicate() + except Exception ,e: + raise Errors.WafError('Execution failure: %s'%str(e),ex=e) + if not isinstance(out,str): + out=out.decode(sys.stdout.encoding or'iso8859-1') + if not isinstance(err,str): + err=err.decode(sys.stdout.encoding or'iso8859-1') + if out and quiet!=STDOUT and quiet!=BOTH: + self.to_log('out: %s'%out) + if err and quiet!=STDERR and quiet!=BOTH: + self.to_log('err: %s'%err) + if p.returncode: + e=Errors.WafError('Command %r returned %r'%(cmd,p.returncode)) + e.returncode=p.returncode + e.stderr=err + e.stdout=out + raise e + if to_ret==BOTH: + return(out,err) + elif to_ret==STDERR: + return err + return out + def fatal(self,msg,ex=None): + if self.logger: + self.logger.info('from %s: %s'%(self.path.abspath(),msg)) + try: + msg='%s\n(complete log in %s)'%(msg,self.logger.handlers[0].baseFilename) + except: + pass + raise self.errors.ConfigurationError(msg,ex=ex) + def to_log(self,msg): + if not msg: + return + if self.logger: + self.logger.info(msg) + else: + sys.stderr.write(str(msg)) + sys.stderr.flush() + def msg(self,msg,result,color=None): + self.start_msg(msg) + if not isinstance(color,str): + color=result and'GREEN'or'YELLOW' + self.end_msg(result,color) + def start_msg(self,msg): + try: + if self.in_msg: + self.in_msg+=1 + return + except: + self.in_msg=0 + self.in_msg+=1 + try: + self.line_just=max(self.line_just,len(msg)) + except AttributeError: + self.line_just=max(40,len(msg)) + for x in(self.line_just*'-',msg): + self.to_log(x) + Logs.pprint('NORMAL',"%s :"%msg.ljust(self.line_just),sep='') + def end_msg(self,result,color=None): + self.in_msg-=1 + if self.in_msg: + return + defcolor='GREEN' + if result==True: + msg='ok' + elif result==False: + msg='not found' + defcolor='YELLOW' + else: + msg=str(result) + self.to_log(msg) + Logs.pprint(color or defcolor,msg) + def load_special_tools(self,var,ban=[]): + global waf_dir + lst=self.root.find_node(waf_dir).find_node('waflib/extras').ant_glob(var) + for x in lst: + if not x.name in ban: + load_tool(x.name.replace('.py','')) +cache_modules={} +def load_module(path): + try: + return cache_modules[path] + except KeyError: + pass + module=imp.new_module(WSCRIPT_FILE) + try: + code=Utils.readf(path,m='rU') + except(IOError,OSError): + raise Errors.WafError('Could not read the file %r'%path) + module_dir=os.path.dirname(path) + sys.path.insert(0,module_dir) + exec(compile(code,path,'exec'),module.__dict__) + sys.path.remove(module_dir) + cache_modules[path]=module + return module +def load_tool(tool,tooldir=None): + tool=tool.replace('++','xx') + tool=tool.replace('java','javaw') + tool=tool.replace('compiler_cc','compiler_c') + if tooldir: + assert isinstance(tooldir,list) + sys.path=tooldir+sys.path + try: + __import__(tool) + ret=sys.modules[tool] + Context.tools[tool]=ret + return ret + finally: + for d in tooldir: + sys.path.remove(d) + else: + global waf_dir + try: + os.stat(os.path.join(waf_dir,'waflib','extras',tool+'.py')) + d='waflib.extras.%s'%tool + except: + try: + os.stat(os.path.join(waf_dir,'waflib','Tools',tool+'.py')) + d='waflib.Tools.%s'%tool + except: + d=tool + __import__(d) + ret=sys.modules[d] + Context.tools[tool]=ret + return ret diff --git a/waflib/Errors.py b/waflib/Errors.py new file mode 100644 index 0000000..aacc1a9 --- /dev/null +++ b/waflib/Errors.py @@ -0,0 +1,37 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import traceback,sys +class WafError(Exception): + def __init__(self,msg='',ex=None): + self.msg=msg + assert not isinstance(msg,Exception) + self.stack=[] + if ex: + if not msg: + self.msg=str(ex) + if isinstance(ex,WafError): + self.stack=ex.stack + else: + self.stack=traceback.extract_tb(sys.exc_info()[2]) + self.stack+=traceback.extract_stack()[:-1] + self.verbose_msg=''.join(traceback.format_list(self.stack)) + def __str__(self): + return str(self.msg) +class BuildError(WafError): + def __init__(self,error_tasks=[]): + self.tasks=error_tasks + WafError.__init__(self,self.format_error()) + def format_error(self): + lst=['Build failed'] + for tsk in self.tasks: + txt=tsk.format_error() + if txt:lst.append(txt) + return'\n'.join(lst) +class ConfigurationError(WafError): + pass +class TaskRescan(WafError): + pass +class TaskNotReady(WafError): + pass diff --git a/waflib/Logs.py b/waflib/Logs.py new file mode 100644 index 0000000..2ba46d2 --- /dev/null +++ b/waflib/Logs.py @@ -0,0 +1,149 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os,re,traceback,sys +_nocolor=os.environ.get('NOCOLOR','no')not in('no','0','false') +try: + if not _nocolor: + import waflib.ansiterm +except: + pass +import logging +LOG_FORMAT="%(asctime)s %(c1)s%(zone)s%(c2)s %(message)s" +HOUR_FORMAT="%H:%M:%S" +zones='' +verbose=0 +colors_lst={'USE':True,'BOLD':'\x1b[01;1m','RED':'\x1b[01;31m','GREEN':'\x1b[32m','YELLOW':'\x1b[33m','PINK':'\x1b[35m','BLUE':'\x1b[01;34m','CYAN':'\x1b[36m','NORMAL':'\x1b[0m','cursor_on':'\x1b[?25h','cursor_off':'\x1b[?25l',} +got_tty=not os.environ.get('TERM','dumb')in['dumb','emacs'] +if got_tty: + try: + got_tty=sys.stderr.isatty() + except AttributeError: + got_tty=False +if(not got_tty and os.environ.get('TERM','dumb')!='msys')or _nocolor: + colors_lst['USE']=False +def get_term_cols(): + return 80 +try: + import struct,fcntl,termios +except ImportError: + pass +else: + if got_tty: + def get_term_cols_real(): + dummy_lines,cols=struct.unpack("HHHH",fcntl.ioctl(sys.stderr.fileno(),termios.TIOCGWINSZ,struct.pack("HHHH",0,0,0,0)))[:2] + return cols + try: + get_term_cols_real() + except: + pass + else: + get_term_cols=get_term_cols_real +get_term_cols.__doc__=""" + Get the console width in characters. + + :return: the number of characters per line + :rtype: int + """ +def get_color(cl): + if not colors_lst['USE']:return'' + return colors_lst.get(cl,'') +class color_dict(object): + def __getattr__(self,a): + return get_color(a) + def __call__(self,a): + return get_color(a) +colors=color_dict() +re_log=re.compile(r'(\w+): (.*)',re.M) +class log_filter(logging.Filter): + def __init__(self,name=None): + pass + def filter(self,rec): + rec.c1=colors.PINK + rec.c2=colors.NORMAL + rec.zone=rec.module + if rec.levelno>=logging.INFO: + if rec.levelno>=logging.ERROR: + rec.c1=colors.RED + elif rec.levelno>=logging.WARNING: + rec.c1=colors.YELLOW + else: + rec.c1=colors.GREEN + return True + m=re_log.match(rec.msg) + if m: + rec.zone=m.group(1) + rec.msg=m.group(2) + if zones: + return getattr(rec,'zone','')in zones or'*'in zones + elif not verbose>2: + return False + return True +class formatter(logging.Formatter): + def __init__(self): + logging.Formatter.__init__(self,LOG_FORMAT,HOUR_FORMAT) + def format(self,rec): + if rec.levelno>=logging.WARNING or rec.levelno==logging.INFO: + try: + msg=rec.msg.decode('utf-8') + except: + msg=rec.msg + return'%s%s%s'%(rec.c1,msg,rec.c2) + return logging.Formatter.format(self,rec) +log=None +def debug(*k,**kw): + if verbose: + k=list(k) + k[0]=k[0].replace('\n',' ') + global log + log.debug(*k,**kw) +def error(*k,**kw): + global log + log.error(*k,**kw) + if verbose>2: + st=traceback.extract_stack() + if st: + st=st[:-1] + buf=[] + for filename,lineno,name,line in st: + buf.append(' File "%s", line %d, in %s'%(filename,lineno,name)) + if line: + buf.append(' %s'%line.strip()) + if buf:log.error("\n".join(buf)) +def warn(*k,**kw): + global log + log.warn(*k,**kw) +def info(*k,**kw): + global log + log.info(*k,**kw) +def init_log(): + global log + log=logging.getLogger('waflib') + log.handlers=[] + log.filters=[] + hdlr=logging.StreamHandler() + hdlr.setFormatter(formatter()) + log.addHandler(hdlr) + log.addFilter(log_filter()) + log.setLevel(logging.DEBUG) +def make_logger(path,name): + logger=logging.getLogger(name) + hdlr=logging.FileHandler(path,'w') + formatter=logging.Formatter('%(message)s') + hdlr.setFormatter(formatter) + logger.addHandler(hdlr) + logger.setLevel(logging.DEBUG) + return logger +def make_mem_logger(name,to_log,size=10000): + from logging.handlers import MemoryHandler + logger=logging.getLogger(name) + hdlr=MemoryHandler(size,target=to_log) + formatter=logging.Formatter('%(message)s') + hdlr.setFormatter(formatter) + logger.addHandler(hdlr) + logger.memhandler=hdlr + logger.setLevel(logging.DEBUG) + return logger +def pprint(col,str,label='',sep='\n'): + sys.stderr.write("%s%s%s %s%s"%(colors(col),str,colors.NORMAL,label,sep)) diff --git a/waflib/Node.py b/waflib/Node.py new file mode 100644 index 0000000..9a86b22 --- /dev/null +++ b/waflib/Node.py @@ -0,0 +1,506 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import sys +if sys.hexversion < 0x020400f0: from sets import Set as set +import os,re,sys,shutil +from waflib import Utils,Errors +exclude_regs=''' +**/*~ +**/#*# +**/.#* +**/%*% +**/._* +**/CVS +**/CVS/** +**/.cvsignore +**/SCCS +**/SCCS/** +**/vssver.scc +**/.svn +**/.svn/** +**/BitKeeper +**/.git +**/.git/** +**/.gitignore +**/.bzr +**/.bzrignore +**/.bzr/** +**/.hg +**/.hg/** +**/_MTN +**/_MTN/** +**/.arch-ids +**/{arch} +**/_darcs +**/_darcs/** +**/.DS_Store''' +def split_path(path): + return path.split('/') +def split_path_cygwin(path): + if path.startswith('//'): + ret=path.split('/')[2:] + ret[0]='/'+ret[0] + return ret + return path.split('/') +re_sp=re.compile('[/\\\\]') +def split_path_win32(path): + if path.startswith('\\\\'): + ret=re.split(re_sp,path)[2:] + ret[0]='\\'+ret[0] + return ret + return re.split(re_sp,path) +if sys.platform=='cygwin': + split_path=split_path_cygwin +elif Utils.is_win32: + split_path=split_path_win32 +class Node(object): + __slots__=('name','sig','children','parent','cache_abspath','cache_isdir') + def __init__(self,name,parent): + self.name=name + self.parent=parent + if parent: + if name in parent.children: + raise Errors.WafError('node %s exists in the parent files %r already'%(name,parent)) + parent.children[name]=self + def __setstate__(self,data): + self.name=data[0] + self.parent=data[1] + if data[2]is not None: + self.children=data[2] + if data[3]is not None: + self.sig=data[3] + def __getstate__(self): + return(self.name,self.parent,getattr(self,'children',None),getattr(self,'sig',None)) + def __str__(self): + return self.name + def __repr__(self): + return self.abspath() + def __hash__(self): + return id(self) + def __eq__(self,node): + return id(self)==id(node) + def __copy__(self): + raise Errors.WafError('nodes are not supposed to be copied') + def read(self,flags='r'): + return Utils.readf(self.abspath(),flags) + def write(self,data,flags='w'): + f=None + try: + f=open(self.abspath(),flags) + f.write(data) + finally: + if f: + f.close() + def chmod(self,val): + os.chmod(self.abspath(),val) + def delete(self): + try: + if getattr(self,'children',None): + shutil.rmtree(self.abspath()) + else: + os.unlink(self.abspath()) + except: + pass + try: + delattr(self,'children') + except: + pass + def suffix(self): + k=max(0,self.name.rfind('.')) + return self.name[k:] + def height(self): + d=self + val=-1 + while d: + d=d.parent + val+=1 + return val + def listdir(self): + lst=Utils.listdir(self.abspath()) + lst.sort() + return lst + def mkdir(self): + if getattr(self,'cache_isdir',None): + return + try: + self.parent.mkdir() + except: + pass + if self.name: + try: + os.makedirs(self.abspath()) + except OSError: + pass + if not os.path.isdir(self.abspath()): + raise Errors.WafError('Could not create the directory %s'%self.abspath()) + try: + self.children + except: + self.children={} + self.cache_isdir=True + def find_node(self,lst): + if isinstance(lst,str): + lst=[x for x in split_path(lst)if x and x!='.'] + cur=self + for x in lst: + if x=='..': + cur=cur.parent or cur + continue + try: + if x in cur.children: + cur=cur.children[x] + continue + except: + cur.children={} + cur=self.__class__(x,cur) + try: + os.stat(cur.abspath()) + except: + del cur.parent.children[x] + return None + ret=cur + try: + os.stat(ret.abspath()) + except: + del ret.parent.children[ret.name] + return None + try: + while not getattr(cur.parent,'cache_isdir',None): + cur=cur.parent + cur.cache_isdir=True + except AttributeError: + pass + return ret + def make_node(self,lst): + if isinstance(lst,str): + lst=[x for x in split_path(lst)if x and x!='.'] + cur=self + for x in lst: + if x=='..': + cur=cur.parent or cur + continue + if getattr(cur,'children',{}): + if x in cur.children: + cur=cur.children[x] + continue + else: + cur.children={} + cur=self.__class__(x,cur) + return cur + def search(self,lst): + if isinstance(lst,str): + lst=[x for x in split_path(lst)if x and x!='.'] + cur=self + try: + for x in lst: + if x=='..': + cur=cur.parent or cur + else: + cur=cur.children[x] + return cur + except: + pass + def path_from(self,node): + c1=self + c2=node + c1h=c1.height() + c2h=c2.height() + lst=[] + up=0 + while c1h>c2h: + lst.append(c1.name) + c1=c1.parent + c1h-=1 + while c2h>c1h: + up+=1 + c2=c2.parent + c2h-=1 + while id(c1)!=id(c2): + lst.append(c1.name) + up+=1 + c1=c1.parent + c2=c2.parent + for i in range(up): + lst.append('..') + lst.reverse() + return os.sep.join(lst)or'.' + def abspath(self): + try: + return self.cache_abspath + except: + pass + if os.sep=='/': + if not self.parent: + val=os.sep + elif not self.parent.name: + val=os.sep+self.name + else: + val=self.parent.abspath()+os.sep+self.name + else: + if not self.parent: + val='' + elif not self.parent.name: + val=self.name+os.sep + else: + val=self.parent.abspath().rstrip(os.sep)+os.sep+self.name + self.cache_abspath=val + return val + def is_child_of(self,node): + p=self + diff=self.height()-node.height() + while diff>0: + diff-=1 + p=p.parent + return id(p)==id(node) + def ant_iter(self,accept=None,maxdepth=25,pats=[],dir=False,src=True,remove=True): + dircont=self.listdir() + dircont.sort() + try: + lst=set(self.children.keys()) + if remove: + for x in lst-set(dircont): + del self.children[x] + except: + self.children={} + for name in dircont: + npats=accept(name,pats) + if npats and npats[0]: + accepted=[]in npats[0] + node=self.make_node([name]) + isdir=os.path.isdir(node.abspath()) + if accepted: + if isdir: + if dir: + yield node + else: + if src: + yield node + if getattr(node,'cache_isdir',None)or isdir: + node.cache_isdir=True + if maxdepth: + for k in node.ant_iter(accept=accept,maxdepth=maxdepth-1,pats=npats,dir=dir,src=src,remove=remove): + yield k + raise StopIteration + def ant_glob(self,*k,**kw): + src=kw.get('src',True) + dir=kw.get('dir',False) + excl=kw.get('excl',exclude_regs) + incl=k and k[0]or kw.get('incl','**') + def to_pat(s): + lst=Utils.to_list(s) + ret=[] + for x in lst: + x=x.replace('\\','/').replace('//','/') + if x.endswith('/'): + x+='**' + lst2=x.split('/') + accu=[] + for k in lst2: + if k=='**': + accu.append(k) + else: + k=k.replace('.','[.]').replace('*','.*').replace('?','.').replace('+','\\+') + k='^%s$'%k + try: + accu.append(re.compile(k)) + except Exception ,e: + raise Errors.WafError("Invalid pattern: %s"%k,e) + ret.append(accu) + return ret + def filtre(name,nn): + ret=[] + for lst in nn: + if not lst: + pass + elif lst[0]=='**': + ret.append(lst) + if len(lst)>1: + if lst[1].match(name): + ret.append(lst[2:]) + else: + ret.append([]) + elif lst[0].match(name): + ret.append(lst[1:]) + return ret + def accept(name,pats): + nacc=filtre(name,pats[0]) + nrej=filtre(name,pats[1]) + if[]in nrej: + nacc=[] + return[nacc,nrej] + ret=[x for x in self.ant_iter(accept=accept,pats=[to_pat(incl),to_pat(excl)],maxdepth=25,dir=dir,src=src,remove=kw.get('remove',True))] + if kw.get('flat',False): + return' '.join([x.path_from(self)for x in ret]) + return ret + def find_nodes(self,find_dirs=True,find_files=True,match_fun=lambda x:True): + x=""" + Recursively finds nodes:: + + def configure(cnf): + cnf.find_nodes() + + :param find_dirs: whether to return directories + :param find_files: whether to return files + :param match_fun: matching function, taking a node as parameter + :rtype generator + :return: a generator that iterates over all the requested files + """ + files=self.listdir() + for f in files: + node=self.make_node([f]) + if os.path.isdir(node.abspath()): + if find_dirs and match_fun(node): + yield node + gen=node.find_nodes(find_dirs,find_files,match_fun) + for g in gen: + yield g + else: + if find_files and match_fun(node): + yield node + def is_src(self): + cur=self + x=id(self.ctx.srcnode) + y=id(self.ctx.bldnode) + while cur.parent: + if id(cur)==y: + return False + if id(cur)==x: + return True + cur=cur.parent + return False + def is_bld(self): + cur=self + y=id(self.ctx.bldnode) + while cur.parent: + if id(cur)==y: + return True + cur=cur.parent + return False + def get_src(self): + cur=self + x=id(self.ctx.srcnode) + y=id(self.ctx.bldnode) + lst=[] + while cur.parent: + if id(cur)==y: + lst.reverse() + return self.ctx.srcnode.make_node(lst) + if id(cur)==x: + return self + lst.append(cur.name) + cur=cur.parent + return self + def get_bld(self): + cur=self + x=id(self.ctx.srcnode) + y=id(self.ctx.bldnode) + lst=[] + while cur.parent: + if id(cur)==y: + return self + if id(cur)==x: + lst.reverse() + return self.ctx.bldnode.make_node(lst) + lst.append(cur.name) + cur=cur.parent + lst.reverse() + if lst and Utils.is_win32 and len(lst[0])==2 and lst[0].endswith(':'): + lst[0]=lst[0][0] + return self.ctx.bldnode.make_node(['__root__']+lst) + def find_resource(self,lst): + if isinstance(lst,str): + lst=[x for x in split_path(lst)if x and x!='.'] + node=self.get_bld().search(lst) + if not node: + self=self.get_src() + node=self.find_node(lst) + try: + pat=node.abspath() + if os.path.isdir(pat): + return None + except: + pass + return node + def find_or_declare(self,lst): + if isinstance(lst,str): + lst=[x for x in split_path(lst)if x and x!='.'] + node=self.get_bld().search(lst) + if node: + if not os.path.isfile(node.abspath()): + node.sig=None + try: + node.parent.mkdir() + except: + pass + return node + self=self.get_src() + node=self.find_node(lst) + if node: + if not os.path.isfile(node.abspath()): + node.sig=None + try: + node.parent.mkdir() + except: + pass + return node + node=self.get_bld().make_node(lst) + node.parent.mkdir() + return node + def find_dir(self,lst): + if isinstance(lst,str): + lst=[x for x in split_path(lst)if x and x!='.'] + node=self.find_node(lst) + try: + if not os.path.isdir(node.abspath()): + return None + except(OSError,AttributeError): + return None + return node + def change_ext(self,ext,ext_in=None): + name=self.name + if ext_in is None: + k=name.rfind('.') + if k>=0: + name=name[:k]+ext + else: + name=name+ext + else: + name=name[:-len(ext_in)]+ext + return self.parent.find_or_declare([name]) + def nice_path(self,env=None): + return self.path_from(self.ctx.launch_node()) + def bldpath(self): + return self.path_from(self.ctx.bldnode) + def srcpath(self): + return self.path_from(self.ctx.srcnode) + def relpath(self): + cur=self + x=id(self.ctx.bldnode) + while cur.parent: + if id(cur)==x: + return self.bldpath() + cur=cur.parent + return self.srcpath() + def bld_dir(self): + return self.parent.bldpath() + def bld_base(self): + s=os.path.splitext(self.name)[0] + return self.bld_dir()+os.sep+s + def get_bld_sig(self): + try: + ret=self.ctx.hash_cache[id(self)] + except KeyError: + pass + except AttributeError: + self.ctx.hash_cache={} + else: + return ret + if not self.is_bld()or self.ctx.bldnode is self.ctx.srcnode: + self.sig=Utils.h_file(self.abspath()) + self.ctx.hash_cache[id(self)]=ret=self.sig + return ret +pickle_lock=Utils.threading.Lock() +class Nod3(Node): + pass diff --git a/waflib/Options.py b/waflib/Options.py new file mode 100644 index 0000000..2149b1b --- /dev/null +++ b/waflib/Options.py @@ -0,0 +1,134 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os,tempfile,optparse,sys,re +from waflib import Logs,Utils,Context +cmds='distclean configure build install clean uninstall check dist distcheck'.split() +options={} +commands=[] +lockfile=os.environ.get('WAFLOCK','.lock-waf_%s_build'%sys.platform) +try:cache_global=os.path.abspath(os.environ['WAFCACHE']) +except KeyError:cache_global='' +platform=Utils.unversioned_sys_platform() +class opt_parser(optparse.OptionParser): + def __init__(self,ctx): + optparse.OptionParser.__init__(self,conflict_handler="resolve",version='waf %s (%s)'%(Context.WAFVERSION,Context.WAFREVISION)) + self.formatter.width=Logs.get_term_cols() + p=self.add_option + self.ctx=ctx + jobs=ctx.jobs() + p('-j','--jobs',dest='jobs',default=jobs,type='int',help='amount of parallel jobs (%r)'%jobs) + p('-k','--keep',dest='keep',default=0,action='count',help='keep running happily even if errors are found') + p('-v','--verbose',dest='verbose',default=0,action='count',help='verbosity level -v -vv or -vvv [default: 0]') + p('--nocache',dest='nocache',default=False,action='store_true',help='ignore the WAFCACHE (if set)') + p('--zones',dest='zones',default='',action='store',help='debugging zones (task_gen, deps, tasks, etc)') + gr=optparse.OptionGroup(self,'configure options') + self.add_option_group(gr) + gr.add_option('-o','--out',action='store',default='',help='build dir for the project',dest='out') + gr.add_option('-t','--top',action='store',default='',help='src dir for the project',dest='top') + default_prefix=os.environ.get('PREFIX') + if not default_prefix: + if platform=='win32': + d=tempfile.gettempdir() + default_prefix=d[0].upper()+d[1:] + else: + default_prefix='/usr/local/' + gr.add_option('--prefix',dest='prefix',default=default_prefix,help='installation prefix [default: %r]'%default_prefix) + gr.add_option('--download',dest='download',default=False,action='store_true',help='try to download the tools if missing') + gr=optparse.OptionGroup(self,'build and install options') + self.add_option_group(gr) + gr.add_option('-p','--progress',dest='progress_bar',default=0,action='count',help='-p: progress bar; -pp: ide output') + gr.add_option('--targets',dest='targets',default='',action='store',help='task generators, e.g. "target1,target2"') + gr=optparse.OptionGroup(self,'step options') + self.add_option_group(gr) + gr.add_option('--files',dest='files',default='',action='store',help='files to process, by regexp, e.g. "*/main.c,*/test/main.o"') + default_destdir=os.environ.get('DESTDIR','') + gr=optparse.OptionGroup(self,'install/uninstall options') + self.add_option_group(gr) + gr.add_option('--destdir',help='installation root [default: %r]'%default_destdir,default=default_destdir,dest='destdir') + gr.add_option('-f','--force',dest='force',default=False,action='store_true',help='force file installation') + def get_usage(self): + cmds_str={} + for cls in Context.classes: + if not cls.cmd or cls.cmd=='options': + continue + s=cls.__doc__ or'' + cmds_str[cls.cmd]=s + if Context.g_module: + for(k,v)in Context.g_module.__dict__.items(): + if k in['options','init','shutdown']: + continue + if type(v)is type(Context.create_context): + if v.__doc__ and not k.startswith('_'): + cmds_str[k]=v.__doc__ + just=0 + for k in cmds_str: + just=max(just,len(k)) + lst=[' %s: %s'%(k.ljust(just),v)for(k,v)in cmds_str.items()] + lst.sort() + ret='\n'.join(lst) + return'''waf [commands] [options] + +Main commands (example: ./waf build -j4) +%s +'''%ret +class OptionsContext(Context.Context): + cmd='options' + fun='options' + def __init__(self,**kw): + super(OptionsContext,self).__init__(**kw) + self.parser=opt_parser(self) + self.option_groups={} + def jobs(self): + count=int(os.environ.get('JOBS',0)) + if count<1: + if'NUMBER_OF_PROCESSORS'in os.environ: + count=int(os.environ.get('NUMBER_OF_PROCESSORS',1)) + else: + if hasattr(os,'sysconf_names'): + if'SC_NPROCESSORS_ONLN'in os.sysconf_names: + count=int(os.sysconf('SC_NPROCESSORS_ONLN')) + elif'SC_NPROCESSORS_CONF'in os.sysconf_names: + count=int(os.sysconf('SC_NPROCESSORS_CONF')) + if not count and os.name not in('nt','java'): + try: + tmp=self.cmd_and_log(['sysctl','-n','hw.ncpu'],quiet=0) + except Exception: + pass + else: + if re.match('^[0-9]+$',tmp): + count=int(tmp) + if count<1: + count=1 + elif count>1024: + count=1024 + return count + def add_option(self,*k,**kw): + self.parser.add_option(*k,**kw) + def add_option_group(self,*k,**kw): + try: + gr=self.option_groups[k[0]] + except: + gr=self.parser.add_option_group(*k,**kw) + self.option_groups[k[0]]=gr + return gr + def get_option_group(self,opt_str): + try: + return self.option_groups[opt_str] + except KeyError: + for group in self.parser.option_groups: + if group.title==opt_str: + return group + return None + def parse_args(self,_args=None): + global options,commands + (options,leftover_args)=self.parser.parse_args(args=_args) + commands=leftover_args + if options.destdir: + options.destdir=os.path.abspath(os.path.expanduser(options.destdir)) + if options.verbose>=1: + self.load('errcheck') + def execute(self): + super(OptionsContext,self).execute() + self.parse_args() diff --git a/waflib/Runner.py b/waflib/Runner.py new file mode 100644 index 0000000..6f64fed --- /dev/null +++ b/waflib/Runner.py @@ -0,0 +1,197 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import random,atexit +try: + from queue import Queue +except: + from Queue import Queue +from waflib import Utils,Task,Errors,Logs +GAP=10 +class TaskConsumer(Utils.threading.Thread): + def __init__(self): + Utils.threading.Thread.__init__(self) + self.ready=Queue() + self.setDaemon(1) + self.start() + def run(self): + try: + self.loop() + except: + pass + def loop(self): + while 1: + tsk=self.ready.get() + if not isinstance(tsk,Task.TaskBase): + tsk(self) + else: + tsk.process() +pool=Queue() +def get_pool(): + try: + return pool.get(False) + except: + return TaskConsumer() +def put_pool(x): + pool.put(x) +def _free_resources(): + global pool + lst=[] + while pool.qsize(): + lst.append(pool.get()) + for x in lst: + x.ready.put(None) + for x in lst: + x.join() + pool=None +atexit.register(_free_resources) +class Parallel(object): + def __init__(self,bld,j=2): + self.numjobs=j + self.bld=bld + self.outstanding=[] + self.frozen=[] + self.out=Queue(0) + self.count=0 + self.processed=1 + self.stop=False + self.error=[] + self.biter=None + self.dirty=False + def get_next_task(self): + if not self.outstanding: + return None + return self.outstanding.pop(0) + def postpone(self,tsk): + if random.randint(0,1): + self.frozen.insert(0,tsk) + else: + self.frozen.append(tsk) + def refill_task_list(self): + while self.count>self.numjobs*GAP: + self.get_out() + while not self.outstanding: + if self.count: + self.get_out() + elif self.frozen: + try: + cond=self.deadlock==self.processed + except: + pass + else: + if cond: + msg='check the build order for the tasks' + for tsk in self.frozen: + if not tsk.run_after: + msg='check the methods runnable_status' + break + lst=[] + for tsk in self.frozen: + lst.append('%s\t-> %r'%(repr(tsk),[id(x)for x in tsk.run_after])) + raise Errors.WafError('Deadlock detected: %s%s'%(msg,''.join(lst))) + self.deadlock=self.processed + if self.frozen: + self.outstanding+=self.frozen + self.frozen=[] + elif not self.count: + self.outstanding.extend(self.biter.next()) + self.total=self.bld.total() + break + def add_more_tasks(self,tsk): + if getattr(tsk,'more_tasks',None): + self.outstanding+=tsk.more_tasks + self.total+=len(tsk.more_tasks) + def get_out(self): + tsk=self.out.get() + if not self.stop: + self.add_more_tasks(tsk) + self.count-=1 + self.dirty=True + return tsk + def error_handler(self,tsk): + if not self.bld.keep: + self.stop=True + self.error.append(tsk) + def add_task(self,tsk): + try: + self.pool + except AttributeError: + self.init_task_pool() + self.ready.put(tsk) + def init_task_pool(self): + pool=self.pool=[get_pool()for i in range(self.numjobs)] + self.ready=Queue(0) + def setq(consumer): + consumer.ready=self.ready + for x in pool: + x.ready.put(setq) + return pool + def free_task_pool(self): + def setq(consumer): + consumer.ready=Queue(0) + self.out.put(self) + try: + pool=self.pool + except: + pass + else: + for x in pool: + self.ready.put(setq) + for x in pool: + self.get_out() + for x in pool: + put_pool(x) + self.pool=[] + def start(self): + self.total=self.bld.total() + while not self.stop: + self.refill_task_list() + tsk=self.get_next_task() + if not tsk: + if self.count: + continue + else: + break + if tsk.hasrun: + self.processed+=1 + continue + if self.stop: + break + try: + st=tsk.runnable_status() + except Exception: + self.processed+=1 + tsk.err_msg=Utils.ex_stack() + if not self.stop and self.bld.keep: + tsk.hasrun=Task.SKIPPED + if self.bld.keep==1: + if Logs.verbose>1 or not self.error: + self.error.append(tsk) + self.stop=True + else: + if Logs.verbose>1: + self.error.append(tsk) + continue + tsk.hasrun=Task.EXCEPTION + self.error_handler(tsk) + continue + if st==Task.ASK_LATER: + self.postpone(tsk) + elif st==Task.SKIP_ME: + self.processed+=1 + tsk.hasrun=Task.SKIPPED + self.add_more_tasks(tsk) + else: + tsk.position=(self.processed,self.total) + self.count+=1 + tsk.master=self + self.processed+=1 + if self.numjobs==1: + tsk.process() + else: + self.add_task(tsk) + while self.error and self.count: + self.get_out() + assert(self.count==0 or self.stop) + self.free_task_pool() diff --git a/waflib/Scripting.py b/waflib/Scripting.py new file mode 100644 index 0000000..9a5d2e9 --- /dev/null +++ b/waflib/Scripting.py @@ -0,0 +1,367 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os,shutil,traceback,errno,sys,stat +from waflib import Utils,Configure,Logs,Options,ConfigSet,Context,Errors,Build,Node +build_dir_override=None +no_climb_commands=['configure'] +default_cmd="build" +def waf_entry_point(current_directory,version,wafdir): + Logs.init_log() + if Context.WAFVERSION!=version: + Logs.error('Waf script %r and library %r do not match (directory %r)'%(version,Context.WAFVERSION,wafdir)) + sys.exit(1) + if'--version'in sys.argv: + Context.run_dir=current_directory + ctx=Context.create_context('options') + ctx.curdir=current_directory + ctx.parse_args() + sys.exit(0) + Context.waf_dir=wafdir + Context.launch_dir=current_directory + no_climb=os.environ.get('NOCLIMB',None) + if not no_climb: + for k in no_climb_commands: + if k in sys.argv: + no_climb=True + break + cur=current_directory + while cur: + lst=os.listdir(cur) + if Options.lockfile in lst: + env=ConfigSet.ConfigSet() + try: + env.load(os.path.join(cur,Options.lockfile)) + ino=os.stat(cur)[stat.ST_INO] + except Exception: + pass + else: + for x in[env.run_dir,env.top_dir,env.out_dir]: + if Utils.is_win32: + if cur==x: + load=True + break + else: + try: + ino2=os.stat(x)[stat.ST_INO] + except: + pass + else: + if ino==ino2: + load=True + break + else: + Logs.warn('invalid lock file in %s'%cur) + load=False + if load: + Context.run_dir=env.run_dir + Context.top_dir=env.top_dir + Context.out_dir=env.out_dir + break + if not Context.run_dir: + if Context.WSCRIPT_FILE in lst: + Context.run_dir=cur + next=os.path.dirname(cur) + if next==cur: + break + cur=next + if no_climb: + break + if not Context.run_dir: + if'-h'in sys.argv or'--help'in sys.argv: + Logs.warn('No wscript file found: the help message may be incomplete') + Context.run_dir=current_directory + ctx=Context.create_context('options') + ctx.curdir=current_directory + ctx.parse_args() + sys.exit(0) + Logs.error('Waf: Run from a directory containing a file named %r'%Context.WSCRIPT_FILE) + sys.exit(1) + try: + os.chdir(Context.run_dir) + except OSError: + Logs.error('Waf: The folder %r is unreadable'%Context.run_dir) + sys.exit(1) + try: + set_main_module(Context.run_dir+os.sep+Context.WSCRIPT_FILE) + except Errors.WafError ,e: + Logs.pprint('RED',e.verbose_msg) + Logs.error(str(e)) + sys.exit(1) + except Exception ,e: + Logs.error('Waf: The wscript in %r is unreadable'%Context.run_dir,e) + traceback.print_exc(file=sys.stdout) + sys.exit(2) + try: + run_commands() + except Errors.WafError ,e: + if Logs.verbose>1: + Logs.pprint('RED',e.verbose_msg) + Logs.error(e.msg) + sys.exit(1) + except Exception ,e: + traceback.print_exc(file=sys.stdout) + sys.exit(2) + except KeyboardInterrupt: + Logs.pprint('RED','Interrupted') + sys.exit(68) +def set_main_module(file_path): + Context.g_module=Context.load_module(file_path) + Context.g_module.root_path=file_path + def set_def(obj): + name=obj.__name__ + if not name in Context.g_module.__dict__: + setattr(Context.g_module,name,obj) + for k in[update,dist,distclean,distcheck,update]: + set_def(k) + if not'init'in Context.g_module.__dict__: + Context.g_module.init=Utils.nada + if not'shutdown'in Context.g_module.__dict__: + Context.g_module.shutdown=Utils.nada + if not'options'in Context.g_module.__dict__: + Context.g_module.options=Utils.nada +def parse_options(): + Context.create_context('options').execute() + if not Options.commands: + Options.commands=[default_cmd] + Options.commands=[x for x in Options.commands if x!='options'] + Logs.verbose=Options.options.verbose + Logs.init_log() + if Options.options.zones: + Logs.zones=Options.options.zones.split(',') + if not Logs.verbose: + Logs.verbose=1 + elif Logs.verbose>0: + Logs.zones=['runner'] + if Logs.verbose>2: + Logs.zones=['*'] +def run_command(cmd_name): + ctx=Context.create_context(cmd_name) + ctx.options=Options.options + ctx.cmd=cmd_name + ctx.execute() + return ctx +def run_commands(): + parse_options() + run_command('init') + while Options.commands: + cmd_name=Options.commands.pop(0) + timer=Utils.Timer() + run_command(cmd_name) + if not Options.options.progress_bar: + elapsed=' (%s)'%str(timer) + Logs.info('%r finished successfully%s'%(cmd_name,elapsed)) + run_command('shutdown') +def _can_distclean(name): + for k in'.o .moc .exe'.split(): + if name.endswith(k): + return True + return False +def distclean_dir(dirname): + for(root,dirs,files)in os.walk(dirname): + for f in files: + if _can_distclean(f): + fname=root+os.sep+f + try: + os.unlink(fname) + except: + Logs.warn('could not remove %r'%fname) + for x in[Context.DBFILE,'config.log']: + try: + os.unlink(x) + except: + pass + try: + shutil.rmtree('c4che') + except: + pass +def distclean(ctx): + '''removes the build directory''' + lst=os.listdir('.') + for f in lst: + if f==Options.lockfile: + try: + proj=ConfigSet.ConfigSet(f) + except: + Logs.warn('could not read %r'%f) + continue + if proj['out_dir']!=proj['top_dir']: + try: + shutil.rmtree(proj['out_dir']) + except IOError: + pass + except OSError ,e: + if e.errno!=errno.ENOENT: + Logs.warn('project %r cannot be removed'%proj[Context.OUT]) + else: + distclean_dir(proj['out_dir']) + for k in(proj['out_dir'],proj['top_dir'],proj['run_dir']): + try: + os.remove(os.path.join(k,Options.lockfile)) + except OSError ,e: + if e.errno!=errno.ENOENT: + Logs.warn('file %r cannot be removed'%f) + if f.startswith('.waf')and not Options.commands: + shutil.rmtree(f,ignore_errors=True) +class Dist(Context.Context): + cmd='dist' + fun='dist' + algo='tar.bz2' + ext_algo={} + def execute(self): + self.recurse([os.path.dirname(Context.g_module.root_path)]) + self.archive() + def archive(self): + import tarfile + arch_name=self.get_arch_name() + try: + self.base_path + except: + self.base_path=self.path + node=self.base_path.make_node(arch_name) + try: + node.delete() + except: + pass + files=self.get_files() + if self.algo.startswith('tar.'): + tar=tarfile.open(arch_name,'w:'+self.algo.replace('tar.','')) + for x in files: + self.add_tar_file(x,tar) + tar.close() + elif self.algo=='zip': + import zipfile + zip=zipfile.ZipFile(arch_name,'w',compression=zipfile.ZIP_DEFLATED) + for x in files: + archive_name=self.get_base_name()+'/'+x.path_from(self.base_path) + zip.write(x.abspath(),archive_name,zipfile.ZIP_DEFLATED) + zip.close() + else: + self.fatal('Valid algo types are tar.bz2, tar.gz or zip') + try: + from hashlib import sha1 as sha + except ImportError: + from sha import sha + try: + digest=" (sha=%r)"%sha(node.read()).hexdigest() + except: + digest='' + Logs.info('New archive created: %s%s'%(self.arch_name,digest)) + def get_tar_path(self,node): + return node.abspath() + def add_tar_file(self,x,tar): + p=self.get_tar_path(x) + tinfo=tar.gettarinfo(name=p,arcname=self.get_tar_prefix()+'/'+x.path_from(self.base_path)) + tinfo.uid=0 + tinfo.gid=0 + tinfo.uname='root' + tinfo.gname='root' + fu=None + try: + fu=open(p,'rb') + tar.addfile(tinfo,fileobj=fu) + finally: + if fu: + fu.close() + def get_tar_prefix(self): + try: + return self.tar_prefix + except: + return self.get_base_name() + def get_arch_name(self): + try: + self.arch_name + except: + self.arch_name=self.get_base_name()+'.'+self.ext_algo.get(self.algo,self.algo) + return self.arch_name + def get_base_name(self): + try: + self.base_name + except: + appname=getattr(Context.g_module,Context.APPNAME,'noname') + version=getattr(Context.g_module,Context.VERSION,'1.0') + self.base_name=appname+'-'+version + return self.base_name + def get_excl(self): + try: + return self.excl + except: + self.excl=Node.exclude_regs+' **/waf-1.6.* **/.waf-1.6* **/waf3-1.6.* **/.waf3-1.6* **/*~ **/*.rej **/*.orig **/*.pyc **/*.pyo **/*.bak **/*.swp **/.lock-w*' + nd=self.root.find_node(Context.out_dir) + if nd: + self.excl+=' '+nd.path_from(self.base_path) + return self.excl + def get_files(self): + try: + files=self.files + except: + files=self.base_path.ant_glob('**/*',excl=self.get_excl()) + return files +def dist(ctx): + '''makes a tarball for redistributing the sources''' + pass +class DistCheck(Dist): + fun='distcheck' + cmd='distcheck' + def execute(self): + self.recurse([os.path.dirname(Context.g_module.root_path)]) + self.archive() + self.check() + def check(self): + import tempfile,tarfile + t=None + try: + t=tarfile.open(self.get_arch_name()) + for x in t: + t.extract(x) + finally: + if t: + t.close() + instdir=tempfile.mkdtemp('.inst',self.get_base_name()) + ret=Utils.subprocess.Popen([sys.argv[0],'configure','install','uninstall','--destdir='+instdir],cwd=self.get_base_name()).wait() + if ret: + raise Errors.WafError('distcheck failed with code %i'%ret) + if os.path.exists(instdir): + raise Errors.WafError('distcheck succeeded, but files were left in %s'%instdir) + shutil.rmtree(self.get_base_name()) +def distcheck(ctx): + '''checks if the project compiles (tarball from 'dist')''' + pass +def update(ctx): + '''updates the plugins from the *waflib/extras* directory''' + lst=Options.options.files.split(',') + if not lst: + lst=[x for x in Utils.listdir(Context.waf_dir+'/waflib/extras')if x.endswith('.py')] + for x in lst: + tool=x.replace('.py','') + try: + Configure.download_tool(tool,force=True,ctx=ctx) + except Errors.WafError: + Logs.error('Could not find the tool %s in the remote repository'%x) +def autoconfigure(execute_method): + def execute(self): + if not Configure.autoconfig: + return execute_method(self) + env=ConfigSet.ConfigSet() + do_config=False + try: + env.load(os.path.join(Context.top_dir,Options.lockfile)) + except Exception: + Logs.warn('Configuring the project') + do_config=True + else: + if env.run_dir!=Context.run_dir: + do_config=True + else: + h=0 + for f in env['files']: + h=hash((h,Utils.readf(f,'rb'))) + do_config=h!=env.hash + if do_config: + Options.commands.insert(0,self.cmd) + Options.commands.insert(0,'configure') + return + return execute_method(self) + return execute +Build.BuildContext.execute=autoconfigure(Build.BuildContext.execute) diff --git a/waflib/Task.py b/waflib/Task.py new file mode 100644 index 0000000..1678a10 --- /dev/null +++ b/waflib/Task.py @@ -0,0 +1,672 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import sys +if sys.hexversion < 0x020400f0: from sets import Set as set +import os,shutil,re,tempfile +from waflib import Utils,Logs,Errors +NOT_RUN=0 +MISSING=1 +CRASHED=2 +EXCEPTION=3 +SKIPPED=8 +SUCCESS=9 +ASK_LATER=-1 +SKIP_ME=-2 +RUN_ME=-3 +COMPILE_TEMPLATE_SHELL=''' +def f(tsk): + env = tsk.env + gen = tsk.generator + bld = gen.bld + wd = getattr(tsk, 'cwd', None) + p = env.get_flat + tsk.last_cmd = cmd = \'\'\' %s \'\'\' % s + return tsk.exec_command(cmd, cwd=wd, env=env.env or None) +''' +COMPILE_TEMPLATE_NOSHELL=''' +def f(tsk): + env = tsk.env + gen = tsk.generator + bld = gen.bld + wd = getattr(tsk, 'cwd', None) + def to_list(xx): + if isinstance(xx, str): return [xx] + return xx + tsk.last_cmd = lst = [] + %s + lst = [x for x in lst if x] + return tsk.exec_command(lst, cwd=wd, env=env.env or None) +''' +def cache_outputs(cls): + m1=cls.run + def run(self): + bld=self.generator.bld + if bld.cache_global and not bld.nocache: + if self.can_retrieve_cache(): + return 0 + return m1(self) + cls.run=run + m2=cls.post_run + def post_run(self): + bld=self.generator.bld + ret=m2(self) + if bld.cache_global and not bld.nocache: + self.put_files_cache() + return ret + cls.post_run=post_run + return cls +classes={} +class store_task_type(type): + def __init__(cls,name,bases,dict): + super(store_task_type,cls).__init__(name,bases,dict) + name=cls.__name__ + if name.endswith('_task'): + name=name.replace('_task','') + if name!='evil'and name!='TaskBase': + global classes + if getattr(cls,'run_str',None): + (f,dvars)=compile_fun(cls.run_str,cls.shell) + cls.hcode=cls.run_str + cls.run_str=None + cls.run=f + cls.vars=list(set(cls.vars+dvars)) + cls.vars.sort() + elif getattr(cls,'run',None)and not'hcode'in cls.__dict__: + cls.hcode=Utils.h_fun(cls.run) + if not getattr(cls,'nocache',None): + cls=cache_outputs(cls) + classes[name]=cls +evil=store_task_type('evil',(object,),{}) +class TaskBase(evil): + color='GREEN' + ext_in=[] + ext_out=[] + before=[] + after=[] + hcode='' + def __init__(self,*k,**kw): + self.hasrun=NOT_RUN + try: + self.generator=kw['generator'] + except KeyError: + self.generator=self + def __repr__(self): + return'\n\t{task %r: %s %s}'%(self.__class__.__name__,id(self),str(getattr(self,'fun',''))) + def __str__(self): + if hasattr(self,'fun'): + return'executing: %s\n'%self.fun.__name__ + return self.__class__.__name__+'\n' + def __hash__(self): + return id(self) + def exec_command(self,cmd,**kw): + bld=self.generator.bld + try: + if not kw.get('cwd',None): + kw['cwd']=bld.cwd + except AttributeError: + bld.cwd=kw['cwd']=bld.variant_dir + return bld.exec_command(cmd,**kw) + def runnable_status(self): + return RUN_ME + def process(self): + m=self.master + if m.stop: + m.out.put(self) + return + try: + del self.generator.bld.task_sigs[self.uid()] + except: + pass + try: + self.generator.bld.returned_tasks.append(self) + self.log_display(self.generator.bld) + ret=self.run() + except Exception: + self.err_msg=Utils.ex_stack() + self.hasrun=EXCEPTION + m.error_handler(self) + m.out.put(self) + return + if ret: + self.err_code=ret + self.hasrun=CRASHED + else: + try: + self.post_run() + except Errors.WafError: + pass + except Exception: + self.err_msg=Utils.ex_stack() + self.hasrun=EXCEPTION + else: + self.hasrun=SUCCESS + if self.hasrun!=SUCCESS: + m.error_handler(self) + m.out.put(self) + def run(self): + if hasattr(self,'fun'): + return self.fun(self) + return 0 + def post_run(self): + pass + def log_display(self,bld): + bld.to_log(self.display()) + def display(self): + col1=Logs.colors(self.color) + col2=Logs.colors.NORMAL + master=self.master + def cur(): + tmp=-1 + if hasattr(master,'ready'): + tmp-=master.ready.qsize() + return master.processed+tmp + if self.generator.bld.progress_bar==1: + return self.generator.bld.progress_line(cur(),master.total,col1,col2) + if self.generator.bld.progress_bar==2: + ela=str(self.generator.bld.timer) + try: + ins=','.join([n.name for n in self.inputs]) + except AttributeError: + ins='' + try: + outs=','.join([n.name for n in self.outputs]) + except AttributeError: + outs='' + return'|Total %s|Current %s|Inputs %s|Outputs %s|Time %s|\n'%(master.total,cur(),ins,outs,ela) + s=str(self) + if not s: + return None + total=master.total + n=len(str(total)) + fs='[%%%dd/%%%dd] %%s%%s%%s'%(n,n) + return fs%(cur(),total,col1,s,col2) + def attr(self,att,default=None): + ret=getattr(self,att,self) + if ret is self:return getattr(self.__class__,att,default) + return ret + def hash_constraints(self): + cls=self.__class__ + tup=(str(cls.before),str(cls.after),str(cls.ext_in),str(cls.ext_out),cls.__name__,cls.hcode) + h=hash(tup) + return h + def format_error(self): + msg=getattr(self,'last_cmd','') + name=getattr(self.generator,'name','') + if getattr(self,"err_msg",None): + return self.err_msg + elif not self.hasrun: + return'task in %r was not executed for some reason: %r'%(name,self) + elif self.hasrun==CRASHED: + try: + return' -> task in %r failed (exit status %r): %r\n%r'%(name,self.err_code,self,msg) + except AttributeError: + return' -> task in %r failed: %r\n%r'%(name,self,msg) + elif self.hasrun==MISSING: + return' -> missing files in %r: %r\n%r'%(name,self,msg) + else: + return'invalid status for task in %r: %r'%(name,self.hasrun) + def colon(self,var1,var2): + tmp=self.env[var1] + if isinstance(var2,str): + it=self.env[var2] + else: + it=var2 + if isinstance(tmp,str): + return[tmp%x for x in it] + else: + if Logs.verbose and not tmp and it: + Logs.warn('Missing env variable %r for task %r (generator %r)'%(var1,self,self.generator)) + lst=[] + for y in it: + lst.extend(tmp) + lst.append(y) + return lst +class Task(TaskBase): + vars=[] + shell=False + def __init__(self,*k,**kw): + TaskBase.__init__(self,*k,**kw) + self.env=kw['env'] + self.inputs=[] + self.outputs=[] + self.dep_nodes=[] + self.run_after=set([]) + def __str__(self): + env=self.env + src_str=' '.join([a.nice_path(env)for a in self.inputs]) + tgt_str=' '.join([a.nice_path(env)for a in self.outputs]) + if self.outputs:sep=' -> ' + else:sep='' + return'%s: %s%s%s\n'%(self.__class__.__name__.replace('_task',''),src_str,sep,tgt_str) + def __repr__(self): + return"".join(['\n\t{task %r: '%id(self),self.__class__.__name__," ",",".join([x.name for x in self.inputs])," -> ",",".join([x.name for x in self.outputs]),'}']) + def uid(self): + try: + return self.uid_ + except AttributeError: + m=Utils.md5() + up=m.update + up(self.__class__.__name__) + for x in self.inputs+self.outputs: + up(x.abspath()) + self.uid_=m.digest() + return self.uid_ + def set_inputs(self,inp): + if isinstance(inp,list):self.inputs+=inp + else:self.inputs.append(inp) + def set_outputs(self,out): + if isinstance(out,list):self.outputs+=out + else:self.outputs.append(out) + def set_run_after(self,task): + assert isinstance(task,TaskBase) + self.run_after.add(task) + def signature(self): + try:return self.cache_sig + except AttributeError:pass + self.m=Utils.md5() + self.m.update(self.hcode) + self.sig_explicit_deps() + self.sig_vars() + if self.scan: + try: + self.sig_implicit_deps() + except Errors.TaskRescan: + return self.signature() + ret=self.cache_sig=self.m.digest() + return ret + def runnable_status(self): + for t in self.run_after: + if not t.hasrun: + return ASK_LATER + bld=self.generator.bld + try: + new_sig=self.signature() + except Errors.TaskNotReady: + return ASK_LATER + key=self.uid() + try: + prev_sig=bld.task_sigs[key] + except KeyError: + Logs.debug("task: task %r must run as it was never run before or the task code changed"%self) + return RUN_ME + for node in self.outputs: + try: + if node.sig!=new_sig: + return RUN_ME + except AttributeError: + Logs.debug("task: task %r must run as the output nodes do not exist"%self) + return RUN_ME + if new_sig!=prev_sig: + return RUN_ME + return SKIP_ME + def post_run(self): + bld=self.generator.bld + sig=self.signature() + for node in self.outputs: + try: + os.stat(node.abspath()) + except OSError: + self.hasrun=MISSING + self.err_msg='-> missing file: %r'%node.abspath() + raise Errors.WafError(self.err_msg) + node.sig=sig + bld.task_sigs[self.uid()]=self.cache_sig + def sig_explicit_deps(self): + bld=self.generator.bld + upd=self.m.update + for x in self.inputs+self.dep_nodes: + try: + upd(x.get_bld_sig()) + except(AttributeError,TypeError): + raise Errors.WafError('Missing node signature for %r (required by %r)'%(x,self)) + if bld.deps_man: + additional_deps=bld.deps_man + for x in self.inputs+self.outputs: + try: + d=additional_deps[id(x)] + except KeyError: + continue + for v in d: + if isinstance(v,bld.root.__class__): + try: + v=v.get_bld_sig() + except AttributeError: + raise Errors.WafError('Missing node signature for %r (required by %r)'%(v,self)) + elif hasattr(v,'__call__'): + v=v() + upd(v) + return self.m.digest() + def sig_vars(self): + bld=self.generator.bld + env=self.env + upd=self.m.update + act_sig=bld.hash_env_vars(env,self.__class__.vars) + upd(act_sig) + dep_vars=getattr(self,'dep_vars',None) + if dep_vars: + upd(bld.hash_env_vars(env,dep_vars)) + return self.m.digest() + scan=None + def sig_implicit_deps(self): + bld=self.generator.bld + key=self.uid() + prev=bld.task_sigs.get((key,'imp'),[]) + if prev: + try: + if prev==self.compute_sig_implicit_deps(): + return prev + except: + for x in bld.node_deps.get(self.uid(),[]): + if x.is_child_of(bld.srcnode): + try: + os.stat(x.abspath()) + except: + try: + del x.parent.children[x.name] + except: + pass + del bld.task_sigs[(key,'imp')] + raise Errors.TaskRescan('rescan') + (nodes,names)=self.scan() + if Logs.verbose: + Logs.debug('deps: scanner for %s returned %s %s'%(str(self),str(nodes),str(names))) + bld.node_deps[key]=nodes + bld.raw_deps[key]=names + self.are_implicit_nodes_ready() + try: + bld.task_sigs[(key,'imp')]=sig=self.compute_sig_implicit_deps() + except: + if Logs.verbose: + for k in bld.node_deps.get(self.uid(),[]): + try: + k.get_bld_sig() + except: + Logs.warn('Missing signature for node %r (may cause rebuilds)'%k) + else: + return sig + def compute_sig_implicit_deps(self): + upd=self.m.update + bld=self.generator.bld + self.are_implicit_nodes_ready() + for k in bld.node_deps.get(self.uid(),[]): + upd(k.get_bld_sig()) + return self.m.digest() + def are_implicit_nodes_ready(self): + bld=self.generator.bld + try: + cache=bld.dct_implicit_nodes + except: + bld.dct_implicit_nodes=cache={} + try: + dct=cache[bld.cur] + except KeyError: + dct=cache[bld.cur]={} + for tsk in bld.cur_tasks: + for x in tsk.outputs: + dct[x]=tsk + modified=False + for x in bld.node_deps.get(self.uid(),[]): + if x in dct: + self.run_after.add(dct[x]) + modified=True + if modified: + for tsk in self.run_after: + if not tsk.hasrun: + raise Errors.TaskNotReady('not ready') + def can_retrieve_cache(self): + if not getattr(self,'outputs',None): + return None + sig=self.signature() + ssig=Utils.to_hex(self.uid())+Utils.to_hex(sig) + dname=os.path.join(self.generator.bld.cache_global,ssig) + try: + t1=os.stat(dname).st_mtime + except OSError: + return None + for node in self.outputs: + orig=os.path.join(dname,node.name) + try: + shutil.copy2(orig,node.abspath()) + os.utime(orig,None) + except(OSError,IOError): + Logs.debug('task: failed retrieving file') + return None + try: + t2=os.stat(dname).st_mtime + except OSError: + return None + if t1!=t2: + return None + for node in self.outputs: + node.sig=sig + if self.generator.bld.progress_bar<1: + self.generator.bld.to_log('restoring from cache %r\n'%node.abspath()) + self.cached=True + return True + def put_files_cache(self): + if getattr(self,'cached',None): + return None + if not getattr(self,'outputs',None): + return None + sig=self.signature() + ssig=Utils.to_hex(self.uid())+Utils.to_hex(sig) + dname=os.path.join(self.generator.bld.cache_global,ssig) + tmpdir=tempfile.mkdtemp(prefix=self.generator.bld.cache_global+os.sep+'waf') + try: + shutil.rmtree(dname) + except: + pass + try: + for node in self.outputs: + dest=os.path.join(tmpdir,node.name) + shutil.copy2(node.abspath(),dest) + except(OSError,IOError): + try: + shutil.rmtree(tmpdir) + except: + pass + else: + try: + os.rename(tmpdir,dname) + except OSError: + try: + shutil.rmtree(tmpdir) + except: + pass + else: + try: + os.chmod(dname,Utils.O755) + except: + pass +def is_before(t1,t2): + to_list=Utils.to_list + for k in to_list(t2.ext_in): + if k in to_list(t1.ext_out): + return 1 + if t1.__class__.__name__ in to_list(t2.after): + return 1 + if t2.__class__.__name__ in to_list(t1.before): + return 1 + return 0 +def set_file_constraints(tasks): + ins=Utils.defaultdict(set) + outs=Utils.defaultdict(set) + for x in tasks: + for a in getattr(x,'inputs',[])+getattr(x,'dep_nodes',[]): + ins[id(a)].add(x) + for a in getattr(x,'outputs',[]): + outs[id(a)].add(x) + links=set(ins.keys()).intersection(outs.keys()) + for k in links: + for a in ins[k]: + a.run_after.update(outs[k]) +def set_precedence_constraints(tasks): + cstr_groups=Utils.defaultdict(list) + for x in tasks: + h=x.hash_constraints() + cstr_groups[h].append(x) + keys=list(cstr_groups.keys()) + maxi=len(keys) + for i in range(maxi): + t1=cstr_groups[keys[i]][0] + for j in range(i+1,maxi): + t2=cstr_groups[keys[j]][0] + if is_before(t1,t2): + a=i + b=j + elif is_before(t2,t1): + a=j + b=i + else: + continue + for x in cstr_groups[keys[b]]: + x.run_after.update(cstr_groups[keys[a]]) +def funex(c): + dc={} + exec(c,dc) + return dc['f'] +reg_act=re.compile(r"(?P<backslash>\\)|(?P<dollar>\$\$)|(?P<subst>\$\{(?P<var>\w+)(?P<code>.*?)\})",re.M) +def compile_fun_shell(line): + extr=[] + def repl(match): + g=match.group + if g('dollar'):return"$" + elif g('backslash'):return'\\\\' + elif g('subst'):extr.append((g('var'),g('code')));return"%s" + return None + line=reg_act.sub(repl,line)or line + parm=[] + dvars=[] + app=parm.append + for(var,meth)in extr: + if var=='SRC': + if meth:app('tsk.inputs%s'%meth) + else:app('" ".join([a.path_from(bld.bldnode) for a in tsk.inputs])') + elif var=='TGT': + if meth:app('tsk.outputs%s'%meth) + else:app('" ".join([a.path_from(bld.bldnode) for a in tsk.outputs])') + elif meth: + if meth.startswith(':'): + m=meth[1:] + if m=='SRC': + m='[a.path_from(bld.bldnode) for a in tsk.inputs]' + elif m=='TGT': + m='[a.path_from(bld.bldnode) for a in tsk.outputs]' + elif m[:3]not in('tsk','gen','bld'): + dvars.extend([var,meth[1:]]) + m='%r'%m + app('" ".join(tsk.colon(%r, %s))'%(var,m)) + else: + app('%s%s'%(var,meth)) + else: + if not var in dvars:dvars.append(var) + app("p('%s')"%var) + if parm:parm="%% (%s) "%(',\n\t\t'.join(parm)) + else:parm='' + c=COMPILE_TEMPLATE_SHELL%(line,parm) + Logs.debug('action: %s'%c) + return(funex(c),dvars) +def compile_fun_noshell(line): + extr=[] + def repl(match): + g=match.group + if g('dollar'):return"$" + elif g('subst'):extr.append((g('var'),g('code')));return"<<|@|>>" + return None + line2=reg_act.sub(repl,line) + params=line2.split('<<|@|>>') + assert(extr) + buf=[] + dvars=[] + app=buf.append + for x in range(len(extr)): + params[x]=params[x].strip() + if params[x]: + app("lst.extend(%r)"%params[x].split()) + (var,meth)=extr[x] + if var=='SRC': + if meth:app('lst.append(tsk.inputs%s)'%meth) + else:app("lst.extend([a.path_from(bld.bldnode) for a in tsk.inputs])") + elif var=='TGT': + if meth:app('lst.append(tsk.outputs%s)'%meth) + else:app("lst.extend([a.path_from(bld.bldnode) for a in tsk.outputs])") + elif meth: + if meth.startswith(':'): + m=meth[1:] + if m=='SRC': + m='[a.path_from(bld.bldnode) for a in tsk.inputs]' + elif m=='TGT': + m='[a.path_from(bld.bldnode) for a in tsk.outputs]' + elif m[:3]not in('tsk','gen','bld'): + dvars.extend([var,m]) + m='%r'%m + app('lst.extend(tsk.colon(%r, %s))'%(var,m)) + else: + app('lst.extend(gen.to_list(%s%s))'%(var,meth)) + else: + app('lst.extend(to_list(env[%r]))'%var) + if not var in dvars:dvars.append(var) + if extr: + if params[-1]: + app("lst.extend(%r)"%params[-1].split()) + fun=COMPILE_TEMPLATE_NOSHELL%"\n\t".join(buf) + Logs.debug('action: %s'%fun) + return(funex(fun),dvars) +def compile_fun(line,shell=False): + if line.find('<')>0 or line.find('>')>0 or line.find('&&')>0: + shell=True + if shell: + return compile_fun_shell(line) + else: + return compile_fun_noshell(line) +def task_factory(name,func=None,vars=None,color='GREEN',ext_in=[],ext_out=[],before=[],after=[],shell=False,scan=None): + params={'vars':vars or[],'color':color,'name':name,'ext_in':Utils.to_list(ext_in),'ext_out':Utils.to_list(ext_out),'before':Utils.to_list(before),'after':Utils.to_list(after),'shell':shell,'scan':scan,} + if isinstance(func,str): + params['run_str']=func + else: + params['run']=func + cls=type(Task)(name,(Task,),params) + global classes + classes[name]=cls + return cls +def always_run(cls): + old=cls.runnable_status + def always(self): + ret=old(self) + if ret==SKIP_ME: + ret=RUN_ME + return ret + cls.runnable_status=always + return cls +def update_outputs(cls): + old_post_run=cls.post_run + def post_run(self): + old_post_run(self) + for node in self.outputs: + node.sig=Utils.h_file(node.abspath()) + self.generator.bld.task_sigs[node.abspath()]=self.uid() + cls.post_run=post_run + old_runnable_status=cls.runnable_status + def runnable_status(self): + status=old_runnable_status(self) + if status!=RUN_ME: + return status + try: + bld=self.generator.bld + prev_sig=bld.task_sigs[self.uid()] + if prev_sig==self.signature(): + for x in self.outputs: + if not x.sig or bld.task_sigs[x.abspath()]!=self.uid(): + return RUN_ME + return SKIP_ME + except KeyError: + pass + except IndexError: + pass + except AttributeError: + pass + return RUN_ME + cls.runnable_status=runnable_status + return cls diff --git a/waflib/TaskGen.py b/waflib/TaskGen.py new file mode 100644 index 0000000..8d8f26d --- /dev/null +++ b/waflib/TaskGen.py @@ -0,0 +1,353 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import sys +if sys.hexversion < 0x020400f0: from sets import Set as set +import copy,re,os +from waflib import Task,Utils,Logs,Errors,ConfigSet +feats=Utils.defaultdict(set) +class task_gen(object): + mappings={} + prec=Utils.defaultdict(list) + def __init__(self,*k,**kw): + self.source='' + self.target='' + self.meths=[] + self.prec=Utils.defaultdict(list) + self.mappings={} + self.features=[] + self.tasks=[] + if not'bld'in kw: + self.env=ConfigSet.ConfigSet() + self.idx=0 + self.path=None + else: + self.bld=kw['bld'] + self.env=self.bld.env.derive() + self.path=self.bld.path + try: + self.idx=self.bld.idx[id(self.path)]=self.bld.idx.get(id(self.path),0)+1 + except AttributeError: + self.bld.idx={} + self.idx=self.bld.idx[id(self.path)]=1 + for key,val in kw.items(): + setattr(self,key,val) + def __str__(self): + return"<task_gen %r declared in %s>"%(self.name,self.path.abspath()) + def __repr__(self): + lst=[] + for x in self.__dict__.keys(): + if x not in['env','bld','compiled_tasks','tasks']: + lst.append("%s=%s"%(x,repr(getattr(self,x)))) + return"bld(%s) in %s"%(", ".join(lst),self.path.abspath()) + def get_name(self): + try: + return self._name + except AttributeError: + if isinstance(self.target,list): + lst=[str(x)for x in self.target] + name=self._name=','.join(lst) + else: + name=self._name=str(self.target) + return name + def set_name(self,name): + self._name=name + name=property(get_name,set_name) + def to_list(self,val): + if isinstance(val,str):return val.split() + else:return val + def post(self): + if getattr(self,'posted',None): + return False + self.posted=True + keys=set(self.meths) + self.features=Utils.to_list(self.features) + for x in self.features+['*']: + st=feats[x] + if not st: + if not x in Task.classes: + Logs.warn('feature %r does not exist - bind at least one method to it'%x) + keys.update(list(st)) + prec={} + prec_tbl=self.prec or task_gen.prec + for x in prec_tbl: + if x in keys: + prec[x]=prec_tbl[x] + tmp=[] + for a in keys: + for x in prec.values(): + if a in x:break + else: + tmp.append(a) + out=[] + while tmp: + e=tmp.pop() + if e in keys:out.append(e) + try: + nlst=prec[e] + except KeyError: + pass + else: + del prec[e] + for x in nlst: + for y in prec: + if x in prec[y]: + break + else: + tmp.append(x) + if prec: + raise Errors.WafError('Cycle detected in the method execution %r'%prec) + out.reverse() + self.meths=out + Logs.debug('task_gen: posting %s %d'%(self,id(self))) + for x in out: + try: + v=getattr(self,x) + except AttributeError: + raise Errors.WafError('%r is not a valid task generator method'%x) + Logs.debug('task_gen: -> %s (%d)'%(x,id(self))) + v() + Logs.debug('task_gen: posted %s'%self.name) + return True + def get_hook(self,node): + name=node.name + for k in self.mappings: + if name.endswith(k): + return self.mappings[k] + for k in task_gen.mappings: + if name.endswith(k): + return task_gen.mappings[k] + raise Errors.WafError("File %r has no mapping in %r (did you forget to load a waf tool?)"%(node,task_gen.mappings.keys())) + def create_task(self,name,src=None,tgt=None): + task=Task.classes[name](env=self.env.derive(),generator=self) + if src: + task.set_inputs(src) + if tgt: + task.set_outputs(tgt) + self.tasks.append(task) + return task + def clone(self,env): + newobj=self.bld() + for x in self.__dict__: + if x in['env','bld']: + continue + elif x in['path','features']: + setattr(newobj,x,getattr(self,x)) + else: + setattr(newobj,x,copy.copy(getattr(self,x))) + newobj.posted=False + if isinstance(env,str): + newobj.env=self.bld.all_envs[env].derive() + else: + newobj.env=env.derive() + return newobj +def declare_chain(name='',rule=None,reentrant=None,color='BLUE',ext_in=[],ext_out=[],before=[],after=[],decider=None,scan=None,install_path=None,shell=False): + ext_in=Utils.to_list(ext_in) + ext_out=Utils.to_list(ext_out) + if not name: + name=rule + cls=Task.task_factory(name,rule,color=color,ext_in=ext_in,ext_out=ext_out,before=before,after=after,scan=scan,shell=shell) + def x_file(self,node): + ext=decider and decider(self,node)or cls.ext_out + if ext_in: + _ext_in=ext_in[0] + tsk=self.create_task(name,node) + cnt=0 + keys=self.mappings.keys()+self.__class__.mappings.keys() + for x in ext: + k=node.change_ext(x,ext_in=_ext_in) + tsk.outputs.append(k) + if reentrant!=None: + if cnt<int(reentrant): + self.source.append(k) + else: + for y in keys: + if k.name.endswith(y): + self.source.append(k) + break + cnt+=1 + if install_path: + self.bld.install_files(install_path,tsk.outputs) + return tsk + for x in cls.ext_in: + task_gen.mappings[x]=x_file + return x_file +def taskgen_method(func): + setattr(task_gen,func.__name__,func) + return func +def feature(*k): + def deco(func): + setattr(task_gen,func.__name__,func) + for name in k: + feats[name].update([func.__name__]) + return func + return deco +def before_method(*k): + def deco(func): + setattr(task_gen,func.__name__,func) + for fun_name in k: + if not func.__name__ in task_gen.prec[fun_name]: + task_gen.prec[fun_name].append(func.__name__) + return func + return deco +before=before_method +def after_method(*k): + def deco(func): + setattr(task_gen,func.__name__,func) + for fun_name in k: + if not fun_name in task_gen.prec[func.__name__]: + task_gen.prec[func.__name__].append(fun_name) + return func + return deco +after=after_method +def extension(*k): + def deco(func): + setattr(task_gen,func.__name__,func) + for x in k: + task_gen.mappings[x]=func + return func + return deco +def to_nodes(self,lst,path=None): + tmp=[] + path=path or self.path + find=path.find_resource + if isinstance(lst,self.path.__class__): + lst=[lst] + for x in Utils.to_list(lst): + if isinstance(x,str): + node=find(x) + else: + node=x + if not node: + raise Errors.WafError("source not found: %r in %r"%(x,self)) + tmp.append(node) + return tmp +def process_source(self): + self.source=self.to_nodes(getattr(self,'source',[])) + for node in self.source: + self.get_hook(node)(self,node) +def process_rule(self): + if not getattr(self,'rule',None): + return + name=str(getattr(self,'name',None)or self.target or self.rule) + cls=Task.task_factory(name,self.rule,getattr(self,'vars',[]),shell=getattr(self,'shell',True),color=getattr(self,'color','BLUE')) + tsk=self.create_task(name) + if getattr(self,'target',None): + if isinstance(self.target,str): + self.target=self.target.split() + if not isinstance(self.target,list): + self.target=[self.target] + for x in self.target: + if isinstance(x,str): + tsk.outputs.append(self.path.find_or_declare(x)) + else: + x.parent.mkdir() + tsk.outputs.append(x) + if getattr(self,'install_path',None): + self.bld.install_files(self.install_path,tsk.outputs) + if getattr(self,'source',None): + tsk.inputs=self.to_nodes(self.source) + self.source=[] + if getattr(self,'scan',None): + cls.scan=self.scan + elif getattr(self,'deps',None): + def scan(self): + nodes=[] + for x in self.generator.to_list(self.generator.deps): + node=self.generator.path.find_resource(x) + if not node: + self.generator.bld.fatal('Could not find %r (was it declared?)'%x) + nodes.append(node) + return[nodes,[]] + cls.scan=scan + if getattr(self,'cwd',None): + tsk.cwd=self.cwd + if getattr(self,'update_outputs',None)or getattr(self,'on_results',None): + Task.update_outputs(cls) + if getattr(self,'always',None): + Task.always_run(cls) + for x in['after','before','ext_in','ext_out']: + setattr(cls,x,getattr(self,x,[])) +def sequence_order(self): + if self.meths and self.meths[-1]!='sequence_order': + self.meths.append('sequence_order') + return + if getattr(self,'seq_start',None): + return + if getattr(self.bld,'prev',None): + self.bld.prev.post() + for x in self.bld.prev.tasks: + for y in self.tasks: + y.set_run_after(x) + self.bld.prev=self +re_m4=re.compile('@(\w+)@',re.M) +class subst_pc(Task.Task): + def run(self): + code=self.inputs[0].read() + code=code.replace('%','%%') + lst=[] + def repl(match): + g=match.group + if g(1): + lst.append(g(1)) + return"%%(%s)s"%g(1) + return'' + code=re_m4.sub(repl,code) + try: + d=self.generator.dct + except AttributeError: + d={} + for x in lst: + tmp=getattr(self.generator,x,'')or self.env.get_flat(x)or self.env.get_flat(x.upper()) + d[x]=str(tmp) + self.outputs[0].write(code%d) + self.generator.bld.raw_deps[self.uid()]=self.dep_vars=lst + try:delattr(self,'cache_sig') + except AttributeError:pass + if getattr(self.generator,'chmod',None): + os.chmod(self.outputs[0].abspath(),self.generator.chmod) + def sig_vars(self): + bld=self.generator.bld + env=self.env + upd=self.m.update + vars=self.generator.bld.raw_deps.get(self.uid(),[]) + act_sig=bld.hash_env_vars(env,vars) + upd(act_sig) + lst=[getattr(self.generator,x,'')for x in vars] + upd(Utils.h_list(lst)) + return self.m.digest() +def add_pcfile(self,node): + tsk=self.create_task('subst_pc',node,node.change_ext('.pc','.pc.in')) + self.bld.install_files(getattr(self,'install_path','${LIBDIR}/pkgconfig/'),tsk.outputs) +class subst(subst_pc): + pass +def process_subst(self): + src=self.to_nodes(getattr(self,'source',[])) + tgt=getattr(self,'target',[]) + if isinstance(tgt,self.path.__class__): + tgt=[tgt] + tgt=[isinstance(x,self.path.__class__)and x or self.path.find_or_declare(x)for x in Utils.to_list(tgt)] + if len(src)!=len(tgt): + raise Errors.WafError('invalid source or target for %r'%self) + for x,y in zip(src,tgt): + if not(x and y): + raise Errors.WafError('invalid source or target for %r'%self) + tsk=self.create_task('subst',x,y) + for a in('after','before','ext_in','ext_out'): + val=getattr(self,a,None) + if val: + setattr(tsk,a,val) + inst_to=getattr(self,'install_path',None) + if inst_to: + self.bld.install_files(inst_to,tgt,chmod=getattr(self,'chmod',Utils.O644)) + self.source=[] + +taskgen_method(to_nodes) +feature('*')(process_source) +feature('*')(process_rule) +before_method('process_source')(process_rule) +feature('seq')(sequence_order) +extension('.pc.in')(add_pcfile) +feature('subst')(process_subst) +before_method('process_source','process_rule')(process_subst)
\ No newline at end of file diff --git a/waflib/Tools/__init__.py b/waflib/Tools/__init__.py new file mode 100644 index 0000000..efeed79 --- /dev/null +++ b/waflib/Tools/__init__.py @@ -0,0 +1,4 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + diff --git a/waflib/Tools/ar.py b/waflib/Tools/ar.py new file mode 100644 index 0000000..fd0b7d5 --- /dev/null +++ b/waflib/Tools/ar.py @@ -0,0 +1,12 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +from waflib.Configure import conf +def find_ar(conf): + conf.load('ar') +def configure(conf): + conf.find_program('ar',var='AR') + conf.env.ARFLAGS='rcs' + +conf(find_ar)
\ No newline at end of file diff --git a/waflib/Tools/asm.py b/waflib/Tools/asm.py new file mode 100644 index 0000000..d78dff5 --- /dev/null +++ b/waflib/Tools/asm.py @@ -0,0 +1,25 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os,sys +from waflib import Task,Utils +import waflib.Task +from waflib.Tools.ccroot import link_task,stlink_task +from waflib.TaskGen import extension,feature +class asm(Task.Task): + color='BLUE' + run_str='${AS} ${ASFLAGS} ${CPPPATH_ST:INCPATHS} ${AS_SRC_F}${SRC} ${AS_TGT_F}${TGT}' +def asm_hook(self,node): + return self.create_compiled_task('asm',node) +class asmprogram(link_task): + run_str='${ASLINK} ${ASLINKFLAGS} ${ASLNK_TGT_F}${TGT} ${ASLNK_SRC_F}${SRC}' + ext_out=['.bin'] + inst_to='${BINDIR}' + chmod=Utils.O755 +class asmshlib(asmprogram): + inst_to='${LIBDIR}' +class asmstlib(stlink_task): + pass + +extension('.s','.S','.asm','.ASM','.spp','.SPP')(asm_hook)
\ No newline at end of file diff --git a/waflib/Tools/bison.py b/waflib/Tools/bison.py new file mode 100644 index 0000000..a354e3e --- /dev/null +++ b/waflib/Tools/bison.py @@ -0,0 +1,29 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +from waflib import Task +from waflib.TaskGen import extension +class bison(Task.Task): + color='BLUE' + run_str='${BISON} ${BISONFLAGS} ${SRC[0].abspath()} -o ${TGT[0].name}' + ext_out=['.h'] +def big_bison(self,node): + has_h='-d'in self.env['BISONFLAGS'] + outs=[] + if node.name.endswith('.yc'): + outs.append(node.change_ext('.tab.cc')) + if has_h: + outs.append(node.change_ext('.tab.hh')) + else: + outs.append(node.change_ext('.tab.c')) + if has_h: + outs.append(node.change_ext('.tab.h')) + tsk=self.create_task('bison',node,outs) + tsk.cwd=node.parent.get_bld().abspath() + self.source.append(outs[0]) +def configure(conf): + conf.find_program('bison',var='BISON') + conf.env.BISONFLAGS=['-d'] + +extension('.y','.yc','.yy')(big_bison)
\ No newline at end of file diff --git a/waflib/Tools/c.py b/waflib/Tools/c.py new file mode 100644 index 0000000..3c941de --- /dev/null +++ b/waflib/Tools/c.py @@ -0,0 +1,27 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +from waflib import TaskGen,Task,Utils +from waflib.Tools import c_preproc +from waflib.Tools.ccroot import link_task,stlink_task +def c_hook(self,node): + return self.create_compiled_task('c',node) +class c(Task.Task): + run_str='${CC} ${ARCH_ST:ARCH} ${CFLAGS} ${CPPFLAGS} ${FRAMEWORKPATH_ST:FRAMEWORKPATH} ${CPPPATH_ST:INCPATHS} ${DEFINES_ST:DEFINES} ${CC_SRC_F}${SRC} ${CC_TGT_F}${TGT}' + vars=['CCDEPS'] + ext_in=['.h'] + scan=c_preproc.scan +Task.classes['cc']=cc=c +class cprogram(link_task): + run_str='${LINK_CC} ${LINKFLAGS} ${CCLNK_SRC_F}${SRC} ${CCLNK_TGT_F}${TGT[0].abspath()} ${RPATH_ST:RPATH} ${FRAMEWORKPATH_ST:FRAMEWORKPATH} ${FRAMEWORK_ST:FRAMEWORK} ${ARCH_ST:ARCH} ${STLIB_MARKER} ${STLIBPATH_ST:STLIBPATH} ${STLIB_ST:STLIB} ${SHLIB_MARKER} ${LIBPATH_ST:LIBPATH} ${LIB_ST:LIB}' + ext_out=['.bin'] + vars=['LINKDEPS'] + inst_to='${BINDIR}' + chmod=Utils.O755 +class cshlib(cprogram): + inst_to='${LIBDIR}' +class cstlib(stlink_task): + pass + +TaskGen.extension('.c')(c_hook)
\ No newline at end of file diff --git a/waflib/Tools/c_aliases.py b/waflib/Tools/c_aliases.py new file mode 100644 index 0000000..f21fb9e --- /dev/null +++ b/waflib/Tools/c_aliases.py @@ -0,0 +1,56 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os,sys,re +from waflib import Utils,Build +from waflib.Configure import conf +def get_extensions(lst): + ret=[] + for x in Utils.to_list(lst): + try: + if not isinstance(x,str): + x=x.name + ret.append(x[x.rfind('.')+1:]) + except: + pass + return ret +def sniff_features(**kw): + exts=get_extensions(kw['source']) + type=kw['_type'] + feats=[] + if'cxx'in exts or'cpp'in exts or'c++'in exts or'cc'in exts or'C'in exts: + feats.append('cxx') + if'c'in exts or'vala'in exts: + feats.append('c') + if'd'in exts: + feats.append('d') + if'java'in exts: + feats.append('java') + if'java'in exts: + return'java' + if type in['program','shlib','stlib']: + for x in feats: + if x in['cxx','d','c']: + feats.append(x+type) + return feats +def set_features(kw,_type): + kw['_type']=_type + kw['features']=Utils.to_list(kw.get('features',[]))+Utils.to_list(sniff_features(**kw)) +def program(bld,*k,**kw): + set_features(kw,'program') + return bld(*k,**kw) +def shlib(bld,*k,**kw): + set_features(kw,'shlib') + return bld(*k,**kw) +def stlib(bld,*k,**kw): + set_features(kw,'stlib') + return bld(*k,**kw) +def objects(bld,*k,**kw): + set_features(kw,'objects') + return bld(*k,**kw) + +conf(program) +conf(shlib) +conf(stlib) +conf(objects)
\ No newline at end of file diff --git a/waflib/Tools/c_config.py b/waflib/Tools/c_config.py new file mode 100644 index 0000000..d10e630 --- /dev/null +++ b/waflib/Tools/c_config.py @@ -0,0 +1,713 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import sys +if sys.hexversion < 0x020400f0: from sets import Set as set +import os,imp,sys,re,shlex,shutil +from waflib import Build,Utils,Configure,Task,Options,Logs,TaskGen,Errors,ConfigSet,Runner +from waflib.TaskGen import before_method,after_method,feature +from waflib.Configure import conf +WAF_CONFIG_H='config.h' +DEFKEYS='define_key' +INCKEYS='include_key' +cfg_ver={'atleast-version':'>=','exact-version':'==','max-version':'<=',} +SNIP_FUNCTION=''' + int main() { + void *p; + p=(void*)(%s); + return 0; +} +''' +SNIP_TYPE=''' +int main() { + if ((%(type_name)s *) 0) return 0; + if (sizeof (%(type_name)s)) return 0; +} +''' +SNIP_CLASS=''' +int main() { + if ( +} +''' +SNIP_EMPTY_PROGRAM=''' +int main() { + return 0; +} +''' +SNIP_FIELD=''' +int main() { + char *off; + off = (char*) &((%(type_name)s*)0)->%(field_name)s; + return (size_t) off < sizeof(%(type_name)s); +} +''' +MACRO_TO_DESTOS={'__linux__':'linux','__GNU__':'gnu','__FreeBSD__':'freebsd','__NetBSD__':'netbsd','__OpenBSD__':'openbsd','__sun':'sunos','__hpux':'hpux','__sgi':'irix','_AIX':'aix','__CYGWIN__':'cygwin','__MSYS__':'msys','_UWIN':'uwin','_WIN64':'win32','_WIN32':'win32','__ENVIRONMENT_MAC_OS_X_VERSION_MIN_REQUIRED__':'darwin','__ENVIRONMENT_IPHONE_OS_VERSION_MIN_REQUIRED__':'darwin','__QNX__':'qnx','__native_client__':'nacl'} +MACRO_TO_DEST_CPU={'__x86_64__':'x86_64','__i386__':'x86','__ia64__':'ia','__mips__':'mips','__sparc__':'sparc','__alpha__':'alpha','__arm__':'arm','__hppa__':'hppa','__powerpc__':'powerpc',} +def parse_flags(self,line,uselib,env=None,force_static=False): + assert(isinstance(line,str)) + env=env or self.env + app=env.append_value + appu=env.append_unique + lex=shlex.shlex(line,posix=False) + lex.whitespace_split=True + lex.commenters='' + lst=list(lex) + while lst: + x=lst.pop(0) + st=x[:2] + ot=x[2:] + if st=='-I'or st=='/I': + if not ot:ot=lst.pop(0) + appu('INCLUDES_'+uselib,[ot]) + elif st=='-include': + tmp=[x,lst.pop(0)] + app('CFLAGS',tmp) + app('CXXFLAGS',tmp) + elif st=='-D'or(self.env.CXX_NAME=='msvc'and st=='/D'): + if not ot:ot=lst.pop(0) + app('DEFINES_'+uselib,[ot]) + elif st=='-l': + if not ot:ot=lst.pop(0) + prefix=force_static and'STLIB_'or'LIB_' + appu(prefix+uselib,[ot]) + elif st=='-L': + if not ot:ot=lst.pop(0) + appu('LIBPATH_'+uselib,[ot]) + elif x=='-pthread'or x.startswith('+')or x.startswith('-std'): + app('CFLAGS_'+uselib,[x]) + app('CXXFLAGS_'+uselib,[x]) + app('LINKFLAGS_'+uselib,[x]) + elif x=='-framework': + appu('FRAMEWORK_'+uselib,[lst.pop(0)]) + elif x.startswith('-F'): + appu('FRAMEWORKPATH_'+uselib,[x[2:]]) + elif x.startswith('-Wl'): + app('LINKFLAGS_'+uselib,[x]) + elif x.startswith('-m')or x.startswith('-f')or x.startswith('-dynamic'): + app('CFLAGS_'+uselib,[x]) + app('CXXFLAGS_'+uselib,[x]) + elif x.startswith('-bundle'): + app('LINKFLAGS_'+uselib,[x]) + elif x.startswith('-undefined'): + arg=lst.pop(0) + app('LINKFLAGS_'+uselib,[x,arg]) + elif x.startswith('-arch')or x.startswith('-isysroot'): + tmp=[x,lst.pop(0)] + app('CFLAGS_'+uselib,tmp) + app('CXXFLAGS_'+uselib,tmp) + app('LINKFLAGS_'+uselib,tmp) + elif x.endswith('.a')or x.endswith('.so')or x.endswith('.dylib'): + appu('LINKFLAGS_'+uselib,[x]) +def ret_msg(self,f,kw): + if isinstance(f,str): + return f + return f(kw) +def validate_cfg(self,kw): + if not'path'in kw: + if not self.env.PKGCONFIG: + self.find_program('pkg-config',var='PKGCONFIG') + kw['path']=self.env.PKGCONFIG + if'atleast_pkgconfig_version'in kw: + if not'msg'in kw: + kw['msg']='Checking for pkg-config version >= %r'%kw['atleast_pkgconfig_version'] + return + if not'okmsg'in kw: + kw['okmsg']='yes' + if not'errmsg'in kw: + kw['errmsg']='not found' + if'modversion'in kw: + if not'msg'in kw: + kw['msg']='Checking for %r version'%kw['modversion'] + return + for x in cfg_ver.keys(): + y=x.replace('-','_') + if y in kw: + if not'package'in kw: + raise ValueError('%s requires a package'%x) + if not'msg'in kw: + kw['msg']='Checking for %r %s %s'%(kw['package'],cfg_ver[x],kw[y]) + return + if not'msg'in kw: + kw['msg']='Checking for %r'%(kw['package']or kw['path']) +def exec_cfg(self,kw): + if'atleast_pkgconfig_version'in kw: + cmd=[kw['path'],'--atleast-pkgconfig-version=%s'%kw['atleast_pkgconfig_version']] + self.cmd_and_log(cmd) + if not'okmsg'in kw: + kw['okmsg']='yes' + return + for x in cfg_ver: + y=x.replace('-','_') + if y in kw: + self.cmd_and_log([kw['path'],'--%s=%s'%(x,kw[y]),kw['package']]) + if not'okmsg'in kw: + kw['okmsg']='yes' + self.define(self.have_define(kw.get('uselib_store',kw['package'])),1,0) + break + if'modversion'in kw: + version=self.cmd_and_log([kw['path'],'--modversion',kw['modversion']]).strip() + self.define('%s_VERSION'%Utils.quote_define_name(kw.get('uselib_store',kw['modversion'])),version) + return version + lst=[kw['path']] + defi=kw.get('define_variable',None) + if not defi: + defi=self.env.PKG_CONFIG_DEFINES or{} + for key,val in defi.items(): + lst.append('--define-variable=%s=%s'%(key,val)) + if kw['package']: + lst.extend(Utils.to_list(kw['package'])) + if'variables'in kw: + env=kw.get('env',self.env) + uselib=kw.get('uselib_store',kw['package'].upper()) + vars=Utils.to_list(kw['variables']) + for v in vars: + val=self.cmd_and_log(lst+['--variable='+v]).strip() + var='%s_%s'%(uselib,v) + env[var]=val + if not'okmsg'in kw: + kw['okmsg']='yes' + return + static=False + if'args'in kw: + args=Utils.to_list(kw['args']) + if'--static'in args or'--static-libs'in args: + static=True + lst+=args + ret=self.cmd_and_log(lst) + if not'okmsg'in kw: + kw['okmsg']='yes' + self.define(self.have_define(kw.get('uselib_store',kw['package'])),1,0) + self.parse_flags(ret,kw.get('uselib_store',kw['package'].upper()),kw.get('env',self.env),force_static=static) + return ret +def check_cfg(self,*k,**kw): + if k: + lst=k[0].split() + kw['package']=lst[0] + kw['args']=' '.join(lst[1:]) + self.validate_cfg(kw) + if'msg'in kw: + self.start_msg(kw['msg']) + ret=None + try: + ret=self.exec_cfg(kw) + except self.errors.WafError ,e: + if'errmsg'in kw: + self.end_msg(kw['errmsg'],'YELLOW') + if Logs.verbose>1: + raise + else: + self.fatal('The configuration failed') + else: + kw['success']=ret + if'okmsg'in kw: + self.end_msg(self.ret_msg(kw['okmsg'],kw)) + return ret +def validate_c(self,kw): + if not'env'in kw: + kw['env']=self.env.derive() + env=kw['env'] + if not'compiler'in kw and not'features'in kw: + kw['compiler']='c' + if env['CXX_NAME']and Task.classes.get('cxx',None): + kw['compiler']='cxx' + if not self.env['CXX']: + self.fatal('a c++ compiler is required') + else: + if not self.env['CC']: + self.fatal('a c compiler is required') + if not'compile_mode'in kw: + kw['compile_mode']='c' + if'cxx'in Utils.to_list(kw.get('features',[]))or kw.get('compiler','')=='cxx': + kw['compile_mode']='cxx' + if not'type'in kw: + kw['type']='cprogram' + if not'features'in kw: + kw['features']=[kw['compile_mode'],kw['type']] + else: + kw['features']=Utils.to_list(kw['features']) + if not'compile_filename'in kw: + kw['compile_filename']='test.c'+((kw['compile_mode']=='cxx')and'pp'or'') + def to_header(dct): + if'header_name'in dct: + dct=Utils.to_list(dct['header_name']) + return''.join(['#include <%s>\n'%x for x in dct]) + return'' + if'framework_name'in kw: + fwkname=kw['framework_name'] + if not'uselib_store'in kw: + kw['uselib_store']=fwkname.upper() + if not kw.get('no_header',False): + if not'header_name'in kw: + kw['header_name']=[] + fwk='%s/%s.h'%(fwkname,fwkname) + if kw.get('remove_dot_h',None): + fwk=fwk[:-2] + kw['header_name']=Utils.to_list(kw['header_name'])+[fwk] + kw['msg']='Checking for framework %s'%fwkname + kw['framework']=fwkname + if'function_name'in kw: + fu=kw['function_name'] + if not'msg'in kw: + kw['msg']='Checking for function %s'%fu + kw['code']=to_header(kw)+SNIP_FUNCTION%fu + if not'uselib_store'in kw: + kw['uselib_store']=fu.upper() + if not'define_name'in kw: + kw['define_name']=self.have_define(fu) + elif'type_name'in kw: + tu=kw['type_name'] + if not'header_name'in kw: + kw['header_name']='stdint.h' + if'field_name'in kw: + field=kw['field_name'] + kw['code']=to_header(kw)+SNIP_FIELD%{'type_name':tu,'field_name':field} + if not'msg'in kw: + kw['msg']='Checking for field %s in %s'%(field,tu) + if not'define_name'in kw: + kw['define_name']=self.have_define((tu+'_'+field).upper()) + else: + kw['code']=to_header(kw)+SNIP_TYPE%{'type_name':tu} + if not'msg'in kw: + kw['msg']='Checking for type %s'%tu + if not'define_name'in kw: + kw['define_name']=self.have_define(tu.upper()) + elif'header_name'in kw: + if not'msg'in kw: + kw['msg']='Checking for header %s'%kw['header_name'] + l=Utils.to_list(kw['header_name']) + assert len(l)>0,'list of headers in header_name is empty' + kw['code']=to_header(kw)+SNIP_EMPTY_PROGRAM + if not'uselib_store'in kw: + kw['uselib_store']=l[0].upper() + if not'define_name'in kw: + kw['define_name']=self.have_define(l[0]) + if'lib'in kw: + if not'msg'in kw: + kw['msg']='Checking for library %s'%kw['lib'] + if not'uselib_store'in kw: + kw['uselib_store']=kw['lib'].upper() + if'stlib'in kw: + if not'msg'in kw: + kw['msg']='Checking for static library %s'%kw['stlib'] + if not'uselib_store'in kw: + kw['uselib_store']=kw['stlib'].upper() + if'fragment'in kw: + kw['code']=kw['fragment'] + if not'msg'in kw: + kw['msg']='Checking for code snippet' + if not'errmsg'in kw: + kw['errmsg']='no' + for(flagsname,flagstype)in[('cxxflags','compiler'),('cflags','compiler'),('linkflags','linker')]: + if flagsname in kw: + if not'msg'in kw: + kw['msg']='Checking for %s flags %s'%(flagstype,kw[flagsname]) + if not'errmsg'in kw: + kw['errmsg']='no' + if not'execute'in kw: + kw['execute']=False + if kw['execute']: + kw['features'].append('test_exec') + if not'errmsg'in kw: + kw['errmsg']='not found' + if not'okmsg'in kw: + kw['okmsg']='yes' + if not'code'in kw: + kw['code']=SNIP_EMPTY_PROGRAM + if self.env[INCKEYS]: + kw['code']='\n'.join(['#include <%s>'%x for x in self.env[INCKEYS]])+'\n'+kw['code'] + if not kw.get('success'):kw['success']=None + if'define_name'in kw: + self.undefine(kw['define_name']) + assert'msg'in kw,'invalid parameters, read http://freehackers.org/~tnagy/wafbook/single.html#config_helpers_c' +def post_check(self,*k,**kw): + is_success=0 + if kw['execute']: + if kw['success']is not None: + if kw.get('define_ret',False): + is_success=kw['success'] + else: + is_success=(kw['success']==0) + else: + is_success=(kw['success']==0) + if'define_name'in kw: + if'header_name'in kw or'function_name'in kw or'type_name'in kw or'fragment'in kw: + nm=kw['define_name'] + if kw['execute']and kw.get('define_ret',None)and isinstance(is_success,str): + self.define(kw['define_name'],is_success,quote=kw.get('quote',1)) + else: + self.define_cond(kw['define_name'],is_success) + else: + self.define_cond(kw['define_name'],is_success) + if'header_name'in kw: + if kw.get('auto_add_header_name',False): + self.env.append_value(INCKEYS,Utils.to_list(kw['header_name'])) + if is_success and'uselib_store'in kw: + from waflib.Tools import ccroot + _vars=set([]) + for x in kw['features']: + if x in ccroot.USELIB_VARS: + _vars|=ccroot.USELIB_VARS[x] + for k in _vars: + lk=k.lower() + if k=='INCLUDES':lk='includes' + if k=='DEFINES':lk='defines' + if lk in kw: + val=kw[lk] + if isinstance(val,str): + val=val.rstrip(os.path.sep) + self.env.append_unique(k+'_'+kw['uselib_store'],val) + return is_success +def check(self,*k,**kw): + self.validate_c(kw) + self.start_msg(kw['msg']) + ret=None + try: + ret=self.run_c_code(*k,**kw) + except self.errors.ConfigurationError ,e: + self.end_msg(kw['errmsg'],'YELLOW') + if Logs.verbose>1: + raise + else: + self.fatal('The configuration failed') + else: + kw['success']=ret + self.end_msg(self.ret_msg(kw['okmsg'],kw)) + ret=self.post_check(*k,**kw) + if not ret: + self.fatal('The configuration failed %r'%ret) + return ret +class test_exec(Task.Task): + color='PINK' + def run(self): + if getattr(self.generator,'rpath',None): + if getattr(self.generator,'define_ret',False): + self.generator.bld.retval=self.generator.bld.cmd_and_log([self.inputs[0].abspath()]) + else: + self.generator.bld.retval=self.generator.bld.exec_command([self.inputs[0].abspath()]) + else: + env=self.env.env or{} + env.update(dict(os.environ)) + for var in('LD_LIBRARY_PATH','DYLD_LIBRARY_PATH','PATH'): + env[var]=self.inputs[0].parent.abspath()+os.path.pathsep+env.get(var,'') + if getattr(self.generator,'define_ret',False): + self.generator.bld.retval=self.generator.bld.cmd_and_log([self.inputs[0].abspath()],env=env) + else: + self.generator.bld.retval=self.generator.bld.exec_command([self.inputs[0].abspath()],env=env) +def test_exec_fun(self): + self.create_task('test_exec',self.link_task.outputs[0]) +CACHE_RESULTS=1 +COMPILE_ERRORS=2 +def run_c_code(self,*k,**kw): + lst=[str(v)for(p,v)in kw.items()if p!='env'] + h=Utils.h_list(lst) + dir=self.bldnode.abspath()+os.sep+(not Utils.is_win32 and'.'or'')+'conf_check_'+Utils.to_hex(h) + try: + os.makedirs(dir) + except: + pass + try: + os.stat(dir) + except: + self.fatal('cannot use the configuration test folder %r'%dir) + cachemode=getattr(Options.options,'confcache',None) + if cachemode==CACHE_RESULTS: + try: + proj=ConfigSet.ConfigSet(os.path.join(dir,'cache_run_c_code')) + ret=proj['cache_run_c_code'] + except: + pass + else: + if isinstance(ret,str)and ret.startswith('Test does not build'): + self.fatal(ret) + return ret + bdir=os.path.join(dir,'testbuild') + if not os.path.exists(bdir): + os.makedirs(bdir) + self.test_bld=bld=Build.BuildContext(top_dir=dir,out_dir=bdir) + bld.init_dirs() + bld.progress_bar=0 + bld.targets='*' + if kw['compile_filename']: + node=bld.srcnode.make_node(kw['compile_filename']) + node.write(kw['code']) + bld.logger=self.logger + bld.all_envs.update(self.all_envs) + bld.env=kw['env'] + o=bld(features=kw['features'],source=kw['compile_filename'],target='testprog') + for k,v in kw.items(): + setattr(o,k,v) + self.to_log("==>\n%s\n<=="%kw['code']) + bld.targets='*' + ret=-1 + try: + try: + bld.compile() + except Errors.WafError: + ret='Test does not build: %s'%Utils.ex_stack() + self.fatal(ret) + else: + ret=getattr(bld,'retval',0) + finally: + proj=ConfigSet.ConfigSet() + proj['cache_run_c_code']=ret + proj.store(os.path.join(dir,'cache_run_c_code')) + return ret +def check_cxx(self,*k,**kw): + kw['compiler']='cxx' + return self.check(*k,**kw) +def check_cc(self,*k,**kw): + kw['compiler']='c' + return self.check(*k,**kw) +def define(self,key,val,quote=True): + assert key and isinstance(key,str) + if isinstance(val,int)or isinstance(val,float): + s='%s=%s' + else: + s=quote and'%s="%s"'or'%s=%s' + app=s%(key,str(val)) + ban=key+'=' + lst=self.env['DEFINES'] + for x in lst: + if x.startswith(ban): + lst[lst.index(x)]=app + break + else: + self.env.append_value('DEFINES',app) + self.env.append_unique(DEFKEYS,key) +def undefine(self,key): + assert key and isinstance(key,str) + ban=key+'=' + lst=[x for x in self.env['DEFINES']if not x.startswith(ban)] + self.env['DEFINES']=lst + self.env.append_unique(DEFKEYS,key) +def define_cond(self,key,val): + assert key and isinstance(key,str) + if val: + self.define(key,1) + else: + self.undefine(key) +def is_defined(self,key): + assert key and isinstance(key,str) + ban=key+'=' + for x in self.env['DEFINES']: + if x.startswith(ban): + return True + return False +def get_define(self,key): + assert key and isinstance(key,str) + ban=key+'=' + for x in self.env['DEFINES']: + if x.startswith(ban): + return x[len(ban):] + return None +def have_define(self,key): + return self.__dict__.get('HAVE_PAT','HAVE_%s')%Utils.quote_define_name(key) +def write_config_header(self,configfile='',guard='',top=False,env=None,defines=True,headers=False,remove=True): + if not configfile:configfile=WAF_CONFIG_H + waf_guard=guard or'_%s_WAF'%Utils.quote_define_name(configfile) + node=top and self.bldnode or self.path.get_bld() + node=node.make_node(configfile) + node.parent.mkdir() + lst=['/* WARNING! All changes made to this file will be lost! */\n'] + lst.append('#ifndef %s\n#define %s\n'%(waf_guard,waf_guard)) + lst.append(self.get_config_header(defines,headers)) + lst.append('\n#endif /* %s */\n'%waf_guard) + node.write('\n'.join(lst)) + env=env or self.env + env.append_unique(Build.CFG_FILES,[node.abspath()]) + if remove: + for key in self.env[DEFKEYS]: + self.undefine(key) + self.env[DEFKEYS]=[] +def get_config_header(self,defines=True,headers=False): + lst=[] + if headers: + for x in self.env[INCKEYS]: + lst.append('#include <%s>'%x) + if defines: + for x in self.env[DEFKEYS]: + if self.is_defined(x): + val=self.get_define(x) + lst.append('#define %s %s'%(x,val)) + else: + lst.append('/* #undef %s */'%x) + return"\n".join(lst) +def cc_add_flags(conf): + conf.add_os_flags('CPPFLAGS','CFLAGS') + conf.add_os_flags('CFLAGS') +def cxx_add_flags(conf): + conf.add_os_flags('CPPFLAGS','CXXFLAGS') + conf.add_os_flags('CXXFLAGS') +def link_add_flags(conf): + conf.add_os_flags('LINKFLAGS') + conf.add_os_flags('LDFLAGS','LINKFLAGS') +def cc_load_tools(conf): + if not conf.env.DEST_OS: + conf.env.DEST_OS=Utils.unversioned_sys_platform() + conf.load('c') +def cxx_load_tools(conf): + if not conf.env.DEST_OS: + conf.env.DEST_OS=Utils.unversioned_sys_platform() + conf.load('cxx') +def get_cc_version(conf,cc,gcc=False,icc=False): + cmd=cc+['-dM','-E','-'] + env=conf.env.env or None + try: + p=Utils.subprocess.Popen(cmd,stdin=Utils.subprocess.PIPE,stdout=Utils.subprocess.PIPE,stderr=Utils.subprocess.PIPE,env=env) + p.stdin.write('\n') + out=p.communicate()[0] + except: + conf.fatal('Could not determine the compiler version %r'%cmd) + if not isinstance(out,str): + out=out.decode(sys.stdout.encoding) + if gcc: + if out.find('__INTEL_COMPILER')>=0: + conf.fatal('The intel compiler pretends to be gcc') + if out.find('__GNUC__')<0: + conf.fatal('Could not determine the compiler type') + if icc and out.find('__INTEL_COMPILER')<0: + conf.fatal('Not icc/icpc') + k={} + if icc or gcc: + out=out.split('\n') + for line in out: + lst=shlex.split(line) + if len(lst)>2: + key=lst[1] + val=lst[2] + k[key]=val + def isD(var): + return var in k + def isT(var): + return var in k and k[var]!='0' + if not conf.env.DEST_OS: + conf.env.DEST_OS='' + for i in MACRO_TO_DESTOS: + if isD(i): + conf.env.DEST_OS=MACRO_TO_DESTOS[i] + break + else: + if isD('__APPLE__')and isD('__MACH__'): + conf.env.DEST_OS='darwin' + elif isD('__unix__'): + conf.env.DEST_OS='generic' + if isD('__ELF__'): + conf.env.DEST_BINFMT='elf' + elif isD('__WINNT__')or isD('__CYGWIN__'): + conf.env.DEST_BINFMT='pe' + conf.env.LIBDIR=conf.env['PREFIX']+'/bin' + elif isD('__APPLE__'): + conf.env.DEST_BINFMT='mac-o' + if not conf.env.DEST_BINFMT: + conf.env.DEST_BINFMT=Utils.destos_to_binfmt(conf.env.DEST_OS) + for i in MACRO_TO_DEST_CPU: + if isD(i): + conf.env.DEST_CPU=MACRO_TO_DEST_CPU[i] + break + Logs.debug('ccroot: dest platform: '+' '.join([conf.env[x]or'?'for x in('DEST_OS','DEST_BINFMT','DEST_CPU')])) + if icc: + ver=k['__INTEL_COMPILER'] + conf.env['CC_VERSION']=(ver[:-2],ver[-2],ver[-1]) + else: + conf.env['CC_VERSION']=(k['__GNUC__'],k['__GNUC_MINOR__'],k['__GNUC_PATCHLEVEL__']) + return k +def get_xlc_version(conf,cc): + version_re=re.compile(r"IBM XL C/C\+\+.*, V(?P<major>\d*)\.(?P<minor>\d*)",re.I).search + cmd=cc+['-qversion'] + try: + out,err=conf.cmd_and_log(cmd,output=0) + except Errors.WafError: + conf.fatal('Could not find xlc %r'%cmd) + if out:match=version_re(out) + else:match=version_re(err) + if not match: + conf.fatal('Could not determine the XLC version.') + k=match.groupdict() + conf.env['CC_VERSION']=(k['major'],k['minor']) +def add_as_needed(self): + if self.env.DEST_BINFMT=='elf'and'gcc'in(self.env.CXX_NAME,self.env.CC_NAME): + self.env.append_unique('LINKFLAGS','--as-needed') +class cfgtask(Task.TaskBase): + def display(self): + return'' + def runnable_status(self): + return Task.RUN_ME + def run(self): + conf=self.conf + bld=Build.BuildContext(top_dir=conf.srcnode.abspath(),out_dir=conf.bldnode.abspath()) + bld.env=conf.env + bld.init_dirs() + bld.in_msg=1 + bld.logger=self.logger + try: + bld.check(**self.args) + except: + return 1 +def multicheck(self,*k,**kw): + self.start_msg(kw.get('msg','Executing %d configuration tests'%len(k))) + class par(object): + def __init__(self): + self.keep=False + self.cache_global=Options.cache_global + self.nocache=Options.options.nocache + self.returned_tasks=[] + def total(self): + return len(tasks) + def to_log(self,*k,**kw): + return + bld=par() + tasks=[] + for dct in k: + x=cfgtask(bld=bld) + tasks.append(x) + x.args=dct + x.bld=bld + x.conf=self + x.args=dct + x.logger=Logs.make_mem_logger(str(id(x)),self.logger) + def it(): + yield tasks + while 1: + yield[] + p=Runner.Parallel(bld,Options.options.jobs) + p.biter=it() + p.start() + for x in tasks: + x.logger.memhandler.flush() + for x in tasks: + if x.hasrun!=Task.SUCCESS: + self.end_msg(kw.get('errmsg','no'),color='YELLOW') + self.fatal(kw.get('fatalmsg',None)or'One of the tests has failed, see the config.log for more information') + self.end_msg('ok') + +conf(parse_flags) +conf(ret_msg) +conf(validate_cfg) +conf(exec_cfg) +conf(check_cfg) +conf(validate_c) +conf(post_check) +conf(check) +feature('test_exec')(test_exec_fun) +after_method('apply_link')(test_exec_fun) +conf(run_c_code) +conf(check_cxx) +conf(check_cc) +conf(define) +conf(undefine) +conf(define_cond) +conf(is_defined) +conf(get_define) +conf(have_define) +conf(write_config_header) +conf(get_config_header) +conf(cc_add_flags) +conf(cxx_add_flags) +conf(link_add_flags) +conf(cc_load_tools) +conf(cxx_load_tools) +conf(get_cc_version) +conf(get_xlc_version) +conf(add_as_needed) +conf(multicheck)
\ No newline at end of file diff --git a/waflib/Tools/c_osx.py b/waflib/Tools/c_osx.py new file mode 100644 index 0000000..92e39c5 --- /dev/null +++ b/waflib/Tools/c_osx.py @@ -0,0 +1,121 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os,shutil,sys,platform +from waflib import TaskGen,Task,Build,Options,Utils,Errors +from waflib.TaskGen import taskgen_method,feature,after_method,before_method +app_info=''' +<?xml version="1.0" encoding="UTF-8"?> +<!DOCTYPE plist SYSTEM "file://localhost/System/Library/DTDs/PropertyList.dtd"> +<plist version="0.9"> +<dict> + <key>CFBundlePackageType</key> + <string>APPL</string> + <key>CFBundleGetInfoString</key> + <string>Created by Waf</string> + <key>CFBundleSignature</key> + <string>????</string> + <key>NOTE</key> + <string>THIS IS A GENERATED FILE, DO NOT MODIFY</string> + <key>CFBundleExecutable</key> + <string>%s</string> +</dict> +</plist> +''' +def set_macosx_deployment_target(self): + if self.env['MACOSX_DEPLOYMENT_TARGET']: + os.environ['MACOSX_DEPLOYMENT_TARGET']=self.env['MACOSX_DEPLOYMENT_TARGET'] + elif'MACOSX_DEPLOYMENT_TARGET'not in os.environ: + if Utils.unversioned_sys_platform()=='darwin': + os.environ['MACOSX_DEPLOYMENT_TARGET']='.'.join(platform.mac_ver()[0].split('.')[:2]) +def create_bundle_dirs(self,name,out): + bld=self.bld + dir=out.parent.find_or_declare(name) + dir.mkdir() + macos=dir.find_or_declare(['Contents','MacOS']) + macos.mkdir() + return dir +def bundle_name_for_output(out): + name=out.name + k=name.rfind('.') + if k>=0: + name=name[:k]+'.app' + else: + name=name+'.app' + return name +def create_task_macapp(self): + if self.env['MACAPP']or getattr(self,'mac_app',False): + out=self.link_task.outputs[0] + name=bundle_name_for_output(out) + dir=self.create_bundle_dirs(name,out) + n1=dir.find_or_declare(['Contents','MacOS',out.name]) + self.apptask=self.create_task('macapp',self.link_task.outputs,n1) + inst_to=getattr(self,'install_path','/Applications')+'/%s/Contents/MacOS/'%name + self.bld.install_files(inst_to,n1,chmod=Utils.O755) + if getattr(self,'mac_resources',None): + res_dir=n1.parent.parent.make_node('Resources') + inst_to=getattr(self,'install_path','/Applications')+'/%s/Resources'%name + for x in self.to_list(self.mac_resources): + node=self.path.find_node(x) + if not node: + raise Errors.WafError('Missing mac_resource %r in %r'%(x,self)) + parent=node.parent + if os.path.isdir(node.abspath()): + nodes=node.ant_glob('**') + else: + nodes=[node] + for node in nodes: + rel=node.path_from(parent) + tsk=self.create_task('macapp',node,res_dir.make_node(rel)) + self.bld.install_as(inst_to+'/%s'%rel,node) + if getattr(self.bld,'is_install',None): + self.install_task.hasrun=Task.SKIP_ME +def create_task_macplist(self): + if self.env['MACAPP']or getattr(self,'mac_app',False): + out=self.link_task.outputs[0] + name=bundle_name_for_output(out) + dir=self.create_bundle_dirs(name,out) + n1=dir.find_or_declare(['Contents','Info.plist']) + self.plisttask=plisttask=self.create_task('macplist',[],n1) + if getattr(self,'mac_plist',False): + node=self.path.find_resource(self.mac_plist) + if node: + plisttask.inputs.append(node) + else: + plisttask.code=self.mac_plist + else: + plisttask.code=app_info%self.link_task.outputs[0].name + inst_to=getattr(self,'install_path','/Applications')+'/%s/Contents/'%name + self.bld.install_files(inst_to,n1) +def apply_bundle(self): + if self.env['MACBUNDLE']or getattr(self,'mac_bundle',False): + self.env['LINKFLAGS_cshlib']=self.env['LINKFLAGS_cxxshlib']=[] + self.env['cshlib_PATTERN']=self.env['cxxshlib_PATTERN']=self.env['macbundle_PATTERN'] + use=self.use=self.to_list(getattr(self,'use',[])) + if not'MACBUNDLE'in use: + use.append('MACBUNDLE') +app_dirs=['Contents','Contents/MacOS','Contents/Resources'] +class macapp(Task.Task): + color='PINK' + def run(self): + self.outputs[0].parent.mkdir() + shutil.copy2(self.inputs[0].srcpath(),self.outputs[0].abspath()) +class macplist(Task.Task): + color='PINK' + ext_in=['.bin'] + def run(self): + if getattr(self,'code',None): + txt=self.code + else: + txt=self.inputs[0].read() + self.outputs[0].write(txt) + +feature('c','cxx')(set_macosx_deployment_target) +taskgen_method(create_bundle_dirs) +feature('cprogram','cxxprogram')(create_task_macapp) +after_method('apply_link')(create_task_macapp) +feature('cprogram','cxxprogram')(create_task_macplist) +after_method('apply_link')(create_task_macplist) +feature('cshlib','cxxshlib')(apply_bundle) +before_method('apply_link','propagate_uselib_vars')(apply_bundle)
\ No newline at end of file diff --git a/waflib/Tools/c_preproc.py b/waflib/Tools/c_preproc.py new file mode 100644 index 0000000..4cb99ef --- /dev/null +++ b/waflib/Tools/c_preproc.py @@ -0,0 +1,606 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import sys +if sys.hexversion < 0x020400f0: from sets import Set as set +import re,sys,os,string,traceback +from waflib import Logs,Build,Utils,Errors +from waflib.Logs import debug,error +class PreprocError(Errors.WafError): + pass +POPFILE='-' +recursion_limit=150 +go_absolute=False +standard_includes=['/usr/include'] +if Utils.is_win32: + standard_includes=[] +use_trigraphs=0 +strict_quotes=0 +g_optrans={'not':'!','and':'&&','bitand':'&','and_eq':'&=','or':'||','bitor':'|','or_eq':'|=','xor':'^','xor_eq':'^=','compl':'~',} +re_lines=re.compile('^[ \t]*(#|%:)[ \t]*(ifdef|ifndef|if|else|elif|endif|include|import|define|undef|pragma)[ \t]*(.*)\r*$',re.IGNORECASE|re.MULTILINE) +re_mac=re.compile("^[a-zA-Z_]\w*") +re_fun=re.compile('^[a-zA-Z_][a-zA-Z0-9_]*[(]') +re_pragma_once=re.compile('^\s*once\s*',re.IGNORECASE) +re_nl=re.compile('\\\\\r*\n',re.MULTILINE) +re_cpp=re.compile(r"""(/\*[^*]*\*+([^/*][^*]*\*+)*/)|//[^\n]*|("(\\.|[^"\\])*"|'(\\.|[^'\\])*'|.[^/"'\\]*)""",re.MULTILINE) +trig_def=[('??'+a,b)for a,b in zip("=-/!'()<>",r'#~\|^[]{}')] +chr_esc={'0':0,'a':7,'b':8,'t':9,'n':10,'f':11,'v':12,'r':13,'\\':92,"'":39} +NUM='i' +OP='O' +IDENT='T' +STR='s' +CHAR='c' +tok_types=[NUM,STR,IDENT,OP] +exp_types=[r"""0[xX](?P<hex>[a-fA-F0-9]+)(?P<qual1>[uUlL]*)|L*?'(?P<char>(\\.|[^\\'])+)'|(?P<n1>\d+)[Ee](?P<exp0>[+-]*?\d+)(?P<float0>[fFlL]*)|(?P<n2>\d*\.\d+)([Ee](?P<exp1>[+-]*?\d+))?(?P<float1>[fFlL]*)|(?P<n4>\d+\.\d*)([Ee](?P<exp2>[+-]*?\d+))?(?P<float2>[fFlL]*)|(?P<oct>0*)(?P<n0>\d+)(?P<qual2>[uUlL]*)""",r'L?"([^"\\]|\\.)*"',r'[a-zA-Z_]\w*',r'%:%:|<<=|>>=|\.\.\.|<<|<%|<:|<=|>>|>=|\+\+|\+=|--|->|-=|\*=|/=|%:|%=|%>|==|&&|&=|\|\||\|=|\^=|:>|!=|##|[\(\)\{\}\[\]<>\?\|\^\*\+&=:!#;,%/\-\?\~\.]',] +re_clexer=re.compile('|'.join(["(?P<%s>%s)"%(name,part)for name,part in zip(tok_types,exp_types)]),re.M) +accepted='a' +ignored='i' +undefined='u' +skipped='s' +def repl(m): + s=m.group(1) + if s: + return' ' + return m.group(3)or'' +def filter_comments(filename): + code=Utils.readf(filename) + if use_trigraphs: + for(a,b)in trig_def:code=code.split(a).join(b) + code=re_nl.sub('',code) + code=re_cpp.sub(repl,code) + return[(m.group(2),m.group(3))for m in re.finditer(re_lines,code)] +prec={} +ops=['* / %','+ -','<< >>','< <= >= >','== !=','& | ^','&& ||',','] +for x in range(len(ops)): + syms=ops[x] + for u in syms.split(): + prec[u]=x +def trimquotes(s): + if not s:return'' + s=s.rstrip() + if s[0]=="'"and s[-1]=="'":return s[1:-1] + return s +def reduce_nums(val_1,val_2,val_op): + try:a=0+val_1 + except TypeError:a=int(val_1) + try:b=0+val_2 + except TypeError:b=int(val_2) + d=val_op + if d=='%':c=a%b + elif d=='+':c=a+b + elif d=='-':c=a-b + elif d=='*':c=a*b + elif d=='/':c=a/b + elif d=='^':c=a^b + elif d=='|':c=a|b + elif d=='||':c=int(a or b) + elif d=='&':c=a&b + elif d=='&&':c=int(a and b) + elif d=='==':c=int(a==b) + elif d=='!=':c=int(a!=b) + elif d=='<=':c=int(a<=b) + elif d=='<':c=int(a<b) + elif d=='>':c=int(a>b) + elif d=='>=':c=int(a>=b) + elif d=='^':c=int(a^b) + elif d=='<<':c=a<<b + elif d=='>>':c=a>>b + else:c=0 + return c +def get_num(lst): + if not lst:raise PreprocError("empty list for get_num") + (p,v)=lst[0] + if p==OP: + if v=='(': + count_par=1 + i=1 + while i<len(lst): + (p,v)=lst[i] + if p==OP: + if v==')': + count_par-=1 + if count_par==0: + break + elif v=='(': + count_par+=1 + i+=1 + else: + raise PreprocError("rparen expected %r"%lst) + (num,_)=get_term(lst[1:i]) + return(num,lst[i+1:]) + elif v=='+': + return get_num(lst[1:]) + elif v=='-': + num,lst=get_num(lst[1:]) + return(reduce_nums('-1',num,'*'),lst) + elif v=='!': + num,lst=get_num(lst[1:]) + return(int(not int(num)),lst) + elif v=='~': + return(~int(num),lst) + else: + raise PreprocError("Invalid op token %r for get_num"%lst) + elif p==NUM: + return v,lst[1:] + elif p==IDENT: + return 0,lst[1:] + else: + raise PreprocError("Invalid token %r for get_num"%lst) +def get_term(lst): + if not lst:raise PreprocError("empty list for get_term") + num,lst=get_num(lst) + if not lst: + return(num,[]) + (p,v)=lst[0] + if p==OP: + if v=='&&'and not num: + return(num,[]) + elif v=='||'and num: + return(num,[]) + elif v==',': + return get_term(lst[1:]) + elif v=='?': + count_par=0 + i=1 + while i<len(lst): + (p,v)=lst[i] + if p==OP: + if v==')': + count_par-=1 + elif v=='(': + count_par+=1 + elif v==':': + if count_par==0: + break + i+=1 + else: + raise PreprocError("rparen expected %r"%lst) + if int(num): + return get_term(lst[1:i]) + else: + return get_term(lst[i+1:]) + else: + num2,lst=get_num(lst[1:]) + if not lst: + num2=reduce_nums(num,num2,v) + return get_term([(NUM,num2)]+lst) + p2,v2=lst[0] + if p2!=OP: + raise PreprocError("op expected %r"%lst) + if prec[v2]>=prec[v]: + num2=reduce_nums(num,num2,v) + return get_term([(NUM,num2)]+lst) + else: + num3,lst=get_num(lst[1:]) + num3=reduce_nums(num2,num3,v2) + return get_term([(NUM,num),(p,v),(NUM,num3)]+lst) + raise PreprocError("cannot reduce %r"%lst) +def reduce_eval(lst): + num,lst=get_term(lst) + return(NUM,num) +def stringize(lst): + lst=[str(v2)for(p2,v2)in lst] + return"".join(lst) +def paste_tokens(t1,t2): + p1=None + if t1[0]==OP and t2[0]==OP: + p1=OP + elif t1[0]==IDENT and(t2[0]==IDENT or t2[0]==NUM): + p1=IDENT + elif t1[0]==NUM and t2[0]==NUM: + p1=NUM + if not p1: + raise PreprocError('tokens do not make a valid paste %r and %r'%(t1,t2)) + return(p1,t1[1]+t2[1]) +def reduce_tokens(lst,defs,ban=[]): + i=0 + while i<len(lst): + (p,v)=lst[i] + if p==IDENT and v=="defined": + del lst[i] + if i<len(lst): + (p2,v2)=lst[i] + if p2==IDENT: + if v2 in defs: + lst[i]=(NUM,1) + else: + lst[i]=(NUM,0) + elif p2==OP and v2=='(': + del lst[i] + (p2,v2)=lst[i] + del lst[i] + if v2 in defs: + lst[i]=(NUM,1) + else: + lst[i]=(NUM,0) + else: + raise PreprocError("Invalid define expression %r"%lst) + elif p==IDENT and v in defs: + if isinstance(defs[v],str): + a,b=extract_macro(defs[v]) + defs[v]=b + macro_def=defs[v] + to_add=macro_def[1] + if isinstance(macro_def[0],list): + del lst[i] + for x in range(len(to_add)): + lst.insert(i,to_add[x]) + i+=1 + else: + args=[] + del lst[i] + if i>=len(lst): + raise PreprocError("expected '(' after %r (got nothing)"%v) + (p2,v2)=lst[i] + if p2!=OP or v2!='(': + raise PreprocError("expected '(' after %r"%v) + del lst[i] + one_param=[] + count_paren=0 + while i<len(lst): + p2,v2=lst[i] + del lst[i] + if p2==OP and count_paren==0: + if v2=='(': + one_param.append((p2,v2)) + count_paren+=1 + elif v2==')': + if one_param:args.append(one_param) + break + elif v2==',': + if not one_param:raise PreprocError("empty param in funcall %s"%p) + args.append(one_param) + one_param=[] + else: + one_param.append((p2,v2)) + else: + one_param.append((p2,v2)) + if v2=='(':count_paren+=1 + elif v2==')':count_paren-=1 + else: + raise PreprocError('malformed macro') + accu=[] + arg_table=macro_def[0] + j=0 + while j<len(to_add): + (p2,v2)=to_add[j] + if p2==OP and v2=='#': + if j+1<len(to_add)and to_add[j+1][0]==IDENT and to_add[j+1][1]in arg_table: + toks=args[arg_table[to_add[j+1][1]]] + accu.append((STR,stringize(toks))) + j+=1 + else: + accu.append((p2,v2)) + elif p2==OP and v2=='##': + if accu and j+1<len(to_add): + t1=accu[-1] + if to_add[j+1][0]==IDENT and to_add[j+1][1]in arg_table: + toks=args[arg_table[to_add[j+1][1]]] + if toks: + accu[-1]=paste_tokens(t1,toks[0]) + accu.extend(toks[1:]) + else: + accu.append((p2,v2)) + accu.extend(toks) + elif to_add[j+1][0]==IDENT and to_add[j+1][1]=='__VA_ARGS__': + va_toks=[] + st=len(macro_def[0]) + pt=len(args) + for x in args[pt-st+1:]: + va_toks.extend(x) + va_toks.append((OP,',')) + if va_toks:va_toks.pop() + if len(accu)>1: + (p3,v3)=accu[-1] + (p4,v4)=accu[-2] + if v3=='##': + accu.pop() + if v4==','and pt<st: + accu.pop() + accu+=va_toks + else: + accu[-1]=paste_tokens(t1,to_add[j+1]) + j+=1 + else: + accu.append((p2,v2)) + elif p2==IDENT and v2 in arg_table: + toks=args[arg_table[v2]] + reduce_tokens(toks,defs,ban+[v]) + accu.extend(toks) + else: + accu.append((p2,v2)) + j+=1 + reduce_tokens(accu,defs,ban+[v]) + for x in range(len(accu)-1,-1,-1): + lst.insert(i,accu[x]) + i+=1 +def eval_macro(lst,defs): + reduce_tokens(lst,defs,[]) + if not lst:raise PreprocError("missing tokens to evaluate") + (p,v)=reduce_eval(lst) + return int(v)!=0 +def extract_macro(txt): + t=tokenize(txt) + if re_fun.search(txt): + p,name=t[0] + p,v=t[1] + if p!=OP:raise PreprocError("expected open parenthesis") + i=1 + pindex=0 + params={} + prev='(' + while 1: + i+=1 + p,v=t[i] + if prev=='(': + if p==IDENT: + params[v]=pindex + pindex+=1 + prev=p + elif p==OP and v==')': + break + else: + raise PreprocError("unexpected token (3)") + elif prev==IDENT: + if p==OP and v==',': + prev=v + elif p==OP and v==')': + break + else: + raise PreprocError("comma or ... expected") + elif prev==',': + if p==IDENT: + params[v]=pindex + pindex+=1 + prev=p + elif p==OP and v=='...': + raise PreprocError("not implemented (1)") + else: + raise PreprocError("comma or ... expected (2)") + elif prev=='...': + raise PreprocError("not implemented (2)") + else: + raise PreprocError("unexpected else") + return(name,[params,t[i+1:]]) + else: + (p,v)=t[0] + return(v,[[],t[1:]]) +re_include=re.compile('^\s*(<(?P<a>.*)>|"(?P<b>.*)")') +def extract_include(txt,defs): + m=re_include.search(txt) + if m: + if m.group('a'):return'<',m.group('a') + if m.group('b'):return'"',m.group('b') + toks=tokenize(txt) + reduce_tokens(toks,defs,['waf_include']) + if not toks: + raise PreprocError("could not parse include %s"%txt) + if len(toks)==1: + if toks[0][0]==STR: + return'"',toks[0][1] + else: + if toks[0][1]=='<'and toks[-1][1]=='>': + return stringize(toks).lstrip('<').rstrip('>') + raise PreprocError("could not parse include %s."%txt) +def parse_char(txt): + if not txt:raise PreprocError("attempted to parse a null char") + if txt[0]!='\\': + return ord(txt) + c=txt[1] + if c=='x': + if len(txt)==4 and txt[3]in string.hexdigits:return int(txt[2:],16) + return int(txt[2:],16) + elif c.isdigit(): + if c=='0'and len(txt)==2:return 0 + for i in 3,2,1: + if len(txt)>i and txt[1:1+i].isdigit(): + return(1+i,int(txt[1:1+i],8)) + else: + try:return chr_esc[c] + except KeyError:raise PreprocError("could not parse char literal '%s'"%txt) +def tokenize(s): + ret=[] + for match in re_clexer.finditer(s): + m=match.group + for name in tok_types: + v=m(name) + if v: + if name==IDENT: + try:v=g_optrans[v];name=OP + except KeyError: + if v.lower()=="true": + v=1 + name=NUM + elif v.lower()=="false": + v=0 + name=NUM + elif name==NUM: + if m('oct'):v=int(v,8) + elif m('hex'):v=int(m('hex'),16) + elif m('n0'):v=m('n0') + else: + v=m('char') + if v:v=parse_char(v) + else:v=m('n2')or m('n4') + elif name==OP: + if v=='%:':v='#' + elif v=='%:%:':v='##' + elif name==STR: + v=v[1:-1] + ret.append((name,v)) + break + return ret +def define_name(line): + return re_mac.match(line).group(0) +class c_parser(object): + def __init__(self,nodepaths=None,defines=None): + self.lines=[] + if defines is None: + self.defs={} + else: + self.defs=dict(defines) + self.state=[] + self.count_files=0 + self.currentnode_stack=[] + self.nodepaths=nodepaths or[] + self.nodes=[] + self.names=[] + self.curfile='' + self.ban_includes=set([]) + def cached_find_resource(self,node,filename): + try: + nd=node.ctx.cache_nd + except: + nd=node.ctx.cache_nd={} + tup=(node,filename) + try: + return nd[tup] + except KeyError: + ret=node.find_resource(filename) + if ret: + if getattr(ret,'children',None): + ret=None + elif ret.is_child_of(node.ctx.bldnode): + tmp=node.ctx.srcnode.search(ret.path_from(node.ctx.bldnode)) + if tmp and getattr(tmp,'children',None): + ret=None + nd[tup]=ret + return ret + def tryfind(self,filename): + self.curfile=filename + found=self.cached_find_resource(self.currentnode_stack[-1],filename) + for n in self.nodepaths: + if found: + break + found=self.cached_find_resource(n,filename) + if found: + self.nodes.append(found) + if filename[-4:]!='.moc': + self.addlines(found) + else: + if not filename in self.names: + self.names.append(filename) + return found + def addlines(self,node): + self.currentnode_stack.append(node.parent) + filepath=node.abspath() + self.count_files+=1 + if self.count_files>recursion_limit: + raise PreprocError("recursion limit exceeded") + pc=self.parse_cache + debug('preproc: reading file %r',filepath) + try: + lns=pc[filepath] + except KeyError: + pass + else: + self.lines.extend(lns) + return + try: + lines=filter_comments(filepath) + lines.append((POPFILE,'')) + lines.reverse() + pc[filepath]=lines + self.lines.extend(lines) + except IOError: + raise PreprocError("could not read the file %s"%filepath) + except Exception: + if Logs.verbose>0: + error("parsing %s failed"%filepath) + traceback.print_exc() + def start(self,node,env): + debug('preproc: scanning %s (in %s)',node.name,node.parent.name) + bld=node.ctx + try: + self.parse_cache=bld.parse_cache + except AttributeError: + bld.parse_cache={} + self.parse_cache=bld.parse_cache + self.addlines(node) + if env['DEFINES']: + try: + lst=['%s %s'%(x[0],trimquotes('='.join(x[1:])))for x in[y.split('=')for y in env['DEFINES']]] + lst.reverse() + self.lines.extend([('define',x)for x in lst]) + except AttributeError: + pass + while self.lines: + (token,line)=self.lines.pop() + if token==POPFILE: + self.count_files-=1 + self.currentnode_stack.pop() + continue + try: + ve=Logs.verbose + if ve:debug('preproc: line is %s - %s state is %s',token,line,self.state) + state=self.state + if token[:2]=='if': + state.append(undefined) + elif token=='endif': + state.pop() + if token[0]!='e': + if skipped in self.state or ignored in self.state: + continue + if token=='if': + ret=eval_macro(tokenize(line),self.defs) + if ret:state[-1]=accepted + else:state[-1]=ignored + elif token=='ifdef': + m=re_mac.match(line) + if m and m.group(0)in self.defs:state[-1]=accepted + else:state[-1]=ignored + elif token=='ifndef': + m=re_mac.match(line) + if m and m.group(0)in self.defs:state[-1]=ignored + else:state[-1]=accepted + elif token=='include'or token=='import': + (kind,inc)=extract_include(line,self.defs) + if inc in self.ban_includes: + continue + if token=='import':self.ban_includes.add(inc) + if ve:debug('preproc: include found %s (%s) ',inc,kind) + if kind=='"'or not strict_quotes: + self.tryfind(inc) + elif token=='elif': + if state[-1]==accepted: + state[-1]=skipped + elif state[-1]==ignored: + if eval_macro(tokenize(line),self.defs): + state[-1]=accepted + elif token=='else': + if state[-1]==accepted:state[-1]=skipped + elif state[-1]==ignored:state[-1]=accepted + elif token=='define': + try: + self.defs[define_name(line)]=line + except: + raise PreprocError("Invalid define line %s"%line) + elif token=='undef': + m=re_mac.match(line) + if m and m.group(0)in self.defs: + self.defs.__delitem__(m.group(0)) + elif token=='pragma': + if re_pragma_once.match(line.lower()): + self.ban_includes.add(self.curfile) + except Exception ,e: + if Logs.verbose: + debug('preproc: line parsing failed (%s): %s %s',e,line,Utils.ex_stack()) +def scan(task): + global go_absolute + try: + incn=task.generator.includes_nodes + except AttributeError: + raise Errors.WafError('%r is missing a feature such as "c", "cxx" or "includes": '%task.generator) + if go_absolute: + nodepaths=incn+standard_includes + else: + nodepaths=[x for x in incn if x.is_child_of(x.ctx.srcnode)or x.is_child_of(x.ctx.bldnode)] + tmp=c_parser(nodepaths) + tmp.start(task.inputs[0],task.env) + if Logs.verbose: + debug('deps: deps for %r: %r; unresolved %r'%(task.inputs,tmp.nodes,tmp.names)) + return(tmp.nodes,tmp.names) + +Utils.run_once(tokenize) +Utils.run_once(define_name)
\ No newline at end of file diff --git a/waflib/Tools/c_tests.py b/waflib/Tools/c_tests.py new file mode 100644 index 0000000..30f92c5 --- /dev/null +++ b/waflib/Tools/c_tests.py @@ -0,0 +1,146 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +from waflib import Task +from waflib.Configure import conf +from waflib.TaskGen import feature,before_method,after_method +import sys +LIB_CODE=''' +#ifdef _MSC_VER +#define testEXPORT __declspec(dllexport) +#else +#define testEXPORT +#endif +testEXPORT int lib_func(void) { return 9; } +''' +MAIN_CODE=''' +#ifdef _MSC_VER +#define testEXPORT __declspec(dllimport) +#else +#define testEXPORT +#endif +testEXPORT int lib_func(void); +int main(void) {return !(lib_func() == 9);} +''' +def link_lib_test_fun(self): + def write_test_file(task): + task.outputs[0].write(task.generator.code) + rpath=[] + if getattr(self,'add_rpath',False): + rpath=[self.bld.path.get_bld().abspath()] + mode=self.mode + m='%s %s'%(mode,mode) + ex=self.test_exec and'test_exec'or'' + bld=self.bld + bld(rule=write_test_file,target='test.'+mode,code=LIB_CODE) + bld(rule=write_test_file,target='main.'+mode,code=MAIN_CODE) + bld(features='%sshlib'%m,source='test.'+mode,target='test') + bld(features='%sprogram %s'%(m,ex),source='main.'+mode,target='app',use='test',rpath=rpath) +def check_library(self,mode=None,test_exec=True): + if not mode: + mode='c' + if self.env.CXX: + mode='cxx' + self.check(compile_filename=[],features='link_lib_test',msg='Checking for libraries',mode=mode,test_exec=test_exec,) +INLINE_CODE=''' +typedef int foo_t; +static %s foo_t static_foo () {return 0; } +%s foo_t foo () { + return 0; +} +''' +INLINE_VALUES=['inline','__inline__','__inline'] +def check_inline(self,**kw): + self.start_msg('Checking for inline') + if not'define_name'in kw: + kw['define_name']='INLINE_MACRO' + if not'features'in kw: + if self.env.CXX: + kw['features']=['cxx'] + else: + kw['features']=['c'] + for x in INLINE_VALUES: + kw['fragment']=INLINE_CODE%(x,x) + try: + self.check(**kw) + except self.errors.ConfigurationError: + continue + else: + self.end_msg(x) + if x!='inline': + self.define('inline',x,quote=False) + return x + self.fatal('could not use inline functions') +LARGE_FRAGMENT='#include <unistd.h>\nint main() { return !(sizeof(off_t) >= 8); }\n' +def check_large_file(self,**kw): + if not'define_name'in kw: + kw['define_name']='HAVE_LARGEFILE' + if not'execute'in kw: + kw['execute']=True + if not'features'in kw: + if self.env.CXX: + kw['features']=['cxx','cxxprogram'] + else: + kw['features']=['c','cprogram'] + kw['fragment']=LARGE_FRAGMENT + kw['msg']='Checking for large file support' + ret=True + try: + if self.env.DEST_BINFMT!='pe': + ret=self.check(**kw) + except self.errors.ConfigurationError: + pass + else: + if ret: + return True + kw['msg']='Checking for -D_FILE_OFFSET_BITS=64' + kw['defines']=['_FILE_OFFSET_BITS=64'] + try: + ret=self.check(**kw) + except self.errors.ConfigurationError: + pass + else: + self.define('_FILE_OFFSET_BITS',64) + return ret + self.fatal('There is no support for large files') +ENDIAN_FRAGMENT=''' +short int ascii_mm[] = { 0x4249, 0x4765, 0x6E44, 0x6961, 0x6E53, 0x7953, 0 }; +short int ascii_ii[] = { 0x694C, 0x5454, 0x656C, 0x6E45, 0x6944, 0x6E61, 0 }; +int use_ascii (int i) { + return ascii_mm[i] + ascii_ii[i]; +} +short int ebcdic_ii[] = { 0x89D3, 0xE3E3, 0x8593, 0x95C5, 0x89C4, 0x9581, 0 }; +short int ebcdic_mm[] = { 0xC2C9, 0xC785, 0x95C4, 0x8981, 0x95E2, 0xA8E2, 0 }; +int use_ebcdic (int i) { + return ebcdic_mm[i] + ebcdic_ii[i]; +} +extern int foo; +''' +class grep_for_endianness(Task.Task): + color='PINK' + def run(self): + txt=self.inputs[0].read(flags='rb').decode('iso8859-1') + if txt.find('LiTTleEnDian')>-1: + self.generator.tmp.append('little') + elif txt.find('BIGenDianSyS')>-1: + self.generator.tmp.append('big') + else: + return-1 +def grep_for_endianness_fun(self): + self.create_task('grep_for_endianness',self.compiled_tasks[0].outputs[0]) +def check_endianness(self): + tmp=[] + def check_msg(self): + return tmp[0] + self.check(fragment=ENDIAN_FRAGMENT,features='c grep_for_endianness',msg="Checking for endianness",define='ENDIANNESS',tmp=tmp,okmsg=check_msg) + return tmp[0] + +feature('link_lib_test')(link_lib_test_fun) +before_method('process_source')(link_lib_test_fun) +conf(check_library) +conf(check_inline) +conf(check_large_file) +feature('grep_for_endianness')(grep_for_endianness_fun) +after_method('process_source')(grep_for_endianness_fun) +conf(check_endianness)
\ No newline at end of file diff --git a/waflib/Tools/ccroot.py b/waflib/Tools/ccroot.py new file mode 100644 index 0000000..e95f793 --- /dev/null +++ b/waflib/Tools/ccroot.py @@ -0,0 +1,375 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import sys +if sys.hexversion < 0x020400f0: from sets import Set as set +import os,sys,re +from waflib import TaskGen,Task,Utils,Logs,Build,Options,Node,Errors +from waflib.Logs import error,debug,warn +from waflib.TaskGen import after_method,before_method,feature,taskgen_method,extension +from waflib.Tools import c_aliases,c_preproc,c_config,c_osx,c_tests +from waflib.Configure import conf +USELIB_VARS=Utils.defaultdict(set) +USELIB_VARS['c']=set(['INCLUDES','FRAMEWORKPATH','DEFINES','CPPFLAGS','CCDEPS','CFLAGS','ARCH']) +USELIB_VARS['cxx']=set(['INCLUDES','FRAMEWORKPATH','DEFINES','CPPFLAGS','CXXDEPS','CXXFLAGS','ARCH']) +USELIB_VARS['d']=set(['INCLUDES','DFLAGS']) +USELIB_VARS['cprogram']=USELIB_VARS['cxxprogram']=set(['LIB','STLIB','LIBPATH','STLIBPATH','LINKFLAGS','RPATH','LINKDEPS','FRAMEWORK','FRAMEWORKPATH','ARCH']) +USELIB_VARS['cshlib']=USELIB_VARS['cxxshlib']=set(['LIB','STLIB','LIBPATH','STLIBPATH','LINKFLAGS','RPATH','LINKDEPS','FRAMEWORK','FRAMEWORKPATH','ARCH']) +USELIB_VARS['cstlib']=USELIB_VARS['cxxstlib']=set(['ARFLAGS','LINKDEPS']) +USELIB_VARS['dprogram']=set(['LIB','STLIB','LIBPATH','STLIBPATH','LINKFLAGS','RPATH','LINKDEPS']) +USELIB_VARS['dshlib']=set(['LIB','STLIB','LIBPATH','STLIBPATH','LINKFLAGS','RPATH','LINKDEPS']) +USELIB_VARS['dstlib']=set(['ARFLAGS','LINKDEPS']) +USELIB_VARS['go']=set(['GOCFLAGS']) +USELIB_VARS['goprogram']=set(['GOLFLAGS']) +USELIB_VARS['asm']=set(['ASFLAGS']) +def create_compiled_task(self,name,node): + out='%s.%d.o'%(node.name,self.idx) + task=self.create_task(name,node,node.parent.find_or_declare(out)) + try: + self.compiled_tasks.append(task) + except AttributeError: + self.compiled_tasks=[task] + return task +def to_incnodes(self,inlst): + lst=[] + seen=set([]) + for x in self.to_list(inlst): + if x in seen or not x: + continue + seen.add(x) + if isinstance(x,Node.Node): + lst.append(x) + else: + if os.path.isabs(x): + lst.append(self.bld.root.make_node(x)or x) + else: + if x[0]=='#': + p=self.bld.bldnode.make_node(x[1:]) + v=self.bld.srcnode.make_node(x[1:]) + else: + p=self.path.get_bld().make_node(x) + v=self.path.make_node(x) + if p.is_child_of(self.bld.bldnode): + p.mkdir() + lst.append(p) + lst.append(v) + return lst +def apply_incpaths(self): + lst=self.to_incnodes(self.to_list(getattr(self,'includes',[]))+self.env['INCLUDES']) + self.includes_nodes=lst + self.env['INCPATHS']=[x.abspath()for x in lst] +class link_task(Task.Task): + color='YELLOW' + inst_to=None + chmod=Utils.O644 + def add_target(self,target): + if isinstance(target,str): + pattern=self.env[self.__class__.__name__+'_PATTERN'] + if not pattern: + pattern='%s' + folder,name=os.path.split(target) + if self.__class__.__name__.find('shlib')>0: + if self.env.DEST_BINFMT=='pe'and getattr(self.generator,'vnum',None): + name=name+'-'+self.generator.vnum.split('.')[0] + tmp=folder+os.sep+pattern%name + target=self.generator.path.find_or_declare(tmp) + self.set_outputs(target) +class stlink_task(link_task): + run_str='${AR} ${ARFLAGS} ${AR_TGT_F}${TGT} ${AR_SRC_F}${SRC}' +def rm_tgt(cls): + old=cls.run + def wrap(self): + try:os.remove(self.outputs[0].abspath()) + except OSError:pass + return old(self) + setattr(cls,'run',wrap) +rm_tgt(stlink_task) +def apply_link(self): + for x in self.features: + if x=='cprogram'and'cxx'in self.features: + x='cxxprogram' + elif x=='cshlib'and'cxx'in self.features: + x='cxxshlib' + if x in Task.classes: + if issubclass(Task.classes[x],link_task): + link=x + break + else: + return + objs=[t.outputs[0]for t in getattr(self,'compiled_tasks',[])] + self.link_task=self.create_task(link,objs) + self.link_task.add_target(self.target) + try: + inst_to=self.install_path + except AttributeError: + inst_to=self.link_task.__class__.inst_to + if inst_to: + self.install_task=self.bld.install_files(inst_to,self.link_task.outputs[:],env=self.env,chmod=self.link_task.chmod) +def use_rec(self,name,**kw): + if name in self.tmp_use_not or name in self.tmp_use_seen: + return + try: + y=self.bld.get_tgen_by_name(name) + except Errors.WafError: + self.uselib.append(name) + self.tmp_use_not.add(name) + return + self.tmp_use_seen.append(name) + y.post() + y.tmp_use_objects=objects=kw.get('objects',True) + y.tmp_use_stlib=stlib=kw.get('stlib',True) + try: + link_task=y.link_task + except AttributeError: + y.tmp_use_var='' + else: + objects=False + if not isinstance(y.link_task,stlink_task): + stlib=False + y.tmp_use_var='LIB' + else: + y.tmp_use_var='STLIB' + p=self.tmp_use_prec + for x in self.to_list(getattr(y,'use',[])): + try: + p[x].append(name) + except: + p[x]=[name] + self.use_rec(x,objects=objects,stlib=stlib) +def process_use(self): + use_not=self.tmp_use_not=set([]) + use_seen=self.tmp_use_seen=[] + use_prec=self.tmp_use_prec={} + self.uselib=self.to_list(getattr(self,'uselib',[])) + self.includes=self.to_list(getattr(self,'includes',[])) + names=self.to_list(getattr(self,'use',[])) + for x in names: + self.use_rec(x) + for x in use_not: + if x in use_prec: + del use_prec[x] + out=[] + tmp=[] + for x in self.tmp_use_seen: + for k in use_prec.values(): + if x in k: + break + else: + tmp.append(x) + while tmp: + e=tmp.pop() + out.append(e) + try: + nlst=use_prec[e] + except KeyError: + pass + else: + del use_prec[e] + for x in nlst: + for y in use_prec: + if x in use_prec[y]: + break + else: + tmp.append(x) + if use_prec: + raise Errors.WafError('Cycle detected in the use processing %r'%use_prec) + out.reverse() + link_task=getattr(self,'link_task',None) + for x in out: + y=self.bld.get_tgen_by_name(x) + var=y.tmp_use_var + if var and link_task: + if var=='LIB'or y.tmp_use_stlib: + self.env.append_value(var,[y.target[y.target.rfind(os.sep)+1:]]) + self.link_task.dep_nodes.extend(y.link_task.outputs) + tmp_path=y.link_task.outputs[0].parent.path_from(self.bld.bldnode) + self.env.append_value(var+'PATH',[tmp_path]) + else: + if y.tmp_use_objects: + self.add_objects_from_tgen(y) + if getattr(y,'export_includes',None): + self.includes.extend(y.to_incnodes(y.export_includes)) + for x in names: + try: + y=self.bld.get_tgen_by_name(x) + except: + if not self.env['STLIB_'+x]and not x in self.uselib: + self.uselib.append(x) + else: + for k in self.to_list(getattr(y,'uselib',[])): + if not self.env['STLIB_'+k]and not k in self.uselib: + self.uselib.append(k) +def add_objects_from_tgen(self,tg): + try: + link_task=self.link_task + except AttributeError: + pass + else: + for tsk in getattr(tg,'compiled_tasks',[]): + for x in tsk.outputs: + if x.name.endswith('.o')or x.name.endswith('.obj'): + link_task.inputs.append(x) +def get_uselib_vars(self): + _vars=set([]) + for x in self.features: + if x in USELIB_VARS: + _vars|=USELIB_VARS[x] + return _vars +def propagate_uselib_vars(self): + _vars=self.get_uselib_vars() + env=self.env + for x in _vars: + y=x.lower() + env.append_unique(x,self.to_list(getattr(self,y,[]))) + for x in self.features: + for var in _vars: + compvar='%s_%s'%(var,x) + env.append_value(var,env[compvar]) + for x in self.to_list(getattr(self,'uselib',[])): + for v in _vars: + env.append_value(v,env[v+'_'+x]) +def apply_implib(self): + if not self.env.DEST_BINFMT=='pe': + return + dll=self.link_task.outputs[0] + if isinstance(self.target,Node.Node): + name=self.target.name + else: + name=os.path.split(self.target)[1] + implib=self.env['implib_PATTERN']%name + implib=dll.parent.find_or_declare(implib) + self.env.append_value('LINKFLAGS',self.env['IMPLIB_ST']%implib.bldpath()) + self.link_task.outputs.append(implib) + if getattr(self,'defs',None)and self.env.DEST_BINFMT=='pe': + node=self.path.find_resource(self.defs) + if not node: + raise Errors.WafError('invalid def file %r'%self.defs) + if'msvc'in(self.env.CC_NAME,self.env.CXX_NAME): + self.env.append_value('LINKFLAGS','/def:%s'%node.path_from(self.bld.bldnode)) + self.link_task.dep_nodes.append(node) + else: + self.link_task.inputs.append(node) + try: + inst_to=self.install_path + except AttributeError: + inst_to=self.link_task.__class__.inst_to + if not inst_to: + return + self.implib_install_task=self.bld.install_as('${PREFIX}/lib/%s'%implib.name,implib,self.env) +def apply_vnum(self): + if not getattr(self,'vnum','')or os.name!='posix'or self.env.DEST_BINFMT not in('elf','mac-o'): + return + link=self.link_task + nums=self.vnum.split('.') + node=link.outputs[0] + libname=node.name + if libname.endswith('.dylib'): + name3=libname.replace('.dylib','.%s.dylib'%self.vnum) + name2=libname.replace('.dylib','.%s.dylib'%nums[0]) + else: + name3=libname+'.'+self.vnum + name2=libname+'.'+nums[0] + if self.env.SONAME_ST: + v=self.env.SONAME_ST%name2 + self.env.append_value('LINKFLAGS',v.split()) + tsk=self.create_task('vnum',node,[node.parent.find_or_declare(name2),node.parent.find_or_declare(name3)]) + if getattr(self.bld,'is_install',None): + self.install_task.hasrun=Task.SKIP_ME + bld=self.bld + path=self.install_task.dest + t1=bld.install_as(path+os.sep+name3,node,env=self.env,chmod=self.link_task.chmod) + t2=bld.symlink_as(path+os.sep+name2,name3) + t3=bld.symlink_as(path+os.sep+libname,name3) + self.vnum_install_task=(t1,t2,t3) + if'-dynamiclib'in self.env['LINKFLAGS']and getattr(self,'install_task',None): + path=os.path.join(self.install_task.get_install_path(),self.link_task.outputs[0].name) + self.env.append_value('LINKFLAGS',['-install_name',path]) +class vnum(Task.Task): + color='CYAN' + quient=True + ext_in=['.bin'] + def run(self): + for x in self.outputs: + path=x.abspath() + try: + os.remove(path) + except OSError: + pass + try: + os.symlink(self.inputs[0].name,path) + except OSError: + return 1 +class fake_shlib(link_task): + def runnable_status(self): + for t in self.run_after: + if not t.hasrun: + return Task.ASK_LATER + for x in self.outputs: + x.sig=Utils.h_file(x.abspath()) + return Task.SKIP_ME +class fake_stlib(stlink_task): + def runnable_status(self): + for t in self.run_after: + if not t.hasrun: + return Task.ASK_LATER + for x in self.outputs: + x.sig=Utils.h_file(x.abspath()) + return Task.SKIP_ME +def read_shlib(self,name,paths=[]): + return self(name=name,features='fake_lib',lib_paths=paths,lib_type='shlib') +def read_stlib(self,name,paths=[]): + return self(name=name,features='fake_lib',lib_paths=paths,lib_type='stlib') +lib_patterns={'shlib':['lib%s.so','%s.so','lib%s.dll','%s.dll'],'stlib':['lib%s.a','%s.a','lib%s.dll','%s.dll','lib%s.lib','%s.lib'],} +def process_lib(self): + node=None + names=[x%self.name for x in lib_patterns[self.lib_type]] + for x in self.lib_paths+[self.path,'/usr/lib64','/usr/lib','/usr/local/lib64','/usr/local/lib']: + if not isinstance(x,Node.Node): + x=self.bld.root.find_node(x)or self.path.find_node(x) + if not x: + continue + for y in names: + node=x.find_node(y) + if node: + node.sig=Utils.h_file(node.abspath()) + break + else: + continue + break + else: + raise Errors.WafError('could not find library %r'%self.name) + self.link_task=self.create_task('fake_%s'%self.lib_type,[],[node]) + self.target=self.name +class fake_o(Task.Task): + def runnable_status(self): + return Task.SKIP_ME +def add_those_o_files(self,node): + tsk=self.create_task('fake_o',[],node) + try: + self.compiled_tasks.append(tsk) + except AttributeError: + self.compiled_tasks=[tsk] + +taskgen_method(create_compiled_task) +taskgen_method(to_incnodes) +feature('c','cxx','d','go','asm','fc','includes')(apply_incpaths) +after_method('propagate_uselib_vars','process_source')(apply_incpaths) +feature('c','cxx','d','go','fc','asm')(apply_link) +after_method('process_source')(apply_link) +taskgen_method(use_rec) +feature('c','cxx','d','use','fc')(process_use) +before_method('apply_incpaths','propagate_uselib_vars')(process_use) +after_method('apply_link','process_source')(process_use) +taskgen_method(add_objects_from_tgen) +taskgen_method(get_uselib_vars) +feature('c','cxx','d','fc','javac','cs','uselib')(propagate_uselib_vars) +after_method('process_use')(propagate_uselib_vars) +feature('cshlib','cxxshlib','fcshlib')(apply_implib) +after_method('apply_link')(apply_implib) +feature('cshlib','cxxshlib','dshlib','fcshlib','vnum')(apply_vnum) +after_method('apply_link')(apply_vnum) +conf(read_shlib) +conf(read_stlib) +feature('fake_lib')(process_lib) +extension('.o','.obj')(add_those_o_files)
\ No newline at end of file diff --git a/waflib/Tools/compiler_c.py b/waflib/Tools/compiler_c.py new file mode 100644 index 0000000..04504fa --- /dev/null +++ b/waflib/Tools/compiler_c.py @@ -0,0 +1,39 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os,sys,imp,types +from waflib.Tools import ccroot +from waflib import Utils,Configure +from waflib.Logs import debug +c_compiler={'win32':['msvc','gcc'],'cygwin':['gcc'],'darwin':['gcc'],'aix':['xlc','gcc'],'linux':['gcc','icc'],'sunos':['suncc','gcc'],'irix':['gcc','irixcc'],'hpux':['gcc'],'gnu':['gcc'],'java':['gcc','msvc','icc'],'default':['gcc'],} +def configure(conf): + try:test_for_compiler=conf.options.check_c_compiler + except AttributeError:conf.fatal("Add options(opt): opt.load('compiler_c')") + for compiler in test_for_compiler.split(): + conf.env.stash() + conf.start_msg('Checking for %r (c compiler)'%compiler) + try: + conf.load(compiler) + except conf.errors.ConfigurationError ,e: + conf.env.revert() + conf.end_msg(False) + debug('compiler_c: %r'%e) + else: + if conf.env['CC']: + conf.end_msg(conf.env.get_flat('CC')) + conf.env['COMPILER_CC']=compiler + break + conf.end_msg(False) + else: + conf.fatal('could not configure a c compiler!') +def options(opt): + opt.load_special_tools('c_*.py',ban=['c_dumbpreproc.py']) + global c_compiler + build_platform=Utils.unversioned_sys_platform() + possible_compiler_list=c_compiler[build_platform in c_compiler and build_platform or'default'] + test_for_compiler=' '.join(possible_compiler_list) + cc_compiler_opts=opt.add_option_group("C Compiler Options") + cc_compiler_opts.add_option('--check-c-compiler',default="%s"%test_for_compiler,help='On this platform (%s) the following C-Compiler will be checked by default: "%s"'%(build_platform,test_for_compiler),dest="check_c_compiler") + for x in test_for_compiler.split(): + opt.load('%s'%x) diff --git a/waflib/Tools/compiler_cxx.py b/waflib/Tools/compiler_cxx.py new file mode 100644 index 0000000..14b7c7d --- /dev/null +++ b/waflib/Tools/compiler_cxx.py @@ -0,0 +1,39 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os,sys,imp,types +from waflib.Tools import ccroot +from waflib import Utils,Configure +from waflib.Logs import debug +cxx_compiler={'win32':['msvc','g++'],'cygwin':['g++'],'darwin':['g++'],'aix':['xlc++','g++'],'linux':['g++','icpc'],'sunos':['sunc++','g++'],'irix':['g++'],'hpux':['g++'],'gnu':['g++'],'java':['g++','msvc','icpc'],'default':['g++']} +def configure(conf): + try:test_for_compiler=conf.options.check_cxx_compiler + except AttributeError:conf.fatal("Add options(opt): opt.load('compiler_cxx')") + for compiler in test_for_compiler.split(): + conf.env.stash() + conf.start_msg('Checking for %r (c++ compiler)'%compiler) + try: + conf.load(compiler) + except conf.errors.ConfigurationError ,e: + conf.env.revert() + conf.end_msg(False) + debug('compiler_cxx: %r'%e) + else: + if conf.env['CXX']: + conf.end_msg(conf.env.get_flat('CXX')) + conf.env['COMPILER_CXX']=compiler + break + conf.end_msg(False) + else: + conf.fatal('could not configure a c++ compiler!') +def options(opt): + opt.load_special_tools('cxx_*.py') + global cxx_compiler + build_platform=Utils.unversioned_sys_platform() + possible_compiler_list=cxx_compiler[build_platform in cxx_compiler and build_platform or'default'] + test_for_compiler=' '.join(possible_compiler_list) + cxx_compiler_opts=opt.add_option_group('C++ Compiler Options') + cxx_compiler_opts.add_option('--check-cxx-compiler',default="%s"%test_for_compiler,help='On this platform (%s) the following C++ Compiler will be checked by default: "%s"'%(build_platform,test_for_compiler),dest="check_cxx_compiler") + for x in test_for_compiler.split(): + opt.load('%s'%x) diff --git a/waflib/Tools/compiler_d.py b/waflib/Tools/compiler_d.py new file mode 100644 index 0000000..b5396b0 --- /dev/null +++ b/waflib/Tools/compiler_d.py @@ -0,0 +1,30 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os,sys,imp,types +from waflib import Utils,Configure,Options,Logs +def configure(conf): + for compiler in conf.options.dcheck.split(','): + conf.env.stash() + conf.start_msg('Checking for %r (d compiler)'%compiler) + try: + conf.load(compiler) + except conf.errors.ConfigurationError ,e: + conf.env.revert() + conf.end_msg(False) + Logs.debug('compiler_cxx: %r'%e) + else: + if conf.env.D: + conf.end_msg(conf.env.get_flat('D')) + conf.env['COMPILER_D']=compiler + conf.env.D_COMPILER=conf.env.D + break + conf.end_msg(False) + else: + conf.fatal('no suitable d compiler was found') +def options(opt): + d_compiler_opts=opt.add_option_group('D Compiler Options') + d_compiler_opts.add_option('--check-d-compiler',default='gdc,dmd',action='store',help='check for the compiler [Default:gdc,dmd]',dest='dcheck') + for d_compiler in['gdc','dmd']: + opt.load('%s'%d_compiler) diff --git a/waflib/Tools/compiler_fc.py b/waflib/Tools/compiler_fc.py new file mode 100644 index 0000000..ec5d2ea --- /dev/null +++ b/waflib/Tools/compiler_fc.py @@ -0,0 +1,43 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os,sys,imp,types +from waflib import Utils,Configure,Options,Logs,Errors +from waflib.Tools import fc +fc_compiler={'win32':['gfortran','ifort'],'darwin':['gfortran','g95','ifort'],'linux':['gfortran','g95','ifort'],'java':['gfortran','g95','ifort'],'default':['gfortran'],'aix':['gfortran']} +def __list_possible_compiler(platform): + try: + return fc_compiler[platform] + except KeyError: + return fc_compiler["default"] +def configure(conf): + try:test_for_compiler=conf.options.check_fc + except AttributeError:conf.fatal("Add options(opt): opt.load('compiler_fc')") + for compiler in test_for_compiler.split(): + conf.env.stash() + conf.start_msg('Checking for %r (fortran compiler)'%compiler) + try: + conf.load(compiler) + except conf.errors.ConfigurationError ,e: + conf.env.revert() + conf.end_msg(False) + Logs.debug('compiler_fortran: %r'%e) + else: + if conf.env['FC']: + conf.end_msg(conf.env.get_flat('FC')) + conf.env.COMPILER_FORTRAN=compiler + break + conf.end_msg(False) + else: + conf.fatal('could not configure a fortran compiler!') +def options(opt): + opt.load_special_tools('fc_*.py') + build_platform=Utils.unversioned_sys_platform() + detected_platform=Options.platform + possible_compiler_list=__list_possible_compiler(detected_platform) + test_for_compiler=' '.join(possible_compiler_list) + fortran_compiler_opts=opt.add_option_group("Fortran Compiler Options") + fortran_compiler_opts.add_option('--check-fortran-compiler',default="%s"%test_for_compiler,help='On this platform (%s) the following Fortran Compiler will be checked by default: "%s"'%(detected_platform,test_for_compiler),dest="check_fc") + for compiler in test_for_compiler.split(): + opt.load('%s'%compiler) diff --git a/waflib/Tools/cs.py b/waflib/Tools/cs.py new file mode 100644 index 0000000..0fdf761 --- /dev/null +++ b/waflib/Tools/cs.py @@ -0,0 +1,98 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import sys +if sys.hexversion < 0x020400f0: from sets import Set as set +from waflib import Utils,Task,Options,Logs,Errors +from waflib.TaskGen import before_method,after_method,feature +from waflib.Tools import ccroot +from waflib.Configure import conf +ccroot.USELIB_VARS['cs']=set(['CSFLAGS','ASSEMBLIES','RESOURCES']) +ccroot.lib_patterns['csshlib']=['%s'] +def apply_cs(self): + cs_nodes=[] + no_nodes=[] + for x in self.to_nodes(self.source): + if x.name.endswith('.cs'): + cs_nodes.append(x) + else: + no_nodes.append(x) + self.source=no_nodes + bintype=getattr(self,'type',self.gen.endswith('.dll')and'library'or'exe') + self.cs_task=tsk=self.create_task('mcs',cs_nodes,self.path.find_or_declare(self.gen)) + tsk.env.CSTYPE='/target:%s'%bintype + tsk.env.OUT='/out:%s'%tsk.outputs[0].abspath() + inst_to=getattr(self,'install_path',bintype=='exe'and'${BINDIR}'or'${LIBDIR}') + if inst_to: + mod=getattr(self,'chmod',bintype=='exe'and Utils.O755 or Utils.O644) + self.install_task=self.bld.install_files(inst_to,self.cs_task.outputs[:],env=self.env,chmod=mod) +def use_cs(self): + names=self.to_list(getattr(self,'use',[])) + get=self.bld.get_tgen_by_name + for x in names: + try: + y=get(x) + except Errors.WafError: + self.cs_task.env.append_value('CSFLAGS','/reference:%s'%x) + continue + y.post() + tsk=getattr(y,'cs_task',None)or getattr(y,'link_task',None) + if not tsk: + self.bld.fatal('cs task has no link task for use %r'%self) + self.cs_task.dep_nodes.extend(tsk.outputs) + self.cs_task.set_run_after(tsk) + self.cs_task.env.append_value('CSFLAGS','/reference:%s'%tsk.outputs[0].abspath()) +def debug_cs(self): + csdebug=getattr(self,'csdebug',self.env.CSDEBUG) + if not csdebug: + return + node=self.cs_task.outputs[0] + if self.env.CS_NAME=='mono': + out=node.parent.find_or_declare(node.name+'.mdb') + else: + out=node.change_ext('.pdb') + self.cs_task.outputs.append(out) + try: + self.install_task.source.append(out) + except AttributeError: + pass + if csdebug=='pdbonly': + val=['/debug+','/debug:pdbonly'] + elif csdebug=='full': + val=['/debug+','/debug:full'] + else: + val=['/debug-'] + self.cs_task.env.append_value('CSFLAGS',val) +class mcs(Task.Task): + color='YELLOW' + run_str='${MCS} ${CSTYPE} ${CSFLAGS} ${ASS_ST:ASSEMBLIES} ${RES_ST:RESOURCES} ${OUT} ${SRC}' +def configure(conf): + csc=getattr(Options.options,'cscbinary',None) + if csc: + conf.env.MCS=csc + conf.find_program(['csc','mcs','gmcs'],var='MCS') + conf.env.ASS_ST='/r:%s' + conf.env.RES_ST='/resource:%s' + conf.env.CS_NAME='csc' + if str(conf.env.MCS).lower().find('mcs')>-1: + conf.env.CS_NAME='mono' +def options(opt): + opt.add_option('--with-csc-binary',type='string',dest='cscbinary') +class fake_csshlib(Task.Task): + color='YELLOW' + inst_to=None + def runnable_status(self): + for x in self.outputs: + x.sig=Utils.h_file(x.abspath()) + return Task.SKIP_ME +def read_csshlib(self,name,paths=[]): + return self(name=name,features='fake_lib',lib_paths=paths,lib_type='csshlib') + +feature('cs')(apply_cs) +before_method('process_source')(apply_cs) +feature('cs')(use_cs) +after_method('apply_cs')(use_cs) +feature('cs')(debug_cs) +after_method('apply_cs','use_cs')(debug_cs) +conf(read_csshlib)
\ No newline at end of file diff --git a/waflib/Tools/cxx.py b/waflib/Tools/cxx.py new file mode 100644 index 0000000..e378383 --- /dev/null +++ b/waflib/Tools/cxx.py @@ -0,0 +1,27 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +from waflib import TaskGen,Task,Utils +from waflib.Tools import c_preproc +from waflib.Tools.ccroot import link_task,stlink_task +def cxx_hook(self,node): + return self.create_compiled_task('cxx',node) +TaskGen.extension('.cpp','.cc','.cxx','.C','.c++')(cxx_hook) +if not'.c'in TaskGen.task_gen.mappings: + TaskGen.task_gen.mappings['.c']=TaskGen.task_gen.mappings['.cpp'] +class cxx(Task.Task): + run_str='${CXX} ${ARCH_ST:ARCH} ${CXXFLAGS} ${CPPFLAGS} ${FRAMEWORKPATH_ST:FRAMEWORKPATH} ${CPPPATH_ST:INCPATHS} ${DEFINES_ST:DEFINES} ${CXX_SRC_F}${SRC} ${CXX_TGT_F}${TGT}' + vars=['CXXDEPS'] + ext_in=['.h'] + scan=c_preproc.scan +class cxxprogram(link_task): + run_str='${LINK_CXX} ${LINKFLAGS} ${CXXLNK_SRC_F}${SRC} ${CXXLNK_TGT_F}${TGT[0].abspath()} ${RPATH_ST:RPATH} ${FRAMEWORKPATH_ST:FRAMEWORKPATH} ${FRAMEWORK_ST:FRAMEWORK} ${ARCH_ST:ARCH} ${STLIB_MARKER} ${STLIBPATH_ST:STLIBPATH} ${STLIB_ST:STLIB} ${SHLIB_MARKER} ${LIBPATH_ST:LIBPATH} ${LIB_ST:LIB}' + vars=['LINKDEPS'] + ext_out=['.bin'] + inst_to='${BINDIR}' + chmod=Utils.O755 +class cxxshlib(cxxprogram): + inst_to='${LIBDIR}' +class cxxstlib(stlink_task): + pass diff --git a/waflib/Tools/d.py b/waflib/Tools/d.py new file mode 100644 index 0000000..b56f3dd --- /dev/null +++ b/waflib/Tools/d.py @@ -0,0 +1,56 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +from waflib import Utils,Task,Errors +from waflib.TaskGen import taskgen_method,feature,extension +from waflib.Tools import d_scan,d_config +from waflib.Tools.ccroot import link_task,stlink_task +class d(Task.Task): + color='GREEN' + run_str='${D} ${DFLAGS} ${DINC_ST:INCPATHS} ${D_SRC_F:SRC} ${D_TGT_F:TGT}' + scan=d_scan.scan +class d_with_header(d): + run_str='${D} ${DFLAGS} ${DINC_ST:INCPATHS} ${D_HDR_F:tgt.outputs[1].bldpath()} ${D_SRC_F:SRC} ${D_TGT_F:tgt.outputs[0].bldpath()}' +class d_header(Task.Task): + color='BLUE' + run_str='${D} ${D_HEADER} ${SRC}' +class dprogram(link_task): + run_str='${D_LINKER} ${LINKFLAGS} ${DLNK_SRC_F}${SRC} ${DLNK_TGT_F:TGT} ${RPATH_ST:RPATH} ${DSTLIB_MARKER} ${DSTLIBPATH_ST:STLIBPATH} ${DSTLIB_ST:STLIB} ${DSHLIB_MARKER} ${DLIBPATH_ST:LIBPATH} ${DSHLIB_ST:LIB}' + inst_to='${BINDIR}' + chmod=Utils.O755 +class dshlib(dprogram): + inst_to='${LIBDIR}' +class dstlib(stlink_task): + pass +def d_hook(self,node): + ext=Utils.destos_to_binfmt(self.env.DEST_OS)=='pe'and'obj'or'o' + out='%s.%d.%s'%(node.name,self.idx,ext) + def create_compiled_task(self,name,node): + task=self.create_task(name,node,node.parent.find_or_declare(out)) + try: + self.compiled_tasks.append(task) + except AttributeError: + self.compiled_tasks=[task] + return task + if getattr(self,'generate_headers',None): + tsk=create_compiled_task(self,'d_with_header',node) + tsk.outputs.append(node.change_ext(self.env['DHEADER_ext'])) + else: + tsk=create_compiled_task(self,'d',node) + return tsk +def generate_header(self,filename,install_path=None): + try: + self.header_lst.append([filename,install_path]) + except AttributeError: + self.header_lst=[[filename,install_path]] +def process_header(self): + for i in getattr(self,'header_lst',[]): + node=self.path.find_resource(i[0]) + if not node: + raise Errors.WafError('file %r not found on d obj'%i[0]) + self.create_task('d_header',node,node.change_ext('.di')) + +extension('.d','.di','.D')(d_hook) +taskgen_method(generate_header) +feature('d')(process_header)
\ No newline at end of file diff --git a/waflib/Tools/d_config.py b/waflib/Tools/d_config.py new file mode 100644 index 0000000..a61ac80 --- /dev/null +++ b/waflib/Tools/d_config.py @@ -0,0 +1,47 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +from waflib import Utils +from waflib.Configure import conf +def d_platform_flags(self): + v=self.env + if not v.DEST_OS: + v.DEST_OS=Utils.unversioned_sys_platform() + if Utils.destos_to_binfmt(self.env.DEST_OS)=='pe': + v['dprogram_PATTERN']='%s.exe' + v['dshlib_PATTERN']='lib%s.dll' + v['dstlib_PATTERN']='lib%s.a' + else: + v['dprogram_PATTERN']='%s' + v['dshlib_PATTERN']='lib%s.so' + v['dstlib_PATTERN']='lib%s.a' +DLIB=''' +version(D_Version2) { + import std.stdio; + int main() { + writefln("phobos2"); + return 0; + } +} else { + version(Tango) { + import tango.stdc.stdio; + int main() { + printf("tango"); + return 0; + } + } else { + import std.stdio; + int main() { + writefln("phobos1"); + return 0; + } + } +} +''' +def check_dlibrary(self): + ret=self.check_cc(features='d dprogram',fragment=DLIB,compile_filename='test.d',execute=True,define_ret=True) + self.env.DLIBRARY=ret.strip() + +conf(d_platform_flags) +conf(check_dlibrary)
\ No newline at end of file diff --git a/waflib/Tools/d_scan.py b/waflib/Tools/d_scan.py new file mode 100644 index 0000000..ee80c5f --- /dev/null +++ b/waflib/Tools/d_scan.py @@ -0,0 +1,133 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import re +from waflib import Utils,Logs +def filter_comments(filename): + txt=Utils.readf(filename) + i=0 + buf=[] + max=len(txt) + begin=0 + while i<max: + c=txt[i] + if c=='"'or c=="'": + buf.append(txt[begin:i]) + delim=c + i+=1 + while i<max: + c=txt[i] + if c==delim:break + elif c=='\\': + i+=1 + i+=1 + i+=1 + begin=i + elif c=='/': + buf.append(txt[begin:i]) + i+=1 + if i==max:break + c=txt[i] + if c=='+': + i+=1 + nesting=1 + c=None + while i<max: + prev=c + c=txt[i] + if prev=='/'and c=='+': + nesting+=1 + c=None + elif prev=='+'and c=='/': + nesting-=1 + if nesting==0:break + c=None + i+=1 + elif c=='*': + i+=1 + c=None + while i<max: + prev=c + c=txt[i] + if prev=='*'and c=='/':break + i+=1 + elif c=='/': + i+=1 + while i<max and txt[i]!='\n': + i+=1 + else: + begin=i-1 + continue + i+=1 + begin=i + buf.append(' ') + else: + i+=1 + buf.append(txt[begin:]) + return buf +class d_parser(object): + def __init__(self,env,incpaths): + self.allnames=[] + self.re_module=re.compile("module\s+([^;]+)") + self.re_import=re.compile("import\s+([^;]+)") + self.re_import_bindings=re.compile("([^:]+):(.*)") + self.re_import_alias=re.compile("[^=]+=(.+)") + self.env=env + self.nodes=[] + self.names=[] + self.incpaths=incpaths + def tryfind(self,filename): + found=0 + for n in self.incpaths: + found=n.find_resource(filename.replace('.','/')+'.d') + if found: + self.nodes.append(found) + self.waiting.append(found) + break + if not found: + if not filename in self.names: + self.names.append(filename) + def get_strings(self,code): + self.module='' + lst=[] + mod_name=self.re_module.search(code) + if mod_name: + self.module=re.sub('\s+','',mod_name.group(1)) + import_iterator=self.re_import.finditer(code) + if import_iterator: + for import_match in import_iterator: + import_match_str=re.sub('\s+','',import_match.group(1)) + bindings_match=self.re_import_bindings.match(import_match_str) + if bindings_match: + import_match_str=bindings_match.group(1) + matches=import_match_str.split(',') + for match in matches: + alias_match=self.re_import_alias.match(match) + if alias_match: + match=alias_match.group(1) + lst.append(match) + return lst + def start(self,node): + self.waiting=[node] + while self.waiting: + nd=self.waiting.pop(0) + self.iter(nd) + def iter(self,node): + path=node.abspath() + code="".join(filter_comments(path)) + names=self.get_strings(code) + for x in names: + if x in self.allnames:continue + self.allnames.append(x) + self.tryfind(x) +def scan(self): + env=self.env + gruik=d_parser(env,self.generator.includes_nodes) + node=self.inputs[0] + gruik.start(node) + nodes=gruik.nodes + names=gruik.names + if Logs.verbose: + Logs.debug('deps: deps for %s: %r; unresolved %r'%(str(node),nodes,names)) + return(nodes,names) diff --git a/waflib/Tools/dbus.py b/waflib/Tools/dbus.py new file mode 100644 index 0000000..9204da8 --- /dev/null +++ b/waflib/Tools/dbus.py @@ -0,0 +1,30 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +from waflib import Task,Errors +from waflib.TaskGen import taskgen_method,before_method +def add_dbus_file(self,filename,prefix,mode): + if not hasattr(self,'dbus_lst'): + self.dbus_lst=[] + if not'process_dbus'in self.meths: + self.meths.append('process_dbus') + self.dbus_lst.append([filename,prefix,mode]) +def process_dbus(self): + for filename,prefix,mode in getattr(self,'dbus_lst',[]): + node=self.path.find_resource(filename) + if not node: + raise Errors.WafError('file not found '+filename) + tsk=self.create_task('dbus_binding_tool',node,node.change_ext('.h')) + tsk.env.DBUS_BINDING_TOOL_PREFIX=prefix + tsk.env.DBUS_BINDING_TOOL_MODE=mode +class dbus_binding_tool(Task.Task): + color='BLUE' + ext_out=['.h'] + run_str='${DBUS_BINDING_TOOL} --prefix=${DBUS_BINDING_TOOL_PREFIX} --mode=${DBUS_BINDING_TOOL_MODE} --output=${TGT} ${SRC}' + shell=True +def configure(conf): + dbus_binding_tool=conf.find_program('dbus-binding-tool',var='DBUS_BINDING_TOOL') + +taskgen_method(add_dbus_file) +before_method('apply_core')(process_dbus)
\ No newline at end of file diff --git a/waflib/Tools/dmd.py b/waflib/Tools/dmd.py new file mode 100644 index 0000000..7d3f7df --- /dev/null +++ b/waflib/Tools/dmd.py @@ -0,0 +1,47 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import sys +from waflib.Tools import ar,d +from waflib.Configure import conf +def find_dmd(conf): + conf.find_program(['dmd','ldc'],var='D') +def common_flags_ldc(conf): + v=conf.env + v['DFLAGS']=['-d-version=Posix'] + v['LINKFLAGS']=[] + v['DFLAGS_dshlib']=['-relocation-model=pic'] +def common_flags_dmd(conf): + v=conf.env + v['D_SRC_F']=['-c'] + v['D_TGT_F']='-of%s' + v['D_LINKER']=v['D'] + v['DLNK_SRC_F']='' + v['DLNK_TGT_F']='-of%s' + v['DINC_ST']='-I%s' + v['DSHLIB_MARKER']=v['DSTLIB_MARKER']='' + v['DSTLIB_ST']=v['DSHLIB_ST']='-L-l%s' + v['DSTLIBPATH_ST']=v['DLIBPATH_ST']='-L-L%s' + v['LINKFLAGS_dprogram']=['-quiet'] + v['DFLAGS_dshlib']=['-fPIC'] + v['LINKFLAGS_dshlib']=['-L-shared'] + v['DHEADER_ext']='.di' + v.DFLAGS_d_with_header=['-H','-Hf'] + v['D_HDR_F']='%s' +def configure(conf): + conf.find_dmd() + if sys.platform=='win32': + out=conf.cmd_and_log([conf.env.D,'--help']) + if out.find("D Compiler v2.")>-1: + conf.fatal('dmd2 on Windows is not supported, use gdc or ldc instead') + conf.load('ar') + conf.load('d') + conf.common_flags_dmd() + conf.d_platform_flags() + if str(conf.env.D).find('ldc')>-1: + conf.common_flags_ldc() + +conf(find_dmd) +conf(common_flags_ldc) +conf(common_flags_dmd)
\ No newline at end of file diff --git a/waflib/Tools/errcheck.py b/waflib/Tools/errcheck.py new file mode 100644 index 0000000..93cb6c3 --- /dev/null +++ b/waflib/Tools/errcheck.py @@ -0,0 +1,161 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import sys +if sys.hexversion < 0x020400f0: from sets import Set as set +typos={'feature':'features','sources':'source','targets':'target','include':'includes','export_include':'export_includes','define':'defines','importpath':'includes','installpath':'install_path',} +meths_typos=['__call__','program','shlib','stlib','objects'] +from waflib import Logs,Build,Node,Task,TaskGen,ConfigSet,Errors,Utils +import waflib.Tools.ccroot +def check_same_targets(self): + mp=Utils.defaultdict(list) + uids={} + def check_task(tsk): + if not isinstance(tsk,Task.Task): + return + for node in tsk.outputs: + mp[node].append(tsk) + try: + uids[tsk.uid()].append(tsk) + except: + uids[tsk.uid()]=[tsk] + for g in self.groups: + for tg in g: + try: + for tsk in tg.tasks: + check_task(tsk) + except AttributeError: + check_task(tg) + dupe=False + for(k,v)in mp.items(): + if len(v)>1: + dupe=True + msg='* Node %r is created by more than once%s. The task generators are:'%(k,Logs.verbose==1 and" (full message on 'waf -v -v')"or"") + Logs.error(msg) + for x in v: + if Logs.verbose>1: + Logs.error(' %d. %r'%(1+v.index(x),x.generator)) + else: + Logs.error(' %d. %r in %r'%(1+v.index(x),x.generator.name,getattr(x.generator,'path',None))) + if not dupe: + for(k,v)in uids.items(): + if len(v)>1: + Logs.error('* Several tasks use the same identifier. Please check the information on\n http://waf.googlecode.com/git/docs/apidocs/Task.html#waflib.Task.Task.uid') + for tsk in v: + Logs.error(' - object %r (%r) defined in %r'%(tsk.__class__.__name__,tsk,tsk.generator)) +def check_invalid_constraints(self): + feat=set([]) + for x in list(TaskGen.feats.values()): + feat.union(set(x)) + for(x,y)in TaskGen.task_gen.prec.items(): + feat.add(x) + feat.union(set(y)) + ext=set([]) + for x in TaskGen.task_gen.mappings.values(): + ext.add(x.__name__) + invalid=ext&feat + if invalid: + Logs.error('The methods %r have invalid annotations: @extension <-> @feature/@before_method/@after_method'%list(invalid)) + for cls in list(Task.classes.values()): + for x in('before','after'): + for y in Utils.to_list(getattr(cls,x,[])): + if not Task.classes.get(y,None): + Logs.error('Erroneous order constraint %r=%r on task class %r'%(x,y,cls.__name__)) + if getattr(cls,'rule',None): + Logs.error('Erroneous attribute "rule" on task class %r (rename to "run_str")'%cls.__name__) +def replace(m): + oldcall=getattr(Build.BuildContext,m) + def call(self,*k,**kw): + ret=oldcall(self,*k,**kw) + for x in typos: + if x in kw: + err=True + Logs.error('Fix the typo %r -> %r on %r'%(x,typos[x],ret)) + return ret + setattr(Build.BuildContext,m,call) +def enhance_lib(): + for m in meths_typos: + replace(m) + def ant_glob(self,*k,**kw): + if k: + lst=Utils.to_list(k[0]) + for pat in lst: + if'..'in pat.split('/'): + Logs.error("In ant_glob pattern %r: '..' means 'two dots', not 'parent directory'"%k[0]) + if kw.get('remove',True): + try: + if self.is_child_of(self.ctx.bldnode)and not kw.get('quiet',False): + Logs.error('Using ant_glob on the build folder (%r) is dangerous (quiet=True to disable this warning)'%self) + except AttributeError: + pass + return self.old_ant_glob(*k,**kw) + Node.Node.old_ant_glob=Node.Node.ant_glob + Node.Node.ant_glob=ant_glob + old=Task.is_before + def is_before(t1,t2): + ret=old(t1,t2) + if ret and old(t2,t1): + Logs.error('Contradictory order constraints in classes %r %r'%(t1,t2)) + return ret + Task.is_before=is_before + def check_err_features(self): + lst=self.to_list(self.features) + if'shlib'in lst: + Logs.error('feature shlib -> cshlib, dshlib or cxxshlib') + for x in('c','cxx','d','fc'): + if not x in lst and lst and lst[0]in[x+y for y in('program','shlib','stlib')]: + Logs.error('%r features is probably missing %r'%(self,x)) + TaskGen.feature('*')(check_err_features) + def check_err_order(self): + if not hasattr(self,'rule'): + for x in('before','after','ext_in','ext_out'): + if hasattr(self,x): + Logs.warn('Erroneous order constraint %r on non-rule based task generator %r'%(x,self)) + else: + for x in('before','after'): + for y in self.to_list(getattr(self,x,[])): + if not Task.classes.get(y,None): + Logs.error('Erroneous order constraint %s=%r on %r'%(x,y,self)) + TaskGen.feature('*')(check_err_order) + def check_compile(self): + check_invalid_constraints(self) + try: + ret=self.orig_compile() + finally: + check_same_targets(self) + return ret + Build.BuildContext.orig_compile=Build.BuildContext.compile + Build.BuildContext.compile=check_compile + def use_rec(self,name,**kw): + try: + y=self.bld.get_tgen_by_name(name) + except Errors.WafError: + pass + else: + idx=self.bld.get_group_idx(self) + odx=self.bld.get_group_idx(y) + if odx>idx: + msg="Invalid 'use' across build groups:" + if Logs.verbose>1: + msg+='\n target %r\n uses:\n %r'%(self,y) + else: + msg+=" %r uses %r (try 'waf -v -v' for the full error)"%(self.name,name) + raise Errors.WafError(msg) + self.orig_use_rec(name,**kw) + TaskGen.task_gen.orig_use_rec=TaskGen.task_gen.use_rec + TaskGen.task_gen.use_rec=use_rec + def getattri(self,name,default=None): + if name=='append'or name=='add': + raise Errors.WafError('env.append and env.add do not exist: use env.append_value/env.append_unique') + elif name=='prepend': + raise Errors.WafError('env.prepend does not exist: use env.prepend_value') + if name in self.__slots__: + return object.__getattr__(self,name,default) + else: + return self[name] + ConfigSet.ConfigSet.__getattr__=getattri +def options(opt): + enhance_lib() +def configure(conf): + pass diff --git a/waflib/Tools/fc.py b/waflib/Tools/fc.py new file mode 100644 index 0000000..30b1b48 --- /dev/null +++ b/waflib/Tools/fc.py @@ -0,0 +1,123 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import sys +if sys.hexversion < 0x020400f0: from sets import Set as set +import re +from waflib import Utils,Task,TaskGen,Logs +from waflib.Tools import ccroot,fc_config,fc_scan +from waflib.TaskGen import feature,before_method,after_method,extension +from waflib.Configure import conf +ccroot.USELIB_VARS['fc']=set(['FCFLAGS','DEFINES','INCLUDES']) +ccroot.USELIB_VARS['fcprogram_test']=ccroot.USELIB_VARS['fcprogram']=set(['LIB','STLIB','LIBPATH','STLIBPATH','LINKFLAGS','RPATH','LINKDEPS']) +ccroot.USELIB_VARS['fcshlib']=set(['LIB','STLIB','LIBPATH','STLIBPATH','LINKFLAGS','RPATH','LINKDEPS']) +ccroot.USELIB_VARS['fcstlib']=set(['ARFLAGS','LINKDEPS']) +def dummy(self): + pass +def fc_hook(self,node): + return self.create_compiled_task('fc',node) +def modfile(conf,name): + return{'lower':name.lower()+'.mod','lower.MOD':name.upper()+'.MOD','UPPER.mod':name.upper()+'.mod','UPPER':name.upper()+'.MOD'}[conf.env.FC_MOD_CAPITALIZATION or'lower'] +def get_fortran_tasks(tsk): + bld=tsk.generator.bld + tasks=bld.get_tasks_group(bld.get_group_idx(tsk.generator)) + return[x for x in tasks if isinstance(x,fc)and not getattr(x,'nomod',None)and not getattr(x,'mod_fortran_done',None)] +class fc(Task.Task): + color='GREEN' + run_str='${FC} ${FCFLAGS} ${FCINCPATH_ST:INCPATHS} ${FCDEFINES_ST:DEFINES} ${_FCMODOUTFLAGS} ${FC_TGT_F}${TGT[0].abspath()} ${FC_SRC_F}${SRC[0].abspath()}' + vars=["FORTRANMODPATHFLAG"] + def scan(self): + tmp=fc_scan.fortran_parser(self.generator.includes_nodes) + tmp.task=self + tmp.start(self.inputs[0]) + if Logs.verbose: + Logs.debug('deps: deps for %r: %r; unresolved %r'%(self.inputs,tmp.nodes,tmp.names)) + return(tmp.nodes,tmp.names) + def runnable_status(self): + if getattr(self,'mod_fortran_done',None): + return super(fc,self).runnable_status() + bld=self.generator.bld + lst=get_fortran_tasks(self) + for tsk in lst: + tsk.mod_fortran_done=True + for tsk in lst: + ret=tsk.runnable_status() + if ret==Task.ASK_LATER: + for x in lst: + x.mod_fortran_done=None + return Task.ASK_LATER + ins=Utils.defaultdict(set) + outs=Utils.defaultdict(set) + for tsk in lst: + key=tsk.uid() + for x in bld.raw_deps[key]: + if x.startswith('MOD@'): + name=bld.modfile(x.replace('MOD@','')) + node=bld.srcnode.find_or_declare(name) + tsk.set_outputs(node) + outs[id(node)].add(tsk) + for tsk in lst: + key=tsk.uid() + for x in bld.raw_deps[key]: + if x.startswith('USE@'): + name=bld.modfile(x.replace('USE@','')) + node=bld.srcnode.find_resource(name) + if node and node not in tsk.outputs: + if not node in bld.node_deps[key]: + bld.node_deps[key].append(node) + ins[id(node)].add(tsk) + for k in ins.keys(): + for a in ins[k]: + a.run_after.update(outs[k]) + tmp=[] + for t in outs[k]: + tmp.extend(t.outputs) + a.dep_nodes.extend(tmp) + try: + a.dep_nodes.sort(key=lambda x:x.abspath()) + except: + a.dep_nodes.sort(lambda x,y:cmp(x.abspath(),y.abspath())) + for tsk in lst: + try: + delattr(tsk,'cache_sig') + except AttributeError: + pass + return super(fc,self).runnable_status() +class fcprogram(ccroot.link_task): + color='YELLOW' + run_str='${FC} ${LINKFLAGS} ${FCLNK_SRC_F}${SRC} ${FCLNK_TGT_F}${TGT[0].abspath()} ${RPATH_ST:RPATH} ${FCSTLIB_MARKER} ${FCSTLIBPATH_ST:STLIBPATH} ${FCSTLIB_ST:STLIB} ${FCSHLIB_MARKER} ${FCLIBPATH_ST:LIBPATH} ${FCLIB_ST:LIB}' + inst_to='${BINDIR}' + chmod=Utils.O755 +class fcshlib(fcprogram): + inst_to='${LIBDIR}' +class fcprogram_test(fcprogram): + def can_retrieve_cache(self): + return False + def runnable_status(self): + ret=super(fcprogram_test,self).runnable_status() + if ret==Task.SKIP_ME: + ret=Task.RUN_ME + return ret + def exec_command(self,cmd,**kw): + bld=self.generator.bld + kw['shell']=isinstance(cmd,str) + kw['stdout']=kw['stderr']=Utils.subprocess.PIPE + kw['cwd']=bld.variant_dir + bld.out=bld.err='' + bld.to_log('command: %s\n'%cmd) + kw['output']=0 + try: + (bld.out,bld.err)=bld.cmd_and_log(cmd,**kw) + except Exception ,e: + return-1 + if bld.out: + bld.to_log("out: %s\n"%bld.out) + if bld.err: + bld.to_log("err: %s\n"%bld.err) +class fcstlib(ccroot.stlink_task): + pass + +feature('fcprogram','fcshlib','fcstlib','fcprogram_test')(dummy) +extension('.f','.f90','.F','.F90','.for','.FOR')(fc_hook) +conf(modfile)
\ No newline at end of file diff --git a/waflib/Tools/fc_config.py b/waflib/Tools/fc_config.py new file mode 100644 index 0000000..f9c97fa --- /dev/null +++ b/waflib/Tools/fc_config.py @@ -0,0 +1,283 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import re,shutil,os,sys,string,shlex +from waflib.Configure import conf +from waflib.TaskGen import feature,after_method,before_method +from waflib import Build,Utils +FC_FRAGMENT=' program main\n end program main\n' +FC_FRAGMENT2=' PROGRAM MAIN\n END\n' +def fc_flags(conf): + v=conf.env + v['FC_SRC_F']=[] + v['FC_TGT_F']=['-c','-o'] + v['FCINCPATH_ST']='-I%s' + v['FCDEFINES_ST']='-D%s' + if not v['LINK_FC']:v['LINK_FC']=v['FC'] + v['FCLNK_SRC_F']=[] + v['FCLNK_TGT_F']=['-o'] + v['FCFLAGS_fcshlib']=['-fpic'] + v['LINKFLAGS_fcshlib']=['-shared'] + v['fcshlib_PATTERN']='lib%s.so' + v['fcstlib_PATTERN']='lib%s.a' + v['FCLIB_ST']='-l%s' + v['FCLIBPATH_ST']='-L%s' + v['FCSTLIB_ST']='-l%s' + v['FCSTLIBPATH_ST']='-L%s' + v['FCSTLIB_MARKER']='-Wl,-Bstatic' + v['FCSHLIB_MARKER']='-Wl,-Bdynamic' + v['SONAME_ST']='-Wl,-h,%s' +def check_fortran(self,*k,**kw): + self.check_cc(fragment=FC_FRAGMENT,compile_filename='test.f',features='fc fcprogram',msg='Compiling a simple fortran app') +def check_fc(self,*k,**kw): + kw['compiler']='fc' + if not'compile_mode'in kw: + kw['compile_mode']='fc' + if not'type'in kw: + kw['type']='fcprogram' + if not'compile_filename'in kw: + kw['compile_filename']='test.f90' + if not'code'in kw: + kw['code']=FC_FRAGMENT + return self.check(*k,**kw) +def fortran_modifier_darwin(conf): + v=conf.env + v['FCFLAGS_fcshlib']=['-fPIC','-compatibility_version','1','-current_version','1'] + v['LINKFLAGS_fcshlib']=['-dynamiclib'] + v['fcshlib_PATTERN']='lib%s.dylib' + v['FRAMEWORKPATH_ST']='-F%s' + v['FRAMEWORK_ST']='-framework %s' + v['LINKFLAGS_fcstlib']=[] + v['FCSHLIB_MARKER']='' + v['FCSTLIB_MARKER']='' + v['SONAME_ST']='' +def fortran_modifier_win32(conf): + v=conf.env + v['fcprogram_PATTERN']=v['fcprogram_test_PATTERN']='%s.exe' + v['fcshlib_PATTERN']='%s.dll' + v['implib_PATTERN']='lib%s.dll.a' + v['IMPLIB_ST']='-Wl,--out-implib,%s' + v['FCFLAGS_fcshlib']=[] + v.append_value('FCFLAGS_fcshlib',['-DDLL_EXPORT']) + v.append_value('LINKFLAGS',['-Wl,--enable-auto-import']) +def fortran_modifier_cygwin(conf): + fortran_modifier_win32(conf) + v=conf.env + v['fcshlib_PATTERN']='cyg%s.dll' + v.append_value('LINKFLAGS_fcshlib',['-Wl,--enable-auto-image-base']) + v['FCFLAGS_fcshlib']=[] +def check_fortran_dummy_main(self,*k,**kw): + if not self.env.CC: + self.fatal('A c compiler is required for check_fortran_dummy_main') + lst=['MAIN__','__MAIN','_MAIN','MAIN_','MAIN'] + lst.extend([m.lower()for m in lst]) + lst.append('') + self.start_msg('Detecting whether we need a dummy main') + for main in lst: + kw['fortran_main']=main + try: + self.check_cc(fragment='int %s() { return 0; }\n'%(main or'test'),features='c fcprogram',mandatory=True) + if not main: + self.env.FC_MAIN=-1 + self.end_msg('no') + else: + self.env.FC_MAIN=main + self.end_msg('yes %s'%main) + break + except self.errors.ConfigurationError: + pass + else: + self.end_msg('not found') + self.fatal('could not detect whether fortran requires a dummy main, see the config.log') +GCC_DRIVER_LINE=re.compile('^Driving:') +POSIX_STATIC_EXT=re.compile('\S+\.a') +POSIX_LIB_FLAGS=re.compile('-l\S+') +def is_link_verbose(self,txt): + assert isinstance(txt,str) + for line in txt.splitlines(): + if not GCC_DRIVER_LINE.search(line): + if POSIX_STATIC_EXT.search(line)or POSIX_LIB_FLAGS.search(line): + return True + return False +def check_fortran_verbose_flag(self,*k,**kw): + self.start_msg('fortran link verbose flag') + for x in['-v','--verbose','-verbose','-V']: + try: + self.check_cc(features='fc fcprogram_test',fragment=FC_FRAGMENT2,compile_filename='test.f',linkflags=[x],mandatory=True) + except self.errors.ConfigurationError: + pass + else: + if self.is_link_verbose(self.test_bld.err)or self.is_link_verbose(self.test_bld.out): + self.end_msg(x) + break + else: + self.end_msg('failure') + self.fatal('Could not obtain the fortran link verbose flag (see config.log)') + self.env.FC_VERBOSE_FLAG=x + return x +LINKFLAGS_IGNORED=[r'-lang*',r'-lcrt[a-zA-Z0-9\.]*\.o',r'-lc$',r'-lSystem',r'-libmil',r'-LIST:*',r'-LNO:*'] +if os.name=='nt': + LINKFLAGS_IGNORED.extend([r'-lfrt*',r'-luser32',r'-lkernel32',r'-ladvapi32',r'-lmsvcrt',r'-lshell32',r'-lmingw',r'-lmoldname']) +else: + LINKFLAGS_IGNORED.append(r'-lgcc*') +RLINKFLAGS_IGNORED=[re.compile(f)for f in LINKFLAGS_IGNORED] +def _match_ignore(line): + for i in RLINKFLAGS_IGNORED: + if i.match(line): + return True + return False +def parse_fortran_link(lines): + final_flags=[] + for line in lines: + if not GCC_DRIVER_LINE.match(line): + _parse_flink_line(line,final_flags) + return final_flags +SPACE_OPTS=re.compile('^-[LRuYz]$') +NOSPACE_OPTS=re.compile('^-[RL]') +def _parse_flink_line(line,final_flags): + lexer=shlex.shlex(line,posix=True) + lexer.whitespace_split=True + t=lexer.get_token() + tmp_flags=[] + while t: + def parse(token): + if _match_ignore(token): + pass + elif token.startswith('-lkernel32')and sys.platform=='cygwin': + tmp_flags.append(token) + elif SPACE_OPTS.match(token): + t=lexer.get_token() + if t.startswith('P,'): + t=t[2:] + for opt in t.split(os.pathsep): + tmp_flags.append('-L%s'%opt) + elif NOSPACE_OPTS.match(token): + tmp_flags.append(token) + elif POSIX_LIB_FLAGS.match(token): + tmp_flags.append(token) + else: + pass + t=lexer.get_token() + return t + t=parse(t) + final_flags.extend(tmp_flags) + return final_flags +def check_fortran_clib(self,autoadd=True,*k,**kw): + if not self.env.FC_VERBOSE_FLAG: + self.fatal('env.FC_VERBOSE_FLAG is not set: execute check_fortran_verbose_flag?') + self.start_msg('Getting fortran runtime link flags') + try: + self.check_cc(fragment=FC_FRAGMENT2,compile_filename='test.f',features='fc fcprogram_test',linkflags=[self.env.FC_VERBOSE_FLAG]) + except: + self.end_msg(False) + if kw.get('mandatory',True): + conf.fatal('Could not find the c library flags') + else: + out=self.test_bld.err + flags=parse_fortran_link(out.splitlines()) + self.end_msg('ok (%s)'%' '.join(flags)) + self.env.LINKFLAGS_CLIB=flags + return flags + return[] +def getoutput(conf,cmd,stdin=False): + if stdin: + stdin=Utils.subprocess.PIPE + else: + stdin=None + env=conf.env.env or None + try: + p=Utils.subprocess.Popen(cmd,stdin=stdin,stdout=Utils.subprocess.PIPE,stderr=Utils.subprocess.PIPE,env=env) + if stdin: + p.stdin.write('\n') + stdout,stderr=p.communicate() + except: + conf.fatal('could not determine the compiler version %r'%cmd) + else: + if not isinstance(stdout,str): + stdout=stdout.decode(sys.stdout.encoding) + if not isinstance(stderr,str): + stderr=stderr.decode(sys.stdout.encoding) + return stdout,stderr +ROUTINES_CODE="""\ + subroutine foobar() + return + end + subroutine foo_bar() + return + end +""" +MAIN_CODE=""" +void %(dummy_func_nounder)s(void); +void %(dummy_func_under)s(void); +int %(main_func_name)s() { + %(dummy_func_nounder)s(); + %(dummy_func_under)s(); + return 0; +} +""" +def link_main_routines_tg_method(self): + def write_test_file(task): + task.outputs[0].write(task.generator.code) + bld=self.bld + bld(rule=write_test_file,target='main.c',code=MAIN_CODE%self.__dict__) + bld(rule=write_test_file,target='test.f',code=ROUTINES_CODE) + bld(features='fc fcstlib',source='test.f',target='test') + bld(features='c fcprogram',source='main.c',target='app',use='test') +def mangling_schemes(): + for u in['_','']: + for du in['','_']: + for c in["lower","upper"]: + yield(u,du,c) +def mangle_name(u,du,c,name): + return getattr(name,c)()+u+(name.find('_')!=-1 and du or'') +def check_fortran_mangling(self,*k,**kw): + if not self.env.CC: + self.fatal('A c compiler is required for link_main_routines') + if not self.env.FC: + self.fatal('A fortran compiler is required for link_main_routines') + if not self.env.FC_MAIN: + self.fatal('Checking for mangling requires self.env.FC_MAIN (execute "check_fortran_dummy_main" first?)') + self.start_msg('Getting fortran mangling scheme') + for(u,du,c)in mangling_schemes(): + try: + self.check_cc(compile_filename=[],features='link_main_routines_func',msg='nomsg',errmsg='nomsg',mandatory=True,dummy_func_nounder=mangle_name(u,du,c,"foobar"),dummy_func_under=mangle_name(u,du,c,"foo_bar"),main_func_name=self.env.FC_MAIN) + except self.errors.ConfigurationError: + pass + else: + self.end_msg("ok ('%s', '%s', '%s-case')"%(u,du,c)) + self.env.FORTRAN_MANGLING=(u,du,c) + break + else: + self.end_msg(False) + self.fatal('mangler not found') + return(u,du,c) +def set_lib_pat(self): + self.env['fcshlib_PATTERN']=self.env['pyext_PATTERN'] +def detect_openmp(self): + for x in['-fopenmp','-openmp','-mp','-xopenmp','-omp','-qsmp=omp']: + try: + self.check_fc(msg='Checking for OpenMP flag %s'%x,fragment='program main\n call omp_get_num_threads()\nend program main',fcflags=x,linkflags=x,uselib_store='OPENMP') + except self.errors.ConfigurationError: + pass + else: + break + else: + self.fatal('Could not find OpenMP') + +conf(fc_flags) +conf(check_fortran) +conf(check_fc) +conf(fortran_modifier_darwin) +conf(fortran_modifier_win32) +conf(fortran_modifier_cygwin) +conf(check_fortran_dummy_main) +conf(is_link_verbose) +conf(check_fortran_verbose_flag) +conf(check_fortran_clib) +feature('link_main_routines_func')(link_main_routines_tg_method) +before_method('process_source')(link_main_routines_tg_method) +conf(check_fortran_mangling) +feature('pyext')(set_lib_pat) +before_method('propagate_uselib_vars','apply_link')(set_lib_pat) +conf(detect_openmp)
\ No newline at end of file diff --git a/waflib/Tools/fc_scan.py b/waflib/Tools/fc_scan.py new file mode 100644 index 0000000..48e06b5 --- /dev/null +++ b/waflib/Tools/fc_scan.py @@ -0,0 +1,68 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import re +from waflib import Utils,Task,TaskGen,Logs +from waflib.TaskGen import feature,before_method,after_method,extension +from waflib.Configure import conf +INC_REGEX="""(?:^|['">]\s*;)\s*INCLUDE\s+(?:\w+_)?[<"'](.+?)(?=["'>])""" +USE_REGEX="""(?:^|;)\s*USE(?:\s+|(?:(?:\s*,\s*(?:NON_)?INTRINSIC)?\s*::))\s*(\w+)""" +MOD_REGEX="""(?:^|;)\s*MODULE(?!\s*PROCEDURE)(?:\s+|(?:(?:\s*,\s*(?:NON_)?INTRINSIC)?\s*::))\s*(\w+)""" +re_inc=re.compile(INC_REGEX,re.I) +re_use=re.compile(USE_REGEX,re.I) +re_mod=re.compile(MOD_REGEX,re.I) +class fortran_parser(object): + def __init__(self,incpaths): + self.seen=[] + self.nodes=[] + self.names=[] + self.incpaths=incpaths + def find_deps(self,node): + txt=node.read() + incs=[] + uses=[] + mods=[] + for line in txt.splitlines(): + m=re_inc.search(line) + if m: + incs.append(m.group(1)) + m=re_use.search(line) + if m: + uses.append(m.group(1)) + m=re_mod.search(line) + if m: + mods.append(m.group(1)) + return(incs,uses,mods) + def start(self,node): + self.waiting=[node] + while self.waiting: + nd=self.waiting.pop(0) + self.iter(nd) + def iter(self,node): + path=node.abspath() + incs,uses,mods=self.find_deps(node) + for x in incs: + if x in self.seen: + continue + self.seen.append(x) + self.tryfind_header(x) + for x in uses: + name="USE@%s"%x + if not name in self.names: + self.names.append(name) + for x in mods: + name="MOD@%s"%x + if not name in self.names: + self.names.append(name) + def tryfind_header(self,filename): + found=None + for n in self.incpaths: + found=n.find_resource(filename) + if found: + self.nodes.append(found) + self.waiting.append(found) + break + if not found: + if not filename in self.names: + self.names.append(filename) diff --git a/waflib/Tools/flex.py b/waflib/Tools/flex.py new file mode 100644 index 0000000..d5f4367 --- /dev/null +++ b/waflib/Tools/flex.py @@ -0,0 +1,27 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import waflib.TaskGen +def decide_ext(self,node): + if'cxx'in self.features: + return['.lex.cc'] + return['.lex.c'] +def flexfun(tsk): + env=tsk.env + bld=tsk.generator.bld + wd=bld.variant_dir + def to_list(xx): + if isinstance(xx,str):return[xx] + return xx + tsk.last_cmd=lst=[] + lst.extend(to_list(env['FLEX'])) + lst.extend(to_list(env['FLEXFLAGS'])) + lst.extend([a.path_from(bld.bldnode)for a in tsk.inputs]) + lst=[x for x in lst if x] + txt=bld.cmd_and_log(lst,cwd=wd,env=env.env or None,quiet=0) + tsk.outputs[0].write(txt) +waflib.TaskGen.declare_chain(name='flex',rule=flexfun,ext_in='.l',decider=decide_ext,) +def configure(conf): + conf.find_program('flex',var='FLEX') + conf.env.FLEXFLAGS=['-t'] diff --git a/waflib/Tools/g95.py b/waflib/Tools/g95.py new file mode 100644 index 0000000..a2bb542 --- /dev/null +++ b/waflib/Tools/g95.py @@ -0,0 +1,55 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import re +from waflib import Utils +from waflib.Tools import fc,fc_config,fc_scan +from waflib.Configure import conf +def find_g95(conf): + fc=conf.find_program('g95',var='FC') + fc=conf.cmd_to_list(fc) + conf.get_g95_version(fc) + conf.env.FC_NAME='G95' +def g95_flags(conf): + v=conf.env + v['FCFLAGS_fcshlib']=['-fPIC'] + v['FORTRANMODFLAG']=['-fmod=',''] + v['FCFLAGS_DEBUG']=['-Werror'] +def g95_modifier_win32(conf): + fc_config.fortran_modifier_win32(conf) +def g95_modifier_cygwin(conf): + fc_config.fortran_modifier_cygwin(conf) +def g95_modifier_darwin(conf): + fc_config.fortran_modifier_darwin(conf) +def g95_modifier_platform(conf): + dest_os=conf.env['DEST_OS']or Utils.unversioned_sys_platform() + g95_modifier_func=getattr(conf,'g95_modifier_'+dest_os,None) + if g95_modifier_func: + g95_modifier_func() +def get_g95_version(conf,fc): + version_re=re.compile(r"g95\s*(?P<major>\d*)\.(?P<minor>\d*)").search + cmd=fc+['--version'] + out,err=fc_config.getoutput(conf,cmd,stdin=False) + if out: + match=version_re(out) + else: + match=version_re(err) + if not match: + conf.fatal('cannot determine g95 version') + k=match.groupdict() + conf.env['FC_VERSION']=(k['major'],k['minor']) +def configure(conf): + conf.find_g95() + conf.find_ar() + conf.fc_flags() + conf.g95_flags() + conf.g95_modifier_platform() + +conf(find_g95) +conf(g95_flags) +conf(g95_modifier_win32) +conf(g95_modifier_cygwin) +conf(g95_modifier_darwin) +conf(g95_modifier_platform) +conf(get_g95_version)
\ No newline at end of file diff --git a/waflib/Tools/gas.py b/waflib/Tools/gas.py new file mode 100644 index 0000000..0aef0c4 --- /dev/null +++ b/waflib/Tools/gas.py @@ -0,0 +1,11 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import waflib.Tools.asm +from waflib.Tools import ar +def configure(conf): + conf.find_program(['gas','as','gcc'],var='AS') + conf.env.AS_TGT_F=['-o'] + conf.env.ASLNK_TGT_F=['-o'] + conf.find_ar() diff --git a/waflib/Tools/gcc.py b/waflib/Tools/gcc.py new file mode 100644 index 0000000..5734b76 --- /dev/null +++ b/waflib/Tools/gcc.py @@ -0,0 +1,98 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os,sys +from waflib import Configure,Options,Utils +from waflib.Tools import ccroot,ar +from waflib.Configure import conf +def find_gcc(conf): + cc=conf.find_program(['gcc','cc'],var='CC') + cc=conf.cmd_to_list(cc) + conf.get_cc_version(cc,gcc=True) + conf.env.CC_NAME='gcc' + conf.env.CC=cc +def gcc_common_flags(conf): + v=conf.env + v['CC_SRC_F']=[] + v['CC_TGT_F']=['-c','-o'] + if not v['LINK_CC']:v['LINK_CC']=v['CC'] + v['CCLNK_SRC_F']=[] + v['CCLNK_TGT_F']=['-o'] + v['CPPPATH_ST']='-I%s' + v['DEFINES_ST']='-D%s' + v['LIB_ST']='-l%s' + v['LIBPATH_ST']='-L%s' + v['STLIB_ST']='-l%s' + v['STLIBPATH_ST']='-L%s' + v['RPATH_ST']='-Wl,-rpath,%s' + v['SONAME_ST']='-Wl,-h,%s' + v['SHLIB_MARKER']='-Wl,-Bdynamic' + v['STLIB_MARKER']='-Wl,-Bstatic' + v['cprogram_PATTERN']='%s' + v['CFLAGS_cshlib']=['-fPIC'] + v['LINKFLAGS_cshlib']=['-shared'] + v['cshlib_PATTERN']='lib%s.so' + v['LINKFLAGS_cstlib']=['-Wl,-Bstatic'] + v['cstlib_PATTERN']='lib%s.a' + v['LINKFLAGS_MACBUNDLE']=['-bundle','-undefined','dynamic_lookup'] + v['CFLAGS_MACBUNDLE']=['-fPIC'] + v['macbundle_PATTERN']='%s.bundle' +def gcc_modifier_win32(conf): + v=conf.env + v['cprogram_PATTERN']='%s.exe' + v['cshlib_PATTERN']='%s.dll' + v['implib_PATTERN']='lib%s.dll.a' + v['IMPLIB_ST']='-Wl,--out-implib,%s' + v['CFLAGS_cshlib']=[] + v.append_value('CFLAGS_cshlib',['-DDLL_EXPORT']) + v.append_value('LINKFLAGS',['-Wl,--enable-auto-import']) +def gcc_modifier_cygwin(conf): + gcc_modifier_win32(conf) + v=conf.env + v['cshlib_PATTERN']='cyg%s.dll' + v.append_value('LINKFLAGS_cshlib',['-Wl,--enable-auto-image-base']) + v['CFLAGS_cshlib']=[] +def gcc_modifier_darwin(conf): + v=conf.env + v['CFLAGS_cshlib']=['-fPIC','-compatibility_version','1','-current_version','1'] + v['LINKFLAGS_cshlib']=['-dynamiclib'] + v['cshlib_PATTERN']='lib%s.dylib' + v['FRAMEWORKPATH_ST']='-F%s' + v['FRAMEWORK_ST']=['-framework'] + v['ARCH_ST']=['-arch'] + v['LINKFLAGS_cstlib']=[] + v['SHLIB_MARKER']=[] + v['STLIB_MARKER']=[] + v['SONAME_ST']=[] +def gcc_modifier_aix(conf): + v=conf.env + v['LINKFLAGS_cprogram']=['-Wl,-brtl'] + v['LINKFLAGS_cshlib']=['-shared','-Wl,-brtl,-bexpfull'] + v['SHLIB_MARKER']=[] +def gcc_modifier_hpux(conf): + v=conf.env + v['SHLIB_MARKER']=[] + v['CFLAGS_cshlib']=['-fPIC','-DPIC'] + v['cshlib_PATTERN']='lib%s.sl' +def gcc_modifier_platform(conf): + gcc_modifier_func=getattr(conf,'gcc_modifier_'+conf.env.DEST_OS,None) + if gcc_modifier_func: + gcc_modifier_func() +def configure(conf): + conf.find_gcc() + conf.find_ar() + conf.gcc_common_flags() + conf.gcc_modifier_platform() + conf.cc_load_tools() + conf.cc_add_flags() + conf.link_add_flags() + +conf(find_gcc) +conf(gcc_common_flags) +conf(gcc_modifier_win32) +conf(gcc_modifier_cygwin) +conf(gcc_modifier_darwin) +conf(gcc_modifier_aix) +conf(gcc_modifier_hpux) +conf(gcc_modifier_platform)
\ No newline at end of file diff --git a/waflib/Tools/gdc.py b/waflib/Tools/gdc.py new file mode 100644 index 0000000..ff8a8ab --- /dev/null +++ b/waflib/Tools/gdc.py @@ -0,0 +1,34 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import sys +from waflib.Tools import ar,d +from waflib.Configure import conf +def find_gdc(conf): + conf.find_program('gdc',var='D') +def common_flags_gdc(conf): + v=conf.env + v['DFLAGS']=[] + v['D_SRC_F']=['-c'] + v['D_TGT_F']='-o%s' + v['D_LINKER']=v['D'] + v['DLNK_SRC_F']='' + v['DLNK_TGT_F']='-o%s' + v['DINC_ST']='-I%s' + v['DSHLIB_MARKER']=v['DSTLIB_MARKER']='' + v['DSTLIB_ST']=v['DSHLIB_ST']='-l%s' + v['DSTLIBPATH_ST']=v['DLIBPATH_ST']='-L%s' + v['LINKFLAGS_dshlib']=['-shared'] + v['DHEADER_ext']='.di' + v.DFLAGS_d_with_header='-fintfc' + v['D_HDR_F']='-fintfc-file=%s' +def configure(conf): + conf.find_gdc() + conf.load('ar') + conf.load('d') + conf.common_flags_gdc() + conf.d_platform_flags() + +conf(find_gdc) +conf(common_flags_gdc)
\ No newline at end of file diff --git a/waflib/Tools/gfortran.py b/waflib/Tools/gfortran.py new file mode 100644 index 0000000..6dc1da1 --- /dev/null +++ b/waflib/Tools/gfortran.py @@ -0,0 +1,69 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import re +from waflib import Utils +from waflib.Tools import fc,fc_config,fc_scan +from waflib.Configure import conf +def find_gfortran(conf): + fc=conf.find_program(['gfortran','g77'],var='FC') + fc=conf.cmd_to_list(fc) + conf.get_gfortran_version(fc) + conf.env.FC_NAME='GFORTRAN' +def gfortran_flags(conf): + v=conf.env + v['FCFLAGS_fcshlib']=['-fPIC'] + v['FORTRANMODFLAG']=['-J',''] + v['FCFLAGS_DEBUG']=['-Werror'] +def gfortran_modifier_win32(conf): + fc_config.fortran_modifier_win32(conf) +def gfortran_modifier_cygwin(conf): + fc_config.fortran_modifier_cygwin(conf) +def gfortran_modifier_darwin(conf): + fc_config.fortran_modifier_darwin(conf) +def gfortran_modifier_platform(conf): + dest_os=conf.env['DEST_OS']or Utils.unversioned_sys_platform() + gfortran_modifier_func=getattr(conf,'gfortran_modifier_'+dest_os,None) + if gfortran_modifier_func: + gfortran_modifier_func() +def get_gfortran_version(conf,fc): + version_re=re.compile(r"GNU\s*Fortran",re.I).search + cmd=fc+['--version'] + out,err=fc_config.getoutput(conf,cmd,stdin=False) + if out:match=version_re(out) + else:match=version_re(err) + if not match: + conf.fatal('Could not determine the compiler type') + cmd=fc+['-dM','-E','-'] + out,err=fc_config.getoutput(conf,cmd,stdin=True) + if out.find('__GNUC__')<0: + conf.fatal('Could not determine the compiler type') + k={} + out=out.split('\n') + import shlex + for line in out: + lst=shlex.split(line) + if len(lst)>2: + key=lst[1] + val=lst[2] + k[key]=val + def isD(var): + return var in k + def isT(var): + return var in k and k[var]!='0' + conf.env['FC_VERSION']=(k['__GNUC__'],k['__GNUC_MINOR__'],k['__GNUC_PATCHLEVEL__']) +def configure(conf): + conf.find_gfortran() + conf.find_ar() + conf.fc_flags() + conf.gfortran_flags() + conf.gfortran_modifier_platform() + +conf(find_gfortran) +conf(gfortran_flags) +conf(gfortran_modifier_win32) +conf(gfortran_modifier_cygwin) +conf(gfortran_modifier_darwin) +conf(gfortran_modifier_platform) +conf(get_gfortran_version)
\ No newline at end of file diff --git a/waflib/Tools/glib2.py b/waflib/Tools/glib2.py new file mode 100644 index 0000000..0d79e52 --- /dev/null +++ b/waflib/Tools/glib2.py @@ -0,0 +1,174 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os +from waflib import Task,Utils,Options,Errors,Logs +from waflib.TaskGen import taskgen_method,before_method,after_method,feature +def add_marshal_file(self,filename,prefix): + if not hasattr(self,'marshal_list'): + self.marshal_list=[] + self.meths.append('process_marshal') + self.marshal_list.append((filename,prefix)) +def process_marshal(self): + for f,prefix in getattr(self,'marshal_list',[]): + node=self.path.find_resource(f) + if not node: + raise Errors.WafError('file not found %r'%f) + h_node=node.change_ext('.h') + c_node=node.change_ext('.c') + task=self.create_task('glib_genmarshal',node,[h_node,c_node]) + task.env.GLIB_GENMARSHAL_PREFIX=prefix + self.source=self.to_nodes(getattr(self,'source',[])) + self.source.append(c_node) +class glib_genmarshal(Task.Task): + def run(self): + bld=self.inputs[0].__class__.ctx + get=self.env.get_flat + cmd1="%s %s --prefix=%s --header > %s"%(get('GLIB_GENMARSHAL'),self.inputs[0].srcpath(),get('GLIB_GENMARSHAL_PREFIX'),self.outputs[0].abspath()) + ret=bld.exec_command(cmd1) + if ret:return ret + c='''#include "%s"\n'''%self.outputs[0].name + self.outputs[1].write(c) + cmd2="%s %s --prefix=%s --body >> %s"%(get('GLIB_GENMARSHAL'),self.inputs[0].srcpath(),get('GLIB_GENMARSHAL_PREFIX'),self.outputs[1].abspath()) + return bld.exec_command(cmd2) + vars=['GLIB_GENMARSHAL_PREFIX','GLIB_GENMARSHAL'] + color='BLUE' + ext_out=['.h'] +def add_enums_from_template(self,source='',target='',template='',comments=''): + if not hasattr(self,'enums_list'): + self.enums_list=[] + self.meths.append('process_enums') + self.enums_list.append({'source':source,'target':target,'template':template,'file-head':'','file-prod':'','file-tail':'','enum-prod':'','value-head':'','value-prod':'','value-tail':'','comments':comments}) +def add_enums(self,source='',target='',file_head='',file_prod='',file_tail='',enum_prod='',value_head='',value_prod='',value_tail='',comments=''): + if not hasattr(self,'enums_list'): + self.enums_list=[] + self.meths.append('process_enums') + self.enums_list.append({'source':source,'template':'','target':target,'file-head':file_head,'file-prod':file_prod,'file-tail':file_tail,'enum-prod':enum_prod,'value-head':value_head,'value-prod':value_prod,'value-tail':value_tail,'comments':comments}) +def process_enums(self): + for enum in getattr(self,'enums_list',[]): + task=self.create_task('glib_mkenums') + env=task.env + inputs=[] + source_list=self.to_list(enum['source']) + if not source_list: + raise Errors.WafError('missing source '+str(enum)) + source_list=[self.path.find_resource(k)for k in source_list] + inputs+=source_list + env['GLIB_MKENUMS_SOURCE']=[k.abspath()for k in source_list] + if not enum['target']: + raise Errors.WafError('missing target '+str(enum)) + tgt_node=self.path.find_or_declare(enum['target']) + if tgt_node.name.endswith('.c'): + self.source.append(tgt_node) + env['GLIB_MKENUMS_TARGET']=tgt_node.abspath() + options=[] + if enum['template']: + template_node=self.path.find_resource(enum['template']) + options.append('--template %s'%(template_node.abspath())) + inputs.append(template_node) + params={'file-head':'--fhead','file-prod':'--fprod','file-tail':'--ftail','enum-prod':'--eprod','value-head':'--vhead','value-prod':'--vprod','value-tail':'--vtail','comments':'--comments'} + for param,option in params.items(): + if enum[param]: + options.append('%s %r'%(option,enum[param])) + env['GLIB_MKENUMS_OPTIONS']=' '.join(options) + task.set_inputs(inputs) + task.set_outputs(tgt_node) +class glib_mkenums(Task.Task): + run_str='${GLIB_MKENUMS} ${GLIB_MKENUMS_OPTIONS} ${GLIB_MKENUMS_SOURCE} > ${GLIB_MKENUMS_TARGET}' + color='PINK' + ext_out=['.h'] +def add_settings_schemas(self,filename_list): + if not hasattr(self,'settings_schema_files'): + self.settings_schema_files=[] + if not isinstance(filename_list,list): + filename_list=[filename_list] + self.settings_schema_files.extend(filename_list) +def add_settings_enums(self,namespace,filename_list): + if hasattr(self,'settings_enum_namespace'): + raise Errors.WafError("Tried to add gsettings enums to '%s' more than once"%self.name) + self.settings_enum_namespace=namespace + if type(filename_list)!='list': + filename_list=[filename_list] + self.settings_enum_files=filename_list +def r_change_ext(self,ext): + name=self.name + k=name.rfind('.') + if k>=0: + name=name[:k]+ext + else: + name=name+ext + return self.parent.find_or_declare([name]) +def process_settings(self): + enums_tgt_node=[] + install_files=[] + settings_schema_files=getattr(self,'settings_schema_files',[]) + if settings_schema_files and not self.env['GLIB_COMPILE_SCHEMAS']: + raise Errors.WafError("Unable to process GSettings schemas - glib-compile-schemas was not found during configure") + if hasattr(self,'settings_enum_files'): + enums_task=self.create_task('glib_mkenums') + source_list=self.settings_enum_files + source_list=[self.path.find_resource(k)for k in source_list] + enums_task.set_inputs(source_list) + enums_task.env['GLIB_MKENUMS_SOURCE']=[k.abspath()for k in source_list] + target=self.settings_enum_namespace+'.enums.xml' + tgt_node=self.path.find_or_declare(target) + enums_task.set_outputs(tgt_node) + enums_task.env['GLIB_MKENUMS_TARGET']=tgt_node.abspath() + enums_tgt_node=[tgt_node] + install_files.append(tgt_node) + options='--comments "<!-- @comment@ -->" --fhead "<schemalist>" --vhead " <@type@ id=\\"%s.@EnumName@\\">" --vprod " <value nick=\\"@valuenick@\\" value=\\"@valuenum@\\"/>" --vtail " </@type@>" --ftail "</schemalist>" '%(self.settings_enum_namespace) + enums_task.env['GLIB_MKENUMS_OPTIONS']=options + for schema in settings_schema_files: + schema_task=self.create_task('glib_validate_schema') + schema_node=self.path.find_resource(schema) + if not schema_node: + raise Errors.WafError("Cannot find the schema file '%s'"%schema) + install_files.append(schema_node) + source_list=enums_tgt_node+[schema_node] + schema_task.set_inputs(source_list) + schema_task.env['GLIB_COMPILE_SCHEMAS_OPTIONS']=[("--schema-file="+k.abspath())for k in source_list] + target_node=r_change_ext(schema_node,'.xml.valid') + schema_task.set_outputs(target_node) + schema_task.env['GLIB_VALIDATE_SCHEMA_OUTPUT']=target_node.abspath() + def compile_schemas_callback(bld): + if not bld.is_install:return + Logs.pprint('YELLOW','Updating GSettings schema cache') + command=Utils.subst_vars("${GLIB_COMPILE_SCHEMAS} ${GSETTINGSSCHEMADIR}",bld.env) + ret=self.bld.exec_command(command) + if self.bld.is_install: + if not self.env['GSETTINGSSCHEMADIR']: + raise Errors.WafError('GSETTINGSSCHEMADIR not defined (should have been set up automatically during configure)') + if install_files: + self.bld.install_files(self.env['GSETTINGSSCHEMADIR'],install_files) + if not hasattr(self.bld,'_compile_schemas_registered'): + self.bld.add_post_fun(compile_schemas_callback) + self.bld._compile_schemas_registered=True +class glib_validate_schema(Task.Task): + run_str='rm -f ${GLIB_VALIDATE_SCHEMA_OUTPUT} && ${GLIB_COMPILE_SCHEMAS} --dry-run ${GLIB_COMPILE_SCHEMAS_OPTIONS} && touch ${GLIB_VALIDATE_SCHEMA_OUTPUT}' + color='PINK' +def configure(conf): + conf.find_program('glib-genmarshal',var='GLIB_GENMARSHAL') + conf.find_perl_program('glib-mkenums',var='GLIB_MKENUMS') + conf.find_program('glib-compile-schemas',var='GLIB_COMPILE_SCHEMAS',mandatory=False) + def getstr(varname): + return getattr(Options.options,varname,getattr(conf.env,varname,'')) + gsettingsschemadir=getstr('GSETTINGSSCHEMADIR') + if not gsettingsschemadir: + datadir=getstr('DATADIR') + if not datadir: + prefix=conf.env['PREFIX'] + datadir=os.path.join(prefix,'share') + gsettingsschemadir=os.path.join(datadir,'glib-2.0','schemas') + conf.env['GSETTINGSSCHEMADIR']=gsettingsschemadir +def options(opt): + opt.add_option('--gsettingsschemadir',help='GSettings schema location [Default: ${datadir}/glib-2.0/schemas]',default='',dest='GSETTINGSSCHEMADIR') + +taskgen_method(add_marshal_file) +before_method('process_source')(process_marshal) +taskgen_method(add_enums_from_template) +taskgen_method(add_enums) +before_method('process_source')(process_enums) +taskgen_method(add_settings_schemas) +taskgen_method(add_settings_enums) +feature('glib2')(process_settings)
\ No newline at end of file diff --git a/waflib/Tools/gnu_dirs.py b/waflib/Tools/gnu_dirs.py new file mode 100644 index 0000000..e698170 --- /dev/null +++ b/waflib/Tools/gnu_dirs.py @@ -0,0 +1,65 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os +from waflib import Utils,Options,Context +_options=[x.split(', ')for x in''' +bindir, user executables, ${EXEC_PREFIX}/bin +sbindir, system admin executables, ${EXEC_PREFIX}/sbin +libexecdir, program executables, ${EXEC_PREFIX}/libexec +sysconfdir, read-only single-machine data, ${PREFIX}/etc +sharedstatedir, modifiable architecture-independent data, ${PREFIX}/com +localstatedir, modifiable single-machine data, ${PREFIX}/var +libdir, object code libraries, ${EXEC_PREFIX}/lib +includedir, C header files, ${PREFIX}/include +oldincludedir, C header files for non-gcc, /usr/include +datarootdir, read-only arch.-independent data root, ${PREFIX}/share +datadir, read-only architecture-independent data, ${DATAROOTDIR} +infodir, info documentation, ${DATAROOTDIR}/info +localedir, locale-dependent data, ${DATAROOTDIR}/locale +mandir, man documentation, ${DATAROOTDIR}/man +docdir, documentation root, ${DATAROOTDIR}/doc/${PACKAGE} +htmldir, html documentation, ${DOCDIR} +dvidir, dvi documentation, ${DOCDIR} +pdfdir, pdf documentation, ${DOCDIR} +psdir, ps documentation, ${DOCDIR} +'''.split('\n')if x] +def configure(conf): + def get_param(varname,default): + return getattr(Options.options,varname,'')or default + env=conf.env + conf.env.LIBDIR=conf.env.BINDIR=[] + env['EXEC_PREFIX']=get_param('EXEC_PREFIX',env['PREFIX']) + env['PACKAGE']=getattr(Context.g_module,'APPNAME',None)or env['PACKAGE'] + complete=False + iter=0 + while not complete and iter<len(_options)+1: + iter+=1 + complete=True + for name,help,default in _options: + name=name.upper() + if not env[name]: + try: + env[name]=Utils.subst_vars(get_param(name,default).replace('/',os.sep),env) + except TypeError: + complete=False + if not complete: + lst=[name for name,_,_ in _options if not env[name.upper()]] + raise conf.errors.WafError('Variable substitution failure %r'%lst) +def options(opt): + inst_dir=opt.add_option_group('Installation directories','By default, "waf install" will put the files in\ + "/usr/local/bin", "/usr/local/lib" etc. An installation prefix other\ + than "/usr/local" can be given using "--prefix", for example "--prefix=$HOME"') + for k in('--prefix','--destdir'): + option=opt.parser.get_option(k) + if option: + opt.parser.remove_option(k) + inst_dir.add_option(option) + inst_dir.add_option('--exec-prefix',help='installation prefix [Default: ${PREFIX}]',default='',dest='EXEC_PREFIX') + dirs_options=opt.add_option_group('Pre-defined installation directories','') + for name,help,default in _options: + option_name='--'+name + str_default=default + str_help='%s [Default: %s]'%(help,str_default) + dirs_options.add_option(option_name,help=str_help,default='',dest=name.upper()) diff --git a/waflib/Tools/gxx.py b/waflib/Tools/gxx.py new file mode 100644 index 0000000..647008d --- /dev/null +++ b/waflib/Tools/gxx.py @@ -0,0 +1,98 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os,sys +from waflib import Configure,Options,Utils +from waflib.Tools import ccroot,ar +from waflib.Configure import conf +def find_gxx(conf): + cxx=conf.find_program(['g++','c++'],var='CXX') + cxx=conf.cmd_to_list(cxx) + conf.get_cc_version(cxx,gcc=True) + conf.env.CXX_NAME='gcc' + conf.env.CXX=cxx +def gxx_common_flags(conf): + v=conf.env + v['CXX_SRC_F']=[] + v['CXX_TGT_F']=['-c','-o'] + if not v['LINK_CXX']:v['LINK_CXX']=v['CXX'] + v['CXXLNK_SRC_F']=[] + v['CXXLNK_TGT_F']=['-o'] + v['CPPPATH_ST']='-I%s' + v['DEFINES_ST']='-D%s' + v['LIB_ST']='-l%s' + v['LIBPATH_ST']='-L%s' + v['STLIB_ST']='-l%s' + v['STLIBPATH_ST']='-L%s' + v['RPATH_ST']='-Wl,-rpath,%s' + v['SONAME_ST']='-Wl,-h,%s' + v['SHLIB_MARKER']='-Wl,-Bdynamic' + v['STLIB_MARKER']='-Wl,-Bstatic' + v['cxxprogram_PATTERN']='%s' + v['CXXFLAGS_cxxshlib']=['-fPIC'] + v['LINKFLAGS_cxxshlib']=['-shared'] + v['cxxshlib_PATTERN']='lib%s.so' + v['LINKFLAGS_cxxstlib']=['-Wl,-Bstatic'] + v['cxxstlib_PATTERN']='lib%s.a' + v['LINKFLAGS_MACBUNDLE']=['-bundle','-undefined','dynamic_lookup'] + v['CXXFLAGS_MACBUNDLE']=['-fPIC'] + v['macbundle_PATTERN']='%s.bundle' +def gxx_modifier_win32(conf): + v=conf.env + v['cxxprogram_PATTERN']='%s.exe' + v['cxxshlib_PATTERN']='%s.dll' + v['implib_PATTERN']='lib%s.dll.a' + v['IMPLIB_ST']='-Wl,--out-implib,%s' + v['CXXFLAGS_cxxshlib']=[] + v.append_value('CXXFLAGS_cxxshlib',['-DDLL_EXPORT']) + v.append_value('LINKFLAGS',['-Wl,--enable-auto-import']) +def gxx_modifier_cygwin(conf): + gxx_modifier_win32(conf) + v=conf.env + v['cxxshlib_PATTERN']='cyg%s.dll' + v.append_value('LINKFLAGS_cxxshlib',['-Wl,--enable-auto-image-base']) + v['CXXFLAGS_cxxshlib']=[] +def gxx_modifier_darwin(conf): + v=conf.env + v['CXXFLAGS_cxxshlib']=['-fPIC','-compatibility_version','1','-current_version','1'] + v['LINKFLAGS_cxxshlib']=['-dynamiclib'] + v['cxxshlib_PATTERN']='lib%s.dylib' + v['FRAMEWORKPATH_ST']='-F%s' + v['FRAMEWORK_ST']=['-framework'] + v['ARCH_ST']=['-arch'] + v['LINKFLAGS_cxxstlib']=[] + v['SHLIB_MARKER']=[] + v['STLIB_MARKER']=[] + v['SONAME_ST']=[] +def gxx_modifier_aix(conf): + v=conf.env + v['LINKFLAGS_cxxprogram']=['-Wl,-brtl'] + v['LINKFLAGS_cxxshlib']=['-shared','-Wl,-brtl,-bexpfull'] + v['SHLIB_MARKER']=[] +def gxx_modifier_hpux(conf): + v=conf.env + v['SHLIB_MARKER']=[] + v['CFLAGS_cxxshlib']=['-fPIC','-DPIC'] + v['cxxshlib_PATTERN']='lib%s.sl' +def gxx_modifier_platform(conf): + gxx_modifier_func=getattr(conf,'gxx_modifier_'+conf.env.DEST_OS,None) + if gxx_modifier_func: + gxx_modifier_func() +def configure(conf): + conf.find_gxx() + conf.find_ar() + conf.gxx_common_flags() + conf.gxx_modifier_platform() + conf.cxx_load_tools() + conf.cxx_add_flags() + conf.link_add_flags() + +conf(find_gxx) +conf(gxx_common_flags) +conf(gxx_modifier_win32) +conf(gxx_modifier_cygwin) +conf(gxx_modifier_darwin) +conf(gxx_modifier_aix) +conf(gxx_modifier_hpux) +conf(gxx_modifier_platform)
\ No newline at end of file diff --git a/waflib/Tools/icc.py b/waflib/Tools/icc.py new file mode 100644 index 0000000..eaac1cd --- /dev/null +++ b/waflib/Tools/icc.py @@ -0,0 +1,31 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os,sys +from waflib.Tools import ccroot,ar,gcc +from waflib.Configure import conf +def find_icc(conf): + if sys.platform=='cygwin': + conf.fatal('The Intel compiler does not work on Cygwin') + v=conf.env + cc=None + if v['CC']:cc=v['CC'] + elif'CC'in conf.environ:cc=conf.environ['CC'] + if not cc:cc=conf.find_program('icc',var='CC') + if not cc:cc=conf.find_program('ICL',var='CC') + if not cc:conf.fatal('Intel C Compiler (icc) was not found') + cc=conf.cmd_to_list(cc) + conf.get_cc_version(cc,icc=True) + v['CC']=cc + v['CC_NAME']='icc' +def configure(conf): + conf.find_icc() + conf.find_ar() + conf.gcc_common_flags() + conf.gcc_modifier_platform() + conf.cc_load_tools() + conf.cc_add_flags() + conf.link_add_flags() + +conf(find_icc)
\ No newline at end of file diff --git a/waflib/Tools/icpc.py b/waflib/Tools/icpc.py new file mode 100644 index 0000000..6a222ff --- /dev/null +++ b/waflib/Tools/icpc.py @@ -0,0 +1,30 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os,sys +from waflib.Tools import ccroot,ar,gxx +from waflib.Configure import conf +def find_icpc(conf): + if sys.platform=='cygwin': + conf.fatal('The Intel compiler does not work on Cygwin') + v=conf.env + cxx=None + if v['CXX']:cxx=v['CXX'] + elif'CXX'in conf.environ:cxx=conf.environ['CXX'] + if not cxx:cxx=conf.find_program('icpc',var='CXX') + if not cxx:conf.fatal('Intel C++ Compiler (icpc) was not found') + cxx=conf.cmd_to_list(cxx) + conf.get_cc_version(cxx,icc=True) + v['CXX']=cxx + v['CXX_NAME']='icc' +def configure(conf): + conf.find_icpc() + conf.find_ar() + conf.gxx_common_flags() + conf.gxx_modifier_platform() + conf.cxx_load_tools() + conf.cxx_add_flags() + conf.link_add_flags() + +conf(find_icpc)
\ No newline at end of file diff --git a/waflib/Tools/ifort.py b/waflib/Tools/ifort.py new file mode 100644 index 0000000..e9ad686 --- /dev/null +++ b/waflib/Tools/ifort.py @@ -0,0 +1,49 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import re +from waflib import Utils +from waflib.Tools import fc,fc_config,fc_scan +from waflib.Configure import conf +def find_ifort(conf): + fc=conf.find_program('ifort',var='FC') + fc=conf.cmd_to_list(fc) + conf.get_ifort_version(fc) + conf.env.FC_NAME='IFORT' +def ifort_modifier_cygwin(conf): + raise NotImplementedError("Ifort on cygwin not yet implemented") +def ifort_modifier_win32(conf): + fc_config.fortran_modifier_win32(conf) +def ifort_modifier_darwin(conf): + fc_config.fortran_modifier_darwin(conf) +def ifort_modifier_platform(conf): + dest_os=conf.env['DEST_OS']or Utils.unversioned_sys_platform() + ifort_modifier_func=getattr(conf,'ifort_modifier_'+dest_os,None) + if ifort_modifier_func: + ifort_modifier_func() +def get_ifort_version(conf,fc): + version_re=re.compile(r"ifort\s*\(IFORT\)\s*(?P<major>\d*)\.(?P<minor>\d*)",re.I).search + cmd=fc+['--version'] + out,err=fc_config.getoutput(conf,cmd,stdin=False) + if out: + match=version_re(out) + else: + match=version_re(err) + if not match: + conf.fatal('cannot determine ifort version.') + k=match.groupdict() + conf.env['FC_VERSION']=(k['major'],k['minor']) +def configure(conf): + conf.find_ifort() + conf.find_program('xiar',var='AR') + conf.env.ARFLAGS='rcs' + conf.fc_flags() + conf.ifort_modifier_platform() + +conf(find_ifort) +conf(ifort_modifier_cygwin) +conf(ifort_modifier_win32) +conf(ifort_modifier_darwin) +conf(ifort_modifier_platform) +conf(get_ifort_version)
\ No newline at end of file diff --git a/waflib/Tools/intltool.py b/waflib/Tools/intltool.py new file mode 100644 index 0000000..54cb3a2 --- /dev/null +++ b/waflib/Tools/intltool.py @@ -0,0 +1,78 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os,re +from waflib import Configure,TaskGen,Task,Utils,Runner,Options,Build,Logs +import waflib.Tools.ccroot +from waflib.TaskGen import feature,before_method +from waflib.Logs import error +def apply_intltool_in_f(self): + try:self.meths.remove('process_source') + except ValueError:pass + if not self.env.LOCALEDIR: + self.env.LOCALEDIR=self.env.PREFIX+'/share/locale' + for i in self.to_list(self.source): + node=self.path.find_resource(i) + podir=getattr(self,'podir','po') + podirnode=self.path.find_dir(podir) + if not podirnode: + error("could not find the podir %r"%podir) + continue + cache=getattr(self,'intlcache','.intlcache') + self.env['INTLCACHE']=os.path.join(self.path.bldpath(),podir,cache) + self.env['INTLPODIR']=podirnode.bldpath() + self.env['INTLFLAGS']=getattr(self,'flags',['-q','-u','-c']) + task=self.create_task('intltool',node,node.change_ext('')) + inst=getattr(self,'install_path','${LOCALEDIR}') + if inst: + self.bld.install_files(inst,task.outputs) +def apply_intltool_po(self): + try:self.meths.remove('process_source') + except ValueError:pass + if not self.env.LOCALEDIR: + self.env.LOCALEDIR=self.env.PREFIX+'/share/locale' + appname=getattr(self,'appname','set_your_app_name') + podir=getattr(self,'podir','') + inst=getattr(self,'install_path','${LOCALEDIR}') + linguas=self.path.find_node(os.path.join(podir,'LINGUAS')) + if linguas: + file=open(linguas.abspath()) + langs=[] + for line in file.readlines(): + if not line.startswith('#'): + langs+=line.split() + file.close() + re_linguas=re.compile('[-a-zA-Z_@.]+') + for lang in langs: + if re_linguas.match(lang): + node=self.path.find_resource(os.path.join(podir,re_linguas.match(lang).group()+'.po')) + task=self.create_task('po',node,node.change_ext('.mo')) + if inst: + filename=task.outputs[0].name + (langname,ext)=os.path.splitext(filename) + inst_file=inst+os.sep+langname+os.sep+'LC_MESSAGES'+os.sep+appname+'.mo' + self.bld.install_as(inst_file,task.outputs[0],chmod=getattr(self,'chmod',Utils.O644),env=task.env) + else: + Logs.pprint('RED',"Error no LINGUAS file found in po directory") +class po(Task.Task): + run_str='${MSGFMT} -o ${TGT} ${SRC}' + color='BLUE' +class intltool(Task.Task): + run_str='${INTLTOOL} ${INTLFLAGS} ${INTLCACHE} ${INTLPODIR} ${SRC} ${TGT}' + color='BLUE' +def configure(conf): + conf.find_program('msgfmt',var='MSGFMT') + conf.find_perl_program('intltool-merge',var='INTLTOOL') + prefix=conf.env.PREFIX + datadir=conf.env.DATADIR + if not datadir: + datadir=os.path.join(prefix,'share') + conf.define('LOCALEDIR',os.path.join(datadir,'locale').replace('\\','\\\\')) + conf.define('DATADIR',datadir.replace('\\','\\\\')) + if conf.env.CC or conf.env.CXX: + conf.check(header_name='locale.h') + +before_method('process_source')(apply_intltool_in_f) +feature('intltool_in')(apply_intltool_in_f) +feature('intltool_po')(apply_intltool_po)
\ No newline at end of file diff --git a/waflib/Tools/irixcc.py b/waflib/Tools/irixcc.py new file mode 100644 index 0000000..bae88c9 --- /dev/null +++ b/waflib/Tools/irixcc.py @@ -0,0 +1,49 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os +from waflib import Utils +from waflib.Tools import ccroot,ar +from waflib.Configure import conf +def find_irixcc(conf): + v=conf.env + cc=None + if v['CC']:cc=v['CC'] + elif'CC'in conf.environ:cc=conf.environ['CC'] + if not cc:cc=conf.find_program('cc',var='CC') + if not cc:conf.fatal('irixcc was not found') + cc=conf.cmd_to_list(cc) + try: + conf.cmd_and_log(cc+['-version']) + except: + conf.fatal('%r -version could not be executed'%cc) + v['CC']=cc + v['CC_NAME']='irix' +def irixcc_common_flags(conf): + v=conf.env + v['CC_SRC_F']='' + v['CC_TGT_F']=['-c','-o'] + v['CPPPATH_ST']='-I%s' + v['DEFINES_ST']='-D%s' + if not v['LINK_CC']:v['LINK_CC']=v['CC'] + v['CCLNK_SRC_F']='' + v['CCLNK_TGT_F']=['-o'] + v['LIB_ST']='-l%s' + v['LIBPATH_ST']='-L%s' + v['STLIB_ST']='-l%s' + v['STLIBPATH_ST']='-L%s' + v['cprogram_PATTERN']='%s' + v['cshlib_PATTERN']='lib%s.so' + v['cstlib_PATTERN']='lib%s.a' +def configure(conf): + conf.find_irixcc() + conf.find_cpp() + conf.find_ar() + conf.irixcc_common_flags() + conf.cc_load_tools() + conf.cc_add_flags() + conf.link_add_flags() + +conf(find_irixcc) +conf(irixcc_common_flags)
\ No newline at end of file diff --git a/waflib/Tools/javaw.py b/waflib/Tools/javaw.py new file mode 100644 index 0000000..26ff560 --- /dev/null +++ b/waflib/Tools/javaw.py @@ -0,0 +1,275 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import sys +if sys.hexversion < 0x020400f0: from sets import Set as set +import os,re,tempfile,shutil +from waflib.Configure import conf +from waflib import TaskGen,Task,Utils,Options,Build,Errors,Node,Logs +from waflib.TaskGen import feature,before_method,after_method +from waflib.Tools import ccroot +ccroot.USELIB_VARS['javac']=set(['CLASSPATH','JAVACFLAGS']) +SOURCE_RE='**/*.java' +JAR_RE='**/*' +class_check_source=''' +public class Test { + public static void main(String[] argv) { + Class lib; + if (argv.length < 1) { + System.err.println("Missing argument"); + System.exit(77); + } + try { + lib = Class.forName(argv[0]); + } catch (ClassNotFoundException e) { + System.err.println("ClassNotFoundException"); + System.exit(1); + } + lib = null; + System.exit(0); + } +} +''' +def apply_java(self): + Utils.def_attrs(self,jarname='',classpath='',sourcepath='.',srcdir='.',jar_mf_attributes={},jar_mf_classpath=[]) + nodes_lst=[] + outdir=getattr(self,'outdir',None) + if outdir: + if not isinstance(outdir,Node.Node): + outdir=self.path.get_bld().make_node(self.outdir) + else: + outdir=self.path.get_bld() + outdir.mkdir() + self.outdir=outdir + self.env['OUTDIR']=outdir.abspath() + self.javac_task=tsk=self.create_task('javac') + tmp=[] + srcdir=getattr(self,'srcdir','') + if isinstance(srcdir,Node.Node): + srcdir=[srcdir] + for x in Utils.to_list(srcdir): + if isinstance(x,Node.Node): + y=x + else: + y=self.path.find_dir(x) + if not y: + self.bld.fatal('Could not find the folder %s from %s'%(x,self.path)) + tmp.append(y) + tsk.srcdir=tmp + if getattr(self,'compat',None): + tsk.env.append_value('JAVACFLAGS',['-source',self.compat]) + if hasattr(self,'sourcepath'): + fold=[isinstance(x,Node.Node)and x or self.path.find_dir(x)for x in self.to_list(self.sourcepath)] + names=os.pathsep.join([x.srcpath()for x in fold]) + else: + names=[x.srcpath()for x in tsk.srcdir] + if names: + tsk.env.append_value('JAVACFLAGS',['-sourcepath',names]) +def use_javac_files(self): + lst=[] + self.uselib=self.to_list(getattr(self,'uselib',[])) + names=self.to_list(getattr(self,'use',[])) + get=self.bld.get_tgen_by_name + for x in names: + try: + y=get(x) + except: + self.uselib.append(x) + else: + y.post() + lst.append(y.jar_task.outputs[0].abspath()) + self.javac_task.set_run_after(y.jar_task) + if lst: + self.env.append_value('CLASSPATH',lst) +def set_classpath(self): + self.env.append_value('CLASSPATH',getattr(self,'classpath',[])) + for x in self.tasks: + x.env.CLASSPATH=os.pathsep.join(self.env.CLASSPATH)+os.pathsep +def jar_files(self): + destfile=getattr(self,'destfile','test.jar') + jaropts=getattr(self,'jaropts',[]) + manifest=getattr(self,'manifest',None) + basedir=getattr(self,'basedir',None) + if basedir: + if not isinstance(self.basedir,Node.Node): + basedir=self.path.get_bld().make_node(basedir) + else: + basedir=self.path.get_bld() + if not basedir: + self.bld.fatal('Could not find the basedir %r for %r'%(self.basedir,self)) + self.jar_task=tsk=self.create_task('jar_create') + if manifest: + jarcreate=getattr(self,'jarcreate','cfm') + node=self.path.find_node(manifest) + tsk.dep_nodes.append(node) + jaropts.insert(0,node.abspath()) + else: + jarcreate=getattr(self,'jarcreate','cf') + if not isinstance(destfile,Node.Node): + destfile=self.path.find_or_declare(destfile) + if not destfile: + self.bld.fatal('invalid destfile %r for %r'%(destfile,self)) + tsk.set_outputs(destfile) + tsk.basedir=basedir + jaropts.append('-C') + jaropts.append(basedir.bldpath()) + jaropts.append('.') + tsk.env['JAROPTS']=jaropts + tsk.env['JARCREATE']=jarcreate + if getattr(self,'javac_task',None): + tsk.set_run_after(self.javac_task) +def use_jar_files(self): + lst=[] + self.uselib=self.to_list(getattr(self,'uselib',[])) + names=self.to_list(getattr(self,'use',[])) + get=self.bld.get_tgen_by_name + for x in names: + try: + y=get(x) + except: + self.uselib.append(x) + else: + y.post() + self.jar_task.run_after.update(y.tasks) +class jar_create(Task.Task): + color='GREEN' + run_str='${JAR} ${JARCREATE} ${TGT} ${JAROPTS}' + def runnable_status(self): + for t in self.run_after: + if not t.hasrun: + return Task.ASK_LATER + if not self.inputs: + global JAR_RE + try: + self.inputs=[x for x in self.basedir.ant_glob(JAR_RE,remove=False)if id(x)!=id(self.outputs[0])] + except: + raise Errors.WafError('Could not find the basedir %r for %r'%(self.basedir,self)) + return super(jar_create,self).runnable_status() +class javac(Task.Task): + color='BLUE' + nocache=True + vars=['CLASSPATH','JAVACFLAGS','JAVAC','OUTDIR'] + def runnable_status(self): + for t in self.run_after: + if not t.hasrun: + return Task.ASK_LATER + if not self.inputs: + global SOURCE_RE + self.inputs=[] + for x in self.srcdir: + self.inputs.extend(x.ant_glob(SOURCE_RE,remove=False)) + return super(javac,self).runnable_status() + def run(self): + env=self.env + gen=self.generator + bld=gen.bld + wd=bld.bldnode.abspath() + def to_list(xx): + if isinstance(xx,str):return[xx] + return xx + cmd=[] + cmd.extend(to_list(env['JAVAC'])) + cmd.extend(['-classpath']) + cmd.extend(to_list(env['CLASSPATH'])) + cmd.extend(['-d']) + cmd.extend(to_list(env['OUTDIR'])) + cmd.extend(to_list(env['JAVACFLAGS'])) + files=[a.path_from(bld.bldnode)for a in self.inputs] + tmp=None + try: + if len(str(files))+len(str(cmd))>8192: + (fd,tmp)=tempfile.mkstemp(dir=bld.bldnode.abspath()) + try: + os.write(fd,'\n'.join(files)) + finally: + if tmp: + os.close(fd) + if Logs.verbose: + Logs.debug('runner: %r'%(cmd+files)) + cmd.append('@'+tmp) + else: + cmd+=files + ret=self.exec_command(cmd,cwd=wd,env=env.env or None) + finally: + if tmp: + os.unlink(tmp) + return ret + def post_run(self): + for n in self.generator.outdir.ant_glob('**/*.class'): + n.sig=Utils.h_file(n.abspath()) + self.generator.bld.task_sigs[self.uid()]=self.cache_sig +def configure(self): + java_path=self.environ['PATH'].split(os.pathsep) + v=self.env + if'JAVA_HOME'in self.environ: + java_path=[os.path.join(self.environ['JAVA_HOME'],'bin')]+java_path + self.env['JAVA_HOME']=[self.environ['JAVA_HOME']] + for x in'javac java jar'.split(): + self.find_program(x,var=x.upper(),path_list=java_path) + self.env[x.upper()]=self.cmd_to_list(self.env[x.upper()]) + if'CLASSPATH'in self.environ: + v['CLASSPATH']=self.environ['CLASSPATH'] + if not v['JAR']:self.fatal('jar is required for making java packages') + if not v['JAVAC']:self.fatal('javac is required for compiling java classes') + v['JARCREATE']='cf' + v['JAVACFLAGS']=[] +def check_java_class(self,classname,with_classpath=None): + javatestdir='.waf-javatest' + classpath=javatestdir + if self.env['CLASSPATH']: + classpath+=os.pathsep+self.env['CLASSPATH'] + if isinstance(with_classpath,str): + classpath+=os.pathsep+with_classpath + shutil.rmtree(javatestdir,True) + os.mkdir(javatestdir) + java_file=open(os.path.join(javatestdir,'Test.java'),'w') + java_file.write(class_check_source) + java_file.close() + self.exec_command(self.env['JAVAC']+[os.path.join(javatestdir,'Test.java')],shell=False) + cmd=self.env['JAVA']+['-cp',classpath,'Test',classname] + self.to_log("%s\n"%str(cmd)) + found=self.exec_command(cmd,shell=False) + self.msg('Checking for java class %s'%classname,not found) + shutil.rmtree(javatestdir,True) + return found +def check_jni_headers(conf): + if not conf.env.CC_NAME and not conf.env.CXX_NAME: + conf.fatal('load a compiler first (gcc, g++, ..)') + if not conf.env.JAVA_HOME: + conf.fatal('set JAVA_HOME in the system environment') + javaHome=conf.env['JAVA_HOME'][0] + dir=conf.root.find_dir(conf.env.JAVA_HOME[0]+'/include') + if dir is None: + conf.fatal('JAVA_HOME does not seem to be set properly') + f=dir.ant_glob('**/(jni|jni_md).h') + incDirs=[x.parent.abspath()for x in f] + dir=conf.root.find_dir(conf.env.JAVA_HOME[0]) + f=dir.ant_glob('**/*jvm.(so|dll|dylib)') + libDirs=[x.parent.abspath()for x in f]or[javaHome] + f=dir.ant_glob('**/*jvm.(lib)') + if f: + libDirs=[[x,y.parent.abspath()]for x in libDirs for y in f] + for d in libDirs: + try: + conf.check(header_name='jni.h',define_name='HAVE_JNI_H',lib='jvm',libpath=d,includes=incDirs,uselib_store='JAVA',uselib='JAVA') + except: + pass + else: + break + else: + conf.fatal('could not find lib jvm in %r (see config.log)'%libDirs) + +feature('javac')(apply_java) +before_method('process_source')(apply_java) +feature('javac')(use_javac_files) +after_method('apply_java')(use_javac_files) +feature('javac')(set_classpath) +after_method('apply_java','propagate_uselib_vars','use_javac_files')(set_classpath) +feature('jar')(jar_files) +after_method('apply_java','use_javac_files')(jar_files) +before_method('process_source')(jar_files) +feature('jar')(use_jar_files) +after_method('jar_files')(use_jar_files) +conf(check_java_class) +conf(check_jni_headers)
\ No newline at end of file diff --git a/waflib/Tools/kde4.py b/waflib/Tools/kde4.py new file mode 100644 index 0000000..e4a8a92 --- /dev/null +++ b/waflib/Tools/kde4.py @@ -0,0 +1,49 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os,sys,re +from waflib import Options,TaskGen,Task,Utils +from waflib.TaskGen import feature,after_method +def apply_msgfmt(self): + for lang in self.to_list(self.langs): + node=self.path.find_resource(lang+'.po') + task=self.create_task('msgfmt',node,node.change_ext('.mo')) + langname=lang.split('/') + langname=langname[-1] + inst=getattr(self,'install_path','${KDE4_LOCALE_INSTALL_DIR}') + self.bld.install_as(inst+os.sep+langname+os.sep+'LC_MESSAGES'+os.sep+getattr(self,'appname','set_your_appname')+'.mo',task.outputs[0],chmod=getattr(self,'chmod',Utils.O644)) +class msgfmt(Task.Task): + color='BLUE' + run_str='${MSGFMT} ${SRC} -o ${TGT}' +def configure(self): + kdeconfig=self.find_program('kde4-config') + prefix=self.cmd_and_log('%s --prefix'%kdeconfig).strip() + fname='%s/share/apps/cmake/modules/KDELibsDependencies.cmake'%prefix + try:os.stat(fname) + except OSError: + fname='%s/share/kde4/apps/cmake/modules/KDELibsDependencies.cmake'%prefix + try:os.stat(fname) + except OSError:self.fatal('could not open %s'%fname) + try: + txt=Utils.readf(fname) + except(OSError,IOError): + self.fatal('could not read %s'%fname) + txt=txt.replace('\\\n','\n') + fu=re.compile('#(.*)\n') + txt=fu.sub('',txt) + setregexp=re.compile('([sS][eE][tT]\s*\()\s*([^\s]+)\s+\"([^"]+)\"\)') + found=setregexp.findall(txt) + for(_,key,val)in found: + self.env[key]=val + self.env['LIB_KDECORE']=['kdecore'] + self.env['LIB_KDEUI']=['kdeui'] + self.env['LIB_KIO']=['kio'] + self.env['LIB_KHTML']=['khtml'] + self.env['LIB_KPARTS']=['kparts'] + self.env['LIBPATH_KDECORE']=[self.env['KDE4_LIB_INSTALL_DIR']] + self.env['INCLUDES_KDECORE']=[self.env['KDE4_INCLUDE_INSTALL_DIR']] + self.env.append_value('INCLUDES_KDECORE',[self.env['KDE4_INCLUDE_INSTALL_DIR']+os.sep+'KDE']) + self.find_program('msgfmt',var='MSGFMT') + +feature('msgfmt')(apply_msgfmt)
\ No newline at end of file diff --git a/waflib/Tools/lua.py b/waflib/Tools/lua.py new file mode 100644 index 0000000..0d48d4f --- /dev/null +++ b/waflib/Tools/lua.py @@ -0,0 +1,19 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +from waflib.TaskGen import extension +from waflib import Task,Utils +def add_lua(self,node): + tsk=self.create_task('luac',node,node.change_ext('.luac')) + inst_to=getattr(self,'install_path',self.env.LUADIR and'${LUADIR}'or None) + if inst_to: + self.bld.install_files(inst_to,tsk.outputs) + return tsk +class luac(Task.Task): + run_str='${LUAC} -s -o ${TGT} ${SRC}' + color='PINK' +def configure(conf): + conf.find_program('luac',var='LUAC') + +extension('.lua')(add_lua)
\ No newline at end of file diff --git a/waflib/Tools/msvc.py b/waflib/Tools/msvc.py new file mode 100644 index 0000000..1ec9bb6 --- /dev/null +++ b/waflib/Tools/msvc.py @@ -0,0 +1,654 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os,sys,re,tempfile +try: + import _winreg +except: + try: + import winreg as _winreg + except: + _winreg=None +from waflib import Utils,TaskGen,Runner,Configure,Task,Options +from waflib.Logs import debug,info,warn,error +from waflib.TaskGen import after_method,before_method,feature +from waflib.Configure import conf +from waflib.Tools import ccroot,c,cxx,ar,winres +g_msvc_systemlibs=''' +aclui activeds ad1 adptif adsiid advapi32 asycfilt authz bhsupp bits bufferoverflowu cabinet +cap certadm certidl ciuuid clusapi comctl32 comdlg32 comsupp comsuppd comsuppw comsuppwd comsvcs +credui crypt32 cryptnet cryptui d3d8thk daouuid dbgeng dbghelp dciman32 ddao35 ddao35d +ddao35u ddao35ud delayimp dhcpcsvc dhcpsapi dlcapi dnsapi dsprop dsuiext dtchelp +faultrep fcachdll fci fdi framedyd framedyn gdi32 gdiplus glauxglu32 gpedit gpmuuid +gtrts32w gtrtst32hlink htmlhelp httpapi icm32 icmui imagehlp imm32 iphlpapi iprop +kernel32 ksguid ksproxy ksuser libcmt libcmtd libcpmt libcpmtd loadperf lz32 mapi +mapi32 mgmtapi minidump mmc mobsync mpr mprapi mqoa mqrt msacm32 mscms mscoree +msdasc msimg32 msrating mstask msvcmrt msvcurt msvcurtd mswsock msxml2 mtx mtxdm +netapi32 nmapinmsupp npptools ntdsapi ntdsbcli ntmsapi ntquery odbc32 odbcbcp +odbccp32 oldnames ole32 oleacc oleaut32 oledb oledlgolepro32 opends60 opengl32 +osptk parser pdh penter pgobootrun pgort powrprof psapi ptrustm ptrustmd ptrustu +ptrustud qosname rasapi32 rasdlg rassapi resutils riched20 rpcndr rpcns4 rpcrt4 rtm +rtutils runtmchk scarddlg scrnsave scrnsavw secur32 sensapi setupapi sfc shell32 +shfolder shlwapi sisbkup snmpapi sporder srclient sti strsafe svcguid tapi32 thunk32 +traffic unicows url urlmon user32 userenv usp10 uuid uxtheme vcomp vcompd vdmdbg +version vfw32 wbemuuid webpost wiaguid wininet winmm winscard winspool winstrm +wintrust wldap32 wmiutils wow32 ws2_32 wsnmp32 wsock32 wst wtsapi32 xaswitch xolehlp +'''.split() +all_msvc_platforms=[('x64','amd64'),('x86','x86'),('ia64','ia64'),('x86_amd64','amd64'),('x86_ia64','ia64')] +all_wince_platforms=[('armv4','arm'),('armv4i','arm'),('mipsii','mips'),('mipsii_fp','mips'),('mipsiv','mips'),('mipsiv_fp','mips'),('sh4','sh'),('x86','cex86')] +all_icl_platforms=[('intel64','amd64'),('em64t','amd64'),('ia32','x86'),('Itanium','ia64')] +def options(opt): + opt.add_option('--msvc_version',type='string',help='msvc version, eg: "msvc 10.0,msvc 9.0"',default='') + opt.add_option('--msvc_targets',type='string',help='msvc targets, eg: "x64,arm"',default='') +def setup_msvc(conf,versions): + platforms=getattr(Options.options,'msvc_targets','').split(',') + if platforms==['']: + platforms=Utils.to_list(conf.env['MSVC_TARGETS'])or[i for i,j in all_msvc_platforms+all_icl_platforms+all_wince_platforms] + desired_versions=getattr(Options.options,'msvc_version','').split(',') + if desired_versions==['']: + desired_versions=conf.env['MSVC_VERSIONS']or[v for v,_ in versions][::-1] + versiondict=dict(versions) + for version in desired_versions: + try: + targets=dict(versiondict[version]) + for target in platforms: + try: + arch,(p1,p2,p3)=targets[target] + compiler,revision=version.rsplit(' ',1) + return compiler,revision,p1,p2,p3 + except KeyError:continue + except KeyError:continue + conf.fatal('msvc: Impossible to find a valid architecture for building (in setup_msvc)') +def get_msvc_version(conf,compiler,version,target,vcvars): + debug('msvc: get_msvc_version: %r %r %r',compiler,version,target) + batfile=conf.bldnode.make_node('waf-print-msvc.bat') + batfile.write("""@echo off +set INCLUDE= +set LIB= +call "%s" %s +echo PATH=%%PATH%% +echo INCLUDE=%%INCLUDE%% +echo LIB=%%LIB%% +"""%(vcvars,target)) + sout=conf.cmd_and_log(['cmd','/E:on','/V:on','/C',batfile.abspath()]) + lines=sout.splitlines() + if not lines[0]:lines=lines[1:] + for x in('Setting environment','Setting SDK environment','Intel(R) C++ Compiler','Intel Parallel Studio'): + if lines[0].find(x)!=-1: + break + else: + debug('msvc: get_msvc_version: %r %r %r -> not found',compiler,version,target) + conf.fatal('msvc: Impossible to find a valid architecture for building (in get_msvc_version)') + for line in lines[1:]: + if line.startswith('PATH='): + path=line[5:] + MSVC_PATH=path.split(';') + elif line.startswith('INCLUDE='): + MSVC_INCDIR=[i for i in line[8:].split(';')if i] + elif line.startswith('LIB='): + MSVC_LIBDIR=[i for i in line[4:].split(';')if i] + env={} + env.update(os.environ) + env.update(PATH=path) + compiler_name,linker_name,lib_name=_get_prog_names(conf,compiler) + cxx=conf.find_program(compiler_name,path_list=MSVC_PATH) + cxx=conf.cmd_to_list(cxx) + if'CL'in env: + del(env['CL']) + try: + try: + conf.cmd_and_log(cxx+['/help'],env=env) + except Exception ,e: + debug('msvc: get_msvc_version: %r %r %r -> failure'%(compiler,version,target)) + debug(str(e)) + conf.fatal('msvc: cannot run the compiler (in get_msvc_version)') + else: + debug('msvc: get_msvc_version: %r %r %r -> OK',compiler,version,target) + finally: + conf.env[compiler_name]='' + return(MSVC_PATH,MSVC_INCDIR,MSVC_LIBDIR) +def gather_wsdk_versions(conf,versions): + version_pattern=re.compile('^v..?.?\...?.?') + try: + all_versions=_winreg.OpenKey(_winreg.HKEY_LOCAL_MACHINE,'SOFTWARE\\Wow6432node\\Microsoft\\Microsoft SDKs\\Windows') + except WindowsError: + try: + all_versions=_winreg.OpenKey(_winreg.HKEY_LOCAL_MACHINE,'SOFTWARE\\Microsoft\\Microsoft SDKs\\Windows') + except WindowsError: + return + index=0 + while 1: + try: + version=_winreg.EnumKey(all_versions,index) + except WindowsError: + break + index=index+1 + if not version_pattern.match(version): + continue + try: + msvc_version=_winreg.OpenKey(all_versions,version) + path,type=_winreg.QueryValueEx(msvc_version,'InstallationFolder') + except WindowsError: + continue + if os.path.isfile(os.path.join(path,'bin','SetEnv.cmd')): + targets=[] + for target,arch in all_msvc_platforms: + try: + targets.append((target,(arch,conf.get_msvc_version('wsdk',version,'/'+target,os.path.join(path,'bin','SetEnv.cmd'))))) + except conf.errors.ConfigurationError: + pass + versions.append(('wsdk '+version[1:],targets)) +def gather_wince_supported_platforms(): + supported_wince_platforms=[] + try: + ce_sdk=_winreg.OpenKey(_winreg.HKEY_LOCAL_MACHINE,'SOFTWARE\\Wow6432node\\Microsoft\\Windows CE Tools\\SDKs') + except WindowsError: + try: + ce_sdk=_winreg.OpenKey(_winreg.HKEY_LOCAL_MACHINE,'SOFTWARE\\Microsoft\\Windows CE Tools\\SDKs') + except WindowsError: + ce_sdk='' + if not ce_sdk: + return supported_wince_platforms + ce_index=0 + while 1: + try: + sdk_device=_winreg.EnumKey(ce_sdk,ce_index) + except WindowsError: + break + ce_index=ce_index+1 + sdk=_winreg.OpenKey(ce_sdk,sdk_device) + try: + path,type=_winreg.QueryValueEx(sdk,'SDKRootDir') + except WindowsError: + try: + path,type=_winreg.QueryValueEx(sdk,'SDKInformation') + path,xml=os.path.split(path) + except WindowsError: + continue + path=str(path) + path,device=os.path.split(path) + if not device: + path,device=os.path.split(path) + for arch,compiler in all_wince_platforms: + platforms=[] + if os.path.isdir(os.path.join(path,device,'Lib',arch)): + platforms.append((arch,compiler,os.path.join(path,device,'Include',arch),os.path.join(path,device,'Lib',arch))) + if platforms: + supported_wince_platforms.append((device,platforms)) + return supported_wince_platforms +def gather_msvc_detected_versions(): + version_pattern=re.compile('^(\d\d?\.\d\d?)(Exp)?$') + detected_versions=[] + for vcver,vcvar in[('VCExpress','Exp'),('VisualStudio','')]: + try: + prefix='SOFTWARE\\Wow6432node\\Microsoft\\'+vcver + all_versions=_winreg.OpenKey(_winreg.HKEY_LOCAL_MACHINE,prefix) + except WindowsError: + try: + prefix='SOFTWARE\\Microsoft\\'+vcver + all_versions=_winreg.OpenKey(_winreg.HKEY_LOCAL_MACHINE,prefix) + except WindowsError: + continue + index=0 + while 1: + try: + version=_winreg.EnumKey(all_versions,index) + except WindowsError: + break + index=index+1 + match=version_pattern.match(version) + if not match: + continue + else: + versionnumber=float(match.group(1)) + detected_versions.append((versionnumber,version+vcvar,prefix+"\\"+version)) + def fun(tup): + return tup[0] + try: + detected_versions.sort(key=fun) + except: + detected_versions.sort(lambda x,y:cmp(x[0],y[0])) + return detected_versions +def gather_msvc_targets(conf,versions,version,vc_path): + targets=[] + if os.path.isfile(os.path.join(vc_path,'vcvarsall.bat')): + for target,realtarget in all_msvc_platforms[::-1]: + try: + targets.append((target,(realtarget,conf.get_msvc_version('msvc',version,target,os.path.join(vc_path,'vcvarsall.bat'))))) + except conf.errors.ConfigurationError: + pass + elif os.path.isfile(os.path.join(vc_path,'Common7','Tools','vsvars32.bat')): + try: + targets.append(('x86',('x86',conf.get_msvc_version('msvc',version,'x86',os.path.join(vc_path,'Common7','Tools','vsvars32.bat'))))) + except conf.errors.ConfigurationError: + pass + elif os.path.isfile(os.path.join(vc_path,'Bin','vcvars32.bat')): + try: + targets.append(('x86',('x86',conf.get_msvc_version('msvc',version,'',os.path.join(vc_path,'Bin','vcvars32.bat'))))) + except conf.errors.ConfigurationError: + pass + versions.append(('msvc '+version,targets)) +def gather_wince_targets(conf,versions,version,vc_path,vsvars,supported_platforms): + for device,platforms in supported_platforms: + cetargets=[] + for platform,compiler,include,lib in platforms: + winCEpath=os.path.join(vc_path,'ce') + if not os.path.isdir(winCEpath): + continue + try: + common_bindirs,_1,_2=conf.get_msvc_version('msvc',version,'x86',vsvars) + except conf.errors.ConfigurationError: + continue + if os.path.isdir(os.path.join(winCEpath,'lib',platform)): + bindirs=[os.path.join(winCEpath,'bin',compiler),os.path.join(winCEpath,'bin','x86_'+compiler)]+common_bindirs + incdirs=[os.path.join(winCEpath,'include'),os.path.join(winCEpath,'atlmfc','include'),include] + libdirs=[os.path.join(winCEpath,'lib',platform),os.path.join(winCEpath,'atlmfc','lib',platform),lib] + cetargets.append((platform,(platform,(bindirs,incdirs,libdirs)))) + if cetargets: + versions.append((device+' '+version,cetargets)) +def gather_msvc_versions(conf,versions): + vc_paths=[] + for(v,version,reg)in gather_msvc_detected_versions(): + try: + try: + msvc_version=_winreg.OpenKey(_winreg.HKEY_LOCAL_MACHINE,reg+"\\Setup\\VC") + except WindowsError: + msvc_version=_winreg.OpenKey(_winreg.HKEY_LOCAL_MACHINE,reg+"\\Setup\\Microsoft Visual C++") + path,type=_winreg.QueryValueEx(msvc_version,'ProductDir') + vc_paths.append((version,os.path.abspath(str(path)))) + except WindowsError: + continue + wince_supported_platforms=gather_wince_supported_platforms() + for version,vc_path in vc_paths: + vs_path=os.path.dirname(vc_path) + vsvars=os.path.join(vs_path,'Common7','Tools','vsvars32.bat') + if wince_supported_platforms and os.path.isfile(vsvars): + conf.gather_wince_targets(versions,version,vc_path,vsvars,wince_supported_platforms) + for version,vc_path in vc_paths: + vs_path=os.path.dirname(vc_path) + conf.gather_msvc_targets(versions,version,vc_path) +def gather_icl_versions(conf,versions): + version_pattern=re.compile('^...?.?\....?.?') + try: + all_versions=_winreg.OpenKey(_winreg.HKEY_LOCAL_MACHINE,'SOFTWARE\\Wow6432node\\Intel\\Compilers\\C++') + except WindowsError: + try: + all_versions=_winreg.OpenKey(_winreg.HKEY_LOCAL_MACHINE,'SOFTWARE\\Intel\\Compilers\\C++') + except WindowsError: + return + index=0 + while 1: + try: + version=_winreg.EnumKey(all_versions,index) + except WindowsError: + break + index=index+1 + if not version_pattern.match(version): + continue + targets=[] + for target,arch in all_icl_platforms: + try: + if target=='intel64':targetDir='EM64T_NATIVE' + else:targetDir=target + _winreg.OpenKey(all_versions,version+'\\'+targetDir) + icl_version=_winreg.OpenKey(all_versions,version) + path,type=_winreg.QueryValueEx(icl_version,'ProductDir') + if os.path.isfile(os.path.join(path,'bin','iclvars.bat')): + try: + targets.append((target,(arch,conf.get_msvc_version('intel',version,target,os.path.join(path,'bin','iclvars.bat'))))) + except conf.errors.ConfigurationError: + pass + except WindowsError: + pass + for target,arch in all_icl_platforms: + try: + icl_version=_winreg.OpenKey(all_versions,version+'\\'+target) + path,type=_winreg.QueryValueEx(icl_version,'ProductDir') + if os.path.isfile(os.path.join(path,'bin','iclvars.bat')): + try: + targets.append((target,(arch,conf.get_msvc_version('intel',version,target,os.path.join(path,'bin','iclvars.bat'))))) + except conf.errors.ConfigurationError: + pass + except WindowsError: + continue + major=version[0:2] + versions.append(('intel '+major,targets)) +def get_msvc_versions(conf): + if not conf.env['MSVC_INSTALLED_VERSIONS']: + lst=[] + conf.gather_icl_versions(lst) + conf.gather_wsdk_versions(lst) + conf.gather_msvc_versions(lst) + conf.env['MSVC_INSTALLED_VERSIONS']=lst + return conf.env['MSVC_INSTALLED_VERSIONS'] +def print_all_msvc_detected(conf): + for version,targets in conf.env['MSVC_INSTALLED_VERSIONS']: + info(version) + for target,l in targets: + info("\t"+target) +def detect_msvc(conf): + versions=get_msvc_versions(conf) + return setup_msvc(conf,versions) +def find_lt_names_msvc(self,libname,is_static=False): + lt_names=['lib%s.la'%libname,'%s.la'%libname,] + for path in self.env['LIBPATH']: + for la in lt_names: + laf=os.path.join(path,la) + dll=None + if os.path.exists(laf): + ltdict=Utils.read_la_file(laf) + lt_libdir=None + if ltdict.get('libdir',''): + lt_libdir=ltdict['libdir'] + if not is_static and ltdict.get('library_names',''): + dllnames=ltdict['library_names'].split() + dll=dllnames[0].lower() + dll=re.sub('\.dll$','',dll) + return(lt_libdir,dll,False) + elif ltdict.get('old_library',''): + olib=ltdict['old_library'] + if os.path.exists(os.path.join(path,olib)): + return(path,olib,True) + elif lt_libdir!=''and os.path.exists(os.path.join(lt_libdir,olib)): + return(lt_libdir,olib,True) + else: + return(None,olib,True) + else: + raise self.errors.WafError('invalid libtool object file: %s'%laf) + return(None,None,None) +def libname_msvc(self,libname,is_static=False): + lib=libname.lower() + lib=re.sub('\.lib$','',lib) + if lib in g_msvc_systemlibs: + return lib + lib=re.sub('^lib','',lib) + if lib=='m': + return None + (lt_path,lt_libname,lt_static)=self.find_lt_names_msvc(lib,is_static) + if lt_path!=None and lt_libname!=None: + if lt_static==True: + return os.path.join(lt_path,lt_libname) + if lt_path!=None: + _libpaths=[lt_path]+self.env['LIBPATH'] + else: + _libpaths=self.env['LIBPATH'] + static_libs=['lib%ss.lib'%lib,'lib%s.lib'%lib,'%ss.lib'%lib,'%s.lib'%lib,] + dynamic_libs=['lib%s.dll.lib'%lib,'lib%s.dll.a'%lib,'%s.dll.lib'%lib,'%s.dll.a'%lib,'lib%s_d.lib'%lib,'%s_d.lib'%lib,'%s.lib'%lib,] + libnames=static_libs + if not is_static: + libnames=dynamic_libs+static_libs + for path in _libpaths: + for libn in libnames: + if os.path.exists(os.path.join(path,libn)): + debug('msvc: lib found: %s'%os.path.join(path,libn)) + return re.sub('\.lib$','',libn) + self.fatal("The library %r could not be found"%libname) + return re.sub('\.lib$','',libname) +def check_lib_msvc(self,libname,is_static=False,uselib_store=None): + libn=self.libname_msvc(libname,is_static) + if not uselib_store: + uselib_store=libname.upper() + if False and is_static: + self.env['STLIB_'+uselib_store]=[libn] + else: + self.env['LIB_'+uselib_store]=[libn] +def check_libs_msvc(self,libnames,is_static=False): + for libname in Utils.to_list(libnames): + self.check_lib_msvc(libname,is_static) +def configure(conf): + conf.autodetect() + conf.find_msvc() + conf.msvc_common_flags() + conf.cc_load_tools() + conf.cxx_load_tools() + conf.cc_add_flags() + conf.cxx_add_flags() + conf.link_add_flags() + conf.visual_studio_add_flags() +def no_autodetect(conf): + conf.env.NO_MSVC_DETECT=1 + configure(conf) +def autodetect(conf): + v=conf.env + if v.NO_MSVC_DETECT: + return + compiler,version,path,includes,libdirs=conf.detect_msvc() + v['PATH']=path + v['INCLUDES']=includes + v['LIBPATH']=libdirs + v['MSVC_COMPILER']=compiler + try: + v['MSVC_VERSION']=float(version) + except: + v['MSVC_VERSION']=float(version[:-3]) +def _get_prog_names(conf,compiler): + if compiler=='intel': + compiler_name='ICL' + linker_name='XILINK' + lib_name='XILIB' + else: + compiler_name='CL' + linker_name='LINK' + lib_name='LIB' + return compiler_name,linker_name,lib_name +def find_msvc(conf): + if sys.platform=='cygwin': + conf.fatal('MSVC module does not work under cygwin Python!') + v=conf.env + path=v['PATH'] + compiler=v['MSVC_COMPILER'] + version=v['MSVC_VERSION'] + compiler_name,linker_name,lib_name=_get_prog_names(conf,compiler) + v.MSVC_MANIFEST=(compiler=='msvc'and version>=8)or(compiler=='wsdk'and version>=6)or(compiler=='intel'and version>=11) + cxx=None + if v['CXX']:cxx=v['CXX'] + elif'CXX'in conf.environ:cxx=conf.environ['CXX'] + cxx=conf.find_program(compiler_name,var='CXX',path_list=path) + cxx=conf.cmd_to_list(cxx) + env=dict(conf.environ) + if path:env.update(PATH=';'.join(path)) + if not conf.cmd_and_log(cxx+['/nologo','/help'],env=env): + conf.fatal('the msvc compiler could not be identified') + v['CC']=v['CXX']=cxx + v['CC_NAME']=v['CXX_NAME']='msvc' + if not v['LINK_CXX']: + link=conf.find_program(linker_name,path_list=path) + if link:v['LINK_CXX']=link + else:conf.fatal('%s was not found (linker)'%linker_name) + v['LINK']=link + if not v['LINK_CC']: + v['LINK_CC']=v['LINK_CXX'] + if not v['AR']: + stliblink=conf.find_program(lib_name,path_list=path,var='AR') + if not stliblink:return + v['ARFLAGS']=['/NOLOGO'] + if v.MSVC_MANIFEST: + mt=conf.find_program('MT',path_list=path,var='MT') + v['MTFLAGS']=['/NOLOGO'] + conf.load('winres') + if not conf.env['WINRC']: + warn('Resource compiler not found. Compiling resource file is disabled') +def visual_studio_add_flags(self): + v=self.env + try:v.prepend_value('INCLUDES',self.environ['INCLUDE'].split(';')) + except:pass + try:v.prepend_value('LIBPATH',self.environ['LIB'].split(';')) + except:pass +def msvc_common_flags(conf): + v=conf.env + v['DEST_BINFMT']='pe' + v.append_value('CFLAGS',['/nologo']) + v.append_value('CXXFLAGS',['/nologo']) + v['DEFINES_ST']='/D%s' + v['CC_SRC_F']='' + v['CC_TGT_F']=['/c','/Fo'] + if v['MSVC_VERSION']>=8: + v['CC_TGT_F']=['/FC']+v['CC_TGT_F'] + v['CXX_SRC_F']='' + v['CXX_TGT_F']=['/c','/Fo'] + if v['MSVC_VERSION']>=8: + v['CXX_TGT_F']=['/FC']+v['CXX_TGT_F'] + v['CPPPATH_ST']='/I%s' + v['AR_TGT_F']=v['CCLNK_TGT_F']=v['CXXLNK_TGT_F']='/OUT:' + v['CFLAGS_CONSOLE']=v['CXXFLAGS_CONSOLE']=['/SUBSYSTEM:CONSOLE'] + v['CFLAGS_NATIVE']=v['CXXFLAGS_NATIVE']=['/SUBSYSTEM:NATIVE'] + v['CFLAGS_POSIX']=v['CXXFLAGS_POSIX']=['/SUBSYSTEM:POSIX'] + v['CFLAGS_WINDOWS']=v['CXXFLAGS_WINDOWS']=['/SUBSYSTEM:WINDOWS'] + v['CFLAGS_WINDOWSCE']=v['CXXFLAGS_WINDOWSCE']=['/SUBSYSTEM:WINDOWSCE'] + v['CFLAGS_CRT_MULTITHREADED']=v['CXXFLAGS_CRT_MULTITHREADED']=['/MT'] + v['CFLAGS_CRT_MULTITHREADED_DLL']=v['CXXFLAGS_CRT_MULTITHREADED_DLL']=['/MD'] + v['CFLAGS_CRT_MULTITHREADED_DBG']=v['CXXFLAGS_CRT_MULTITHREADED_DBG']=['/MTd'] + v['CFLAGS_CRT_MULTITHREADED_DLL_DBG']=v['CXXFLAGS_CRT_MULTITHREADED_DLL_DBG']=['/MDd'] + v['LIB_ST']='%s.lib' + v['LIBPATH_ST']='/LIBPATH:%s' + v['STLIB_ST']='lib%s.lib' + v['STLIBPATH_ST']='/LIBPATH:%s' + v.append_value('LINKFLAGS',['/NOLOGO']) + if v['MSVC_MANIFEST']: + v.append_value('LINKFLAGS',['/MANIFEST']) + v['CFLAGS_cshlib']=[] + v['CXXFLAGS_cxxshlib']=[] + v['LINKFLAGS_cshlib']=v['LINKFLAGS_cxxshlib']=['/DLL'] + v['cshlib_PATTERN']=v['cxxshlib_PATTERN']='%s.dll' + v['implib_PATTERN']='%s.lib' + v['IMPLIB_ST']='/IMPLIB:%s' + v['LINKFLAGS_cstlib']=[] + v['cstlib_PATTERN']=v['cxxstlib_PATTERN']='lib%s.lib' + v['cprogram_PATTERN']=v['cxxprogram_PATTERN']='%s.exe' +def apply_flags_msvc(self): + if self.env.CC_NAME!='msvc'or not getattr(self,'link_task',None): + return + is_static=isinstance(self.link_task,ccroot.stlink_task) + subsystem=getattr(self,'subsystem','') + if subsystem: + subsystem='/subsystem:%s'%subsystem + flags=is_static and'ARFLAGS'or'LINKFLAGS' + self.env.append_value(flags,subsystem) + if not is_static: + for f in self.env.LINKFLAGS: + d=f.lower() + if d[1:]=='debug': + pdbnode=self.link_task.outputs[0].change_ext('.pdb') + self.link_task.outputs.append(pdbnode) + try: + self.install_task.source.append(pdbnode) + except AttributeError: + pass + break +def apply_manifest(self): + if self.env.CC_NAME=='msvc'and self.env.MSVC_MANIFEST and getattr(self,'link_task',None): + out_node=self.link_task.outputs[0] + man_node=out_node.parent.find_or_declare(out_node.name+'.manifest') + self.link_task.outputs.append(man_node) + self.link_task.do_manifest=True +def exec_mf(self): + env=self.env + mtool=env['MT'] + if not mtool: + return 0 + self.do_manifest=False + outfile=self.outputs[0].abspath() + manifest=None + for out_node in self.outputs: + if out_node.name.endswith('.manifest'): + manifest=out_node.abspath() + break + if manifest is None: + return 0 + mode='' + if'cprogram'in self.generator.features or'cxxprogram'in self.generator.features: + mode='1' + elif'cshlib'in self.generator.features or'cxxshlib'in self.generator.features: + mode='2' + debug('msvc: embedding manifest in mode %r'%mode) + lst=[] + lst.append(env['MT']) + lst.extend(Utils.to_list(env['MTFLAGS'])) + lst.extend(['-manifest',manifest]) + lst.append('-outputresource:%s;%s'%(outfile,mode)) + lst=[lst] + return self.exec_command(*lst) +def quote_response_command(self,flag): + if flag.find(' ')>-1: + for x in('/LIBPATH:','/IMPLIB:','/OUT:','/I'): + if flag.startswith(x): + flag='%s"%s"'%(x,flag[len(x):]) + break + else: + flag='"%s"'%flag + return flag +def exec_response_command(self,cmd,**kw): + try: + tmp=None + if sys.platform.startswith('win')and isinstance(cmd,list)and len(' '.join(cmd))>=8192: + program=cmd[0] + cmd=[self.quote_response_command(x)for x in cmd] + (fd,tmp)=tempfile.mkstemp() + os.write(fd,'\r\n'.join(i.replace('\\','\\\\')for i in cmd[1:])) + os.close(fd) + cmd=[program,'@'+tmp] + ret=self.generator.bld.exec_command(cmd,**kw) + finally: + if tmp: + try: + os.remove(tmp) + except: + pass + return ret +def exec_command_msvc(self,*k,**kw): + if self.env['CC_NAME']=='msvc': + if isinstance(k[0],list): + lst=[] + carry='' + for a in k[0]: + if a=='/Fo'or a=='/doc'or a[-1]==':': + carry=a + else: + lst.append(carry+a) + carry='' + k=[lst] + if self.env['PATH']: + env=dict(os.environ) + env.update(PATH=';'.join(self.env['PATH'])) + kw['env']=env + bld=self.generator.bld + try: + if not kw.get('cwd',None): + kw['cwd']=bld.cwd + except AttributeError: + bld.cwd=kw['cwd']=bld.variant_dir + ret=self.exec_response_command(k[0],**kw) + if not ret and getattr(self,'do_manifest',None): + ret=self.exec_mf() + return ret +for k in'c cxx cprogram cxxprogram cshlib cxxshlib cstlib cxxstlib'.split(): + cls=Task.classes.get(k,None) + if cls: + cls.exec_command=exec_command_msvc + cls.exec_response_command=exec_response_command + cls.quote_response_command=quote_response_command + cls.exec_mf=exec_mf + +conf(get_msvc_version) +conf(gather_wsdk_versions) +conf(gather_msvc_targets) +conf(gather_wince_targets) +conf(gather_msvc_versions) +conf(gather_icl_versions) +conf(get_msvc_versions) +conf(print_all_msvc_detected) +conf(detect_msvc) +conf(find_lt_names_msvc) +conf(libname_msvc) +conf(check_lib_msvc) +conf(check_libs_msvc) +conf(no_autodetect) +conf(autodetect) +conf(find_msvc) +conf(visual_studio_add_flags) +conf(msvc_common_flags) +after_method('apply_link')(apply_flags_msvc) +feature('c','cxx')(apply_flags_msvc) +feature('cprogram','cshlib','cxxprogram','cxxshlib')(apply_manifest) +after_method('apply_link')(apply_manifest)
\ No newline at end of file diff --git a/waflib/Tools/nasm.py b/waflib/Tools/nasm.py new file mode 100644 index 0000000..22717d3 --- /dev/null +++ b/waflib/Tools/nasm.py @@ -0,0 +1,14 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import waflib.Tools.asm +from waflib.TaskGen import feature +def apply_nasm_vars(self): + self.env.append_value('ASFLAGS',self.to_list(getattr(self,'nasm_flags',[]))) +def configure(conf): + nasm=conf.find_program(['nasm','yasm'],var='AS') + conf.env.AS_TGT_F=['-o'] + conf.env.ASLNK_TGT_F=['-o'] + +feature('asm')(apply_nasm_vars)
\ No newline at end of file diff --git a/waflib/Tools/perl.py b/waflib/Tools/perl.py new file mode 100644 index 0000000..0f66333 --- /dev/null +++ b/waflib/Tools/perl.py @@ -0,0 +1,81 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os +from waflib import Task,Options,Utils +from waflib.Configure import conf +from waflib.TaskGen import extension,feature,before_method +def init_perlext(self): + self.uselib=self.to_list(getattr(self,'uselib',[])) + if not'PERLEXT'in self.uselib:self.uselib.append('PERLEXT') + self.env['cshlib_PATTERN']=self.env['cxxshlib_PATTERN']=self.env['perlext_PATTERN'] +def xsubpp_file(self,node): + outnode=node.change_ext('.c') + self.create_task('xsubpp',node,outnode) + self.source.append(outnode) +class xsubpp(Task.Task): + run_str='${PERL} ${XSUBPP} -noprototypes -typemap ${EXTUTILS_TYPEMAP} ${SRC} > ${TGT}' + color='BLUE' + ext_out=['.h'] +def check_perl_version(self,minver=None): + res=True + if minver: + cver='.'.join(map(str,minver)) + else: + cver='' + self.start_msg('Checking for minimum perl version %s'%cver) + perl=getattr(Options.options,'perlbinary',None) + if not perl: + perl=self.find_program('perl',var='PERL') + if not perl: + self.end_msg("Perl not found",color="YELLOW") + return False + self.env['PERL']=perl + version=self.cmd_and_log([perl,"-e",'printf \"%vd\", $^V']) + if not version: + res=False + version="Unknown" + elif not minver is None: + ver=tuple(map(int,version.split("."))) + if ver<minver: + res=False + self.end_msg(version,color=res and"GREEN"or"YELLOW") + return res +def check_perl_module(self,module): + cmd=[self.env['PERL'],'-e','use %s'%module] + self.start_msg('perl module %s'%module) + try: + r=self.cmd_and_log(cmd) + except: + self.end_msg(False) + return None + self.end_msg(r or True) + return r +def check_perl_ext_devel(self): + env=self.env + perl=env.PERL + if not perl: + self.fatal('find perl first') + def read_out(cmd): + return Utils.to_list(self.cmd_and_log(perl+cmd)) + env['LINKFLAGS_PERLEXT']=read_out(" -MConfig -e'print $Config{lddlflags}'") + env['INCLUDES_PERLEXT']=read_out(" -MConfig -e'print \"$Config{archlib}/CORE\"'") + env['CFLAGS_PERLEXT']=read_out(" -MConfig -e'print \"$Config{ccflags} $Config{cccdlflags}\"'") + env['XSUBPP']=read_out(" -MConfig -e'print \"$Config{privlib}/ExtUtils/xsubpp$Config{exe_ext}\"'") + env['EXTUTILS_TYPEMAP']=read_out(" -MConfig -e'print \"$Config{privlib}/ExtUtils/typemap\"'") + if not getattr(Options.options,'perlarchdir',None): + env['ARCHDIR_PERL']=self.cmd_and_log(perl+" -MConfig -e'print $Config{sitearch}'") + else: + env['ARCHDIR_PERL']=getattr(Options.options,'perlarchdir') + env['perlext_PATTERN']='%s.'+self.cmd_and_log(perl+" -MConfig -e'print $Config{dlext}'") +def options(opt): + opt.add_option('--with-perl-binary',type='string',dest='perlbinary',help='Specify alternate perl binary',default=None) + opt.add_option('--with-perl-archdir',type='string',dest='perlarchdir',help='Specify directory where to install arch specific files',default=None) + +before_method('apply_incpaths','apply_link','propagate_uselib_vars')(init_perlext) +feature('perlext')(init_perlext) +extension('.xs')(xsubpp_file) +conf(check_perl_version) +conf(check_perl_module) +conf(check_perl_ext_devel)
\ No newline at end of file diff --git a/waflib/Tools/python.py b/waflib/Tools/python.py new file mode 100644 index 0000000..cdaff84 --- /dev/null +++ b/waflib/Tools/python.py @@ -0,0 +1,336 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os,sys +from waflib import Utils,Options,Errors +from waflib.Logs import debug,warn,info,error +from waflib.TaskGen import extension,before_method,after_method,feature +from waflib.Configure import conf +FRAG=''' +#include <Python.h> +#ifdef __cplusplus +extern "C" { +#endif + void Py_Initialize(void); + void Py_Finalize(void); +#ifdef __cplusplus +} +#endif +int main() +{ + Py_Initialize(); + Py_Finalize(); + return 0; +} +''' +INST=''' +import sys, py_compile +py_compile.compile(sys.argv[1], sys.argv[2], sys.argv[3]) +''' +DISTUTILS_IMP=['from distutils.sysconfig import get_config_var, get_python_lib'] +def process_py(self,node): + try: + if not self.bld.is_install: + return + except: + return + try: + if not self.install_path: + return + except AttributeError: + self.install_path='${PYTHONDIR}' + def inst_py(ctx): + install_from=getattr(self,'install_from',None) + if install_from: + install_from=self.path.find_dir(install_from) + install_pyfile(self,node,install_from) + self.bld.add_post_fun(inst_py) +def install_pyfile(self,node,install_from=None): + from_node=install_from or node.parent + tsk=self.bld.install_as(self.install_path+'/'+node.path_from(from_node),node,postpone=False) + path=tsk.get_install_path() + if self.bld.is_install<0: + info("+ removing byte compiled python files") + for x in'co': + try: + os.remove(path+x) + except OSError: + pass + if self.bld.is_install>0: + try: + st1=os.stat(path) + except: + error('The python file is missing, this should not happen') + for x in['c','o']: + do_inst=self.env['PY'+x.upper()] + try: + st2=os.stat(path+x) + except OSError: + pass + else: + if st1.st_mtime<=st2.st_mtime: + do_inst=False + if do_inst: + lst=(x=='o')and[self.env['PYFLAGS_OPT']]or[] + (a,b,c)=(path,path+x,tsk.get_install_path(destdir=False)+x) + argv=self.env['PYTHON']+lst+['-c',INST,a,b,c] + info('+ byte compiling %r'%(path+x)) + env=self.env.env or None + ret=Utils.subprocess.Popen(argv,env=env).wait() + if ret: + raise Errors.WafError('py%s compilation failed %r'%(x,path)) +def feature_py(self): + pass +def init_pyext(self): + try: + if not self.install_path: + return + except AttributeError: + self.install_path='${PYTHONARCHDIR}' + self.uselib=self.to_list(getattr(self,'uselib',[])) + if not'PYEXT'in self.uselib: + self.uselib.append('PYEXT') + self.env['cshlib_PATTERN']=self.env['cxxshlib_PATTERN']=self.env['macbundle_PATTERN']=self.env['pyext_PATTERN'] +def set_bundle(self): + if Utils.unversioned_sys_platform()=='darwin': + self.mac_bundle=True +def init_pyembed(self): + self.uselib=self.to_list(getattr(self,'uselib',[])) + if not'PYEMBED'in self.uselib: + self.uselib.append('PYEMBED') +def get_python_variables(self,variables,imports=None): + if not imports: + try: + imports=self.python_imports + except AttributeError: + imports=DISTUTILS_IMP + program=list(imports) + program.append('') + for v in variables: + program.append("print(repr(%s))"%v) + os_env=dict(os.environ) + try: + del os_env['MACOSX_DEPLOYMENT_TARGET'] + except KeyError: + pass + try: + out=self.cmd_and_log(self.env.PYTHON+['-c','\n'.join(program)],env=os_env) + except Errors.WafError: + self.fatal('The distutils module is unusable: install "python-devel"?') + return_values=[] + for s in out.split('\n'): + s=s.strip() + if not s: + continue + if s=='None': + return_values.append(None) + elif s[0]=="'"and s[-1]=="'": + return_values.append(s[1:-1]) + elif s[0].isdigit(): + return_values.append(int(s)) + else:break + return return_values +def check_python_headers(conf): + if not conf.env['CC_NAME']and not conf.env['CXX_NAME']: + conf.fatal('load a compiler first (gcc, g++, ..)') + if not conf.env['PYTHON_VERSION']: + conf.check_python_version() + env=conf.env + pybin=conf.env.PYTHON + if not pybin: + conf.fatal('could not find the python executable') + v='prefix SO LDFLAGS LIBDIR LIBPL INCLUDEPY Py_ENABLE_SHARED MACOSX_DEPLOYMENT_TARGET LDSHARED CFLAGS'.split() + try: + lst=conf.get_python_variables(["get_config_var('%s') or ''"%x for x in v]) + except RuntimeError: + conf.fatal("Python development headers not found (-v for details).") + vals=['%s = %r'%(x,y)for(x,y)in zip(v,lst)] + conf.to_log("Configuration returned from %r:\n%r\n"%(pybin,'\n'.join(vals))) + dct=dict(zip(v,lst)) + x='MACOSX_DEPLOYMENT_TARGET' + if dct[x]: + conf.env[x]=conf.environ[x]=dct[x] + env['pyext_PATTERN']='%s'+dct['SO'] + all_flags=dct['LDFLAGS']+' '+dct['CFLAGS'] + conf.parse_flags(all_flags,'PYEMBED') + all_flags=dct['LDFLAGS']+' '+dct['LDSHARED']+' '+dct['CFLAGS'] + conf.parse_flags(all_flags,'PYEXT') + result=None + for name in('python'+env['PYTHON_VERSION'],'python'+env['PYTHON_VERSION'].replace('.','')): + if not result and env['LIBPATH_PYEMBED']: + path=env['LIBPATH_PYEMBED'] + conf.to_log("\n\n# Trying default LIBPATH_PYEMBED: %r\n"%path) + result=conf.check(lib=name,uselib='PYEMBED',libpath=path,mandatory=False,msg='Checking for library %s in LIBPATH_PYEMBED'%name) + if not result and dct['LIBDIR']: + path=[dct['LIBDIR']] + conf.to_log("\n\n# try again with -L$python_LIBDIR: %r\n"%path) + result=conf.check(lib=name,uselib='PYEMBED',libpath=path,mandatory=False,msg='Checking for library %s in LIBDIR'%name) + if not result and dct['LIBPL']: + path=[dct['LIBPL']] + conf.to_log("\n\n# try again with -L$python_LIBPL (some systems don't install the python library in $prefix/lib)\n") + result=conf.check(lib=name,uselib='PYEMBED',libpath=path,mandatory=False,msg='Checking for library %s in python_LIBPL'%name) + if not result: + path=[os.path.join(dct['prefix'],"libs")] + conf.to_log("\n\n# try again with -L$prefix/libs, and pythonXY name rather than pythonX.Y (win32)\n") + result=conf.check(lib=name,uselib='PYEMBED',libpath=path,mandatory=False,msg='Checking for library %s in $prefix/libs'%name) + if result: + break + if result: + env['LIBPATH_PYEMBED']=path + env.append_value('LIB_PYEMBED',[name]) + else: + conf.to_log("\n\n### LIB NOT FOUND\n") + if(Utils.is_win32 or sys.platform.startswith('os2')or dct['Py_ENABLE_SHARED']): + env['LIBPATH_PYEXT']=env['LIBPATH_PYEMBED'] + env['LIB_PYEXT']=env['LIB_PYEMBED'] + num='.'.join(env['PYTHON_VERSION'].split('.')[:2]) + conf.find_program(['python%s-config'%num,'python-config-%s'%num,'python%sm-config'%num],var='PYTHON_CONFIG',mandatory=False) + includes=[] + if conf.env.PYTHON_CONFIG: + for incstr in conf.cmd_and_log([conf.env.PYTHON_CONFIG,'--includes']).strip().split(): + if(incstr.startswith('-I')or incstr.startswith('/I')): + incstr=incstr[2:] + if incstr not in includes: + includes.append(incstr) + conf.to_log("Include path for Python extensions (found via python-config --includes): %r\n"%(includes,)) + env['INCLUDES_PYEXT']=includes + env['INCLUDES_PYEMBED']=includes + else: + conf.to_log("Include path for Python extensions ""(found via distutils module): %r\n"%(dct['INCLUDEPY'],)) + env['INCLUDES_PYEXT']=[dct['INCLUDEPY']] + env['INCLUDES_PYEMBED']=[dct['INCLUDEPY']] + if env['CC_NAME']=='gcc': + env.append_value('CFLAGS_PYEMBED',['-fno-strict-aliasing']) + env.append_value('CFLAGS_PYEXT',['-fno-strict-aliasing']) + if env['CXX_NAME']=='gcc': + env.append_value('CXXFLAGS_PYEMBED',['-fno-strict-aliasing']) + env.append_value('CXXFLAGS_PYEXT',['-fno-strict-aliasing']) + if env.CC_NAME=="msvc": + from distutils.msvccompiler import MSVCCompiler + dist_compiler=MSVCCompiler() + dist_compiler.initialize() + env.append_value('CFLAGS_PYEXT',dist_compiler.compile_options) + env.append_value('CXXFLAGS_PYEXT',dist_compiler.compile_options) + env.append_value('LINKFLAGS_PYEXT',dist_compiler.ldflags_shared) + try: + conf.check(header_name='Python.h',define_name='HAVE_PYTHON_H',uselib='PYEMBED',fragment=FRAG,errmsg='Could not find the python development headers') + except conf.errors.ConfigurationError: + conf.check_cfg(path=conf.env.PYTHON_CONFIG,package='',uselib_store='PYEMBED',args=['--cflags','--libs']) + conf.check(header_name='Python.h',define_name='HAVE_PYTHON_H',msg='Getting the python flags from python-config',uselib='PYEMBED',fragment=FRAG,errmsg='Could not find the python development headers elsewhere') +def check_python_version(conf,minver=None): + assert minver is None or isinstance(minver,tuple) + pybin=conf.env['PYTHON'] + if not pybin: + conf.fatal('could not find the python executable') + cmd=pybin+['-c','import sys\nfor x in sys.version_info: print(str(x))'] + debug('python: Running python command %r'%cmd) + lines=conf.cmd_and_log(cmd).split() + assert len(lines)==5,"found %i lines, expected 5: %r"%(len(lines),lines) + pyver_tuple=(int(lines[0]),int(lines[1]),int(lines[2]),lines[3],int(lines[4])) + result=(minver is None)or(pyver_tuple>=minver) + if result: + pyver='.'.join([str(x)for x in pyver_tuple[:2]]) + conf.env['PYTHON_VERSION']=pyver + if'PYTHONDIR'in conf.environ: + pydir=conf.environ['PYTHONDIR'] + else: + if Utils.is_win32: + (python_LIBDEST,pydir)=conf.get_python_variables(["get_config_var('LIBDEST') or ''","get_python_lib(standard_lib=0, prefix=%r) or ''"%conf.env['PREFIX']]) + else: + python_LIBDEST=None + (pydir,)=conf.get_python_variables(["get_python_lib(standard_lib=0, prefix=%r) or ''"%conf.env['PREFIX']]) + if python_LIBDEST is None: + if conf.env['LIBDIR']: + python_LIBDEST=os.path.join(conf.env['LIBDIR'],"python"+pyver) + else: + python_LIBDEST=os.path.join(conf.env['PREFIX'],"lib","python"+pyver) + if'PYTHONARCHDIR'in conf.environ: + pyarchdir=conf.environ['PYTHONARCHDIR'] + else: + (pyarchdir,)=conf.get_python_variables(["get_python_lib(plat_specific=1, standard_lib=0, prefix=%r) or ''"%conf.env['PREFIX']]) + if not pyarchdir: + pyarchdir=pydir + if hasattr(conf,'define'): + conf.define('PYTHONDIR',pydir) + conf.define('PYTHONARCHDIR',pyarchdir) + conf.env['PYTHONDIR']=pydir + conf.env['PYTHONARCHDIR']=pyarchdir + pyver_full='.'.join(map(str,pyver_tuple[:3])) + if minver is None: + conf.msg('Checking for python version',pyver_full) + else: + minver_str='.'.join(map(str,minver)) + conf.msg('Checking for python version',pyver_tuple,">= %s"%(minver_str,)and'GREEN'or'YELLOW') + if not result: + conf.fatal('The python version is too old, expecting %r'%(minver,)) +PYTHON_MODULE_TEMPLATE=''' +import %s as current_module +version = getattr(current_module, '__version__', None) +if version is not None: + print(str(version)) +else: + print('unknown version') +''' +def check_python_module(conf,module_name,condition=''): + msg='Python module %s'%module_name + if condition: + msg='%s (%s)'%(msg,condition) + conf.start_msg(msg) + try: + ret=conf.cmd_and_log(conf.env['PYTHON']+['-c',PYTHON_MODULE_TEMPLATE%module_name]) + except Exception: + conf.end_msg(False) + conf.fatal('Could not find the python module %r'%module_name) + ret=ret.strip() + if condition: + conf.end_msg(ret) + if ret=='unknown version': + conf.fatal('Could not check the %s version'%module_name) + from distutils.version import LooseVersion + def num(*k): + if isinstance(k[0],int): + return LooseVersion('.'.join([str(x)for x in k])) + else: + return LooseVersion(k[0]) + d={'num':num,'ver':LooseVersion(ret)} + ev=eval(condition,{},d) + if not ev: + conf.fatal('The %s version does not satisfy the requirements'%module_name) + else: + if ret=='unknown version': + conf.end_msg(True) + else: + conf.end_msg(ret) +def configure(conf): + try: + conf.find_program('python',var='PYTHON') + except conf.errors.ConfigurationError: + warn("could not find a python executable, setting to sys.executable '%s'"%sys.executable) + conf.env.PYTHON=sys.executable + if conf.env.PYTHON!=sys.executable: + warn("python executable '%s' different from sys.executable '%s'"%(conf.env.PYTHON,sys.executable)) + conf.env.PYTHON=conf.cmd_to_list(conf.env.PYTHON) + v=conf.env + v['PYCMD']='"import sys, py_compile;py_compile.compile(sys.argv[1], sys.argv[2])"' + v['PYFLAGS']='' + v['PYFLAGS_OPT']='-O' + v['PYC']=getattr(Options.options,'pyc',1) + v['PYO']=getattr(Options.options,'pyo',1) +def options(opt): + opt.add_option('--nopyc',action='store_false',default=1,help='Do not install bytecode compiled .pyc files (configuration) [Default:install]',dest='pyc') + opt.add_option('--nopyo',action='store_false',default=1,help='Do not install optimised compiled .pyo files (configuration) [Default:install]',dest='pyo') + +extension('.py')(process_py) +feature('py')(feature_py) +feature('pyext')(init_pyext) +before_method('propagate_uselib_vars','apply_link')(init_pyext) +after_method('apply_bundle')(init_pyext) +feature('pyext')(set_bundle) +before_method('apply_link','apply_bundle')(set_bundle) +before_method('propagate_uselib_vars')(init_pyembed) +feature('pyembed')(init_pyembed) +conf(get_python_variables) +conf(check_python_headers) +conf(check_python_version) +conf(check_python_module)
\ No newline at end of file diff --git a/waflib/Tools/qt4.py b/waflib/Tools/qt4.py new file mode 100644 index 0000000..1ee9724 --- /dev/null +++ b/waflib/Tools/qt4.py @@ -0,0 +1,434 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import sys +if sys.hexversion < 0x020400f0: from sets import Set as set +try: + from xml.sax import make_parser + from xml.sax.handler import ContentHandler +except ImportError: + has_xml=False + ContentHandler=object +else: + has_xml=True +import os,sys +from waflib.Tools import c_preproc,cxx +from waflib import Task,Utils,Options,Errors +from waflib.TaskGen import feature,after_method,extension +from waflib.Configure import conf +from waflib import Logs +MOC_H=['.h','.hpp','.hxx','.hh'] +EXT_RCC=['.qrc'] +EXT_UI=['.ui'] +EXT_QT4=['.cpp','.cc','.cxx','.C'] +QT4_LIBS="QtCore QtGui QtUiTools QtNetwork QtOpenGL QtSql QtSvg QtTest QtXml QtXmlPatterns QtWebKit Qt3Support QtHelp QtScript QtDeclarative" +class qxx(cxx.cxx): + def __init__(self,*k,**kw): + Task.Task.__init__(self,*k,**kw) + self.moc_done=0 + def scan(self): + (nodes,names)=c_preproc.scan(self) + for x in nodes: + if x.name.endswith('.moc'): + nodes.remove(x) + names.append(x.path_from(self.inputs[0].parent.get_bld())) + return(nodes,names) + def runnable_status(self): + if self.moc_done: + return Task.Task.runnable_status(self) + else: + for t in self.run_after: + if not t.hasrun: + return Task.ASK_LATER + self.add_moc_tasks() + return Task.Task.runnable_status(self) + def add_moc_tasks(self): + node=self.inputs[0] + bld=self.generator.bld + try: + self.signature() + except KeyError: + pass + else: + delattr(self,'cache_sig') + moctasks=[] + mocfiles=[] + try: + tmp_lst=bld.raw_deps[self.uid()] + bld.raw_deps[self.uid()]=[] + except KeyError: + tmp_lst=[] + for d in tmp_lst: + if not d.endswith('.moc'): + continue + if d in mocfiles: + Logs.error("paranoia owns") + continue + mocfiles.append(d) + h_node=None + try:ext=Options.options.qt_header_ext.split() + except AttributeError:pass + if not ext:ext=MOC_H + base2=d[:-4] + for x in[node.parent]+self.generator.includes_nodes: + for e in ext: + h_node=x.find_node(base2+e) + if h_node: + break + if h_node: + m_node=h_node.change_ext('.moc') + break + else: + for k in EXT_QT4: + if base2.endswith(k): + for x in[node.parent]+self.generator.includes_nodes: + h_node=x.find_node(base2) + if h_node: + break + if h_node: + m_node=h_node.change_ext(k+'.moc') + break + if not h_node: + raise Errors.WafError('no header found for %r which is a moc file'%d) + bld.node_deps[(self.inputs[0].parent.abspath(),m_node.name)]=h_node + task=Task.classes['moc'](env=self.env,generator=self.generator) + task.set_inputs(h_node) + task.set_outputs(m_node) + gen=bld.producer + gen.outstanding.insert(0,task) + gen.total+=1 + moctasks.append(task) + tmp_lst=bld.raw_deps[self.uid()]=mocfiles + lst=bld.node_deps.get(self.uid(),()) + for d in lst: + name=d.name + if name.endswith('.moc'): + task=Task.classes['moc'](env=self.env,generator=self.generator) + task.set_inputs(bld.node_deps[(self.inputs[0].parent.abspath(),name)]) + task.set_outputs(d) + gen=bld.producer + gen.outstanding.insert(0,task) + gen.total+=1 + moctasks.append(task) + self.run_after.update(set(moctasks)) + self.moc_done=1 + run=Task.classes['cxx'].__dict__['run'] +class trans_update(Task.Task): + run_str='${QT_LUPDATE} ${SRC} -ts ${TGT}' + color='BLUE' +Task.update_outputs(trans_update) +class XMLHandler(ContentHandler): + def __init__(self): + self.buf=[] + self.files=[] + def startElement(self,name,attrs): + if name=='file': + self.buf=[] + def endElement(self,name): + if name=='file': + self.files.append(str(''.join(self.buf))) + def characters(self,cars): + self.buf.append(cars) +def create_rcc_task(self,node): + rcnode=node.change_ext('_rc.cpp') + rcctask=self.create_task('rcc',node,rcnode) + cpptask=self.create_task('cxx',rcnode,rcnode.change_ext('.o')) + try: + self.compiled_tasks.append(cpptask) + except AttributeError: + self.compiled_tasks=[cpptask] + return cpptask +def create_uic_task(self,node): + uictask=self.create_task('ui4',node) + uictask.outputs=[self.path.find_or_declare(self.env['ui_PATTERN']%node.name[:-3])] +def add_lang(self,node): + self.lang=self.to_list(getattr(self,'lang',[]))+[node] +def apply_qt4(self): + if getattr(self,'lang',None): + qmtasks=[] + for x in self.to_list(self.lang): + if isinstance(x,str): + x=self.path.find_resource(x+'.ts') + qmtasks.append(self.create_task('ts2qm',x,x.change_ext('.qm'))) + if getattr(self,'update',None)and Options.options.trans_qt4: + cxxnodes=[a.inputs[0]for a in self.compiled_tasks]+[a.inputs[0]for a in self.tasks if getattr(a,'inputs',None)and a.inputs[0].name.endswith('.ui')] + for x in qmtasks: + self.create_task('trans_update',cxxnodes,x.inputs) + if getattr(self,'langname',None): + qmnodes=[x.outputs[0]for x in qmtasks] + rcnode=self.langname + if isinstance(rcnode,str): + rcnode=self.path.find_or_declare(rcnode+'.qrc') + t=self.create_task('qm2rcc',qmnodes,rcnode) + k=create_rcc_task(self,t.outputs[0]) + self.link_task.inputs.append(k.outputs[0]) + lst=[] + for flag in self.to_list(self.env['CXXFLAGS']): + if len(flag)<2:continue + f=flag[0:2] + if f in['-D','-I','/D','/I']: + if(f[0]=='/'): + lst.append('-'+flag[1:]) + else: + lst.append(flag) + self.env['MOC_FLAGS']=lst +def cxx_hook(self,node): + return self.create_compiled_task('qxx',node) +class rcc(Task.Task): + color='BLUE' + run_str='${QT_RCC} -name ${SRC[0].name} ${SRC[0].abspath()} ${RCC_ST} -o ${TGT}' + ext_out=['.h'] + def scan(self): + node=self.inputs[0] + if not has_xml: + Logs.error('no xml support was found, the rcc dependencies will be incomplete!') + return([],[]) + parser=make_parser() + curHandler=XMLHandler() + parser.setContentHandler(curHandler) + fi=open(self.inputs[0].abspath()) + parser.parse(fi) + fi.close() + nodes=[] + names=[] + root=self.inputs[0].parent + for x in curHandler.files: + nd=root.find_resource(x) + if nd:nodes.append(nd) + else:names.append(x) + return(nodes,names) +class moc(Task.Task): + color='BLUE' + run_str='${QT_MOC} ${MOC_FLAGS} ${MOCCPPPATH_ST:INCPATHS} ${MOCDEFINES_ST:DEFINES} ${SRC} ${MOC_ST} ${TGT}' +class ui4(Task.Task): + color='BLUE' + run_str='${QT_UIC} ${SRC} -o ${TGT}' + ext_out=['.h'] +class ts2qm(Task.Task): + color='BLUE' + run_str='${QT_LRELEASE} ${QT_LRELEASE_FLAGS} ${SRC} -qm ${TGT}' +class qm2rcc(Task.Task): + color='BLUE' + after='ts2qm' + def run(self): + txt='\n'.join(['<file>%s</file>'%k.path_from(self.outputs[0].parent)for k in self.inputs]) + code='<!DOCTYPE RCC><RCC version="1.0">\n<qresource>\n%s\n</qresource>\n</RCC>'%txt + self.outputs[0].write(code) +def configure(self): + self.find_qt4_binaries() + self.set_qt4_libs_to_check() + self.find_qt4_libraries() + self.add_qt4_rpath() + self.simplify_qt4_libs() +def find_qt4_binaries(self): + env=self.env + opt=Options.options + qtdir=getattr(opt,'qtdir','') + qtbin=getattr(opt,'qtbin','') + paths=[] + if qtdir: + qtbin=os.path.join(qtdir,'bin') + if not qtdir: + qtdir=self.environ.get('QT4_ROOT','') + qtbin=os.path.join(qtdir,'bin') + if qtbin: + paths=[qtbin] + if not qtdir: + paths=os.environ.get('PATH','').split(os.pathsep) + paths.append('/usr/share/qt4/bin/') + try: + lst=Utils.listdir('/usr/local/Trolltech/') + except OSError: + pass + else: + if lst: + lst.sort() + lst.reverse() + qtdir='/usr/local/Trolltech/%s/'%lst[0] + qtbin=os.path.join(qtdir,'bin') + paths.append(qtbin) + cand=None + prev_ver=['4','0','0'] + for qmk in['qmake-qt4','qmake4','qmake']: + try: + qmake=self.find_program(qmk,path_list=paths) + except self.errors.ConfigurationError: + pass + else: + try: + version=self.cmd_and_log([qmake,'-query','QT_VERSION']).strip() + except self.errors.ConfigurationError: + pass + else: + if version: + new_ver=version.split('.') + if new_ver>prev_ver: + cand=qmake + prev_ver=new_ver + if cand: + self.env.QMAKE=cand + else: + self.fatal('Could not find qmake for qt4') + qtbin=self.cmd_and_log([self.env.QMAKE,'-query','QT_INSTALL_BINS']).strip()+os.sep + def find_bin(lst,var): + for f in lst: + try: + ret=self.find_program(f,path_list=paths) + except self.errors.ConfigurationError: + pass + else: + env[var]=ret + break + find_bin(['uic-qt3','uic3'],'QT_UIC3') + find_bin(['uic-qt4','uic'],'QT_UIC') + if not env['QT_UIC']: + self.fatal('cannot find the uic compiler for qt4') + try: + uicver=self.cmd_and_log(env['QT_UIC']+" -version 2>&1").strip() + except self.errors.ConfigurationError: + self.fatal('this uic compiler is for qt3, add uic for qt4 to your path') + uicver=uicver.replace('Qt User Interface Compiler ','').replace('User Interface Compiler for Qt','') + self.msg('Checking for uic version','%s'%uicver) + if uicver.find(' 3.')!=-1: + self.fatal('this uic compiler is for qt3, add uic for qt4 to your path') + find_bin(['moc-qt4','moc'],'QT_MOC') + find_bin(['rcc'],'QT_RCC') + find_bin(['lrelease-qt4','lrelease'],'QT_LRELEASE') + find_bin(['lupdate-qt4','lupdate'],'QT_LUPDATE') + env['UIC3_ST']='%s -o %s' + env['UIC_ST']='%s -o %s' + env['MOC_ST']='-o' + env['ui_PATTERN']='ui_%s.h' + env['QT_LRELEASE_FLAGS']=['-silent'] + env.MOCCPPPATH_ST='-I%s' + env.MOCDEFINES_ST='-D%s' +def find_qt4_libraries(self): + qtlibs=getattr(Options.options,'qtlibs','') + if not qtlibs: + try: + qtlibs=self.cmd_and_log([self.env.QMAKE,'-query','QT_INSTALL_LIBS']).strip() + except Errors.WafError: + qtdir=self.cmd_and_log([self.env.QMAKE,'-query','QT_INSTALL_PREFIX']).strip()+os.sep + qtlibs=os.path.join(qtdir,'lib') + self.msg('Found the Qt4 libraries in',qtlibs) + qtincludes=self.cmd_and_log([self.env.QMAKE,'-query','QT_INSTALL_HEADERS']).strip() + env=self.env + if not'PKG_CONFIG_PATH'in os.environ: + os.environ['PKG_CONFIG_PATH']='%s:%s/pkgconfig:/usr/lib/qt4/lib/pkgconfig:/opt/qt4/lib/pkgconfig:/usr/lib/qt4/lib:/opt/qt4/lib'%(qtlibs,qtlibs) + try: + self.check_cfg(atleast_pkgconfig_version='0.1') + except self.errors.ConfigurationError: + for i in self.qt4_vars: + uselib=i.upper() + if Utils.unversioned_sys_platform()=="darwin": + frameworkName=i+".framework" + qtDynamicLib=os.path.join(qtlibs,frameworkName,i) + if os.path.exists(qtDynamicLib): + env.append_unique('FRAMEWORK_'+uselib,i) + self.msg('Checking for %s'%i,qtDynamicLib,'GREEN') + else: + self.msg('Checking for %s'%i,False,'YELLOW') + env.append_unique('INCLUDES_'+uselib,os.path.join(qtlibs,frameworkName,'Headers')) + elif sys.platform!="win32": + qtDynamicLib=os.path.join(qtlibs,"lib"+i+".so") + qtStaticLib=os.path.join(qtlibs,"lib"+i+".a") + if os.path.exists(qtDynamicLib): + env.append_unique('LIB_'+uselib,i) + self.msg('Checking for %s'%i,qtDynamicLib,'GREEN') + elif os.path.exists(qtStaticLib): + env.append_unique('LIB_'+uselib,i) + self.msg('Checking for %s'%i,qtStaticLib,'GREEN') + else: + self.msg('Checking for %s'%i,False,'YELLOW') + env.append_unique('LIBPATH_'+uselib,qtlibs) + env.append_unique('INCLUDES_'+uselib,qtincludes) + env.append_unique('INCLUDES_'+uselib,os.path.join(qtincludes,i)) + else: + for k in("lib%s.a","lib%s4.a","%s.lib","%s4.lib"): + lib=os.path.join(qtlibs,k%i) + if os.path.exists(lib): + env.append_unique('LIB_'+uselib,i+k[k.find("%s")+2:k.find('.')]) + self.msg('Checking for %s'%i,lib,'GREEN') + break + else: + self.msg('Checking for %s'%i,False,'YELLOW') + env.append_unique('LIBPATH_'+uselib,qtlibs) + env.append_unique('INCLUDES_'+uselib,qtincludes) + env.append_unique('INCLUDES_'+uselib,os.path.join(qtincludes,i)) + uselib=i.upper()+"_debug" + for k in("lib%sd.a","lib%sd4.a","%sd.lib","%sd4.lib"): + lib=os.path.join(qtlibs,k%i) + if os.path.exists(lib): + env.append_unique('LIB_'+uselib,i+k[k.find("%s")+2:k.find('.')]) + self.msg('Checking for %s'%i,lib,'GREEN') + break + else: + self.msg('Checking for %s'%i,False,'YELLOW') + env.append_unique('LIBPATH_'+uselib,qtlibs) + env.append_unique('INCLUDES_'+uselib,qtincludes) + env.append_unique('INCLUDES_'+uselib,os.path.join(qtincludes,i)) + else: + for i in self.qt4_vars_debug+self.qt4_vars: + self.check_cfg(package=i,args='--cflags --libs',mandatory=False) +def simplify_qt4_libs(self): + env=self.env + def process_lib(vars_,coreval): + for d in vars_: + var=d.upper() + if var=='QTCORE': + continue + value=env['LIBPATH_'+var] + if value: + core=env[coreval] + accu=[] + for lib in value: + if lib in core: + continue + accu.append(lib) + env['LIBPATH_'+var]=accu + process_lib(self.qt4_vars,'LIBPATH_QTCORE') + process_lib(self.qt4_vars_debug,'LIBPATH_QTCORE_DEBUG') +def add_qt4_rpath(self): + env=self.env + if Options.options.want_rpath: + def process_rpath(vars_,coreval): + for d in vars_: + var=d.upper() + value=env['LIBPATH_'+var] + if value: + core=env[coreval] + accu=[] + for lib in value: + if var!='QTCORE': + if lib in core: + continue + accu.append('-Wl,--rpath='+lib) + env['RPATH_'+var]=accu + process_rpath(self.qt4_vars,'LIBPATH_QTCORE') + process_rpath(self.qt4_vars_debug,'LIBPATH_QTCORE_DEBUG') +def set_qt4_libs_to_check(self): + if not hasattr(self,'qt4_vars'): + self.qt4_vars=QT4_LIBS + self.qt4_vars=Utils.to_list(self.qt4_vars) + if not hasattr(self,'qt4_vars_debug'): + self.qt4_vars_debug=[a+'_debug'for a in self.qt4_vars] + self.qt4_vars_debug=Utils.to_list(self.qt4_vars_debug) +def options(opt): + opt.add_option('--want-rpath',action='store_true',default=False,dest='want_rpath',help='enable the rpath for qt libraries') + opt.add_option('--header-ext',type='string',default='',help='header extension for moc files',dest='qt_header_ext') + for i in'qtdir qtbin qtlibs'.split(): + opt.add_option('--'+i,type='string',default='',dest=i) + opt.add_option('--translate',action="store_true",help="collect translation strings",dest="trans_qt4",default=False) + +extension(*EXT_RCC)(create_rcc_task) +extension(*EXT_UI)(create_uic_task) +extension('.ts')(add_lang) +feature('qt4')(apply_qt4) +after_method('apply_link')(apply_qt4) +extension(*EXT_QT4)(cxx_hook) +conf(find_qt4_binaries) +conf(find_qt4_libraries) +conf(simplify_qt4_libs) +conf(add_qt4_rpath) +conf(set_qt4_libs_to_check)
\ No newline at end of file diff --git a/waflib/Tools/ruby.py b/waflib/Tools/ruby.py new file mode 100644 index 0000000..df21a31 --- /dev/null +++ b/waflib/Tools/ruby.py @@ -0,0 +1,104 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os +from waflib import Task,Options,Utils +from waflib.TaskGen import before_method,feature,after_method,Task,extension +from waflib.Configure import conf +def init_rubyext(self): + self.install_path='${ARCHDIR_RUBY}' + self.uselib=self.to_list(getattr(self,'uselib','')) + if not'RUBY'in self.uselib: + self.uselib.append('RUBY') + if not'RUBYEXT'in self.uselib: + self.uselib.append('RUBYEXT') +def apply_ruby_so_name(self): + self.env['cshlib_PATTERN']=self.env['cxxshlib_PATTERN']=self.env['rubyext_PATTERN'] +def check_ruby_version(self,minver=()): + if Options.options.rubybinary: + self.env.RUBY=Options.options.rubybinary + else: + self.find_program('ruby',var='RUBY') + ruby=self.env.RUBY + try: + version=self.cmd_and_log([ruby,'-e','puts defined?(VERSION) ? VERSION : RUBY_VERSION']).strip() + except: + self.fatal('could not determine ruby version') + self.env.RUBY_VERSION=version + try: + ver=tuple(map(int,version.split("."))) + except: + self.fatal('unsupported ruby version %r'%version) + cver='' + if minver: + if ver<minver: + self.fatal('ruby is too old %r'%ver) + cver='.'.join([str(x)for x in minver]) + else: + cver=ver + self.msg('Checking for ruby version %s'%str(minver or''),cver) +def check_ruby_ext_devel(self): + if not self.env.RUBY: + self.fatal('ruby detection is required first') + if not self.env.CC_NAME and not self.env.CXX_NAME: + self.fatal('load a c/c++ compiler first') + version=tuple(map(int,self.env.RUBY_VERSION.split("."))) + def read_out(cmd): + return Utils.to_list(self.cmd_and_log([self.env.RUBY,'-rrbconfig','-e',cmd])) + def read_config(key): + return read_out('puts Config::CONFIG[%r]'%key) + ruby=self.env['RUBY'] + archdir=read_config('archdir') + cpppath=archdir + if version>=(1,9,0): + ruby_hdrdir=read_config('rubyhdrdir') + cpppath+=ruby_hdrdir + cpppath+=[os.path.join(ruby_hdrdir[0],read_config('arch')[0])] + self.check(header_name='ruby.h',includes=cpppath,errmsg='could not find ruby header file') + self.env.LIBPATH_RUBYEXT=read_config('libdir') + self.env.LIBPATH_RUBYEXT+=archdir + self.env.INCLUDES_RUBYEXT=cpppath + self.env.CFLAGS_RUBYEXT=read_config('CCDLFLAGS') + self.env.rubyext_PATTERN='%s.'+read_config('DLEXT')[0] + flags=read_config('LDSHARED') + while flags and flags[0][0]!='-': + flags=flags[1:] + if len(flags)>1 and flags[1]=="ppc": + flags=flags[2:] + self.env.LINKFLAGS_RUBYEXT=flags + self.env.LINKFLAGS_RUBYEXT+=read_config('LIBS') + self.env.LINKFLAGS_RUBYEXT+=read_config('LIBRUBYARG_SHARED') + if Options.options.rubyarchdir: + self.env.ARCHDIR_RUBY=Options.options.rubyarchdir + else: + self.env.ARCHDIR_RUBY=read_config('sitearchdir')[0] + if Options.options.rubylibdir: + self.env.LIBDIR_RUBY=Options.options.rubylibdir + else: + self.env.LIBDIR_RUBY=read_config('sitelibdir')[0] +def check_ruby_module(self,module_name): + self.start_msg('Ruby module %s'%module_name) + try: + self.cmd_and_log([self.env['RUBY'],'-e','require \'%s\';puts 1'%module_name]) + except: + self.end_msg(False) + self.fatal('Could not find the ruby module %r'%module_name) + self.end_msg(True) +def process(self,node): + tsk=self.create_task('run_ruby',node) +class run_ruby(Task.Task): + run_str='${RUBY} ${RBFLAGS} -I ${SRC[0].parent.abspath()} ${SRC}' +def options(opt): + opt.add_option('--with-ruby-archdir',type='string',dest='rubyarchdir',help='Specify directory where to install arch specific files') + opt.add_option('--with-ruby-libdir',type='string',dest='rubylibdir',help='Specify alternate ruby library path') + opt.add_option('--with-ruby-binary',type='string',dest='rubybinary',help='Specify alternate ruby binary') + +feature('rubyext')(init_rubyext) +before_method('apply_incpaths','apply_lib_vars','apply_bundle','apply_link')(init_rubyext) +feature('rubyext')(apply_ruby_so_name) +before_method('apply_link','propagate_uselib')(apply_ruby_so_name) +conf(check_ruby_version) +conf(check_ruby_ext_devel) +conf(check_ruby_module) +extension('.rb')(process)
\ No newline at end of file diff --git a/waflib/Tools/suncc.py b/waflib/Tools/suncc.py new file mode 100644 index 0000000..fcc61d1 --- /dev/null +++ b/waflib/Tools/suncc.py @@ -0,0 +1,54 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os +from waflib import Utils +from waflib.Tools import ccroot,ar +from waflib.Configure import conf +def find_scc(conf): + v=conf.env + cc=None + if v['CC']:cc=v['CC'] + elif'CC'in conf.environ:cc=conf.environ['CC'] + if not cc:cc=conf.find_program('cc',var='CC') + if not cc:conf.fatal('Could not find a Sun C compiler') + cc=conf.cmd_to_list(cc) + try: + conf.cmd_and_log(cc+['-flags']) + except: + conf.fatal('%r is not a Sun compiler'%cc) + v['CC']=cc + v['CC_NAME']='sun' +def scc_common_flags(conf): + v=conf.env + v['CC_SRC_F']=[] + v['CC_TGT_F']=['-c','-o'] + if not v['LINK_CC']:v['LINK_CC']=v['CC'] + v['CCLNK_SRC_F']='' + v['CCLNK_TGT_F']=['-o'] + v['CPPPATH_ST']='-I%s' + v['DEFINES_ST']='-D%s' + v['LIB_ST']='-l%s' + v['LIBPATH_ST']='-L%s' + v['STLIB_ST']='-l%s' + v['STLIBPATH_ST']='-L%s' + v['SONAME_ST']='-Wl,-h,%s' + v['SHLIB_MARKER']='-Bdynamic' + v['STLIB_MARKER']='-Bstatic' + v['cprogram_PATTERN']='%s' + v['CFLAGS_cshlib']=['-Kpic','-DPIC'] + v['LINKFLAGS_cshlib']=['-G'] + v['cshlib_PATTERN']='lib%s.so' + v['LINKFLAGS_cstlib']=['-Bstatic'] + v['cstlib_PATTERN']='lib%s.a' +def configure(conf): + conf.find_scc() + conf.find_ar() + conf.scc_common_flags() + conf.cc_load_tools() + conf.cc_add_flags() + conf.link_add_flags() + +conf(find_scc) +conf(scc_common_flags)
\ No newline at end of file diff --git a/waflib/Tools/suncxx.py b/waflib/Tools/suncxx.py new file mode 100644 index 0000000..c604cd2 --- /dev/null +++ b/waflib/Tools/suncxx.py @@ -0,0 +1,55 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os +from waflib import Utils +from waflib.Tools import ccroot,ar +from waflib.Configure import conf +def find_sxx(conf): + v=conf.env + cc=None + if v['CXX']:cc=v['CXX'] + elif'CXX'in conf.environ:cc=conf.environ['CXX'] + if not cc:cc=conf.find_program('CC',var='CXX') + if not cc:cc=conf.find_program('c++',var='CXX') + if not cc:conf.fatal('Could not find a Sun C++ compiler') + cc=conf.cmd_to_list(cc) + try: + conf.cmd_and_log(cc+['-flags']) + except: + conf.fatal('%r is not a Sun compiler'%cc) + v['CXX']=cc + v['CXX_NAME']='sun' +def sxx_common_flags(conf): + v=conf.env + v['CXX_SRC_F']=[] + v['CXX_TGT_F']=['-c','-o'] + if not v['LINK_CXX']:v['LINK_CXX']=v['CXX'] + v['CXXLNK_SRC_F']=[] + v['CXXLNK_TGT_F']=['-o'] + v['CPPPATH_ST']='-I%s' + v['DEFINES_ST']='-D%s' + v['LIB_ST']='-l%s' + v['LIBPATH_ST']='-L%s' + v['STLIB_ST']='-l%s' + v['STLIBPATH_ST']='-L%s' + v['SONAME_ST']='-Wl,-h,%s' + v['SHLIB_MARKER']='-Bdynamic' + v['STLIB_MARKER']='-Bstatic' + v['cxxprogram_PATTERN']='%s' + v['CXXFLAGS_cxxshlib']=['-Kpic','-DPIC'] + v['LINKFLAGS_cxxshlib']=['-G'] + v['cxxshlib_PATTERN']='lib%s.so' + v['LINKFLAGS_cxxstlib']=['-Bstatic'] + v['cxxstlib_PATTERN']='lib%s.a' +def configure(conf): + conf.find_sxx() + conf.find_ar() + conf.sxx_common_flags() + conf.cxx_load_tools() + conf.cxx_add_flags() + conf.link_add_flags() + +conf(find_sxx) +conf(sxx_common_flags)
\ No newline at end of file diff --git a/waflib/Tools/tex.py b/waflib/Tools/tex.py new file mode 100644 index 0000000..4a26c43 --- /dev/null +++ b/waflib/Tools/tex.py @@ -0,0 +1,242 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os,re +from waflib import Utils,Task,Errors +from waflib.TaskGen import feature,before_method +from waflib.Logs import error,warn,debug +re_bibunit=re.compile(r'\\(?P<type>putbib)\[(?P<file>[^\[\]]*)\]',re.M) +def bibunitscan(self): + node=self.inputs[0] + nodes=[] + if not node:return nodes + code=Utils.readf(node.abspath()) + for match in re_bibunit.finditer(code): + path=match.group('file') + if path: + for k in['','.bib']: + debug('tex: trying %s%s'%(path,k)) + fi=node.parent.find_resource(path+k) + if fi: + nodes.append(fi) + else: + debug('tex: could not find %s'%path) + debug("tex: found the following bibunit files: %s"%nodes) + return nodes +exts_deps_tex=['','.ltx','.tex','.bib','.pdf','.png','.eps','.ps'] +exts_tex=['.ltx','.tex'] +re_tex=re.compile(r'\\(?P<type>include|bibliography|putbib|includegraphics|input|import|bringin|lstinputlisting)(\[[^\[\]]*\])?{(?P<file>[^{}]*)}',re.M) +g_bibtex_re=re.compile('bibdata',re.M) +class tex(Task.Task): + bibtex_fun,_=Task.compile_fun('${BIBTEX} ${BIBTEXFLAGS} ${SRCFILE}',shell=False) + bibtex_fun.__doc__=""" + Execute the program **bibtex** + """ + makeindex_fun,_=Task.compile_fun('${MAKEINDEX} ${MAKEINDEXFLAGS} ${SRCFILE}',shell=False) + makeindex_fun.__doc__=""" + Execute the program **makeindex** + """ + def scan_aux(self,node): + nodes=[node] + re_aux=re.compile(r'\\@input{(?P<file>[^{}]*)}',re.M) + def parse_node(node): + code=node.read() + for match in re_aux.finditer(code): + path=match.group('file') + found=node.parent.find_or_declare(path) + if found and found not in nodes: + debug('tex: found aux node '+found.abspath()) + nodes.append(found) + parse_node(found) + parse_node(node) + return nodes + def scan(self): + node=self.inputs[0] + nodes=[] + names=[] + seen=[] + if not node:return(nodes,names) + def parse_node(node): + if node in seen: + return + seen.append(node) + code=node.read() + global re_tex + for match in re_tex.finditer(code): + for path in match.group('file').split(','): + if path: + add_name=True + found=None + for k in exts_deps_tex: + debug('tex: trying %s%s'%(path,k)) + found=node.parent.find_resource(path+k) + if found and not found in self.outputs: + nodes.append(found) + add_name=False + for ext in exts_tex: + if found.name.endswith(ext): + parse_node(found) + break + if add_name: + names.append(path) + parse_node(node) + for x in nodes: + x.parent.get_bld().mkdir() + debug("tex: found the following : %s and names %s"%(nodes,names)) + return(nodes,names) + def check_status(self,msg,retcode): + if retcode!=0: + raise Errors.WafError("%r command exit status %r"%(msg,retcode)) + def bibfile(self): + need_bibtex=False + try: + for aux_node in self.aux_nodes: + ct=aux_node.read() + if g_bibtex_re.findall(ct): + need_bibtex=True + break + except(OSError,IOError): + error('error bibtex scan') + else: + if need_bibtex: + warn('calling bibtex') + self.env.env={} + self.env.env.update(os.environ) + self.env.env.update({'BIBINPUTS':self.TEXINPUTS,'BSTINPUTS':self.TEXINPUTS}) + self.env.SRCFILE=self.aux_nodes[0].name[:-4] + self.check_status('error when calling bibtex',self.bibtex_fun()) + def bibunits(self): + try: + bibunits=bibunitscan(self) + except FSError: + error('error bibunitscan') + else: + if bibunits: + fn=['bu'+str(i)for i in xrange(1,len(bibunits)+1)] + if fn: + warn('calling bibtex on bibunits') + for f in fn: + self.env.env={'BIBINPUTS':self.TEXINPUTS,'BSTINPUTS':self.TEXINPUTS} + self.env.SRCFILE=f + self.check_status('error when calling bibtex',self.bibtex_fun()) + def makeindex(self): + try: + idx_path=self.idx_node.abspath() + os.stat(idx_path) + except OSError: + warn('index file %s absent, not calling makeindex'%idx_path) + else: + warn('calling makeindex') + self.env.SRCFILE=self.idx_node.name + self.env.env={} + self.check_status('error when calling makeindex %s'%idx_path,self.makeindex_fun()) + def run(self): + env=self.env + if not env['PROMPT_LATEX']: + env.append_value('LATEXFLAGS','-interaction=batchmode') + env.append_value('PDFLATEXFLAGS','-interaction=batchmode') + env.append_value('XELATEXFLAGS','-interaction=batchmode') + fun=self.texfun + node=self.inputs[0] + srcfile=node.abspath() + texinputs=self.env.TEXINPUTS or'' + self.TEXINPUTS=node.parent.get_bld().abspath()+os.pathsep+node.parent.get_src().abspath()+os.pathsep+texinputs+os.pathsep + self.aux_node=node.change_ext('.aux') + self.cwd=self.inputs[0].parent.get_bld().abspath() + warn('first pass on %s'%self.__class__.__name__) + self.env.env={} + self.env.env.update(os.environ) + self.env.env.update({'TEXINPUTS':self.TEXINPUTS}) + self.env.SRCFILE=srcfile + self.check_status('error when calling latex',fun()) + self.aux_nodes=self.scan_aux(node.change_ext('.aux')) + self.idx_node=node.change_ext('.idx') + self.bibfile() + self.bibunits() + self.makeindex() + hash='' + for i in range(10): + prev_hash=hash + try: + hashes=[Utils.h_file(x.abspath())for x in self.aux_nodes] + hash=Utils.h_list(hashes) + except(OSError,IOError): + error('could not read aux.h') + pass + if hash and hash==prev_hash: + break + warn('calling %s'%self.__class__.__name__) + self.env.env={} + self.env.env.update(os.environ) + self.env.env.update({'TEXINPUTS':self.TEXINPUTS}) + self.env.SRCFILE=srcfile + self.check_status('error when calling %s'%self.__class__.__name__,fun()) +class latex(tex): + texfun,vars=Task.compile_fun('${LATEX} ${LATEXFLAGS} ${SRCFILE}',shell=False) +class pdflatex(tex): + texfun,vars=Task.compile_fun('${PDFLATEX} ${PDFLATEXFLAGS} ${SRCFILE}',shell=False) +class xelatex(tex): + texfun,vars=Task.compile_fun('${XELATEX} ${XELATEXFLAGS} ${SRCFILE}',shell=False) +class dvips(Task.Task): + run_str='${DVIPS} ${DVIPSFLAGS} ${SRC} -o ${TGT}' + color='BLUE' + after=['latex','pdflatex','xelatex'] +class dvipdf(Task.Task): + run_str='${DVIPDF} ${DVIPDFFLAGS} ${SRC} ${TGT}' + color='BLUE' + after=['latex','pdflatex','xelatex'] +class pdf2ps(Task.Task): + run_str='${PDF2PS} ${PDF2PSFLAGS} ${SRC} ${TGT}' + color='BLUE' + after=['latex','pdflatex','xelatex'] +def apply_tex(self): + if not getattr(self,'type',None)in['latex','pdflatex','xelatex']: + self.type='pdflatex' + tree=self.bld + outs=Utils.to_list(getattr(self,'outs',[])) + self.env['PROMPT_LATEX']=getattr(self,'prompt',1) + deps_lst=[] + if getattr(self,'deps',None): + deps=self.to_list(self.deps) + for filename in deps: + n=self.path.find_resource(filename) + if not n in deps_lst:deps_lst.append(n) + for node in self.to_nodes(self.source): + if self.type=='latex': + task=self.create_task('latex',node,node.change_ext('.dvi')) + elif self.type=='pdflatex': + task=self.create_task('pdflatex',node,node.change_ext('.pdf')) + elif self.type=='xelatex': + task=self.create_task('xelatex',node,node.change_ext('.pdf')) + task.env=self.env + if deps_lst: + try: + lst=tree.node_deps[task.uid()] + for n in deps_lst: + if not n in lst: + lst.append(n) + except KeyError: + tree.node_deps[task.uid()]=deps_lst + if self.type=='latex': + if'ps'in outs: + tsk=self.create_task('dvips',task.outputs,node.change_ext('.ps')) + tsk.env.env={'TEXINPUTS':node.parent.abspath()+os.pathsep+self.path.abspath()+os.pathsep+self.path.get_bld().abspath()} + if'pdf'in outs: + tsk=self.create_task('dvipdf',task.outputs,node.change_ext('.pdf')) + tsk.env.env={'TEXINPUTS':node.parent.abspath()+os.pathsep+self.path.abspath()+os.pathsep+self.path.get_bld().abspath()} + elif self.type=='pdflatex': + if'ps'in outs: + self.create_task('pdf2ps',task.outputs,node.change_ext('.ps')) + self.source=[] +def configure(self): + v=self.env + for p in'tex latex pdflatex xelatex bibtex dvips dvipdf ps2pdf makeindex pdf2ps'.split(): + try: + self.find_program(p,var=p.upper()) + except self.errors.ConfigurationError: + pass + v['DVIPSFLAGS']='-Ppdf' + +feature('tex')(apply_tex) +before_method('process_source')(apply_tex)
\ No newline at end of file diff --git a/waflib/Tools/vala.py b/waflib/Tools/vala.py new file mode 100644 index 0000000..ff422ef --- /dev/null +++ b/waflib/Tools/vala.py @@ -0,0 +1,216 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os.path,shutil,re +from waflib import Context,Task,Utils,Logs,Options,Errors +from waflib.TaskGen import extension +from waflib.Configure import conf +class valac(Task.Task): + vars=["VALAC","VALAC_VERSION","VALAFLAGS"] + ext_out=['.h'] + def run(self): + env=self.env + cmd=[env['VALAC'],'-C','--quiet'] + cmd.extend(Utils.to_list(env['VALAFLAGS'])) + if self.threading: + cmd.append('--thread') + if self.profile: + cmd.append('--profile=%s'%self.profile) + if self.target_glib: + cmd.append('--target-glib=%s'%self.target_glib) + if self.is_lib: + cmd.append('--library='+self.target) + for x in self.outputs: + if x.name.endswith('.h'): + cmd.append('--header='+x.name) + if self.gir: + cmd.append('--gir=%s.gir'%self.gir) + for vapi_dir in self.vapi_dirs: + cmd.append('--vapidir=%s'%vapi_dir) + for package in self.packages: + cmd.append('--pkg=%s'%package) + for package in self.packages_private: + cmd.append('--pkg=%s'%package) + for define in self.vala_defines: + cmd.append('--define=%s'%define) + cmd.extend([a.abspath()for a in self.inputs]) + ret=self.exec_command(cmd,cwd=self.outputs[0].parent.abspath()) + if ret: + return ret + for x in self.outputs: + if id(x.parent)!=id(self.outputs[0].parent): + shutil.move(self.outputs[0].parent.abspath()+os.sep+x.name,x.abspath()) + if self.packages and getattr(self,'deps_node',None): + self.deps_node.write('\n'.join(self.packages)) + return ret +def vala_file(self,node): + valatask=getattr(self,"valatask",None) + if not valatask: + def _get_api_version(): + api_version='1.0' + if hasattr(Context.g_module,'API_VERSION'): + version=Context.g_module.API_VERSION.split(".") + if version[0]=="0": + api_version="0."+version[1] + else: + api_version=version[0]+".0" + return api_version + valatask=self.create_task('valac') + self.valatask=valatask + self.includes=Utils.to_list(getattr(self,'includes',[])) + self.uselib=self.to_list(getattr(self,'uselib',[])) + valatask.packages=[] + valatask.packages_private=Utils.to_list(getattr(self,'packages_private',[])) + valatask.vapi_dirs=[] + valatask.target=self.target + valatask.threading=False + valatask.install_path=getattr(self,'install_path','') + valatask.profile=getattr(self,'profile','gobject') + valatask.vala_defines=getattr(self,'vala_defines',[]) + valatask.target_glib=None + valatask.gir=getattr(self,'gir',None) + valatask.gir_path=getattr(self,'gir_path','${DATAROOTDIR}/gir-1.0') + valatask.vapi_path=getattr(self,'vapi_path','${DATAROOTDIR}/vala/vapi') + valatask.pkg_name=getattr(self,'pkg_name',self.env['PACKAGE']) + valatask.header_path=getattr(self,'header_path','${INCLUDEDIR}/%s-%s'%(valatask.pkg_name,_get_api_version())) + valatask.install_binding=getattr(self,'install_binding',True) + valatask.is_lib=False + if not'cprogram'in self.features: + valatask.is_lib=True + packages=Utils.to_list(getattr(self,'packages',[])) + vapi_dirs=Utils.to_list(getattr(self,'vapi_dirs',[])) + includes=[] + if hasattr(self,'use'): + local_packages=Utils.to_list(self.use)[:] + seen=[] + while len(local_packages)>0: + package=local_packages.pop() + if package in seen: + continue + seen.append(package) + try: + package_obj=self.bld.get_tgen_by_name(package) + except Errors.WafError: + continue + package_name=package_obj.target + package_node=package_obj.path + package_dir=package_node.path_from(self.path) + for task in package_obj.tasks: + for output in task.outputs: + if output.name==package_name+".vapi": + valatask.set_run_after(task) + if package_name not in packages: + packages.append(package_name) + if package_dir not in vapi_dirs: + vapi_dirs.append(package_dir) + if package_dir not in includes: + includes.append(package_dir) + if hasattr(package_obj,'use'): + lst=self.to_list(package_obj.use) + lst.reverse() + local_packages=[pkg for pkg in lst if pkg not in seen]+local_packages + valatask.packages=packages + for vapi_dir in vapi_dirs: + try: + valatask.vapi_dirs.append(self.path.find_dir(vapi_dir).abspath()) + valatask.vapi_dirs.append(self.path.find_dir(vapi_dir).get_bld().abspath()) + except AttributeError: + Logs.warn("Unable to locate Vala API directory: '%s'"%vapi_dir) + self.includes.append(self.bld.srcnode.abspath()) + self.includes.append(self.bld.bldnode.abspath()) + for include in includes: + try: + self.includes.append(self.path.find_dir(include).abspath()) + self.includes.append(self.path.find_dir(include).get_bld().abspath()) + except AttributeError: + Logs.warn("Unable to locate include directory: '%s'"%include) + if valatask.profile=='gobject': + if hasattr(self,'target_glib'): + Logs.warn('target_glib on vala tasks is not supported --vala-target-glib=MAJOR.MINOR from the vala tool options') + if getattr(Options.options,'vala_target_glib',None): + valatask.target_glib=Options.options.vala_target_glib + if not'GOBJECT'in self.uselib: + self.uselib.append('GOBJECT') + if hasattr(self,'threading'): + if valatask.profile=='gobject': + valatask.threading=self.threading + if not'GTHREAD'in self.uselib: + self.uselib.append('GTHREAD') + else: + Logs.warn("Profile %s does not have threading support"%valatask.profile) + if valatask.is_lib: + valatask.outputs.append(self.path.find_or_declare('%s.h'%self.target)) + valatask.outputs.append(self.path.find_or_declare('%s.vapi'%self.target)) + if valatask.gir: + valatask.outputs.append(self.path.find_or_declare('%s.gir'%self.gir)) + if valatask.packages: + d=self.path.find_or_declare('%s.deps'%self.target) + valatask.outputs.append(d) + valatask.deps_node=d + valatask.inputs.append(node) + c_node=node.change_ext('.c') + valatask.outputs.append(c_node) + self.source.append(c_node) + if valatask.is_lib and valatask.install_binding: + headers_list=[o for o in valatask.outputs if o.suffix()==".h"] + try: + self.install_vheader.source=headers_list + except AttributeError: + self.install_vheader=self.bld.install_files(valatask.header_path,headers_list,self.env) + vapi_list=[o for o in valatask.outputs if(o.suffix()in(".vapi",".deps"))] + try: + self.install_vapi.source=vapi_list + except AttributeError: + self.install_vapi=self.bld.install_files(valatask.vapi_path,vapi_list,self.env) + gir_list=[o for o in valatask.outputs if o.suffix()==".gir"] + try: + self.install_gir.source=gir_list + except AttributeError: + self.install_gir=self.bld.install_files(valatask.gir_path,gir_list,self.env) +valac=Task.update_outputs(valac) +def find_valac(self,valac_name,min_version): + valac=self.find_program(valac_name,var='VALAC') + try: + output=self.cmd_and_log(valac+' --version') + except Exception: + valac_version=None + else: + ver=re.search(r'\d+.\d+.\d+',output).group(0).split('.') + valac_version=tuple([int(x)for x in ver]) + self.msg('Checking for %s version >= %r'%(valac_name,min_version),valac_version,valac_version and valac_version>=min_version) + if valac and valac_version<min_version: + self.fatal("%s version %r is too old, need >= %r"%(valac_name,valac_version,min_version)) + self.env['VALAC_VERSION']=valac_version + return valac +def check_vala(self,min_version=(0,8,0),branch=None): + if not branch: + branch=min_version[:2] + try: + find_valac(self,'valac-%d.%d'%(branch[0],branch[1]),min_version) + except self.errors.ConfigurationError: + find_valac(self,'valac',min_version) +def check_vala_deps(self): + if not self.env['HAVE_GOBJECT']: + pkg_args={'package':'gobject-2.0','uselib_store':'GOBJECT','args':'--cflags --libs'} + if getattr(Options.options,'vala_target_glib',None): + pkg_args['atleast_version']=Options.options.vala_target_glib + self.check_cfg(**pkg_args) + if not self.env['HAVE_GTHREAD']: + pkg_args={'package':'gthread-2.0','uselib_store':'GTHREAD','args':'--cflags --libs'} + if getattr(Options.options,'vala_target_glib',None): + pkg_args['atleast_version']=Options.options.vala_target_glib + self.check_cfg(**pkg_args) +def configure(self): + self.load('gnu_dirs') + self.check_vala_deps() + self.check_vala() +def options(opt): + opt.load('gnu_dirs') + valaopts=opt.add_option_group('Vala Compiler Options') + valaopts.add_option('--vala-target-glib',default=None,dest='vala_target_glib',metavar='MAJOR.MINOR',help='Target version of glib for Vala GObject code generation') + +extension('.vala','.gs')(vala_file) +conf(find_valac) +conf(check_vala) +conf(check_vala_deps)
\ No newline at end of file diff --git a/waflib/Tools/waf_unit_test.py b/waflib/Tools/waf_unit_test.py new file mode 100644 index 0000000..850e713 --- /dev/null +++ b/waflib/Tools/waf_unit_test.py @@ -0,0 +1,79 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os,sys +from waflib.TaskGen import feature,after_method +from waflib import Utils,Task,Logs,Options +testlock=Utils.threading.Lock() +def make_test(self): + if getattr(self,'link_task',None): + self.create_task('utest',self.link_task.outputs) +class utest(Task.Task): + color='PINK' + after=['vnum','inst'] + vars=[] + def runnable_status(self): + ret=super(utest,self).runnable_status() + if ret==Task.SKIP_ME: + if getattr(Options.options,'all_tests',False): + return Task.RUN_ME + return ret + def run(self): + filename=self.inputs[0].abspath() + self.ut_exec=getattr(self,'ut_exec',[filename]) + if getattr(self.generator,'ut_fun',None): + self.generator.ut_fun(self) + try: + fu=getattr(self.generator.bld,'all_test_paths') + except AttributeError: + fu=os.environ.copy() + self.generator.bld.all_test_paths=fu + lst=[] + for g in self.generator.bld.groups: + for tg in g: + if getattr(tg,'link_task',None): + lst.append(tg.link_task.outputs[0].parent.abspath()) + def add_path(dct,path,var): + dct[var]=os.pathsep.join(Utils.to_list(path)+[os.environ.get(var,'')]) + if Utils.is_win32: + add_path(fu,lst,'PATH') + elif Utils.unversioned_sys_platform()=='darwin': + add_path(fu,lst,'DYLD_LIBRARY_PATH') + add_path(fu,lst,'LD_LIBRARY_PATH') + else: + add_path(fu,lst,'LD_LIBRARY_PATH') + cwd=getattr(self.generator,'ut_cwd','')or self.inputs[0].parent.abspath() + proc=Utils.subprocess.Popen(self.ut_exec,cwd=cwd,env=fu,stderr=Utils.subprocess.PIPE,stdout=Utils.subprocess.PIPE) + (stdout,stderr)=proc.communicate() + tup=(filename,proc.returncode,stdout,stderr) + self.generator.utest_result=tup + testlock.acquire() + try: + bld=self.generator.bld + Logs.debug("ut: %r",tup) + try: + bld.utest_results.append(tup) + except AttributeError: + bld.utest_results=[tup] + finally: + testlock.release() +def summary(bld): + lst=getattr(bld,'utest_results',[]) + if lst: + Logs.pprint('CYAN','execution summary') + total=len(lst) + tfail=len([x for x in lst if x[1]]) + Logs.pprint('CYAN',' tests that pass %d/%d'%(total-tfail,total)) + for(f,code,out,err)in lst: + if not code: + Logs.pprint('CYAN',' %s'%f) + Logs.pprint('CYAN',' tests that fail %d/%d'%(tfail,total)) + for(f,code,out,err)in lst: + if code: + Logs.pprint('CYAN',' %s'%f) +def options(opt): + opt.add_option('--alltests',action='store_true',default=False,help='Exec all unit tests',dest='all_tests') + +feature('test')(make_test) +after_method('apply_link')(make_test)
\ No newline at end of file diff --git a/waflib/Tools/winres.py b/waflib/Tools/winres.py new file mode 100644 index 0000000..93dd4f2 --- /dev/null +++ b/waflib/Tools/winres.py @@ -0,0 +1,34 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +from waflib import Task +from waflib.TaskGen import extension +def rc_file(self,node): + obj_ext='.rc.o' + if self.env['WINRC_TGT_F']=='/fo': + obj_ext='.res' + rctask=self.create_task('winrc',node,node.change_ext(obj_ext)) + try: + self.compiled_tasks.append(rctask) + except AttributeError: + self.compiled_tasks=[rctask] +class winrc(Task.Task): + run_str='${WINRC} ${WINRCFLAGS} ${CPPPATH_ST:INCPATHS} ${DEFINES_ST:DEFINES} ${WINRC_TGT_F} ${TGT} ${WINRC_SRC_F} ${SRC}' + color='BLUE' +def configure(conf): + v=conf.env + v['WINRC_TGT_F']='-o' + v['WINRC_SRC_F']='-i' + if not conf.env.WINRC: + if v.CC_NAME=='msvc': + conf.find_program('RC',var='WINRC',path_list=v['PATH']) + v['WINRC_TGT_F']='/fo' + v['WINRC_SRC_F']='' + else: + conf.find_program('windres',var='WINRC',path_list=v['PATH']) + if not conf.env.WINRC: + conf.fatal('winrc was not found!') + v['WINRCFLAGS']=[] + +extension('.rc')(rc_file)
\ No newline at end of file diff --git a/waflib/Tools/xlc.py b/waflib/Tools/xlc.py new file mode 100644 index 0000000..c2a9982 --- /dev/null +++ b/waflib/Tools/xlc.py @@ -0,0 +1,46 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +from waflib.Tools import ccroot,ar +from waflib.Configure import conf +def find_xlc(conf): + cc=conf.find_program(['xlc_r','xlc'],var='CC') + cc=conf.cmd_to_list(cc) + conf.get_xlc_version(cc) + conf.env.CC_NAME='xlc' + conf.env.CC=cc +def xlc_common_flags(conf): + v=conf.env + v['CC_SRC_F']=[] + v['CC_TGT_F']=['-c','-o'] + if not v['LINK_CC']:v['LINK_CC']=v['CC'] + v['CCLNK_SRC_F']=[] + v['CCLNK_TGT_F']=['-o'] + v['CPPPATH_ST']='-I%s' + v['DEFINES_ST']='-D%s' + v['LIB_ST']='-l%s' + v['LIBPATH_ST']='-L%s' + v['STLIB_ST']='-l%s' + v['STLIBPATH_ST']='-L%s' + v['RPATH_ST']='-Wl,-rpath,%s' + v['SONAME_ST']=[] + v['SHLIB_MARKER']=[] + v['STLIB_MARKER']=[] + v['LINKFLAGS_cprogram']=['-Wl,-brtl'] + v['cprogram_PATTERN']='%s' + v['CFLAGS_cshlib']=['-fPIC'] + v['LINKFLAGS_cshlib']=['-G','-Wl,-brtl,-bexpfull'] + v['cshlib_PATTERN']='lib%s.so' + v['LINKFLAGS_cstlib']=[] + v['cstlib_PATTERN']='lib%s.a' +def configure(conf): + conf.find_xlc() + conf.find_ar() + conf.xlc_common_flags() + conf.cc_load_tools() + conf.cc_add_flags() + conf.link_add_flags() + +conf(find_xlc) +conf(xlc_common_flags)
\ No newline at end of file diff --git a/waflib/Tools/xlcxx.py b/waflib/Tools/xlcxx.py new file mode 100644 index 0000000..bfbe01e --- /dev/null +++ b/waflib/Tools/xlcxx.py @@ -0,0 +1,46 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +from waflib.Tools import ccroot,ar +from waflib.Configure import conf +def find_xlcxx(conf): + cxx=conf.find_program(['xlc++_r','xlc++'],var='CXX') + cxx=conf.cmd_to_list(cxx) + conf.get_xlc_version(cxx) + conf.env.CXX_NAME='xlc++' + conf.env.CXX=cxx +def xlcxx_common_flags(conf): + v=conf.env + v['CXX_SRC_F']=[] + v['CXX_TGT_F']=['-c','-o'] + if not v['LINK_CXX']:v['LINK_CXX']=v['CXX'] + v['CXXLNK_SRC_F']=[] + v['CXXLNK_TGT_F']=['-o'] + v['CPPPATH_ST']='-I%s' + v['DEFINES_ST']='-D%s' + v['LIB_ST']='-l%s' + v['LIBPATH_ST']='-L%s' + v['STLIB_ST']='-l%s' + v['STLIBPATH_ST']='-L%s' + v['RPATH_ST']='-Wl,-rpath,%s' + v['SONAME_ST']=[] + v['SHLIB_MARKER']=[] + v['STLIB_MARKER']=[] + v['LINKFLAGS_cxxprogram']=['-Wl,-brtl'] + v['cxxprogram_PATTERN']='%s' + v['CXXFLAGS_cxxshlib']=['-fPIC'] + v['LINKFLAGS_cxxshlib']=['-G','-Wl,-brtl,-bexpfull'] + v['cxxshlib_PATTERN']='lib%s.so' + v['LINKFLAGS_cxxstlib']=[] + v['cxxstlib_PATTERN']='lib%s.a' +def configure(conf): + conf.find_xlcxx() + conf.find_ar() + conf.xlcxx_common_flags() + conf.cxx_load_tools() + conf.cxx_add_flags() + conf.link_add_flags() + +conf(find_xlcxx) +conf(xlcxx_common_flags)
\ No newline at end of file diff --git a/waflib/Utils.py b/waflib/Utils.py new file mode 100644 index 0000000..25fa3f0 --- /dev/null +++ b/waflib/Utils.py @@ -0,0 +1,336 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os,sys,errno,traceback,inspect,re,shutil,datetime,gc +try: + import subprocess +except: + try: + import waflib.extras.subprocess as subprocess + except: + print("The subprocess module is missing (python2.3?):\n try calling 'waf update --files=subprocess'\n or add a copy of subprocess.py to the python libraries") +try: + from collections import deque +except ImportError: + class deque(list): + def popleft(self): + return self.pop(0) +try: + import _winreg as winreg +except: + try: + import winreg + except: + winreg=None +from waflib import Errors +try: + from collections import UserDict +except: + from UserDict import UserDict +try: + from hashlib import md5 +except: + try: + from md5 import md5 + except: + pass +try: + import threading +except: + class threading(object): + pass + class Lock(object): + def acquire(self): + pass + def release(self): + pass + threading.Lock=threading.Thread=Lock +else: + run_old=threading.Thread.run + def run(*args,**kwargs): + try: + run_old(*args,**kwargs) + except(KeyboardInterrupt,SystemExit): + raise + except: + sys.excepthook(*sys.exc_info()) + threading.Thread.run=run +SIG_NIL='iluvcuteoverload' +O644=420 +O755=493 +rot_chr=['\\','|','/','-'] +rot_idx=0 +try: + from collections import defaultdict +except ImportError: + class defaultdict(dict): + def __init__(self,default_factory): + super(defaultdict,self).__init__() + self.default_factory=default_factory + def __getitem__(self,key): + try: + return super(defaultdict,self).__getitem__(key) + except KeyError: + value=self.default_factory() + self[key]=value + return value +is_win32=sys.platform in('win32','cli') +indicator='\x1b[K%s%s%s\r' +if is_win32 and'NOCOLOR'in os.environ: + indicator='%s%s%s\r' +def readf(fname,m='r'): + f=open(fname,m) + try: + txt=f.read() + finally: + f.close() + return txt +def h_file(filename): + f=open(filename,'rb') + m=md5() + try: + while filename: + filename=f.read(100000) + m.update(filename) + finally: + f.close() + return m.digest() +try: + x=''.encode('hex') +except: + import binascii + def to_hex(s): + ret=binascii.hexlify(s) + if not isinstance(ret,str): + ret=ret.decode('utf-8') + return ret +else: + def to_hex(s): + return s.encode('hex') +to_hex.__doc__=""" +Return the hexadecimal representation of a string + +:param s: string to convert +:type s: string +""" +listdir=os.listdir +if is_win32: + def listdir_win32(s): + if not s: + try: + import ctypes + except: + return[x+':\\'for x in list('ABCDEFGHIJKLMNOPQRSTUVWXYZ')] + else: + dlen=4 + maxdrives=26 + buf=ctypes.create_string_buffer(maxdrives*dlen) + ndrives=ctypes.windll.kernel32.GetLogicalDriveStringsA(maxdrives,ctypes.byref(buf)) + return[buf.raw[4*i:4*i+3].decode('ascii')for i in range(int(ndrives/dlen))] + if len(s)==2 and s[1]==":": + s+=os.sep + if not os.path.isdir(s): + e=OSError() + e.errno=errno.ENOENT + raise e + return os.listdir(s) + listdir=listdir_win32 +def num2ver(ver): + if isinstance(ver,str): + ver=tuple(ver.split('.')) + if isinstance(ver,tuple): + ret=0 + for i in range(4): + if i<len(ver): + ret+=256**(3-i)*int(ver[i]) + return ret + return ver +def ex_stack(): + exc_type,exc_value,tb=sys.exc_info() + exc_lines=traceback.format_exception(exc_type,exc_value,tb) + return''.join(exc_lines) +def to_list(sth): + if isinstance(sth,str): + return sth.split() + else: + return sth +re_nl=re.compile('\r*\n',re.M) +def str_to_dict(txt): + tbl={} + lines=re_nl.split(txt) + for x in lines: + x=x.strip() + if not x or x.startswith('#')or x.find('=')<0: + continue + tmp=x.split('=') + tbl[tmp[0].strip()]='='.join(tmp[1:]).strip() + return tbl +def split_path(path): + return path.split('/') +def split_path_cygwin(path): + if path.startswith('//'): + ret=path.split('/')[2:] + ret[0]='/'+ret[0] + return ret + return path.split('/') +re_sp=re.compile('[/\\\\]') +def split_path_win32(path): + if path.startswith('\\\\'): + ret=re.split(re_sp,path)[2:] + ret[0]='\\'+ret[0] + return ret + return re.split(re_sp,path) +if sys.platform=='cygwin': + split_path=split_path_cygwin +elif is_win32: + split_path=split_path_win32 +split_path.__doc__=""" +Split a path by / or \\. This function is not like os.path.split + +:type path: string +:param path: path to split +:return: list of strings +""" +def check_dir(path): + if not os.path.isdir(path): + try: + os.makedirs(path) + except OSError ,e: + if not os.path.isdir(path): + raise Errors.WafError('Cannot create the folder %r'%path,ex=e) +def def_attrs(cls,**kw): + for k,v in kw.items(): + if not hasattr(cls,k): + setattr(cls,k,v) +def quote_define_name(s): + fu=re.compile("[^a-zA-Z0-9]").sub("_",s) + fu=fu.upper() + return fu +def h_list(lst): + m=md5() + m.update(str(lst)) + return m.digest() +def h_fun(fun): + try: + return fun.code + except AttributeError: + try: + h=inspect.getsource(fun) + except IOError: + h="nocode" + try: + fun.code=h + except AttributeError: + pass + return h +reg_subst=re.compile(r"(\\\\)|(\$\$)|\$\{([^}]+)\}") +def subst_vars(expr,params): + def repl_var(m): + if m.group(1): + return'\\' + if m.group(2): + return'$' + try: + return params.get_flat(m.group(3)) + except AttributeError: + return params[m.group(3)] + return reg_subst.sub(repl_var,expr) +def destos_to_binfmt(key): + if key=='darwin': + return'mac-o' + elif key in('win32','cygwin','uwin','msys'): + return'pe' + return'elf' +def unversioned_sys_platform(): + s=sys.platform + if s=='java': + from java.lang import System + s=System.getProperty('os.name') + if s=='Mac OS X': + return'darwin' + elif s.startswith('Windows '): + return'win32' + elif s=='OS/2': + return'os2' + elif s=='HP-UX': + return'hpux' + elif s in('SunOS','Solaris'): + return'sunos' + else:s=s.lower() + if s=='powerpc': + return'darwin' + if s=='win32'or s.endswith('os2')and s!='sunos2':return s + return re.split('\d+$',s)[0] +def nada(*k,**kw): + pass +class Timer(object): + def __init__(self): + self.start_time=datetime.datetime.utcnow() + def __str__(self): + delta=datetime.datetime.utcnow()-self.start_time + days=int(delta.days) + hours=delta.seconds//3600 + minutes=(delta.seconds-hours*3600)//60 + seconds=delta.seconds-hours*3600-minutes*60+float(delta.microseconds)/1000/1000 + result='' + if days: + result+='%dd'%days + if days or hours: + result+='%dh'%hours + if days or hours or minutes: + result+='%dm'%minutes + return'%s%.3fs'%(result,seconds) +if is_win32: + old=shutil.copy2 + def copy2(src,dst): + old(src,dst) + shutil.copystat(src,dst) + setattr(shutil,'copy2',copy2) +if os.name=='java': + try: + gc.disable() + gc.enable() + except NotImplementedError: + gc.disable=gc.enable +def read_la_file(path): + sp=re.compile(r'^([^=]+)=\'(.*)\'$') + dc={} + for line in readf(path).splitlines(): + try: + _,left,right,_=sp.split(line.strip()) + dc[left]=right + except ValueError: + pass + return dc +def nogc(fun): + def f(*k,**kw): + try: + gc.disable() + ret=fun(*k,**kw) + finally: + gc.enable() + return ret + f.__doc__=fun.__doc__ + return f +def run_once(fun): + cache={} + def wrap(k): + try: + return cache[k] + except KeyError: + ret=fun(k) + cache[k]=ret + return ret + wrap.__cache__=cache + return wrap +def get_registry_app_path(key,filename): + if not winreg: + return None + try: + result=winreg.QueryValue(key,"Software\\Microsoft\\Windows\\CurrentVersion\\App Paths\\%s.exe"%filename[0]) + except WindowsError: + pass + else: + if os.path.isfile(result): + return result diff --git a/waflib/__init__.py b/waflib/__init__.py new file mode 100644 index 0000000..efeed79 --- /dev/null +++ b/waflib/__init__.py @@ -0,0 +1,4 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + diff --git a/waflib/ansiterm.py b/waflib/ansiterm.py new file mode 100644 index 0000000..485d033 --- /dev/null +++ b/waflib/ansiterm.py @@ -0,0 +1,177 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import sys,os +try: + if not(sys.stderr.isatty()and sys.stdout.isatty()): + raise ValueError('not a tty') + from ctypes import* + class COORD(Structure): + _fields_=[("X",c_short),("Y",c_short)] + class SMALL_RECT(Structure): + _fields_=[("Left",c_short),("Top",c_short),("Right",c_short),("Bottom",c_short)] + class CONSOLE_SCREEN_BUFFER_INFO(Structure): + _fields_=[("Size",COORD),("CursorPosition",COORD),("Attributes",c_short),("Window",SMALL_RECT),("MaximumWindowSize",COORD)] + class CONSOLE_CURSOR_INFO(Structure): + _fields_=[('dwSize',c_ulong),('bVisible',c_int)] + sbinfo=CONSOLE_SCREEN_BUFFER_INFO() + csinfo=CONSOLE_CURSOR_INFO() + hconsole=windll.kernel32.GetStdHandle(-11) + windll.kernel32.GetConsoleScreenBufferInfo(hconsole,byref(sbinfo)) + if sbinfo.Size.X<9 or sbinfo.Size.Y<9:raise ValueError('small console') + windll.kernel32.GetConsoleCursorInfo(hconsole,byref(csinfo)) +except Exception: + pass +else: + import re,threading + is_vista=getattr(sys,"getwindowsversion",None)and sys.getwindowsversion()[0]>=6 + try: + _type=unicode + except: + _type=str + to_int=lambda number,default:number and int(number)or default + wlock=threading.Lock() + STD_OUTPUT_HANDLE=-11 + STD_ERROR_HANDLE=-12 + class AnsiTerm(object): + def __init__(self): + self.encoding=sys.stdout.encoding + self.hconsole=windll.kernel32.GetStdHandle(STD_OUTPUT_HANDLE) + self.cursor_history=[] + self.orig_sbinfo=CONSOLE_SCREEN_BUFFER_INFO() + self.orig_csinfo=CONSOLE_CURSOR_INFO() + windll.kernel32.GetConsoleScreenBufferInfo(self.hconsole,byref(self.orig_sbinfo)) + windll.kernel32.GetConsoleCursorInfo(hconsole,byref(self.orig_csinfo)) + def screen_buffer_info(self): + sbinfo=CONSOLE_SCREEN_BUFFER_INFO() + windll.kernel32.GetConsoleScreenBufferInfo(self.hconsole,byref(sbinfo)) + return sbinfo + def clear_line(self,param): + mode=param and int(param)or 0 + sbinfo=self.screen_buffer_info() + if mode==1: + line_start=COORD(0,sbinfo.CursorPosition.Y) + line_length=sbinfo.Size.X + elif mode==2: + line_start=COORD(sbinfo.CursorPosition.X,sbinfo.CursorPosition.Y) + line_length=sbinfo.Size.X-sbinfo.CursorPosition.X + else: + line_start=sbinfo.CursorPosition + line_length=sbinfo.Size.X-sbinfo.CursorPosition.X + chars_written=c_int() + windll.kernel32.FillConsoleOutputCharacterA(self.hconsole,c_wchar(' '),line_length,line_start,byref(chars_written)) + windll.kernel32.FillConsoleOutputAttribute(self.hconsole,sbinfo.Attributes,line_length,line_start,byref(chars_written)) + def clear_screen(self,param): + mode=to_int(param,0) + sbinfo=self.screen_buffer_info() + if mode==1: + clear_start=COORD(0,0) + clear_length=sbinfo.CursorPosition.X*sbinfo.CursorPosition.Y + elif mode==2: + clear_start=COORD(0,0) + clear_length=sbinfo.Size.X*sbinfo.Size.Y + windll.kernel32.SetConsoleCursorPosition(self.hconsole,clear_start) + else: + clear_start=sbinfo.CursorPosition + clear_length=((sbinfo.Size.X-sbinfo.CursorPosition.X)+sbinfo.Size.X*(sbinfo.Size.Y-sbinfo.CursorPosition.Y)) + chars_written=c_int() + windll.kernel32.FillConsoleOutputCharacterA(self.hconsole,c_wchar(' '),clear_length,clear_start,byref(chars_written)) + windll.kernel32.FillConsoleOutputAttribute(self.hconsole,sbinfo.Attributes,clear_length,clear_start,byref(chars_written)) + def push_cursor(self,param): + sbinfo=self.screen_buffer_info() + self.cursor_history.append(sbinfo.CursorPosition) + def pop_cursor(self,param): + if self.cursor_history: + old_pos=self.cursor_history.pop() + windll.kernel32.SetConsoleCursorPosition(self.hconsole,old_pos) + def set_cursor(self,param): + y,sep,x=param.partition(';') + x=to_int(x,1)-1 + y=to_int(y,1)-1 + sbinfo=self.screen_buffer_info() + new_pos=COORD(min(max(0,x),sbinfo.Size.X),min(max(0,y),sbinfo.Size.Y)) + windll.kernel32.SetConsoleCursorPosition(self.hconsole,new_pos) + def set_column(self,param): + x=to_int(param,1)-1 + sbinfo=self.screen_buffer_info() + new_pos=COORD(min(max(0,x),sbinfo.Size.X),sbinfo.CursorPosition.Y) + windll.kernel32.SetConsoleCursorPosition(self.hconsole,new_pos) + def move_cursor(self,x_offset=0,y_offset=0): + sbinfo=self.screen_buffer_info() + new_pos=COORD(min(max(0,sbinfo.CursorPosition.X+x_offset),sbinfo.Size.X),min(max(0,sbinfo.CursorPosition.Y+y_offset),sbinfo.Size.Y)) + windll.kernel32.SetConsoleCursorPosition(self.hconsole,new_pos) + def move_up(self,param): + self.move_cursor(y_offset=-to_int(param,1)) + def move_down(self,param): + self.move_cursor(y_offset=to_int(param,1)) + def move_left(self,param): + self.move_cursor(x_offset=-to_int(param,1)) + def move_right(self,param): + self.move_cursor(x_offset=to_int(param,1)) + def next_line(self,param): + sbinfo=self.screen_buffer_info() + self.move_cursor(x_offset=-sbinfo.CursorPosition.X,y_offset=to_int(param,1)) + def prev_line(self,param): + sbinfo=self.screen_buffer_info() + self.move_cursor(x_offset=-sbinfo.CursorPosition.X,y_offset=-to_int(param,1)) + def rgb2bgr(self,c): + return((c&1)<<2)|(c&2)|((c&4)>>2) + def set_color(self,param): + cols=param.split(';') + sbinfo=CONSOLE_SCREEN_BUFFER_INFO() + windll.kernel32.GetConsoleScreenBufferInfo(self.hconsole,byref(sbinfo)) + attr=sbinfo.Attributes + for c in cols: + if is_vista: + c=int(c) + else: + c=to_int(c,0) + if c in range(30,38): + attr=(attr&0xfff0)|self.rgb2bgr(c-30) + elif c in range(40,48): + attr=(attr&0xff0f)|(self.rgb2bgr(c-40)<<4) + elif c==0: + attr=self.orig_sbinfo.Attributes + elif c==1: + attr|=0x08 + elif c==4: + attr|=0x80 + elif c==7: + attr=(attr&0xff88)|((attr&0x70)>>4)|((attr&0x07)<<4) + windll.kernel32.SetConsoleTextAttribute(self.hconsole,attr) + def show_cursor(self,param): + csinfo.bVisible=1 + windll.kernel32.SetConsoleCursorInfo(self.hconsole,byref(csinfo)) + def hide_cursor(self,param): + csinfo.bVisible=0 + windll.kernel32.SetConsoleCursorInfo(self.hconsole,byref(csinfo)) + ansi_command_table={'A':move_up,'B':move_down,'C':move_right,'D':move_left,'E':next_line,'F':prev_line,'G':set_column,'H':set_cursor,'f':set_cursor,'J':clear_screen,'K':clear_line,'h':show_cursor,'l':hide_cursor,'m':set_color,'s':push_cursor,'u':pop_cursor,} + ansi_tokens=re.compile('(?:\x1b\[([0-9?;]*)([a-zA-Z])|([^\x1b]+))') + def write(self,text): + try: + wlock.acquire() + for param,cmd,txt in self.ansi_tokens.findall(text): + if cmd: + cmd_func=self.ansi_command_table.get(cmd) + if cmd_func: + cmd_func(self,param) + else: + self.writeconsole(txt) + finally: + wlock.release() + def writeconsole(self,txt): + chars_written=c_int() + writeconsole=windll.kernel32.WriteConsoleA + if isinstance(txt,_type): + writeconsole=windll.kernel32.WriteConsoleW + TINY_STEP=3000 + for x in range(0,len(txt),TINY_STEP): + tiny=txt[x:x+TINY_STEP] + writeconsole(self.hconsole,tiny,len(tiny),byref(chars_written),None) + def flush(self): + pass + def isatty(self): + return True + sys.stderr=sys.stdout=AnsiTerm() + os.environ['TERM']='vt100' diff --git a/waflib/extras/__init__.py b/waflib/extras/__init__.py new file mode 100644 index 0000000..efeed79 --- /dev/null +++ b/waflib/extras/__init__.py @@ -0,0 +1,4 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + diff --git a/waflib/extras/compat15.py b/waflib/extras/compat15.py new file mode 100644 index 0000000..76851a2 --- /dev/null +++ b/waflib/extras/compat15.py @@ -0,0 +1,223 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import sys +if sys.hexversion < 0x020400f0: from sets import Set as set +import sys +from waflib import ConfigSet,Logs,Options,Scripting,Task,Build,Configure,Node,Runner,TaskGen,Utils,Errors,Context +sys.modules['Environment']=ConfigSet +ConfigSet.Environment=ConfigSet.ConfigSet +sys.modules['Logs']=Logs +sys.modules['Options']=Options +sys.modules['Scripting']=Scripting +sys.modules['Task']=Task +sys.modules['Build']=Build +sys.modules['Configure']=Configure +sys.modules['Node']=Node +sys.modules['Runner']=Runner +sys.modules['TaskGen']=TaskGen +sys.modules['Utils']=Utils +from waflib.Tools import c_preproc +sys.modules['preproc']=c_preproc +from waflib.Tools import c_config +sys.modules['config_c']=c_config +ConfigSet.ConfigSet.copy=ConfigSet.ConfigSet.derive +ConfigSet.ConfigSet.set_variant=Utils.nada +Build.BuildContext.add_subdirs=Build.BuildContext.recurse +Build.BuildContext.new_task_gen=Build.BuildContext.__call__ +Build.BuildContext.is_install=0 +Node.Node.relpath_gen=Node.Node.path_from +def name_to_obj(self,s,env=None): + Logs.warn('compat: change "name_to_obj(name, env)" by "get_tgen_by_name(name)"') + return self.get_tgen_by_name(s) +Build.BuildContext.name_to_obj=name_to_obj +def env_of_name(self,name): + try: + return self.all_envs[name] + except KeyError: + Logs.error('no such environment: '+name) + return None +Build.BuildContext.env_of_name=env_of_name +def set_env_name(self,name,env): + self.all_envs[name]=env + return env +Configure.ConfigurationContext.set_env_name=set_env_name +def retrieve(self,name,fromenv=None): + try: + env=self.all_envs[name] + except KeyError: + env=ConfigSet.ConfigSet() + self.prepare_env(env) + self.all_envs[name]=env + else: + if fromenv:Logs.warn("The environment %s may have been configured already"%name) + return env +Configure.ConfigurationContext.retrieve=retrieve +Configure.ConfigurationContext.sub_config=Configure.ConfigurationContext.recurse +Configure.ConfigurationContext.check_tool=Configure.ConfigurationContext.load +Configure.conftest=Configure.conf +Configure.ConfigurationError=Errors.ConfigurationError +Options.OptionsContext.sub_options=Options.OptionsContext.recurse +Options.OptionsContext.tool_options=Context.Context.load +Options.Handler=Options.OptionsContext +Task.simple_task_type=Task.task_type_from_func=Task.task_factory +Task.TaskBase.classes=Task.classes +def setitem(self,key,value): + if key.startswith('CCFLAGS'): + key=key[1:] + self.table[key]=value +ConfigSet.ConfigSet.__setitem__=setitem +def old_importpaths(self): + if getattr(self,'importpaths',[]): + self.includes=self.importpaths +from waflib import Context +eld=Context.load_tool +def load_tool(*k,**kw): + ret=eld(*k,**kw) + if'set_options'in ret.__dict__: + Logs.warn('compat: rename "set_options" to options') + ret.options=ret.set_options + if'detect'in ret.__dict__: + Logs.warn('compat: rename "detect" to "configure"') + ret.configure=ret.detect + return ret +Context.load_tool=load_tool +rev=Context.load_module +def load_module(path): + ret=rev(path) + if'set_options'in ret.__dict__: + Logs.warn('compat: rename "set_options" to "options" (%r)'%path) + ret.options=ret.set_options + if'srcdir'in ret.__dict__: + Logs.warn('compat: rename "srcdir" to "top" (%r)'%path) + ret.top=ret.srcdir + if'blddir'in ret.__dict__: + Logs.warn('compat: rename "blddir" to "out" (%r)'%path) + ret.out=ret.blddir + return ret +Context.load_module=load_module +old_post=TaskGen.task_gen.post +def post(self): + self.features=self.to_list(self.features) + if'cc'in self.features: + Logs.warn('compat: the feature cc does not exist anymore (use "c")') + self.features.remove('cc') + self.features.append('c') + if'cstaticlib'in self.features: + Logs.warn('compat: the feature cstaticlib does not exist anymore (use "cstlib" or "cxxstlib")') + self.features.remove('cstaticlib') + self.features.append(('cxx'in self.features)and'cxxstlib'or'cstlib') + if getattr(self,'ccflags',None): + Logs.warn('compat: "ccflags" was renamed to "cflags"') + self.cflags=self.ccflags + return old_post(self) +TaskGen.task_gen.post=post +def waf_version(*k,**kw): + Logs.warn('wrong version (waf_version was removed in waf 1.6)') +Utils.waf_version=waf_version +import os +def apply_uselib_local(self): + env=self.env + from waflib.Tools.ccroot import stlink_task + self.uselib=self.to_list(getattr(self,'uselib',[])) + self.includes=self.to_list(getattr(self,'includes',[])) + names=self.to_list(getattr(self,'uselib_local',[])) + get=self.bld.get_tgen_by_name + seen=set([]) + tmp=Utils.deque(names) + if tmp: + Logs.warn('compat: "uselib_local" is deprecated, replace by "use"') + while tmp: + lib_name=tmp.popleft() + if lib_name in seen: + continue + y=get(lib_name) + y.post() + seen.add(lib_name) + if getattr(y,'uselib_local',None): + for x in self.to_list(getattr(y,'uselib_local',[])): + obj=get(x) + obj.post() + if getattr(obj,'link_task',None): + if not isinstance(obj.link_task,stlink_task): + tmp.append(x) + if getattr(y,'link_task',None): + link_name=y.target[y.target.rfind(os.sep)+1:] + if isinstance(y.link_task,stlink_task): + env.append_value('STLIB',[link_name]) + else: + env.append_value('LIB',[link_name]) + self.link_task.set_run_after(y.link_task) + self.link_task.dep_nodes+=y.link_task.outputs + tmp_path=y.link_task.outputs[0].parent.bldpath() + if not tmp_path in env['LIBPATH']: + env.prepend_value('LIBPATH',[tmp_path]) + for v in self.to_list(getattr(y,'uselib',[])): + if not env['STLIB_'+v]: + if not v in self.uselib: + self.uselib.insert(0,v) + if getattr(y,'export_includes',None): + self.includes.extend(y.to_incnodes(y.export_includes)) +def apply_objdeps(self): + names=getattr(self,'add_objects',[]) + if not names: + return + names=self.to_list(names) + get=self.bld.get_tgen_by_name + seen=[] + while names: + x=names[0] + if x in seen: + names=names[1:] + continue + y=get(x) + if getattr(y,'add_objects',None): + added=0 + lst=y.to_list(y.add_objects) + lst.reverse() + for u in lst: + if u in seen:continue + added=1 + names=[u]+names + if added:continue + y.post() + seen.append(x) + for t in getattr(y,'compiled_tasks',[]): + self.link_task.inputs.extend(t.outputs) +def process_obj_files(self): + if not hasattr(self,'obj_files'): + return + for x in self.obj_files: + node=self.path.find_resource(x) + self.link_task.inputs.append(node) +def add_obj_file(self,file): + if not hasattr(self,'obj_files'):self.obj_files=[] + if not'process_obj_files'in self.meths:self.meths.append('process_obj_files') + self.obj_files.append(file) +old_define=Configure.ConfigurationContext.__dict__['define'] +def define(self,key,val,quote=True): + old_define(self,key,val,quote) + if key.startswith('HAVE_'): + self.env[key]=1 +old_undefine=Configure.ConfigurationContext.__dict__['undefine'] +def undefine(self,key): + old_undefine(self,key) + if key.startswith('HAVE_'): + self.env[key]=0 +def set_incdirs(self,val): + Logs.warn('compat: change "export_incdirs" by "export_includes"') + self.export_includes=val +TaskGen.task_gen.export_incdirs=property(None,set_incdirs) + +TaskGen.feature('d')(old_importpaths) +TaskGen.before('apply_incpaths')(old_importpaths) +TaskGen.feature('c','cxx','d')(apply_uselib_local) +TaskGen.before('apply_incpaths','propagate_uselib_vars')(apply_uselib_local) +TaskGen.after('apply_link','process_source')(apply_uselib_local) +TaskGen.feature('cprogram','cxxprogram','cstlib','cxxstlib','cshlib','cxxshlib','dprogram','dstlib','dshlib')(apply_objdeps) +TaskGen.after('apply_link')(apply_objdeps) +TaskGen.after('apply_link')(process_obj_files) +TaskGen.taskgen_method(add_obj_file) +Configure.conf(define) +Configure.conf(undefine)
\ No newline at end of file diff --git a/waflib/fixpy2.py b/waflib/fixpy2.py new file mode 100644 index 0000000..2e6962b --- /dev/null +++ b/waflib/fixpy2.py @@ -0,0 +1,50 @@ +#! /usr/bin/env python +# encoding: utf-8 +# WARNING! Do not edit! http://waf.googlecode.com/git/docs/wafbook/single.html#_obtaining_the_waf_file + +import os +all_modifs={} +def fixdir(dir): + global all_modifs + for k in all_modifs: + for v in all_modifs[k]: + modif(os.path.join(dir,'waflib'),k,v) +def modif(dir,name,fun): + if name=='*': + lst=[] + for y in'. Tools extras'.split(): + for x in os.listdir(os.path.join(dir,y)): + if x.endswith('.py'): + lst.append(y+os.sep+x) + for x in lst: + modif(dir,x,fun) + return + filename=os.path.join(dir,name) + f=open(filename,'r') + txt=f.read() + f.close() + txt=fun(txt) + f=open(filename,'w') + f.write(txt) + f.close() +def subst(*k): + def do_subst(fun): + global all_modifs + for x in k: + try: + all_modifs[x].append(fun) + except KeyError: + all_modifs[x]=[fun] + return fun + return do_subst +def r1(code): + code=code.replace(',e:',',e:') + code=code.replace("",'') + code=code.replace('','') + return code +def r4(code): + code=code.replace('next(self.biter)','self.biter.next()') + return code + +subst('*')(r1) +subst('Runner.py')(r4)
\ No newline at end of file |